How many milliliters of a 0.640 M solution of KBr would be required to contain 17.2 grams of KBr


Please show mathmatics work, thank you

Answer:

Atomic number is the number of protons in an isotope or element.

Explanation: The atomic number is the same number of protons in an element or isotope and if said isotope is neutral than it is the same number of electrons.

Example: Atomic number = 19 Protons = 19 if neutral Electrons = 19

When the umbilical cord is tied after birth, the umbilical arteries close by filling in with connective tissue. The umbilical arteries carry deoxygenated blood from the fetus to the placenta, where the blood is oxygenated and returned to the fetus via the umbilical vein.

When the umbilical cord is cut, the flow of blood from the placenta to the fetus ceases, and the umbilical arteries and vein begin to constrict. This constriction is caused by the contraction of smooth muscles in the vessel walls and the closure of small valves within the vessels. As the umbilical arteries constrict, the flow of blood to the placenta decreases and the vessels begin to fill in with connective tissue. Over time, the connective tissue replaces the smooth muscle and valve tissue in the vessel walls, resulting in the complete closure of the umbilical arteries. This process is important to prevent bleeding and infection in the newborn.

Learn more about placenta here:

https://brainly.com/question/26959441

#SPJ11

An example of a physical change is ice melting. Gasoline burning, potassium chlorate decomposing, and iron rusting, on the other hand, are examples of chemical changes.

Physical changes involve alterations in the physical properties of a substance without any change in its chemical composition, while chemical changes involve the formation of new substances with different chemical properties.

Ice melting is a physical change because it involves a phase transition from solid to liquid without any change in the chemical composition of the water molecules. The water molecules remain the same, but their arrangement changes as the temperature increases and the solid ice converts into liquid water.

Gasoline burning, potassium chlorate decomposing, and iron rusting, on the other hand, are chemical changes. Gasoline burning is a combustion reaction where gasoline reacts with oxygen to produce carbon dioxide, water vapor, and release energy.

Potassium chlorate decomposing involves the breaking down of potassium chlorate into potassium chloride and oxygen gas through a chemical reaction. Iron rusting is a chemical reaction between iron, oxygen, and moisture in the air, resulting in the formation of iron oxide (rust).

In all these examples, new substances are formed with different chemical properties compared to the original substances. These chemical changes involve the breaking and forming of chemical bonds, resulting in the formation of new compounds or substances.

Learn more about physical change from the given link:

https://brainly.com/question/28742279

#SPJ11

Answer:

True

Explanation:

Here is an example: chemical properties include flammability, toxicity, acidity, reactivity. we observe the changes of these properties. Therefore, It's true.

The product formed when 2-methylcyclohexanone reacts with LDA under kinetic conditions and the resulting enolate is alkylated with ethyl bromide is 2-ethyl-2-methylcyclohexanone.

Step-by-step explanation:

1. The first step in this reaction is the formation of an enolate by the reaction of 2-methylcyclohexanone with LDA. LDA is a strong base that deprotonates the 2-methylcyclohexanone to form an enolate.

2. The next step is the alkylation of the enolate with ethyl bromide. This involves the nucleophilic attack of the enolate on the electrophilic carbon of the ethyl bromide, forming a new carbon-carbon bond and displacing the bromide ion.

3. The final product of this reaction is 2-ethyl-2-methylcyclohexanone. This compound has an ethyl group and a methyl group attached to the same carbon atom on the cyclohexanone ring.

In summary, the reaction of 2-methylcyclohexanone with LDA under kinetic conditions and the resulting enolate being alkylated with ethyl bromide leads to the formation of 2-ethyl-2-methylcyclohexanone.

To know more about nucleophilic attack click on below link:

https://brainly.com/question/30625390#

#SPJ11

The pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

Isomers are the molecules which have the same molecular formula but differ in the arrangement of their atoms. The following pairs of compounds are isomers: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3.CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3.CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.In the first pair of compounds, the molecule on the left is n-butane, while the molecule on the right is 2-methylpropane or isobutane. They are isomers because both have the same molecular formula C4H10, but different structures.2. In the second pair of compounds, the molecule on the left is octane, while the molecule on the right is 2-methylheptane.

These compounds have the same molecular formula, C8H18, but different structures.3. In the third pair of compounds, the molecule on the left is 2-methylpentane, while the molecule on the right is 3-methylpentane.

They are isomers because they have the same molecular formula C6H14, but different structures.4.

In the fourth pair of compounds, the molecule on the left is 2,3-dimethylbutane, while the molecule on the right is 2,4-dimethylpentane.

They are isomers because they have the same molecular formula C8H18, but different structures.5. In the fifth pair of compounds, the molecule on the left is isopropyl group, while the molecule on the right is n-propyl group.

They are isomers because they have the same molecular formula C3H7, but different structures.

In conclusion, the pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

To know more about isomers visit:

brainly.com/question/32508297

#SPJ11

Answer:

low, when humidity is low, the chance of precipitation is high.

(so the answer is low :)

Explanation:

Answer:

a) A subtance that increase H3O+ concentration when it is dissolved in water.

Explanation:

Arrhenius acid: any species that increases the concentration of H+ ions (or protons) in an aqueous solution.

Arrhenius base: any species that increses the concentration of OH- in an aqueous solution.

Brønsted-Lowry acid:  any species that donates protons.  

Brønsted-Lowry base: any species that is accepts protons.

There are total three laws of newtons, first law of newtons, second law of newton and third law of newton. Therefore, for every action there is an equal and opposite reaction.

Newton's first law is also called law of inertia. An object at rest remains at rest, and an object in motion remains in motion at constant speed and in a straight line unless acted on by an unbalanced force.

Third law of newton states  that for every action there is an equal and opposite reaction.

Therefore, for every action there is an equal and opposite reaction.

To know more about  newton's law, here:

https://brainly.com/question/29768600

#SPJ1

Answer:

The term matter refers to anything that occupies space and has mass.

Explanation:

Answer:matter

Explanation:

Answer:

Yes both methods give a single product.

Explanation:

The answer can be Yes, both the methods will yield a single product. The correct option is D.

Alcohols can be made by hydrating alkenes or reducing aldehydes, ketones, acids, and esters. Water elements can be added to an alkene's doublebonded carbons in either a Markovnikov's or an antiMarkovnikov's manner.

When yeast ferments the sugars in grains, fruits, and vegetables, it produces it. For example, wine is made from grape sugar, and vodka is made from potato sugar.

In the presence of a catalyst, lower molecular weight olefins react with carbon monoxide and hydrogen in a reaction known as hydroformylation or the oxo reaction. The resulting aldehyde is then hydrogenated to produce alcohol.

Thus, the correct option is D.

For more details regarding alcohol formation, visit:

https://brainly.com/question/9468676

#SPJ6

Your question seems incomplete, the probable complete question is attached below:

Answer: c=lambda v

c= speed of light which is 3*10^8 m/sec

lambda =wavelength

v=frequency

Explanation:

Answer:

its the first one speed of light

Answer:

speed of light

Explanation:

ed21

According to the forces of attraction, to  “see” the spaces in matter, add one cup of alcohol.The total volume is less than two cups, since alcohol has a lot of spaces   between molecules, where water molecules can fill.

Forces of attraction  is a force by which atoms in a molecule  combine. it is basically an attractive force in nature.  It can act between an ion  and an atom as well.It varies for different states  of matter that is solids, liquids and gases.

The forces of attraction are maximum in solids as  the molecules present in solid are tightly held while it is minimum in gases  as the molecules are far apart . The forces of attraction in liquids is intermediate of solids and gases.

The physical properties such as melting point, boiling point, density  are all dependent on forces of attraction which exists in the substances.

Learn more about forces of attraction,here:

https://brainly.com/question/32820512

#SPJ3

Answer:

10

Explanation:

Neons atomic # is 10 and the atomic number is the same as the # of electrons and protons

                           10 protons ........................Explanation:

Answer:

a. Creative solutions are often needed to solve technical problems.

Explanation:

Science in itself is a voyage of discovery. Scientific investigators focusing on various issues are often working hard to find creative solutions to complex technical problems.

In order to find solutions to all these problems bedeviling humanity, scientific investigators must be quite creative. Creativity is always at the bedrock of finding solutions to the complex technical problems of the world which happens to be the ultimate goal of science.

Hence, creativity is indispensable in scientific investigation and creative solutions are often needed to solve technical problems.

Answer:

a. Creative solutions are often needed to solve technical problems

Explanation:

Scientific investigation is the process using the scientific method which consists of empirical techniques in obtaining answers to question raised and used for driving the investigation

The scientist carrying out the investigation into the new area, is therefore required to be creative in adapting the available resources in answering the questions based on the scientific method

Answer:

Explanation:

sheesh i wouldn’t know

This is a perfect answer

ω

Answer:

Exhalation by animals in the form of carbonate in air to form carbon dioxide gas in the atmosphere

Explanation:

This is because, carbon in the environment are being oxidized by the respiratory processes of animals in the carbon cycle into Carbon dioxide gas

Answer:

2D 3D

Explanation:

can I get the options for number 4 and I’m not totally sure for number one but I would say shorter,longer

Answer:

the correct option is : If body fluids are too acidic, carbonic acid is excreted through the respiratory system in the form of carbon dioxide and water.

Explanation:

Metabolic acidosis is compensated by two systems, the renal and respiratory systems.

In the case of the respiratory system, the mechanism it uses to compensate for this phenomenon is to release the carbonic acid molecule dissociated into its components, that is, in the form of water and carbon dioxide.

The greater the acidosis, the more hyperventilation the person will have, and this is because they seek to eliminate carbonic acid more efficiently and quickly, along with renal excision.

The metabolic acidosis generated by carbonic acid is lethal, since the proteins in our body are denatured and the homeostasis of all systems is corrupted.

the value of pBa is approximately 1.66.

Volume of 0.1 M EDTA solution = 75.00 mL

Volume of 0.1 M Ba2+ solution = 50.00 mL

alpha(Y4+) = 0.30 (fraction of EDTA that forms the Y4- complex)

Kf = 7.59 × 10^7 (formation constant for BaY2- complex)

First, let's calculate the moles of EDTA and Ba2+ in the solutions:

Moles of EDTA = (Volume of EDTA solution in L) * (Concentration of EDTA)

= (75.00 mL / 1000 mL/L) * 0.1 M

= 0.0075 mol

Moles of Ba2+ = (Volume of Ba2+ solution in L) * (Concentration of Ba2+)

= (50.00 mL / 1000 mL/L) * 0.1 M

= 0.0050 mol

Next, we determine the moles of BaY2- complex formed by reacting Ba2+ with EDTA:

Moles of BaY2- = alpha(Y4+) * Moles of EDTA

= 0.30 * 0.0075 mol

= 0.00225 mol

Since the stoichiometric ratio between Ba2+ and BaY2- is 1:1, the concentration of Ba2+ remaining in solution is equal to the concentration of Ba2+ initially minus the moles of BaY2- formed:

Concentration of Ba2+ remaining = (Moles of Ba2+ - Moles of BaY2+) / (Total volume of solution in L)

= (0.0050 mol - 0.00225 mol) / (0.075 L + 0.050 L)

= 0.00275 mol / 0.125 L

= 0.022 M

Finally, we can calculate pBa by taking the negative logarithm (base 10) of the concentration of Ba2+ remaining:

pBa = -log10(Concentration of Ba2+ remaining)

= -log10(0.022)

≈ 1.66

Learn more about pBa here : brainly.com/question/30903570

#SPJ11

The net ionic equation for the reaction is:

H+(aq) + CO3^2-(aq) → NO3^-(aq) + H2O(l) + CO2(g)

The given reaction is acid-base neutralization, where HNO3 (nitric acid) acts as the acid, and KHCO3 (potassium hydrogen carbonate) acts as the base. The H+ ion from HNO3 reacts with the CO3^2- ion from KHCO3 to form H2O (water) and CO2 (carbon dioxide) as products. The remaining ions combine to form KNO3 (potassium nitrate) as the main product.

KHCO3 is Potassium bicarbonate. It is a white, crystalline, slightly alkaline and salty substance. It is created by the passage of carbon dioxide through an aqueous potassium carbonate solution. It is used in medicine as an antacid.

To know more about carbon dioxide, visit here:

https://brainly.com/question/15063989

#SPJ4

Answer:

The density is 2.5625g/mL. Hope this helped! :)

Explanation:

M= 8.2g                                                                               D=M/V

V= 28.3-25.1=3.2mL

D=8.2g/3.2mL

D= 2.5625g/mL

The given question requires us to calculate the pH of a solution formed by mixing 100.0 mL of 0.100 M NaF and 100.0 mL of 0.060 M HCl. The Ka of HF is given as 7.24 × 10-4. The following is the step-by-step explanation of how to calculate the pH of the given solution.

Mixing 100.0 mL of 0.100 M NaF and 100.0 mL of 0.060 M HCl we get:0.100 M × 100.0 mL = 10.0 mmol NaF0.060 M × 100.0 mL = 6.00 mmol HCl. We need to find the final concentration of NaF and HCl and determine if a buffer is formed or not. Initially, we have: NaF → Na+ + F-HCl → H+ + Cl-Therefore, in the final solution, we have: Na+ + H+ + F- + Cl- → Na+ + Cl- + HF. The final concentration of NaF is given by: Concentration = moles/volume= (10.0 mmol)/(200.0 mL)= 0.050 M. Similarly, the final concentration of HCl can be determined to be 0.030 M.

Consequently, the final concentration of HF is:6.00 mmol – 10.0 mmol = –4.00 mmol The negative value implies that all of the NaF has reacted with the HCl and that there is no NaF left over to react with water. This indicates that there is no buffer formed, and the solution will be acidic. We can write the following equilibrium equation for HF:HF (aq) + H2O (l) ⇌ H3O+ (aq) + F- (aq). The Ka for HF is 7.24 × 10-4.Ka = [H3O+][F-]/[HF]We can assume that [H3O+] ≈ [F-]. Hence, we can write the expression as follows: Ka = [H3O+]2/[HF]= (7.24 × 10-4) = [H3O+]2/(0.050)Therefore,[H3O+] = √(7.24 × 10-4 × 0.050) = 1.08 × 10-3 pH = –log[H3O+]= –log(1.08 × 10-3) = 2.97Hence, the pH of the given solution is 2.97.

To know more about equilibrium equation visit

https://brainly.com/question/32209502

#SPJ11

The property of matter that is conserved in chemical reactions and shown by balanced equations is known as the Law of Conservation of Mass. According to this law, mass can neither be created nor destroyed in a chemical reaction; it can only be transformed from one form to another.For instance, when two substances are combined, they react and form a new substance.

For such more question on chemical reaction

https://brainly.com/question/11231920

#SPJ8

Convection currents are the underlying cause of tectonic plate interactions that cause geological events, like earthquakes and volcanoes.

The tectonic plate interactions and processes that result in the construction of mountains and other landforms constitute the geological event that is taking place. Convection currents, which happen as molten rock rises from the Earth's mantle below the surface and then cools as it flows to the surface, are one of the primary processes generating this creation.

The plates move and interact with one another as a result of this process, which is fueled by the disparity in density between the hot and cold rock. Divergent boundaries, the kind of boundary at which this phenomenon occurs, are brought about by two plates moving apart.

The creation of the Himalayan Mountains is an illustration of this process. The Himalayas were created as a result of the Himalayan Plate colliding with the Eurasian Plate as it steadily moved north.

High peaks, deep valleys, and steep cliffs are some of the physical features that are visible as a result of this process. The highest mountain range in the world is the Himalayas, and Mount Everest is its highest peak.

To learn more about geological event refer :

https://brainly.com/question/29329752

#SPJ1

The limiting reagent is Nitric acid (Option C)

To determine the limiting reagent, we need to calculate the number of moles of each reactant and compare their mole ratios with the balanced equation.

The balanced equation for the nitration of methyl benzoate is:

C₆H₅COOCH₃ + HNO₃ → C₆H₄(NO₂)COOCH₃ + H₂O

The molar mass of methyl benzoate (C₆H₅COOCH₃) is:

Methyl benzoate = 151.16 g/mol

Number of moles of methyl benzoate used:

n = m/M = 247 g / 151.16 g/mol = 1.635 mol

The density of concentrated nitric acid is 1.42 g/mL, and its molar mass is 63.01 g/mol. Therefore, 2.2 mL of concentrated nitric acid is equal to:

m = V x ρ = 2.2 mL x 1.42 g/mL = 3.124 g

Number of moles of nitric acid used:

n = m/M = 3.124 g / 63.01 g/mol = 0.0495 mol

Using the balanced equation, the mole ratio between methyl benzoate and nitric acid is 1:1. Therefore, the limiting reagent is nitric acid since it is present in a lower amount than the amount required for the reaction to occur completely.

Answer: C. Nitric acid is the limiting reagent.

Learn more about Limiting reagent

brainly.com/question/26905271

#SPJ11

Approximately 8.06% of the mass of hydrogen in ammonium phosphate.

So, the closest answer choice is (a) 8.11%.

To calculate the mass percent of hydrogen in ammonium phosphate ((NH₄)₃PO₄), we need to determine the molar mass of hydrogen in the compound and divide it by the molar mass of the entire compound, then multiply by 100 to express it as a percentage.

The molar mass of hydrogen (H) is approximately 1.01 g/mol.

The molar mass of ammonium phosphate ((NH₄)₃PO₄) can be calculated as follows:

\(3(N) + 12(H) + 1(P) + 4(O) = 3(14.01 \, \text{g/mol}) + 12(1.01 \, \text{g/mol}) + 1(31.00 \, \text{g/mol}) + 4(16.00 \, \text{g/mol}) = 149.09 \, \text{g/mol}.\)

Now we can calculate the mass percent of hydrogen:

\(\left(\frac{12 \, \text{g/mol H}}{149.09 \, \text{g/mol (NH}_4)_3\text{PO}_4}\right) \times 100\% \approx 8.06\%\)

Therefore, the mass percent of hydrogen in ammonium phosphate is approximately 8.06%.

To know more about the mass percent refer here :

https://brainly.com/question/5840377#

#SPJ11