A balloon is filled to a volume of 1.75 L with 3.00 moles of gas at 25
°C. With pressure and temperature held constant, what will be the
volume of the balloon if 0.60 moles of gas are added?

Answer: 3.4008

Explanation:

Answer: 3.4008

To determine the freezing point of the solution, we need to use the freezing point depression equation:

ΔT = Kf * m

Given:

Kf (benzene) = 5.12 °C/m

m = 0.41 m

Substituting the values into the equation:

ΔT = 5.12 °C/m * 0.41 m

ΔT = 2.0992 °C

To find the freezing point, we subtract the freezing point depression from the freezing point of the pure solvent (benzene). The freezing point of benzene is 5.5 °C.

Freezing point = FP (benzene) - ΔT

Freezing point = 5.5 °C - 2.0992 °C

Freezing point = 3.4008 °C

Therefore, the freezing point of the 0.41 m solution of C5H4 in benzene is approximately 3.4008 °C.

Answer:

A ---->gamma ray

Explanation:

Gamma rays have the highest frequencies among all electromagnetic waves and therefore have the shortest wavelengths.

Answer: 2.5 lit

Explanation:

Answer

Explanation

Given:

Volume of the solution = 543 mL = (543/1000) = 0.543 L

Molarity of the LiNO3 solution = 1.83 M

What to find:

Amount (in moles) of LiNO3 needed to make 543 ml of a 1.83 M solution.

Solution:

The amount (in moles) of LiNO3 needed to make 543 ml of a 1.83 M solution can be determined using the molarity formula.

Hence, the amount (in moles) of LiNO3 needed to make 543 ml of a 1.83 M solution is 0.

we can determine the enthalpy of reaction for the hypothetical reaction A2X4(l) + X2(g) → 2AX3(g) using the following steps:

Hess's Law of Constant Heat Summation  states that regardless of the multiple stages or steps of a reaction, the total enthalpy change for the reaction is the sum of all changes.

The law is  Hess's Law  of Constant Heat Summation  is described as a manifestation that enthalpy is a state function.

Learn more about Hess law at:

https://brainly.com/question/9530080

#SPJ1

The student needs to add approximately 83.3 mL of 12 M HCl solution to the existing 1 L of 2 M HCl solution to increase the concentration to 3 M. It is important to handle concentrated acids with caution and follow proper safety procedures.

To increase the concentration of a 1 L solution of 2 M HCl to 3 M, the student needs to calculate the volume of concentrated HCl needed and add it to the existing solution. Here's how the calculation can be done:

Given:

Initial concentration of HCl solution = 2 M

Final concentration desired = 3 M

Initial volume of HCl solution = 1 L

Step 1: Calculate the moles of HCl in the initial solution.

Moles of HCl = Initial concentration × Initial volume = 2 M × 1 L = 2 moles

Step 2: Calculate the moles of HCl needed for the desired concentration.

Moles of HCl needed = Final concentration × Final volume = 3 M × 1 L = 3 moles

Step 3: Calculate the moles of HCl to be added.

Moles of HCl to be added = Moles needed - Moles present = 3 moles - 2 moles = 1 mole

Step 4: Convert the moles of HCl to the required volume of concentrated HCl.

To calculate the volume, we need to know the concentration of the concentrated HCl solution. Assuming it is 12 M, we can use the following formula:

Volume of concentrated HCl = Moles of HCl to be added / Concentration of concentrated HCl

Volume of concentrated HCl = 1 mole / 12 M = 0.0833 L or 83.3 mL

For more such questions on concentration visit:

https://brainly.com/question/28564792

#SPJ8

The mass of the asteroid is C. 1.2 x \(10^{12}\) Kg

To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:

F = (G * m1 * m2) / \(r^{2}\)

where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.

Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x \(10^{7}\) kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):

1.14 N = (6.67430 × \(10^{-11}\) N \(m^{2}\)/\(Kg^{2}\) * 8 x \(10^{7}\) kg * \(m2\)) / \((75000 m)^{2}\)

Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x \(10^{12}\) kg. Therefore, Option C is correct.

The question was incomplete. find the full content below:

Two asteroids are 75000 m apart one has a mass of 8 x \(10^{7}\) kg if the force of gravity between them is 1.14 what is the mass of the asteroid

A. 3.4 x \(10^{11}\) kg

B. 8.3 x \(10^{12}\) kg

C. 1.2 x \(10^{12}\) kg

D. 1.2 x \(10^{10}\) kg

Know more about gravitational force here:
https://brainly.com/question/72250

#SPJ8

The mass (in grams) of chlorine gas is needed to react with 251 grams of iron is 479 grams. Option C.

To determine the mass of chlorine gas needed to react with 251 grams of iron, we need to use the stoichiometry of the balanced chemical equation:

2Fe + 3Cl2 → 2FeCl3

From the balanced equation, we can see that 2 moles of iron (Fe) react with 3 moles of chlorine gas (Cl2) to produce 2 moles of iron(III) chloride (FeCl3).

To calculate the mass of chlorine gas, we can follow these steps:

Step 1: Convert the given mass of iron (Fe) to moles.

Using the molar mass of iron (Fe), which is approximately 55.85 g/mol, we can calculate the number of moles of iron:

moles of Fe = mass of Fe / molar mass of Fe

moles of Fe = 251 g / 55.85 g/mol

moles of Fe ≈ 4.5 mol (rounded to one decimal place)

Step 2: Use the mole ratio from the balanced equation to find the moles of chlorine gas (Cl2) needed.

From the balanced equation, we know that 2 moles of Fe react with 3 moles of Cl2. Therefore, the moles of Cl2 can be calculated as:

moles of Cl2 = (moles of Fe / 2) * 3

moles of Cl2 = (4.5 mol / 2) * 3

moles of Cl2 ≈ 6.75 mol (rounded to two decimal places)

Step 3: Convert the moles of chlorine gas to grams.

Using the molar mass of chlorine gas (Cl2), which is approximately 70.90 g/mol, we can calculate the mass of chlorine gas:

mass of Cl2 = moles of Cl2 * molar mass of Cl2

mass of Cl2 = 6.75 mol * 70.90 g/mol

mass of Cl2 ≈ 479 grams (rounded to the nearest whole number) Option C is correct.

For more such question on mass. visit :

https://brainly.com/question/19385703

#SPJ8

Answer:

C

Explanation:

since the dehydrogenation reacts n produces a c=C w a bond that is doubled lol

The mass of TiC that can be produced is 2.06 g. The limiting reagent is Cl₂.

Calculate the moles of MnO₂

The molar mass of MnO₂ is 86.94 g/mol. So, the number of moles of MnO₂ is:

moles of MnO₂ = mass of MnO₂ / molar mass of MnO₂

= 8.00 g / 86.94 g/mol

= 0.0921 mol

Calculate the moles of HCl

The volume of the HCl solution is 15.0 mL. The density of the HCl solution is 1.13 g/mL. So, the mass of the HCl solution is:

mass of HCl solution = volume of HCl solution × density of HCl solution

= 15.0 mL × 1.13 g/mL

= 16.95 g

The mass of HCl in the solution is 36.4% of the mass of the solution. So, the mass of HCl is:

mass of HCl = 0.364 × mass of HCl solution

= 0.364 × 16.95 g

= 6.14 g

The molar mass of HCl is 36.5 g/mol. So, the number of moles of HCl is:

moles of HCl = mass of HCl / molar mass of HCl

= 6.14 g / 36.5 g/mol

= 0.167 mol

Calculate the moles of Cl₂ produced

The balanced equation for the reaction is:

2 MnO₂(s) + 4 HCl(aq) → 2 MnCl₂(aq) + 2 Cl₂(g)

For every 2 moles of MnO₂, 2 moles of Cl₂ are produced. So, the number of moles of Cl₂ produced is:

moles of Cl₂ = moles of MnO₂ / 2

= 0.0921 mol / 2

= 0.0460 mol

Calculate the moles of TiO₂

The mass of the sample that contains TiO₂ is 5.20 g. The TiO₂ content of the sample is 67.0%. So, the mass of TiO₂ in the sample is:

mass of TiO₂ = 0.670 × mass of sample

= 0.670 × 5.20 g

= 3.48 g

The molar mass of TiO₂ is 79.86 g/mol. So, the number of moles of TiO₂ is:

moles of TiO₂ = mass of TiO₂ / molar mass of TiO₂

= 3.48 g / 79.86 g/mol

= 0.0434 mol

Determine the limiting reagent

The moles of Cl₂ produced is less than the moles of TiO₂. So, Cl₂ is the limiting reagent.

Calculate the mass of TiC produced

The balanced equation for the reaction is:

TiO₂(s) + C(s) + Cl₂(g) → TiCl₄(g) + CO₂(g) + CO(g)

For every 1 mole of TiO₂, 1 mole of TiC is produced. So, the mass of TiC produced is:

mass of TiC = moles of TiO₂ × molar mass of TiC

= 0.0434 mol × 47.86 g/mol

= 2.06 g

Therefore, the mass of TiC that can be produced is 2.06 g and the limiting reagent is Cl₂.

Find out more on limiting reagent here: https://brainly.com/question/14222359

#SPJ1

Answer:

same ammount of electrons

Explanation:

hope this helps:)

Mercury is a compound denser than water and when this happen, it stays lower.

So, in this case, water stays higher than mercury because its density is low.

The level is different by a factor of 13.6 times taller.

An observation is that I can smell smoke as soon as I step outside.

Keeping a close eye on someone or something is the act of observation, such as keeping a close eye on how the planets are moving. When you see or watch something and give it some thought, you can make an observation.

The Workplace Observation evaluation gauges an employee's capacity for observing, following, comprehending, and assessing processes, demonstrations, as well as other workplace practices.

To know more about observation visit:

https://brainly.com/question/9497931

#SPJ1

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The correct answer based on relative electronegativity would be:

Br > P > C > Mg

What is Electronegativity?

Electronegativity is a measure of an element's tendency to attract a bonding pair of electrons towards itself when it forms a chemical bond with another element. It is a property of elements that reflects their ability to attract and hold onto electrons in a chemical bond.

Electronegativity is a measure of an element's tendency to attract a bonding pair of electrons. In general, electronegativity increases from left to right across a period in the periodic table and decreases from top to bottom within a group. Therefore, Bromine (Br) would have the highest electronegativity among the given options, followed by Phosphorus (P), Carbon (C), and Magnesium (Mg) with the lowest electronegativity.

Learn more about Electronegativity from the given link

https://brainly.com/question/24977425

#SPJ1

1. Octagon (8 sides)

2. Hexagon (6 sides)

3. Pentagon (5 sides)

4. Square/Rectangle (4 sides)

5. Triangle (3 sides)

Hope this helps :)

The statement the most abundant isotope of Hydrogen has a mass of 1 amu is wrong.

The average atomic mass could be obtained as the sum of the products of the percentage abundance of each of the hydrogen isotopes and the mass of the isotope.

We know that every element has isotopes. In every sample of the atom, there are various isotopes of the element. Thus the average atomic mass must take into account the masses of all these isotopes.

As such, the statement the most abundant isotope of Hydrogen has a mass of 1 amu is wrong.

Learn ore about atomic mass:https://brainly.com/question/17067547

#SPJ1

The value of x is 1.

To solve the linear system using Cramer's rule, we need to find the value of x in the equation 1x + 3(2) + 9 = 16.

Simplifying the equation, we have:

x + 6 + 9 = 16

x + 15 = 16

x = 16 - 15

x = 1

Therefore, the value of x is 1.

Cramer's rule is a method used to solve systems of linear equations by using determinants. In this case, we have a single equation with one variable, so the determinant involved is a 1x1 matrix. The determinant of a 1x1 matrix is simply the value of the element.

The determinant of the coefficient matrix in this equation is 1. The determinant of the entire system is the determinant of the coefficient matrix divided by the determinant of the matrix formed by replacing the column of the variable with the constants.

Since the determinant of a 1x1 matrix is the value of the element, we have:

determinant of the entire system = determinant of the coefficient matrix / determinant of the constant matrix

= 1 / 1

= 1

Therefore, the determinant of the entire system is 1.

Using Cramer's rule, we can solve for the value of x by dividing the determinant of the matrix formed by replacing the column of the variable with the constants by the determinant of the coefficient matrix. In this case, both determinants are 1. Thus, The value of x is 1.

For more such questions on value

https://brainly.com/question/30371221

#SPJ8

Explanation:

Copper sulphate reacts with potassium iodide to form cuprous iodide and iodine.

2CuSO

4

+4KI→Cu

2

I

2

↓+I

2

+2K

2

SO

4

Thus, CuI

2

is not formed in this reaction.

Hence, the option B is incorrect and option A is correct.

The liberated iodine is titrated with sodium thiosulphate to form sodium tetrathionate.

2Na

2

S

2

O

3

+I

2

→Na

2

S

4

O

6

+2NaI

Iodine is reduced and sodium thiosulphate is oxidized.

Answer:

1H2 + O2 -> 2Н2O.

combination reaction.

The mass, in grams, of 532.0 atoms of cadmium is 9.93 × 10⁻²⁰ g

From the question, we are to determine the mass of the given atoms of cadmium

First, we will calculate the number of moles of cadmium present

Using the formula,

\(Number\ of\ moles = \frac{Number\ of\ atoms}{Avogadro's\ constant}\)

Then,

Number of moles of Cd present = \(\frac{532.0}{6.022 \times 10^{23} }\)

Number of moles of Cd present = 8.83427 × 10⁻²² moles

From the given information,

1 mole of Cd has a mass of 112.41 g

Therefore,

8.83427 × 10⁻²² moles will have a mass of 8.83427 × 10⁻²² × 112.41 g

8.83427 × 10⁻²² × 112.41 = 9.9306 × 10⁻²⁰ g

≅ 9.93 × 10⁻²⁰ g

Hence, the mass, in grams, of 532.0 atoms of cadmium is 9.93 × 10⁻²⁰ g

Learn more on Stoichiometry here: https://brainly.com/question/13784020

Answer: See below

Explanation:

To balance equations, you want to have the same amount of elements on the product and reactants side.

__Al+ __HCl→__AlCl₃+ __H₂

We see that there are 3 Cl on the products side and 1 on the reactants side, but there are 2 H on the product and 1 on reactant. To fulfill them both, let's put a 6 at HCl.

__Al+ 6HCl→__AlCl₃+ __H₂

Now that we have a 6 at HCl, we can fill in AlCl₃ and H₂.

__Al+ 6HCl→ 2AlCl₃+ 3H₂

All we have left is to fill in Al.

2Al+ 6HCl→ 2AlCl₃+ 3H₂

-----------------------------------------------------------------------------------------------------------------

__NaCl→ __Na+ __Cl₂

Since we have 2 Cl on the products, we must put 2 on the reactants.

2NaCl→ __Na+ 1Cl₂

With 2 NaCl, we can fill in Na.

2NaCl→ 2Na+ 1Cl₂

-----------------------------------------------------------------------------------------------------------------

__Na₂S+ __HCl→ __NaCl+ __H₂S

We see 2 Na on reactants, so we can put 2 on the products.

__Na₂S+ __HCl→ 2NaCl+ __H₂S

With 2 H and 2 Cl on the products, we can put a 2 at HCl.

1Na₂S+ 2HCl→ 2NaCl+ 1H₂S

In the given reaction, the limiting reactant is C₆H₆ (benzene).

To determine the limiting reactant as well as calculate the mass of HCl produced, compare the moles of each reactant.

The number of moles for each reactant:

Molar mass of Cl₂ = 35.5 g/mol + 35.5 g/mol = 71 g/mol

Moles of Cl₂ = mass of Cl₂ / molar mass of Cl₂

                     = 45 g / 71 g/mol

                     = 0.634 moles of Cl₂

Molar mass of C₆H₆ (benzene) = 12 g/mol + 6(1 g/mol) = 78 g/mol

Moles of C₆H₆ = mass of C₆H₆ / molar mass of C₆H₆

                        = 45 g / 78 g/mol = 0.577 moles of C₆H₆

Determine the stoichiometry between Cl₂ and HCl:

Cl₂ + C₆H₆ → C₆H₅Cl + HCl

Here, we can see that 1 mole of Cl₂ produces 1 mole of HCl.

Thus, the limiting reactant is C₆H₆ (benzene).

Calculate the mass of HCl produced:

Molar mass of HCl = 1 g/mol + 35.5 g/mol = 36.5 g/mol

Moles of HCl produced = moles of C₆H₆ = 0.577 moles

Mass of HCl produced = moles of HCl produced × molar mass of HCl

Mass of HCl produced = 0.577 moles × 36.5 g/mol

                                     ≈ 21.04 g

Therefore, approximately 21.04 grams of HCl will be produced.

For more details regarding limiting reactant, visit:

https://brainly.com/question/10090573

#SPJ1

Answer:

Empirical formulae is NO2

Molecular Formulae is NO2

Algal blooms and high concentrations of nitrogen in water are effects of water pollution. Overgrazing and the use of chemical fertilizers cause water pollution.

Algal blooms are an effect of water pollution. They occur when there is an excessive amount of nutrients, particularly nitrogen and phosphorus, in the water due to pollution. The overgrowth of algae depletes the oxygen levels in the water, which can harm fish and other aquatic animals.

Overgrazing can cause water pollution by increasing the sedimentation rate of waterways. This sedimentation can carry nutrients, bacteria, and other pollutants into the water, which can degrade water quality and cause harm to aquatic life.

The use of chemical fertilizers to enhance production is a cause of water pollution. When fertilizer is overused, it can leach into waterways and cause nutrient pollution, which can lead to algal blooms and other forms of water pollution.

High concentrations of nitrogen in water are often an effect of water pollution. This can be caused by the overuse of fertilizers or the discharge of untreated sewage into waterways. High nitrogen levels can cause algal blooms, which can lead to oxygen depletion and harm aquatic life.

More on water pollution can be found here: https://brainly.com/question/19920929

#SPJ1

Answer:

Cause:

: : use of chemical fertilizers to enhance production

: : overgrazing

Effect:

: : high concentration of nitrogen in water

: : algal blooms

Hope this helps ;)

Answer:

Any Group 2A element (Be, Mg, Ca, Sr, Ba, Ra)

Explanation:

According to the Octet Rule, Sulfur would want to gain two electrons in its outermost shell to achieve an octet (8 total electrons).  The elements that could accomplish this in a one-to-one ratio would be Group 2A on the periodic table (alkaline earth metals).

There are two types of chemical compound one is covalent compound and other is ionic compound, covalent compound formed by sharing of electron and ionic compound formed by complete transfer of electron. Therefore, alkaline earth metals are the suitable elements.

Chemical Compound is a combination of molecule, Molecule forms by combination of element and element forms by combination of atoms in fixed proportion.

An ionic compound is a metal and nonmetal combined compound. Ionic compound are very hard. They have high melting and boiling point because of strong ion bond.

The compound that is ionic in nature can be dissociated very easily in water. Since ionic compounds are polar in nature, they readily dissolve in water.  The elements that could accomplish this in a one-to-one ratio would be  alkaline earth metals

Therefore, alkaline earth metals are the suitable elements.

To learn more about chemical compound, here:

brainly.com/question/26487468

#SPJ2

The rate of disappearance of Br- is 5 times  of the rate of disappearance of BrO₃⁻. Hence, the disappearance rate of Br- in the reaction is 0.201 M/s .

The rate of a reaction is the rate of disappearance of the reactants or the rate of appearance of the products. The rate of a reaction is directly proportional to the molar concentration of the reactants.

For the given reaction, the rate of reaction can be written in the following terms.

-d/dt [BrO₃⁻] = -1/5 d/dt [Br-] =  -1/6d/dt [H+ ] = +1/3d/dt  [Br²] = + 1/3 d/dt[H₂O]

The minus sign indicates the disappearance and + indicates the formation.

Given, the rate of disappearance of BrO₃⁻ = -d/dt [BrO₃⁻]  = 0.041 M/s.

-d/dt [BrO₃⁻]  = 1/5 d/dt [Br-]

then  d/dt [Br-] = 5 -d/dt [BrO₃⁻]  = 5 × 0.041 M/s = 0.201 M/s.

Therefore, the rate of disappearance of Br- in this reaction is 0.201 M/s.

Find more on reaction rate :

https://brainly.com/question/29261432

#SPJ9

HCN, Na2SO4: Combination of compounds.

Mg3N2: Chemical compound.

CO2, H2O: Dissolution or hydration reaction.

Cu, Zn(NO3)2: Single-replacement reaction.

Na, N2: Combination of elements.

Let's analyze each chemical combination to determine the type of reaction involved:

HCN, Na2SO4:

The combination of hydrogen cyanide (HCN) and sodium sulfate (Na2SO4) does not represent a specific chemical reaction. It is simply the combination of two compounds.

Mg3N2:

Mg3N2 represents a chemical compound, magnesium nitride. It does not indicate a specific reaction.

CO2, H2O:

The combination of carbon dioxide (CO2) and water (H2O) represents a chemical reaction known as hydration or dissolution. When carbon dioxide dissolves in water, it forms carbonic acid (H2CO3), which can further dissociate into hydrogen ions (H+) and bicarbonate ions (HCO3-).

Cu, Zn(NO3)2:

The combination of copper (Cu) and zinc nitrate (Zn(NO3)2) represents a single-replacement reaction. Copper displaces zinc from the compound, resulting in the formation of copper nitrate (Cu(NO3)2) and zinc metal (Zn).

Na, N2:

The combination of sodium (Na) and nitrogen gas (N2) does not represent a specific reaction. It is simply the combination of two elements.

For more question on Combination click on

https://brainly.com/question/28304510

#SPJ11

Answer: Compaction and Cementation.

Explanation. Compaction occurs when the weight of overlying sediment compresses the sediment grains and reduces the amount of pore space between them, resulting in a more tightly packed sedimentary rock. Cementation occurs when mineral-rich groundwater moves through the pore spaces of the sediment, depositing minerals that bind the sediment grains together and form a solid rock.