Your aunt is sipping on iced tea and fanning herself during a hot South Carolina summer day. You tell her that there is enough energy in one drop of her iced tea to run the air conditioner for the rest of her life if the energy could be extracted with 100% efficiency. Your aunt asks you to explain. Use the concepts you learned in this unit to explain the relationship between forces, energy, and matter.
Answers
Answer:
Isn't this like having enough energy to supply the world for centuries with just 1% of the sea's force?
Explanation:
I guess it's because the amount of energy in it can supply energy.
Related Questions
This exercise will lead you to verify that the average atomic mass of magnesium is 24.31 amu, based on the following information:
isotope mass (amu) percent abundance
24Mg 23.985042 78.99%
25Mg 24.985837 10.00%
26Mg 25.982593 11.01%
The average atomic mass is the weighted average of the atomic masses of all isotopes.
What is the fractional abundance of 24Mg?
Answers
Answer: 24.305052 (8 sig figs) [Mg]
Explanation: The AMU of each isotope is multiplied by it's percent abundance to yield a weighted average for each isotope. The sum of these weighted averages will be the wighted average of the element's isotopes:
Isotope Mass (AMU) % Weighted AMU
24Mg 23.985042 78.99% 18.94578468
25Mg 24.985837 10.00% 2.4985837
26Mg 25.982593 11.01% 2.860683489
24.305052 (8 sig figs)
125 grams of zinc was reacted. What volume liters of hydrogen, measured at STP was released?
Answers
125 grams of zinc was reacted, therefore, 125 grams of zinc will produce 42.6 liters of hydrogen gas at STP, and the problem involves stoichiometry, which is the calculation of reactants and products in a chemical reaction.
The balanced chemical equation for the reaction of zinc and hydrochloric acid is:
Zn + 2HCl → ZnCl₂ + H₂
From the equation,
125 g Zn x (1 mole Zn/65.38 g) = 1.91 moles Zn
So, one can expect 1.91 moles of hydrogen gas to be produced.
Now, at STP (standard temperature and pressure), the volume of one mole of gas is 22.4 liters. Therefore, the volume of hydrogen gas produced at STP can be calculated as:
1.91 moles H2 x 22.4 L/mole = 42.6 L H2
Therefore, 125 grams of zinc will produce 42.6 liters of hydrogen gas at STP.
Learn more about the ideal gas law here.
https://brainly.com/question/30556543
#SPJ1
How does the entropy change in the reaction 2C3H6(g) + 902(g) → 6CO2(g) +
6 H₂O(g)?
OA. It is impossible to tell.
B. The entropy increases.
C. The entropy is constant.
D. The entropy decreases.
Answers
Taking into account the definition of entropy, the entropy increases (option B).
What is EntropyEntropy can be interpreted as a measure of the random distribution of a system. In other words, the entropy S is a state function that measures the degree of molecular disorder of systems.
In this way, the change in entropy shows the change in molecular order that occurs in a chemical reaction. If the increase in entropy is positive, the products have a higher molecular disorder (higher entropy) than the reactants. On the other hand, when the increase is negative, the products are more ordered.
So, the entropy increases in the reaction if the total number of product molecules are greater than the total number of reactant molecules.
Entropy change in this caseIn this case, there are 12 moles of gaseous product, and 11 moles of gaseous reactant in the equation. This is, there are more moles in the products than in the reactants.
Therefore, the entropy increases (option B).
Learn more about entropy:
brainly.com/question/22861773
#SPJ1
Air pressure is measured in pascals. For a professional American football game, the ball should be inflated to about 90,000 pascals. Scientists studied the effects of air temperature on the pressure inside American footballs by taking these steps:
1. Prepare 100 footballs.
2. Measure each football's air pressure.
3. Divide footballs into 10 groups.
4. Place the groups in different lockers cooled to different air temperatures.
5. After 12 hours, remove the footballs from lockers.
6. Measure each football’s pressure again.
7. Compare the new pressures to the starting pressures.
What two terms best describe the variable "air pressure inside the football" in this experiment?
independent, qualitative
independent, quantitative
dependent, qualitative
dependent, quantitative
Answers
The variable "air pressure inside the football" in this experiment is quantitative and dependent variable. Hence, option D is correct.
What is the dependent variable?The dependent variable is the variable that is being measured or tested in an experiment.
In the experiment, the scientist filled the footballs with fix quantity of pressure which was then kept for 12 hours. After 12 hours the pressure inside the footballs was again measured. Pressure here is a quantitative variable.
Since the air temperature is an independent variable. The pressure being the dependent variable depends upon the temperature of the air.
Independent variable; The variable which does not depends upon any other variable.
Dependent variable; The variable which depends upon the independent variable or varies with the change independent variable.
Qualitative variables are variables which cannot be expressed in form of numbers. They generally convey the characteristic, category, quality or type.
Whereas Quantitative variables are the variables which can be expressed in the form of numbers. These are the variables which exist along the continuous sequence.
Learn more about dependent variables here:
https://brainly.com/question/1479694
#SPJ1
If a less concentrated initial solution of sodium bicarbonate was used in beaker C, would that solution require more or less bicarbonate to neutralize the acid? Why?
Answers
If a less concentrated initial solution of sodium bicarbonate was used in beaker C, it would require more bicarbonate to neutralize the acid.
What is concentrated?Concentrated means something that has been increased in strength or power by reducing its volume. It can refer to a solution that has a higher concentration of solutes than the original solution, a sound that is louder or stronger, or a force that is more powerful or intense. Concentrated can also refer to a person’s focus or attention on one particular thing, when their thoughts and energy are directed to a single point.
This is because the concentration of sodium bicarbonate determines how much of the acid can be neutralized by the solution. If the initial solution is less concentrated, then it will take more of the bicarbonate to neutralize the same amount of acid.
To learn more about concentrated
https://brainly.com/question/30558048
#SPJ1
The rotational spectrum of 79BrºF shows a series of equidistant lines spaced 0-714 33 cm - apart. Calculate the rotational constant B, and hence the moment of inertia and bond length of the molecule. Determine the wavenumber of the J = 9+= 10 transition, and find which transition gives rise to the most intense spectral line at room temperature (say 300 K).
and calculate the number of revolutions per second which the Brf molecule undergoes when in (a) the J = 0 state, (b) the J = 1 state, and (c) the J = 10 state. Hint: Use E = {lwin conjunction with Eqs (2.10) and (2.13), but remember that here w is in radians per second.[its Q season 2 from fundamentals of molcular spectruscopy . banwell.c.n]
Answers
In the J = 0 state, the BrF molecule does not undergo any revolutions per second. In the J = 1 state, it undergoes approximately 0.498 revolutions per second, and in the J = 10 state, it undergoes approximately 15.71 revolutions per second.
To calculate the rotational constant B, we can use the formula:
B = 1 / (2 * π * Δν)
Where:
B = rotational constant
Δν = spacing between consecutive lines in the rotational spectrum
Given that the spacing between consecutive lines is 0.71433 cm^(-1), we can substitute this value into the formula:
B = 1 / (2 * π * 0.71433 cm^(-1))
B ≈ 0.079 cm^(-1)
The moment of inertia (I) of the molecule can be calculated using the formula:
I = h / (8 * π^2 * B)
Where:
h = Planck's constant
Given that the value of Planck's constant (h) is approximately 6.626 x 10^(-34) J·s, we can substitute the values into the formula:
I = (6.626 x 10^(-34) J·s) / (8 * π^2 * 0.079 cm^(-1))
I ≈ 2.11 x 10^(-46) kg·m^2
The bond length (r) of the molecule can be determined using the formula:
r = sqrt((h / (4 * π^2 * μ * B)) - r_e^2)
Where:
μ = reduced mass of the molecule
r_e = equilibrium bond length
To calculate the wavenumber (ν) of the J = 9+ to J = 10 transition, we can use the formula:
ν = 2 * B * (J + 1)
Substituting J = 9 into the formula, we get:
ν = 2 * 0.079 cm^(-1) * (9 + 1)
ν ≈ 1.58 cm^(-1)
To determine the most intense spectral line at room temperature (300 K), we can use the Boltzmann distribution law. The intensity (I) of a spectral line is proportional to the population of the corresponding rotational level:
I ∝ exp(-E / (k * T))
Where:
E = energy difference between the levels
k = Boltzmann constant
T = temperature in Kelvin
At room temperature (300 K), the population distribution decreases rapidly with increasing energy difference. Therefore, the transition with the lowest energy difference will have the most intense spectral line. In this case, the transition from J = 0 to J = 1 will have the most intense spectral line.
To calculate the number of revolutions per second, we can use the formula:
ω = 2 * π * B * J
Where:
ω = angular frequency (in radians per second)
J = rotational quantum number
For J = 0:
ω = 2 * π * 0.079 cm^(-1) * 0 = 0 rad/s
For J = 1:
ω = 2 * π * 0.079 cm^(-1) * 1 ≈ 0.498 rad/s
For J = 10:
ω = 2 * π * 0.079 cm^(-1) * 10 ≈ 15.71 rad/s
For more such questiosn on BrF molecule visit;
https://brainly.com/question/30624940
#SPJ8
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answers
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Acetylene C2H2 gas is often used in welding torches because of the very high heat produced when it reacts with oxygen O2 gas, producing carbon dioxide gas and water vapor. Calculate the moles of carbon dioxide produced by the reaction of 1.60mol of acetylene. Be sure your answer has a unit symbol, if necessary, and round it to 3 significant digits.
Answers
Answer:
3.20 moles of carbon dioxide
Explanation:
The reaction of C₂H₂ with O₂ is:
C₂H₂ + 5/2O₂ → 2CO₂ + H₂O
Where 1 mole of acetylene produce 2 moles of carbon dioxide.
Based on the chemical equation of this reaction, there are produced twice the moles of acetylene in moles of carbon dioxide assuming a compete reaction.
If 1.60 moles of acetylene reacts there are produced:
1.60 moles * 2 =
3.20 moles of carbon dioxideThe Jones family is expecting guests at any moment they spray room freshener in one corner of the kitchen to remove the strong foods smell The room spray quickly becomes evenly distributed throughout the room making the whole kitchen smell fresh what is happening in this system?
Answers
Answer: Entropy is increasing
Explanation:
Underneath the ocean floor, methane can exist as a solid known as methane hydrate. Methane hydrate forms when large amounts of methane become trapped in the crystal structure of water, which develops into a solid similar to ice. A scientist working for a deep water drilling company is studying the properties of the three different phases of methane: methane hydrate, liquified natural gas, and natural gas. Which of the properties is true
Answers
Answer:
Methane is present in solid, liquid and gaseous form.
Explanation:
Methane hydrate is present in solid state when the hydrogen-bonded water and methane gas come into contact at high pressures and low temperatures in the deep oceans while on the other hand, methane which is present inside the earth surface in gaseous form due to non-availability of water that can combine with methane. Methane is also found in liquid form when it is cool with high pressure and low temperature.
In the lattice structure of sodium chloride, chlorine atom can only form one strong ionic bond because it can only accept one more electron into its outer shell.true or false
Answers
INFORMATION:
We have the next statement:
- In the lattice structure of sodium chloride, chlorine atom can only form one strong ionic bond because it can only accept one more electron into its outer shell.
And we must determine if it is true or false
STEP BY STEP EXPLANATION:
To determine it, we need to use that a chloride ion can strongly bond to as many sodium ions as can effectively pack around it in the regular crystal lattice.
Also, In NaCl there will be six sodium ions strongly bonded to each chloride ion.
So, the statement is false
ANSWER:
False: a chloride ion can strongly bond to as many sodium ions as can effectively pack around it in the regular crystal lattice. In NaCl there will be six sodium ions strongly bonded to each chloride ion
chemical equation for dehydration reaction conducted: calculations: (neatly show all calculations, including all units; for more space use back of paper) molar mass of water: molar mass of the anhydrate: mass percent water in hydrate:
Answers
A dehydration reaction is a chemical reaction that removes water molecules from a compound. The general equation for a dehydration reaction is:
A-H + B-OH → A-B + H₂O
In this equation, A and B represent different parts of the compound, and the -H and -OH groups are removed to form water.
To calculate the molar mass of water, we need to add the atomic masses of hydrogen and oxygen:
Molar mass of water = (2 x atomic mass of H) + atomic mass of O
Molar mass of water = (2 x 1.008) + 16.00
Molar mass of water = 18.016 g/mol
The molar mass of the anhydrate (the compound without water) will depend on the specific compound you are working with. You can find the molar mass of the anhydrate by adding up the atomic masses of each element in the compound.
To find the mass percent of water in the hydrate, you can use the following equation:
Mass percent water = (mass of water in hydrate / mass of hydrate) x 100%
You will need to know the mass of the hydrate and the mass of water in the hydrate to calculate the mass percent of water.
know more about dehydration reaction here
https://brainly.com/question/29644505#
#SPJ11
all the questions 1. What contribution did de Broglie make to the development of the modern model of the atom? (A)Observed the effect of bombarding thin gold foil (and other metal foils) with alpha radiation from radioactive substances. 60 m B. Discovery of the nucleus C. Discovered that atoms and molecules emit energy only in certain discrete quantities, or quanta. D. Discovered negatively charged particles by cathode ray tube experiment E. Described the wave properties of particles
Answers
De Broglie contributed to the development of the modern model of atoms by describing the wave properties of particles. Option E.
De Broglie's contribution to atomic theoryLouis de Broglie was a French physicist who made significant contributions to the development of quantum mechanics.
In his doctoral thesis, he proposed that particles, such as electrons, have both particle-like and wave-like properties. This idea became known as wave-particle duality and laid the foundation for the development of the modern model of the atom.
According to de Broglie's theory, particles can exhibit wave-like behavior and have a wavelength that is inversely proportional to their momentum.
This theory was later experimentally confirmed in a series of experiments that demonstrated the diffraction of electrons and other particles.
More on de Broglie can be found here: https://brainly.com/question/17295250
#SPJ1
A 0.470 g sample of a metal, M, reacts completely with sulfuric acid according to M(s)+H2SO4(aq)⟶MSO4(aq)+H2(g) A volume of 217 mL of hydrogen is collected over water; the water level in the collecting vessel is the same as the outside level. Atmospheric pressure is 756.0 Torr, and the temperature is 25 °C. The vapor pressure of water at 25 °C is 23.8 Torr. Calculate the molar mass of the metal.
Answers
The molar mass when rected with sulphuric acid to liberate 249 mL of hydrogen gas is 48 g/mol
The volume (V) = 249 mL = 249 / 1000 = 0.249 L
Pressure (P) = 1.0079 – 0.03167 = 0.97623 bar
The temperature (T) = 25.0 °C = 25 + 273 = 298 K
Gas constant (R) = 8.314×10¯² bar.L/Kmol
Number of mole (n) =?
n = PV / RT
n = (0.97623 × 0.249) / (8.314×10¯² × 298)
n = 0.0098 mole
How to determine the mole of the metal
Balanced equation
M(s) + H₂SO₄(aq) —> MSO₄(aq) + H₂(g)
From the balanced equation above,
1 mole of M reacts to produce 1 mole of H₂.
Therefore,
Mole of metal = 0.0098 mole
Mass of metal = 0.539 g
Molar mass is given as mass upon mole
Molar mass of metal = 0.470 / 0.0098
Molar mass of metal = 48 g/mol
Learn more about stoichiometry at:
brainly.com/question/14735801
#SPJ9
During a class presentation, your classmate explains that plants perform photosynthesis and animals perform cellular respiration. In your own words, describe what these processes are and explain why your classmate’s statement is correct or incorrect.
Answers
My classmate's statement in incorrect because plants are also composed of cells.
All living things are composed of cells. A cell is the smallest unit of living organisms. Cells obtain energy via the process of cellular respiration. During cellular respiration, glucose is broken down to yield carbon dioxide and water.
In photosynthesis, carbon dioxide and water are combined to form glucose. The two processes are opposites of each other. Plants produce their own food via photosynthesis. Since plants are composed of cells, plant cells also undergo cellular respiration therefore my classmate's statement in incorrect.
Learn more: https://brainly.com/question/11324711
The number of protons plus the number of neutrons equal the ______
1: Atomic Weight
2: Atomic Number
Answers
The ___ something is before it falls, the longer gravity can act on the object.
higher
lower
Answers
Answer:The higher something is before it falls, the longer gravity can act on an object.
Explanation:
When something is dropped from higher up it has more time to fall thus giving gravity more time to act on the object.
Take a look at this link for more information.
http://faculty.ric.edu/psci103/newton/newton_notes.pdf
Draw 4 decyne structure
Answers
The structure of the alkyne 4 - decyne is shown in the image attached.
How do you draw 4-decyne?Alkyne functional group compounds with a triple bond made of carbon and carbon contain 4-decyne (C). The triple bond is found at the fourth carbon position in the ten-carbon chain (decyne) of 4-decyne.
Nine hydrogen atoms (H) are joined to the first nine carbon atoms (C), starting from the left side.
In conclusion, 4-decyne is made up of a chain of ten carbon atoms, with the fourth carbon atom serving as the center of a carbon-carbon triple bond (C). Except for the carbon involved in the triple bond, all carbon atoms are connected to hydrogen atoms.
Learn more about chemical structure:https://brainly.com/question/32300619
#SPJ1
Lesson 06.02 and 06.03: Reading for Argument Graphic Organizer
Answer the questions and complete the graphic organizers as you move through the
two lessons. The notes on 6.02 will help you on your Lesson 6.02 assessment. The whole
graphic organizer will be submitted in lesson 6.03.
6.02: Summarize the Claims and Evidence
2
1. 1. What are the Constitution and Declaration of Independence described as?
Excerpt #
1
3
1. 2. Summarize the claims and evidence King uses in his speech. Excerpt 1 has been
completed as an example for you.
Claims and Evidence
Claim 1: The Constitution and the Declaration of Independence promise
equal rights to all Americans, not just white people.
Claim 2: America has failed to deliver the rights promised by the
Constitution and Declaration of Independence to black people.
Evidence for Claim 2:
Evidence for Claim 2:
Claim 3:
Claim 4:
Answers
They are described as promissory notes that guarantee the unalienable rights of life, liberty, and the pursuit of happiness.
Claim 1 is that the Constitution and the Declaration of Independence give equal rights to all Americans. The evidence for this claim is found in the article of the Declaration of Independence.
Claim 2 is that America has failed to deliver these rights to black people. The evidence for this is found in the speech "I Have a Dream" by Martin Luther King Jr.
What are the Constitution and Declaration of Independence?The Constitution and Declaration of Independence are described as promissory notes that guarantee the unalienable rights of life, liberty, and the pursuit of happiness.
Following are the Claims and Evidence:
Claim 1: All Americans, not only whites, are guaranteed equal rights under the Constitution and the Declaration of Independence.
The Declaration of Independence has supporting evidence for Claim 1.
Claim 2: The United States has failed to grant black people the rights outlined in the Constitution and Declaration of Independence.
Martin Luther King Jr.'s "I Have a Dream" speech serves as proof for Claim 2.
Learn more about the Constitution at: https://brainly.com/question/470736
#SPJ1
How many helium atoms does water (H20) contain?
OA) O
B) 1
C) 2
OD) 3
Answers
Answer:
it's zero
Explanation:
water is composed of hydrogen and oxygen
During laparoscopic surgery, CO2 gas is used to expand the abdomen to help create a larger
working space. If the CO2 injected into the abdomen produces a pressure of 20.0 mmHg
and a volume of 4.00 L at 32.0C, how many grams of CO2 were used?
Answers
Answer:
The answer to your question is V2 = 4.97 l
Explanation:
Data
Volume 1 = V1 = 4.40 L Volume 2 =
Temperature 1 = T1 = 19°C Temperature 2 = T2 = 37°C
Pressure 1 = P1 = 783 mmHg Pressure 2 = 735 mmHg
Process
1.- Convert temperature to °K
T1 = 19 + 273 = 292°K
T2 = 37 + 273 = 310°K
2.- Use the combined gas law to solve this problem
P1V1/T1 = P2V2/T2
-Solve for V2
V2 = P1V1T2 / T1P2
-Substitution
V2 = (783 x 4.40 x 310) / (292 x 735)
-Simplification
V2 = 1068012 / 214620
-Result
V2 = 4.97 l
What is the best definition of the enthalpy of vaporization, ^ Hvap?
A. The change in the disorder of a system when a liquid changes to a
gas
B. The change in the disorder of a system when a molecule forms
from its atoms
C. The energy needed to raise the temperature of a liquid to the
boiling point
D. The energy needed to change a liquid into a gas
Answers
Answer: D. The energy needed to change a liquid into a gas
The percent by mass of Ca in CaCl2 is equal to
1. (40/111) x 100
2. (111/40) x 100
3. (3/1) x 100
4. (1/3) x 100
Answers
Answer:
(40/111)×100Here is a bonus Answer✍️✍️Percent composition by elementElement Symbol Mass PercentChlorine Cl 63.888%Calcium Ca 36.112Mass percentage does not have any unit as numerator and denominator contains the same unit. The percent by mass of Ca in CaCl\(_2\) is equal to (40/111) x 100. The correct option is option A.
What is percentage by mass?Mass percentage represents the the percentage of each element that is making a particular compound.
Mathematically,
Percentage of mass = (component’s mass ÷ total mass) x 100%
Atomic weight of different element of calcium chloride{ CaCl\(_2\)} are
Ca = 40 ; Cl = 35
Total mass of Calcium element in calcium chloride = 40g/mol
Total mass of Chlorine atom in calcium chloride = 35× 2= 71g/mol
Total molar mass of calcium phosphate = 40 +71= 111g/mole
Percentage of calcium in calcium chloride =40÷111 = 36%
Therefore, the percent by mass of Ca in CaCl2 is equal to (40/111) x 100. The correct option is option A.
To learn more about mass percentage, here:
https://brainly.com/question/27429978
#SPJ2
first response gets brainliest
Answers
Uh yah I’ll give you the crown thingy! And extra points:)
Answers
has many layers
formed from material that was eroded
includes fine particles of sand
a student performs a gravimetric analysis experiment and is given 1.94 g 1.94 g of a contaminated mixture containing anhydrous magnesium chloride and potassium nitrate. to determine the percentage by mass of magnesium chloride in the mixture, excess silver nitrate is added to the mixture to precipitate the chloride ion as silver chloride. the mass of the silver chloride precipitate is found to be 1.43 g 1.43 g. which of the following is the mass percent of magnesium chloride in this sample?
a.25%
b.24%
c. 47%
d. 74%
Answers
The only material that will precipitate is silver nitrate. Silver chloride will precipitate as a result of the reaction between magnesium chloride and silver nitrate. 1.94 g 1.94 g of a contaminated combination including anhydrous potassium magnesium chloride and magnesium chloride is supplied to the subject of a gravimetric analysis experiment.
What is anhydrous magnesium?
The student uses extra AgNO3(aq) to precipitate the chloride ion as AgCl to determine the mixture's proportion by mass of MgCl2 (s). To ascertain the sodium chloride content, a gravimetric study is conducted. The ratio of magnesium chloride to silver nitrate is 1:2, meaning that a mineral water should use a minimum of two moles of silver nitrate while precipitating the chloride ions as silver chloride. Using gravimetric analysis, a student wants to ascertain the percentage of mass.
To learn more about potassium nitrate from given link
brainly.com/question/15080595
#SPJ4
Quicklime, CaO, is an important substance used in making mortar. What kind of bonds are present in this compound?
Answers
Answer:
Ionic bond
Explanation:
The main component of quicklime is calcium oxide, whose chemical formula is CaO.
Ca is a metal with 2 electrons in its valence shell.
O is a nonmetal with 6 electrons in its valence shell.
Ca and O form a ionic bond, in which Ca loses 2 electrons and O wins 2 electrons, so that both obey the octet rule.
Help me I'm desperate :( no links or u will be reported
Answers
Answer:
Here is the answer from somewhere in the internet
A weak monoprotic acid is titrated with 0.100 MNaOH. It requires 50.0 mL of the NaOH solution to reach the equivalence point. After 25.0 mL of base is added, the pH of the solution is 3.52.
Estimate the pKa of the weak acid.
Express your answer using three significant figures.
Answers
pKa value =4.76Ka
=1.73×10 −5 !! PH=4−PKa=14−4.76=9.24 for a weak monoprotic acid is titrated with 0.100 M NaOH. It requires 50.0 mL of the NaOH solution to reach the equivalence point. After 25.0 mL of the base is added, the pH of the solution is 3.52.
One way to describe an acid's potency is by its pKa value. The acid dissociation constant, or pKa, is the negative log of the pKa value. A stronger acid is indicated by a lower pKa value. In other words, a lower value means that the acid dissociates in water more completely.
The logarithm of Ka's negative value is denoted as pKa. The logarithmic inverse of the H+ concentration is pH. Acidity indication. An acid's pKa value tells you if it's a strong acid or a weak acid. The pH scale shows how acidic or alkaline a system is.
To learn more about pka value please visit-
https://brainly.com/question/13178964
#SPJ1
A rook is dropped into a graduated cylinder filled with 35 mL of water.
What is the volume of the rock? (Hint: 1 ml water = 1 cm?)
40 cm
O 14 cm
O 5 cm
O 35 cm
Answers
Answer:
5 cm³.
Explanation:
The following data were obtained from the question:
Volume of water = 35 mL
Volume of water + Rock = 40 mL
Volume of rock =.?
The volume of the rock can be obtained as follow:
Volume of rock = (Volume of water + Rock) – (Volume of water)
Volume of rock = 40 – 35
Volume of rock = 5 mL
Finally, we shall convert 5 mL to cm³. This can be obtained as illustrated below:
1 mL = 1 cm³
Therefore,
5 mL = 5 cm³
Thus, the volume of the rock is 5 cm³.