Answer:
A) 3.6 cm
Explanation:
Accuracy comes down to how precisely you can read the length on a given scale. Here since the smallest increment is centimeter, we can go only one decimal beyond to estimate. This is because you can usually estimate to only one decimal place beyond the closest marks on any measuring.
So, the answer should be 3.6 cm.
Here's a document that explains it well: https://www.auburn.wednet.edu/cms/lib03/WA01001938/Centricity/Domain/1360/1_Uncertainty.pdf
Hope that's right!
Simone is helping her mom cook. She takes a glass casserole dish directly from the refrigerator and put it in the oven. Which best explains the result of putting the cold dish in the hot oven?
Group of answer choices
The dish stays cool and will not warm.
The dish quickly changes color.
The dish cracks or breaks.
The dish contracts and shrinks.
Answer:
I think the dish contracts and shrinks
Answer:
The dish cracks or breaks.
Explanation:
When glass changes temperature rapidly, it may undergo thermal shock. This is stress that is produced by a sudden change in temperature.
write two difference between mixture and compound
A compound is the substances that are formed by combining two are more chemical elements. A mixture is a substance created from two or more matter that can be separate with the help of physical methods. Compound substances are always homogeneous in nature.
1 point
A container with nitrogen, oxygen, and hydrogen has a pressure of 10.46
atm. If the pressure of nitrogen is 321 kPa and the pressure of oxygen is
74.0 psi, what is the pressure of hydrogen? *
2.25 atm
18.7 atm
4.90 atm
237 atm
Answer:
2.25 atm
Explanation:
Given data
Pressure of N₂: 321 kPaPressure of O₂: 74.0 psiPressure of H₂: ?Total pressure: 10.46 atmStep 1: Convert the pressure of nitrogen to atm
We will use the relationship 1 atm = 101.325 kPa.
Step 2: Convert the pressure of oxygen to atm
We will use the relationship 1 atm = 14.6959 psi.
Step 3: Calculate the partial pressure of hydrogen
The total pressure is the sum of the partial pressures.
P = pN₂ + pO₂ + pH₂
pH₂ = P - pN₂ - pO₂
pH₂ = 10.46 atm - 3.17 atm - 5.04 atm
pH₂ = 2.25 atm
Answer:
Explanation:
Hello,
IN this case, we can apply the Dalton's law in order to understand the pressure behavior of a mixture as the summation of all the pressures of the compounds in the mixture, in this case, nitrogen, oxygen and hydrogen:
So, since we are asked to compute the pressure of hydrogen, we simply solve for it:
Best regards.
What are all the possible metabolites for the clofibrate structure through metabolism pathways like hydrolysis, alkylation, conjugation, oxidation etc. ?
Clofibrate is a lipid-lowering pharmaceutical that has been utilized to treat hyperlipidemia. Its metabolism system includes different pathways such as hydrolysis, oxidation, conjugation, and others.
What are a few potential metabolites of clofibrate?Metabolites are little molecules that are produced during the process of metabolism in living living beings.
Clofibrate hydrolysis metabolite:
2-(4-Chlorophenoxy)-2-methylpropanoic acid (phenoxyisobutyric acid)Clofibrate oxidation metabolites:
4-Chlorophenylacetic acid4-Chlorobenzaldehyde4-Chlorophenylacetyl-CoAClofibrate alkylation metabolites:
No specific alkylation metabolites have been widely reported for clofibrate.Clofibrate conjugation metabolites:
Glucuronide conjugatesSulfate conjugatesConclusively, the relative abundance and significance of each metabolite can vary among individuals.
Learn more about metabolites
https://brainly.com/question/14422941
#SPJ1
Why do molecules move?
Answer:
Constant temperature variations
Explanation:
With temperature constantly heating many molecules within many forms of matter tend to move around. Take air for instance and density. When air is hot the molecules are moving very quickly because they are being what is known as energized (I don't know the scientific word I apologize.) However, when air is cold it tends to get harder to breath and that is because the air is more dense, since the molecules are atoms are much more compacted.
To further detail the process of cooling and heating up matter, water when it is cooled it tends to become ice; a solid based structure. Therefore, making it more dense or more compacted together. However, once heated the molecules begin to spread apart, in which the density lessens and the molecules become a liquid state or a gas state (depending on the amount of heat applied in terms of kelvin.)
does germanium combine easily with other elements?
Answer:
Yes it does
Explanation:
it does because that’s correct and don’t erase my post again brainly
I need to mark the steepest areas.
The hilltops and the steepest point of a slope are found in the highest and most closely-spaced contour lines on the map.
What are contour lines?Contour lines are lines on a map that connect points of equal elevation. Each contour line represents a specific elevation, and the spacing between contour lines represents the slope of the terrain.
The closer the contour lines are to each other, the steeper the slope. The hilltops are found where the contour lines form a closed circle or oval shape. The steepest point of a slope is found where the contour lines are closest together, indicating the highest rate of change in elevation.
Learn more about contour lines at: https://brainly.com/question/13088900
#SPJ1
what happens to the amount of energy in the air of ChristChurch and El nino years
Answer:
I t transfers from the ocean to the air, however the current is not as warm so less energy will transfer from the current to the air making ChrisstChurch cooler than usual.
In a protein molecule, the number of amino acid molecules may be as few as
5
5,000
500
50
In a protein molecule, the number of amino acid molecules may be as few as d. 50.
Proteins are large macromolecules composed of chains of amino acids. These amino acids are linked together through peptide bonds to form the primary structure of a protein. The number of amino acids present in a protein molecule can vary greatly and depends on the specific protein.
Proteins can range in size from small peptides composed of just a few amino acids to large complex proteins containing thousands of amino acids. The minimum number of amino acids required for a protein to be considered functional is typically around 50. This is because proteins need a certain length and structural complexity to carry out their specific functions.
Proteins play vital roles in living organisms and are involved in various biological processes such as enzyme catalysis, cell signaling, structural support, and immune response. The specific number and sequence of amino acids in a protein molecule determine its unique structure and function.
Therefore, while some proteins may consist of as few as 50 amino acids, larger and more complex proteins can contain thousands of amino acids, enabling them to perform intricate and diverse functions within living systems. Therefore, Option D is correct.
The question was incomplete. find the full content below:
In a protein molecule, the number of amino acid molecules may be as few as
a. 5
b. 5,000
c. 500
d. 50
Know more about amino acid here:
https://brainly.com/question/14351754
#SPJ8
What is the calibration of this graduated cylinder? calibration
A. 5 mL
B. 2 mL
C. 1 mL
D. 10 mL
The answer is 1ml. The answer is 1ml because of calibration of this graduated cylinder
Answer:
1 mL
Explanation:
According to your definition, it is the difference between marked spaces divided by the # of spaces between marked values.
Difference between 2 marked values: 5 mL
# Of Spaces between marked values: 5
Calibration: 5 mL / 5 mL = 1 mL
1
How many valance electrons are in the atom of potassium (K) below?
K
A. 2
B. 8
C. 1
D. 4
Answer:
The answer would be C. 1.
What medal has the highest volume?
The Medal of Honor is the best navy decoration and highest volume.
The President of the USA The Victoria go is the holy grail for Medal of Honor creditors because there are the best in lifestyles. Bearing the inscription For valor and called a VC, this medal turned into first offered for conspicuous bravery' in 1856 and later backdated to the Crimean conflict of 1854. The outstanding service pass is the second maximum army ornament that may be provided to a member of the American military, for intense gallantry and risk of lifestyle in actual combat with an armed enemy force.
The Bronze Star Medal dates lower back to world battle II. these days, it is the fourth-maximum ranking award a provider member can obtain for a heroic and meritorious deed performed in an armed battle. For individuals who acquire the BSM, it's far a sign of their sacrifice, bravery, and honor at the same time as serving their us of a
Learn more about medals here:-https://brainly.com/question/17634999
#SPJ9
Aluminum undergoes a single-displacement reaction with copper (II) sulfate to form aluminum sulfate and _______________.
examples of hazardous substances include group of answer choices medical waste, manure, and ozone. fertilizer, green manure, and sediment. ddt, hiv, and organic soaps. arsenic, lead, mercury, and chloroform.
Arsenic, lead, mercury and chloroform are examples of hazardous substances. These are heavy metals which attach to your cells that thwart your organs from accomplishing their job.
What are the sources of lead, arsenic and mercury?Lead, mercury and arsenic are widely scattered in the environment. Grown-ups are mostly exposed to these contaminants in the workplace. Children can be exposed to poisonous metals from multiple sources, including contaminated air, soil, water and food.
Is arsenic poisonous?Arsenic is highly poisonous in its inorganic form. Contaminated water which is used for drinking, in preparation of food and irrigation of crops have the greatest threat to public health. Long-term consumption of arsenic can cause skin lesions and cancer.
To know more about cancer, visit here:
https://brainly.com/question/8590464
#SPJ4
What is an amu?
Will give Brainliest!
Answer: Amu is an atomic mass unit.
Predict and explain the structure of the major and minor products when hydrogen bromide is added to 2-methylbut-2- ene, (Ch3)2CCHCH3
Pls help with homework!!!!
When hydrogen bromide (HBr) is added to 2-methylbut-2-ene ((CH3)2CCHCH3), an electrophilic addition reaction takes place, where the π bond of the alkene is broken, and the hydrogen and bromine atoms are added to the resulting carbocation.
The reaction proceeds through a Markovnikov addition, where the hydrogen atom attaches to the carbon atom with the greater number of hydrogen atoms.
In this case, the initial addition of HBr to 2-methylbut-2-ene leads to the formation of a primary carbocation, as the positively charged carbon atom only has one alkyl group attached to it. The primary carbocation is relatively unstable, and it can undergo a rearrangement to form a more stable secondary carbocation.
The major product that is typically obtained is the 2-bromo-2-methylbutane. The hydrogen atom from HBr adds to the carbon with three hydrogen atoms (the more substituted carbon), resulting in the formation of a secondary carbocation.
On the other hand, a minor product is also formed, which is 3-bromo-2-methylbutane. This product arises from the addition of HBr to the primary carbocation, which is less stable. Although the primary carbocation is less favored, it can still be formed and lead to the formation of the minor product.
In summary, the addition of HBr to 2-methylbut-2-ene yields two products: the major product is 2-bromo-2-methylbutane, resulting from the addition of HBr to the more stable secondary carbocation, and the minor product is 3-bromo-2-methylbutane, originating from the less stable primary carbocation.
For more such questions on electrophilic addition visit:
https://brainly.com/question/9643304
#SPJ8
What is the concentration, in m/m%, of a solution prepared from 30.0 g NaCl and 140.0 g of water?
The concentration in m/m% of the given solution is 17.65%.
What is mass by m/m % concentration?
m/m % concentration is the total amount of the solute present for every 100g of the solution it is dissolved in.
The given solution contains 30.0g NaCl which is a solute dissolved in 140.0g of water which is the solvent. The m/m % has to be calculated. The total mass of the given solution can be calculated as,
Mass of solution = 140.0g + 30.0g = 170.0g
So, 30.0 g of solute is present in 170.0g of the solution. The amount of solute present in 100.0 g of the solution is,
100 x 30 / 170 = 17.65% of NaCl.
Therefore, the m/m % concentration of the given solution is 17.65%.
To learn more about m/m % concentration click on the given link https://brainly.com/question/18761928
#SPJ1
Match one graph shown at right to each of the gas laws named below.
Charles's law: a, c, d, e (b is incorrect)
Gay-Lussac’s law: a, b, d, e (c is incorrect)
Boyle’s law: b, c, d, e (a is incorrect)
Answer:
DBE
Explanation:
Cause I got it right
The correct options for Charles's law, Gay-Lussac's Law and Boyle's law are D, B and E respectively.
Charles's law states that, under the assumption of constant pressure, the volume of a gas increases or decreases with its temperature. As the temperature increases, the gas molecules move more quickly and occupy more space, increasing the volume of the gas.
Gay-Lussac's law states that, assuming a constant volume, the pressure and temperature of a gas are exactly related. Increasing temperature causes the gas molecules to become more kinetically energetic and collide with the walls of the container more frequently, increasing the pressure.
Boyle's law states that at a given temperature, the pressure and volume of a gas are inversely proportional. The reduced volume forces the gas molecules into a smaller area, increasing the chance of collisions with the container walls and pressure.
Therefore, the correct options for Charles's law, Gay-Lussac's Law and Boyle's law are D, B and E respectively.
Learn more about Boyle's law, here:
https://brainly.com/question/21184611
#SPJ2
Based on a specific example of titration method. How do titration methods play a role in agriculture industry?
Answer:
Titration is an analytical technique that is widely used in the food industry. It allows food manufacturers to determine the quantity of a reactant in a sample. For example, it can be used to discover the amount of salt or sugar in a product or the concentration of vitamin C or E, which has an effect on product colour.
Answer:
How is titration used in the industry?
Titration is an analytical technique that is widely used in the food industry. It allows food manufacturers to determine the quantity of a reactant in a sample. For example, it can be used to discover the amount of salt or sugar in a product or the concentration of vitamin C or E, which has an effect on product colour.
2 examples of metal’s catalytic reaction
Answer:
Example 1
palladium(II) nitrate,
Example 2
Metal catalysts such as Fe, Ni, Mo, and Co are routinely used in the manufacture of CNMs.
Explanation
The three metals used in catalytic converters — rhodium, platinum and palladium — are part of a category known as platinum group metals, or PGMs, which are known for their catalytic properties.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What is the Compound formula for K+ and O2-
Answer:
k20
Explanation:
potassium oxide
hope this helped
you design an experiment to test the effect of adding different amounts of ice (grams) to a given volume of water.
For each trial you record the initial temperature of the water and then the final temperature after the ice was added.
In this experiment, the amount of ice is the
variable, and the temperature change is the
variable.
Answer:
In this experiment, the amount of ice is the independent variable, and the temperature change is the dependent variable.
The chemical reaction between iron (Fe) and oxygen (O) results in the loss of electrons from iron. This reaction is an example of _____.
A) respiration
B) sublimation
C) oxidation
D) combustion
Answer:
d combustion because iron and oxegen need eachother
Answer:
The Correct answer would be Oxidation.
Explanation:
Which graph shows the volume-amount of gas relationship expected for an ideal gas, also known as Avogadro's
law?
A. Graph C
B. Graph A
C. Graph B
D. Graph D
Ideal gas law is valid only for ideal gas not for vanderwaal gas. Among all the given graph, the only graph that is representing Avogadro's law is graph B.
What is ideal gas equation?Ideal gas equation is the mathematical expression that relates pressure volume and temperature.
Mathematically,
PV=nRT
where,
P = pressure of ideal gas
V= volume of ideal gas
n =number of moles of ideal gas
T =temperature of ideal gas
R = Gas constant = 0.0821 L.atm/K.mol
Avogadro's law is a law which states that equal volumes of gases at the same temperature and pressure contain equal numbers of molecules. Among all the given graph, the only graph that is representing Avogadro's law is graph B.
Therefore, the correct option is option B.
To learn more about ideal gas equation, here:
https://brainly.com/question/14826347
#SPJ2
A 7.96 gram sample of silver reacts with oxygen to form 8.55 gram of the metal oxide. What is the formula of the oxide?
When 7.96 g of Silver (Ag) reacts with Oxygen (O) then a metal oxide is formed, the formula of the oxide is Ag₂O (Silver Oxide). Cationic Metal react with anionic oxygen to produce metal oxides.
How to calculate the empirical formula?Metal oxides are the chemical compounds formed by the reaction of oxygen and metals.
For the given metal oxide,
Mass of silver = 7.96 g
Mass of metal oxide = 8.55 g
To find out the number of moles of Ag and O in metal oxide,
Number of moles = mass/molar mass
Moles of Ag = 7.96g/107.87 g.mole⁻¹
(molecular mass of Ag = 107.87g.mole⁻¹)
Moles of Ag = 0.074 mole
Mass of oxygen is not given in the question.
To calculate the mass of oxygen
Mass of O = mass of metal oxide - mass of Ag
mass of O = 8.55 g - 7.96 g
mass of O = 0.59 g
Moles of O = 0.59 g / 16.00 g.mole⁻¹ (molecular mass of O = 16g.mole⁻¹)
Moles of O = 0.037 mol
The mole ratio can be calculated by dividing with the element with lesser number of moles
Ag : O
0.074/0.037 : 0.037/0.037
The ratio is 2:1
So, the empirical formula of the metal oxide formed by the reaction of metal with oxygen is Ag₂O.
Learn more about metal oxides here:
https://brainly.com/question/28710614
#SPJ1
The following half-reaction method is used to balance oxidation-reduction equations.
(1) Determine which atoms change oxidation state from reactant to product in the reaction.
(2) Identify and write half reactions (oxidation and reduction).
(3) Return to the original chemical equation to balance it.
(a) Insert the coefficients from the half reactions first.
(b) Inspect the number of each atom on each side for all elements.
Which important step is missing from this procedure?
Check other reactions similar to this one.
Name the elements that are involved in the reaction.
Make sure the reduction half reaction is identified first.
Balance the half reactions based on the number of electrons.
Answer:
its (D) Balance the half reactions based on the number of electrons.
Explanation:
Answer:
D ✔️
Explanation:
"Balance the half reactions based on the number of electrons."
PLS HELP ME WITH MY CHEMISTRY
Answer:
Explanation:
Given:
Mass of sample= 39.2 g
Volume occupied= 4.4 cm³
To find:
Density=?
Solution:
Formula to be used,
The rounder figure answer upto tenths place can be written as 8.9 g/cm³
A 9.38 gram sample of a compound is dissolved in 250.0 grams of benzene. The freezing point of this solution is 1.02 ˚C below that of pure benzene. What is the molar mass of this compound? Kf for benzene is 5.12 ˚C/m and you may assume i = 1.
Answer:
THE MOLAR MASS OF THE COMPOUND IS 45.31 G/MOL.
Explanation:
Using the formula;
Change in freezing point Δt = i Kf m
where;
i = Van Hoff constant = 1
Kf = freezing point dissociation constant = 5.12 °C /m
M = molarity = unknown
The freezing point of benzene = 5.444°C
Temperature of the final solution = 1.02°C
First is to calculate the change in the temperature
= Temperature of benzene - temperature of the solution
= 5.444 - 1.02
= 4.424 °C
Next is the use the above formula to solve for the molarity
Δt = i Kf m
4.244 = 1 * 5.12 * m / 0.250 kg of benzene
We have to divide the molarity by the mass of benzene used since it was not 1 kg if benzene that was used.
So therefore,
4.244 = 20.48 * m
m = 4.244 / 20.48
m = 0.207 mol.
Next is to calculate the molar mass of the compound:
Molarity = mass / molar mass
Molar mass = mass/ molarity
Molar mass = 9.38 g / 0.207 mol
Molar mass = 45.31 g /mol
The molar mass of the compound is 45.31 g/mol.
the object in question 1 has a mass of 21.535g. what metal is the cylinder most likely made of? why? pls help asap!!
Answer:
Aluminium
Explanation:
From the question given above, the following data were obtained:
Diameter (d) = 1.25 cm
Height (h) = 6.48 cm
Volume (V) of cylindrical=.?
Mass (m) of cylindrical object = 21.535 g
Density of the cylindrical object =..?
Next, we shall determine the radius of the cylindrical object. This is illustrated below:
Diameter (d) = 1.25 cm
Radius (r) =?
r = d/2
r = 1.25/2
Radius (r) = 0.625 cm
Next, we shall determine the volume of the cylindrical object. This can be obtained as follow:
Height (h) = 6.48 cm
Radius (r) = 0.625 cm
Pi (π) = 3.14
Volume (V) of cylindrical=.?
V = πr²h
V = 3.14 × 0.625² × 6.48
V = 7.948 cm³
Recall:
1 cm³ = 1 mL
Therefore
7.948 cm³ = 7.948 mL
Thus, the volume of the cylindrical object is 7.948 mL
Finally, we shall determine the metal in which the cylindrical object is made up of by calculating the density of the cylindrical object. This can be obtained as follow:
Mass (m) of cylindrical object = 21.535 g
Volume of the cylindrical object = 7.948 mL
Density of cylindrical object =?
Density = mass /volume
Density = 21.535 / 7.948
Density of cylindrical object = 2.7 g/mL
Comparing the density of the cylindrical object (i.e 2.7 g/mL) with those given in the table in the question, the cylindrical object is made of aluminium since they have the same density.