Answers
liquid matter is always moving at a pretty medium speed, molecules sliding by each other, has an indefinite shape
gas matter is always moving pretty fast pace, has an indefinite shape, and the molecules bounce off one another
Liquid state: Water, milk, gasoline.
Solid state: Ice cubes, a chair, table.
Gas state: steam, nitrogen, oxygen.
Related Questions
The diagram shows the setup of an experiment. A few observations of the experiment are listed in table below the diagram.
Experimental Observations
Description
1. Color of solution turned blue
2. Shiny hair like crystals deposited on the copper strip
Which of the following is the correct explanation for one of the given observations?
Observation 1 is a result of silver ions moving into the solution.
Observation 2 is a result of nitrate ions moving into the solution.
Observation 1 is a result of silver ions changing their oxidation state.
Observation 2 is a result of silver ions changing their oxidation state.
Answers
The proper explanations to the observation are;
Observation 1 is a result of silver ions changing their oxidation state.Observation 2 is a result of silver ions changing their oxidation state.What is a redox reaction?A redox reaction is one in which a specie is oxidized while the other specie is reduced. In the first observation, the color of the solution turned blue and in the second observation, shiny hair like crystals deposited on the copper strip.
Hence;
Observation 1 is a result of silver ions changing their oxidation state.Observation 2 is a result of silver ions changing their oxidation state.Learn more about redox reaction:https://brainly.com/question/13293425
#SPJ1
A sample of fluorine gas occupies 410 ml at 206 K and 2 atm. What volume does the gas occupy when the pressure is doubled, and the temperature increases to 500 K?
Answers
When the pressure is doubled and the temperature increases to 500 K, the volume of the fluorine gas is approximately 497 mL.
To determine the volume of fluorine gas when the pressure is doubled and the temperature increases, we can use the combined gas law. The combined gas law equation relates the initial and final states of a gas under different conditions. It can be written as:
(P1 × V1) / (T1) = (P2 × V2) / (T2)
Given:
P1 = 2 atm
V1 = 410 mL
T1 = 206 K
P2 = 2 atm × 2 = 4 atm (pressure is doubled)
T2 = 500 K (temperature increases)
We need to find V2, the final volume.
Substituting the given values into the combined gas law equation, we have:
(2 atm × 410 mL) / (206 K) = (4 atm × V2) / (500 K)
Cross-multiplying and simplifying the equation, we get:
(2 atm × 410 mL × 500 K) = (4 atm × V2 × 206 K)
Now, we can solve for V2:
V2 = (2 atm × 410 mL × 500 K) / (4 atm × 206 K)
V2 ≈ 497 mL
Therefore, when the pressure is doubled and the temperature increases to 500 K, the volume of the fluorine gas is approximately 497 mL.
It's important to note that we assumed the gas behaves ideally and followed the combined gas law equation. In reality, deviations from ideal gas behavior can occur at high pressures or low temperatures, so the calculated value is an approximation based on the ideal gas law..
For more such questions on fluorine
https://brainly.com/question/15045637
#SPJ11
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answers
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Use relative differences in electronegativity to label the ends of the polar molecules feted as partially positive or partially negative. a. HF b. HBr c. NO d. CO
Answers
Labeling of the ends of the polar molecules feted as partially positive or partially negative are:
a. The difference in electronegativity between H and F is relatively high (around 1.9), so the bond is quite polar. F is more electronegative than H, so the fluorine end is partially negative and the hydrogen end is partially positive.
b. The difference in electronegativity between H and Br is moderate (around 0.7), so the bond is somewhat polar. Br is more electronegative than H, so the bromine end is partially negative and the hydrogen end is partially positive.
c. The difference in electronegativity between N and O is relatively small (around 0.5), so the bond is somewhat polar. O is more electronegative than N, so the oxygen end is partially negative and the nitrogen end is partially positive.
d. The difference in electronegativity between C and O is relatively large (around 1.0), so the bond is quite polar. O is more electronegative than C, so the oxygen end is partially negative and the carbon end is partially positive.
To know more about polar molecule here
https://brainly.com/question/29976693
#SPJ4
Which statement accurately describes a type of potential energy found in a container full of a chemical substance in liquid form?
A) The rotation of the particles in one place where potential energy is stored.
B) The vibration of the atoms in molecules is one place where potential energy is stored.
C) The bonds between atoms are one place where potential energy is stored.
D) The speed of the particles is one place where potential energy is stored
Answers
Answer:
The bonds between atoms are one place where potential energy is stored.
PLEASEEEE i need help !!
Answers
Answer:
Look below the picture
Explanation:
HELP!!!!!! PLEASE!!!
Answers
Answer:
C
Explanation:
sorry if im wrong!!
Critically discuss the refusal/unwillingness of some individuals to answer questions to put them by authorized Stats SA officials
Answers
People refuse to answer questions from authorized Stats SA officials because they don't want to reveal confidential information.
What does official stats refer to?An official Stats is an official who has the function of asking citizens for different information in order to establish general statistics for all citizens.
Why don't people answer your questions?Some people refuse to answer questions out of mistrust, because they don't want to share personal information.
Learn more about personal information in: https://brainly.com/question/451424
#SPJ1
7.0 x 10 -3 mol of I2 in 100.00ml of solution
Answers
Given:
- Moles of I2: 7.0 x 10^(-3) mol
- Volume of solution: 100.00 mL (which is equal to 0.1000 L)
Molarity (M) = Moles of solute / Volume of solution in liters
Molarity = (7.0 x 10^(-3) mol) / (0.1000 L)
Molarity = 0.070 M
Therefore, the concentration of the I2 solution is 0.070 M.
A cook had a jar containing a sweet food and a jar containing a sour food. The image above shows the sweet and sour foods. At room temperature, both foods are liquids. The same amount of energy was transferred into both substances. Later, one of the foods had changed phase while the other had not. Which food changed phase, and how did it change? PLEASE ANSWER ASAP
Answers
Answer: One of the foods was sour and one was sweet
Explanation:
The sweet one has changed because it has more sugar then the sour one, It either got moldy or melted.
2. Which line on the graph represents the relationship
between pressure and temperature of gas?
a. Line A
b. Line B
C. Line C
Explain why you chose your answer:
Answers
Answer:
Line A
Explanation:
In consideration of Charles's law of gases, temperature is directly proportional to pressure of the gas.
Sometimes a simple incident in our lives can actually have a deeper meaning and impact on us than might be apparent at the time. Write a reflective narrative about a memorable experience in your life.
Answers
I remember the day when I was walking to the grocery store and saw an elderly woman sitting on the sidewalk with her cart. She looked tired and was trying to catch her breath. At first, I walked past her, not wanting to get involved. But then something made me stop and turn around. I approached her and asked if she needed any help. She told me that she had been walking for a while and needed to rest for a bit. I helped her sit down on a nearby bench, and we started talking.
As we talked, I learned that her name was Mary, and she had lived in the neighborhood for over 50 years. She shared stories of her life and her struggles, and I listened with empathy. I could see the gratitude in her eyes, and it made me realize the power of human connection.
That experience taught me that we should never underestimate the impact of a simple act of kindness. It made me more aware of the people around me and more willing to help others in need. It also showed me the importance of empathy and how it can make a difference in someone's life.
Looking back, that moment was a turning point for me. It made me more compassionate and more aware of the needs of others. It showedme that a small gesture of kindness can have a ripple effect and make a big difference in someone's life. It also reminded me that we all have our own stories and struggles, and sometimes all we need is someone to listen and show us a little empathy.
Since that day, I have made it a point to be more aware of the people around me and to offer help whenever I can. Whether it's holding the door open for someone or offering a listening ear, I try to be more present and empathetic in my interactions with others.
That experience also taught me the importance of slowing down and taking the time to connect with people. In our fast-paced world, it's easy to get caught up in our own lives and forget about those around us. But by taking the time to connect with others, we can create meaningful relationships and make a positive impact in the world.
Overall, that simple encounter with Mary taught me a valuable lesson about the power of empathy and human connection. It's a lesson that I will always carry with me and strive to live by in my daily life.
In English, you're asked to write a reflective narrative about a life event with a deeper impact than initially visible. Describe the event, your reaction, its deeper meaning, and how it shaped you.
Explanation:This question pertains to reflective writing, a style typically used in English subject coursework. The task is about developing a narrative based on a memorable experience in your life that had a deeper impact than initially visible. Begin by selecting an event, which while appearing simple, had profound implications in retrospect. Describe the event in detail (who, what, where, when), discussing your personal reaction at the time. Then, explain its deeper meaning or the impact it had on you. Drawing conclusions about how this event shaped your perspectives or behaviours would constitute the reflective element of your narrative.
Learn more about Reflective Narrative here:https://brainly.com/question/33018651
#SPJ2
Identifying Qualitative and quantitative Data
Sort the data collected about a colony of bacteria into qualitative or quantitative data.
spreads across plate
Qualitative Data
Qua
200 purple colonies total
circular in shape
stained purple
75 colonies did not stain purple
55 colonies grew at room temp
Answers
Answer:
qualitative data : quantitative data :
circular in shape 75 colonies ...
stained purple 200 purple ..
spreads across plate 55 colonies ...
Explanation:
i got it right :) .
Answer:
Same XD Have a bless day ^﹏^^O^^O^^O^
Explanation:
following this list of common polyatomic ions what would be the charge for aluminum nitrate?
Nitrate NO3
Phosphate PO43,
Sulfate SO4 -2
acetate C2H3O2-1
Ammonium NH4.
Chromate CrO4-2
Carbonate C03-2
Dichromate CrO7-2
Permanganate MnO4-1
What would be the correct answer for Aluminum nitrate
Answers
Answer:
Nitrate NO3
here's your answer, hope it helps you
Which of the following statements regarding energy is FALSE?
Energy is defined as the capacity to do work, or to put matter into motion
The products of exergonic reactions contain more potential energy than the reactants that form them
Increasing the temperature of atoms and molecules increases their kinetic energy
Exchange reactions allow chemical energy from one molecule to be transferred to another
Answers
Answer:
The correct answer is The products of exergonic reactions contain more potential energy than the reactants that form them.
Explanation:
It is considered false since the products in exothermic reactions have less energy than their reactants, since being exothermic they release energy in the form of heat to the environment that surrounds them.
An exothermic reaction gives energy to the environment that surrounds it at the end of the reaction, that is why the energy of the reactants will ALWAYS be greater than the final energy of the products, since as the reaction occurs, it loses energy and do not win.
The disorder and entropy in these reactions increases, complete combustion would be a clear example of exothermic reactions and their release of energy in the form of heat.
Exothermic reactions can be reversible or irreversible like all reactions.
PLEASE HELP QUICKK
Calculate the energy of combustion for one mole of butane if burning a 0.367 g sample of butane (C4H10) has increased the temperature of a bomb calorimeter by 7.73 °C. The heat capacity of the bomb calorimeter is 2.36 kJ/ °C.
Answers
The energy of combustion for one mole of butane to be approximately 2888.81 kJ/mol.
To calculate the energy of combustion for one mole of butane (C4H10), we need to use the information provided and apply the principle of calorimetry.
First, we need to convert the mass of the butane sample from grams to moles. The molar mass of butane (C4H10) can be calculated as follows:
C: 12.01 g/mol
H: 1.01 g/mol
Molar mass of C4H10 = (12.01 * 4) + (1.01 * 10) = 58.12 g/mol
Next, we calculate the moles of butane in the sample:
moles of butane = mass of butane sample / molar mass of butane
moles of butane = 0.367 g / 58.12 g/mol ≈ 0.00631 mol
Now, we can calculate the heat released by the combustion of the butane sample using the equation:
q = C * ΔT
where q is the heat released, C is the heat capacity of the calorimeter, and ΔT is the change in temperature.
Given that the heat capacity of the bomb calorimeter is 2.36 kJ/°C and the change in temperature is 7.73 °C, we can substitute these values into the equation:
q = (2.36 kJ/°C) * 7.73 °C = 18.2078 kJ
Since the heat released by the combustion of the butane sample is equal to the heat absorbed by the calorimeter, we can equate this value to the energy of combustion for one mole of butane.
Energy of combustion for one mole of butane = q / moles of butane
Energy of combustion for one mole of butane = 18.2078 kJ / 0.00631 mol ≈ 2888.81 kJ/mol
Therefore, the energy of combustion for one mole of butane is approximately 2888.81 kJ/mol.
In conclusion, by applying the principles of calorimetry and using the given data, we have calculated the energy of combustion for one mole of butane to be approximately 2888.81 kJ/mol.
For more questions on molar mass, click on:
https://brainly.com/question/837939
#SPJ8
Choose the substance with the highest surface tension.
a. CH3CH2OH
b. CH3CH2Cl
c. CH3CH2CH3
d. CH2Br2
e. HOCH2CH2OH
Answers
Answer:
Hello
you're answer should be E.HOCH2CH2OH
hope this answer is correct
The substance with the highest surface tension - e. HOCH2CH2OH.
Surface tension is the elastic tendency of a fluid, caused by the attraction of particles in the surface which makes it acquire the least surface area.
it depends on intermolecular forces like hydrogen bonding, Vanderwall forces, ion-dipole, and ion-induced dipole interactions.The higher the intermolecular forces higher will be the surface tension.Among all these intermolecular forces, hydrogen bonding is the strongest.So from given options (a) and (e) have -OH functional group and forms H-bonding.Among these two options, option (e) has 2-OH groups so (e) will have more extensive H-bonding.Thus, The substance with the highest surface tension - e. HOCH2CH2OH.
Learn more:
https://brainly.com/question/277477
A mixture of hydrogen (2.02 g) and chlorine (35.90 g) in a container at 300 K has a total gas pressure of 748 mm Hg. What is the partial atmospheric pressure (atm) of hydrogen in the mixture?
Answers
The partial atmospheric pressure (atm) of hydrogen in the mixture is 0.59 atm.
How do we calculate the partial pressure of gas?Partial pressure of particular gas will be calculated as:
p = nP, where
P = total pressure = 748 mmHgn is the mole fraction which can be calculated as:n = moles of gas / total moles of gasMoles will be calculated as:
n = W/M, whereW = given massM = molar massMoles of Hydrogen gas = 2.02g / 2.014g/mol = 1 mole
Moles of Chlorine gas = 35.90g / 70.9g/mol = 0.5 mole
Mole fraction of hydrogen = 1 / (1+0.5) = 0.6
Partial pressure of hydrogen = (0.6)(748) = 448.8 mmHg = 0.59 atm
Hence, required partial atmospheric pressure of hydrogen is 0.59 atm.
To know more about partial pressure, visit the below link:
https://brainly.com/question/15302032
#SPJ1
Insoluble sulfide compounds are generally black in color. Which of the following combinations could yield a black precipitate? a) Na2S(aq) + KCl(aq) b) Li2S(aq) + Pb(N03)2(aq) c) Pb(C103)2(aq) + NaNO3(aq) d) AgNo3(aq) + KCl(aq) e) K2S(aq) + Sn(N03)4(aq)
Answers
Answer:
b) Li2S(aq)+Pb(NO3)2(aq)
e) K2S(aq)+Sn(NO3)4(aq)
Explanation:
they are the only two of the options that contain a sulfide ion (S) therefore they are the only ones that could be considered in the question.
b) Li2S(aq)+Pb(NO3)2(aq)
e) K2S(aq)+Sn(NO3)4(aq)
how many electrons inter in to the 3d sub-shell of an atom whose atomic number is 22
Answers
The number of electrons that enter the 3d subshell of an atom whose atomic number is 22 is 2.
Why are there two electrons in the 3d subshell ?An atom with an atomic number of 22 is Titanium. It is a strong, lightweight metal that is resistant to corrosion and is used in a variety of applications, including aircraft, spacecraft, medical implants, and jewelry.
The 3d subshell can hold up to 10 electrons, but Titanium only has 2 electrons in the 3d subshell. This is because the 4s subshell is lower in energy than the 3d subshell, so the electrons are filled in the 4s subshell before they are filled in the 3d subshell.
Find out more on Titanium at https://brainly.com/question/20525872
#SPJ1
Stamples of heterogeneous equilibria. FeO(s) + CO(g) = Fe(s) + CO₂(g) II. H₂(g) L₂(g) = 2HI(g) III. CO₂(g) + C(s) = 2CO(g) IV. N₂(g) 3H₂(g) + 2NH3(g) Identify I.
Answers
An example of heterogeneous equilibrium is:
I. FeO(s) + CO(g) ⇌ Fe(s) + CO₂(g)What is heterogeneous equilibrium?Heterogeneous equilibrium refers to an equilibrium state in a chemical reaction where the reactants and products exist in different physical states or phases. It occurs when substances in different phases, such as solids, liquids, and gases, are involved in a chemical reaction.
Considering the given equations:
The equation I: FeO(s) + CO(g) ⇌ Fe(s) + CO₂(g) represents a heterogeneous equilibrium.
This is because the reactants and products involve different phases (solid and gas). FeO is a solid (s), CO is a gas (g), Fe is a solid (s), and CO₂ is a gas (g). The reaction involves the conversion of a solid and a gas to another solid and a gas, and the equilibrium is established between these different phases.
Learn more about heterogenous equilibrium at: https://brainly.com/question/25257772
#SPJ1
Help guys
Please
Please help me if u know
Answers
A 1.90 g sample of elemental sodium, Na(s) is reacted with water, yielding sodium
hydroxide, NaOH, and hydrogen. 2Na(s) + 2H2O(l)→ 2NaOH(aq) + H2(g); The H2(g) is collected
over water at 18 oC. What are the partial pressures of the two gases (hydrogen and water
vapor) when contained in a 1.00 l container at 25
oC? What is the total pressure?
Answers
The partial pressure of hydrogen is 0.98 atm while the partial pressure of water is 0.02 atm. The total pressure of the system is 1 atm.
What is the pressure?We have seen the reaction as it has been shown in the equation that is attached to the question above. Now, we must have to find the number of moles of the hydrogen that was obtained.
Number of moles of sodium = 1.90 g/23 g/mol = 0.08 moles
2 moles of sodium produces 1 mole of hydrogen
0.08 moles of sodium would produce 0.08 moles * 1 mole/ 2 moles
= 0.04 moles
Given that;
P = pressure
V = volume
n = Number of moles
R = gas constant
T = temperature
PV = nRT
P = nRT/V
P = 0.04 * 0.082 * 298/1
P = 0.98 atm
The partial pressure of the hydrogen = 0.98 atm
The partial pressure of the water = SVP of water at 18°C = 0.02 atm
Total pressure of the system = 0.98 atm + 0.02 atm = 1 atm
The system has a total pressure of 1 atm.
Learn more about partial pressure:https://brainly.com/question/15075781
#SPJ1
A solution that is neutral has a pH of:
0
14
10
1
7
Answers
The chemical formula for magnesium oxide is MgO. A chemist determined by measurements that 0.030 moles of magnesium oxide participate in a chemical reaction. Calculate the mass of magnesium oxide that participates.
Answers
Answer:
1.209g of MgO participates
Explanation:
In this problem, we have 0.030 moles of MgO that participates in a particular reaction.
And we are asked to solve for the mass of MgO that participates, that means, we need to convert moles to grams.
To convert moles to grams we need to use molar mass of the compound:
1 atom of Mg has a molar mass of 24.3g/mol
1 atom of O has a molar mass of 16g/mol
That means molar mass of MgO is 24.3g/mol + 16g/mol = 40.3g/mol
And mass of 0.030 moles of MgO is:
0.030 moles MgO * (40.3g/mol) =
1.209g of MgO participatesWhat is the total number of atoms contained in 3.63 moles of nickel?
Answers
Answer:
Explanation:
1 mole of nickel contains 6.02 * 10^23 atoms
3.63 mols of nickel contain x atoms.
What you have is a proportion. A proportion consists of 2 ratios or 4 parts.
Of the 4 parts, you know three of them. The problem is to solve for the 4th.
1/3.63 = 6.02*10^23 / x Cross multiply
x = 3.63 * 6.02* 10^23 Combine the right.
Answer: x = 2.19*10^24 atoms
Using the periodic table, complete the table to describe each atom. Type in
your answers.
Answers
please enter a image below so I can help.
The equilibrium constant _____________. For an ___________ reaction, heat is a reactant. An increase in temperature and heat favors the ____________ reaction and the value of K c _____________.
Answers
Answer:
The equilibrium constant change. For an endothermic reaction, heat is a reactant. An increase in temperature and heat favors the forward reaction and the value of Kc increases.
Explanation:
Hello.
In this case, regarding reactions in equilibrium in which heat is a reactant as those exemplified by:
\(Heat+Reactants \rightleftharpoons Products\)
We infer that the heat of reaction is positive since the reactants have more energy in their ground state than the products making them endothermic. Moreover, since the Le' Chatelier's principle states that increasing the reaction temperature in endothermic reactions, the forward reaction (towards products) is favored because endothermic reactions absorb heat in the form temperature raise, the required statement is:
The equilibrium constant change. For an endothermic reaction, heat is a reactant. An increase in temperature and heat favors the forward reaction and the value of Kc increases.
Regards.
Answer:
The equilibrium constant increases. For an endothermic reaction heat is a reactant. An increase in temperature and heat favours the forward reaction and the value of KC increases.
Explanation:
describe some acidic oxides that can be prepared by the thermal decomposition of nitrates and carbonates.
Answers
Answer:
nitrogen dioxide and oxygen gas
Explanation:
the compounds are white solids and brown nitrogen dioxide and oxygen gases are also given off when heated.
Question: Why is the liquid oxygen machine producing less liquid oxygen than normal?
Claim1: there is frozen water in tank 2, which is blocking some of the oxygen from coming into tank 3.
Claim2: some of the liquid oxygen evaporated in tank 3.
Claim3: some of the oxygen didn’t condense in tank 2.