Answer:
When the candle is lit and burning, it has kinetic energy.
Explanation:
please smash brainliest on my doorstep
What is the percent of oxygen by mass in C2H402
Answer:
53.3 %.
Explanation: C2H4O2. = 2 * 12.011 + 4 * 1.008 + 2 * 15.999. = 60.052.
PLEASE HELP!!!
I am unsure how to do 6 and 7!
6) Magnitude of the rate of constant is E) 230.
7) The overall order is D) 3.
How to calculate rate constant and order of reaction?To find the rate constant, use the rate law equation for this reaction:
rate = k[ClO₂]²[OH⁻]
Using any of the three experiments to solve for k. Experiment 1:
0.0248 M/s = k(0.060 M)²(0.030 M)
Solving for k:
k = 229.6296 ≈ 230
To determine the overall order of the reaction, add up the exponents in the rate law equation. In this case, the overall order is 2 + 1 = 3.
Learn more on rate constant here: https://brainly.com/question/26127112
#SPJ1
Which group of elements will form molecular compounds? (Choose all that apply)
Answer:
hope you understand and your answer is correct
Radiation that travels across distances in
the form of waves is which of the
following?
A. matter
B. a cell
C. a vacuum
D. energy
Answer:
i think the answer is D. energy
Explanation:
Zeros between nonzero digits are significant
Answer:
Explanation:
If a zero is found between significant digits, it is significant
A student is examining two beakers. Beaker A has 100 grams of zinc (Zn) and Beaker
B has 100 grams of Aluminum (Al). Which beaker contains more atoms?
Beaker A contains more atoms, because Zinc has a higher molar mass.
Beaker B contains more atoms, because Aluminum has a higher molar mass.
Beaker A contains more atoms, because Zinc has a lower molar mass.
Beaker B contains more atoms, because Aluminum has a lower molar mass.
Zinc has a larger molar mass than Copper, hence Beaker A has more atoms.
How can you figure out how much of a material there are in a certain amount of an entity?To determine the number of atoms, ions, or molecules present in any quantity (in moles) of atoms, ions, or molecules, apply the equation N = n NA: 10 helium atoms per mole equals 10 x (6.022 1023) or 6.022 1024 helium atoms.
What makes a mole 6.022 x 10 23?An amount of a pure substance that contains the same number of chemical units (atoms, molecules, etc.) as there are atoms in precisely 12 grams of carbon-12 is said to be a MOLE (mol) (i.e., 6.022 X 1023).
To know more about atoms visit:-
https://brainly.com/question/1566330
#SPJ1
Insoluble sulfide compounds are generally black in color. Which of the following combinations could yield a black precipitate? a) Na2S(aq) + KCl(aq) b) Li2S(aq) + Pb(N03)2(aq) c) Pb(C103)2(aq) + NaNO3(aq) d) AgNo3(aq) + KCl(aq) e) K2S(aq) + Sn(N03)4(aq)
Answer:
b) Li2S(aq)+Pb(NO3)2(aq)
e) K2S(aq)+Sn(NO3)4(aq)
Explanation:
they are the only two of the options that contain a sulfide ion (S) therefore they are the only ones that could be considered in the question.
b) Li2S(aq)+Pb(NO3)2(aq)
e) K2S(aq)+Sn(NO3)4(aq)
The equilibrium constant _____________. For an ___________ reaction, heat is a reactant. An increase in temperature and heat favors the ____________ reaction and the value of K c _____________.
Answer:
The equilibrium constant change. For an endothermic reaction, heat is a reactant. An increase in temperature and heat favors the forward reaction and the value of Kc increases.
Explanation:
Hello.
In this case, regarding reactions in equilibrium in which heat is a reactant as those exemplified by:
\(Heat+Reactants \rightleftharpoons Products\)
We infer that the heat of reaction is positive since the reactants have more energy in their ground state than the products making them endothermic. Moreover, since the Le' Chatelier's principle states that increasing the reaction temperature in endothermic reactions, the forward reaction (towards products) is favored because endothermic reactions absorb heat in the form temperature raise, the required statement is:
The equilibrium constant change. For an endothermic reaction, heat is a reactant. An increase in temperature and heat favors the forward reaction and the value of Kc increases.
Regards.
Answer:
The equilibrium constant increases. For an endothermic reaction heat is a reactant. An increase in temperature and heat favours the forward reaction and the value of KC increases.
Explanation:
The density (in g/cm 3) of a gold nugget that has a volume of 1.68 cm 3 and a mass of 32.4 g is __________.
Answer:
19.29 g/\(cm^{3}\)
Explanation:
Gold nugget - what we know:
Density's formula: (g/\(cm^{3}\))
Gold volume: 1.68 \(cm^{3}\)
Gold mass: 32.4 g
Use the density formula to find the density of the gold nugget:
= (g ÷ \(cm^{3}\))
= (32.4 ÷ 1.68)
= 19.285 g/\(cm^{3}\)
Therefore the gold nugget has a density of 19.29 g/\(cm^{3}\)
Pls answer both of these questions plsss this is due in 4 minutes! Please..
Answer:
2: the guy is welding something 3: its going the change the shape of the object
Explanation:
Calculate the equilibrium constant Kp for this reaction, given the following information (at 295 K ):
2NO(g)+Br2(g)⇌2NOBr(g) Kc=2.1
2NO(g)⇌N2(g)+O2(g) Kc=2.3×1030
The equilibrium constant Kp for this reaction is 1.03×10^(-5) atm.
What is equilibrium constant?
The equilibrium constant, represented by K, is a quantitative measurement of the extent to which a chemical reaction has reached equilibrium. It describes the ratio of the concentrations (or partial pressures) of the products and reactants at equilibrium, with each concentration raised to a power equal to its coefficient in the balanced chemical equation.
We can use the relationship between Kp and Kc to solve this problem:
Kp = Kc(RT)^(Δn)
where R is the gas constant, T is the temperature in Kelvin, and Δn is the change in the number of moles of gas between the products and the reactants.
First, let's find Δn:
Δn = (moles of gas in products) - (moles of gas in reactants)
Δn = (2 moles) - (3 moles)
Δn = -1
Next, we can plug in the values and solve:
Kp = Kc(RT)^(-1)
Kp = (2.1)((0.0821 L·atm/mol·K)(295 K))^(-1)
Kp = 1.03×10^(-5) atm
Therefore, the equilibrium constant Kp for this reaction is 1.03×10^(-5) atm.
To learn more about equilibrium constant:
https://brainly.com/question/19340344
#SPJ1
Identify the substance that has formula mass of 133.5amu.
(a) MgCI
b)SCI
c)BCI
D) AICI
The calculated formula masses to 133.5 amu, we find that the substance with a formula mass closest to 133.5 amu is (d) AlCl3. Therefore, the answer is option D.
To identify the substance with a formula mass of 133.5 amu, we need to calculate the formula mass of each given substance and compare it to 133.5 amu.
(a) MgCl2:
The formula mass of MgCl2 can be calculated by adding the atomic masses of magnesium (Mg) and chlorine (Cl).
Mg: atomic mass = 24.31 amu
Cl: atomic mass = 35.45 amu
Formula mass of MgCl2 = (24.31 amu) + 2(35.45 amu) = 95.21 amu
(b) SCl:
The formula mass of SCl can be calculated by adding the atomic masses of sulfur (S) and chlorine (Cl).
S: atomic mass = 32.07 amu
Cl: atomic mass = 35.45 amu
Formula mass of SCl = 32.07 amu + 35.45 amu = 67.52 amu
(c) BCl:
The formula mass of BCl can be calculated by adding the atomic mass of boron (B) and chlorine (Cl).
B: atomic mass = 10.81 amu
Cl: atomic mass = 35.45 amu
Formula mass of BCl = 10.81 amu + 35.45 amu = 46.26 amu
(d) AlCl3:
The formula mass of AlCl3 can be calculated by adding the atomic mass of aluminum (Al) and 3 times the atomic mass of chlorine (Cl).
Al: atomic mass = 26.98 amu
Cl: atomic mass = 35.45 amu
Formula mass of AlCl3 = 26.98 amu + 3(35.45 amu) = 133.78 amu. Option D
For more such questions on masses visit:
https://brainly.com/question/24191825
#SPJ8
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Identify which element is the least malleable: potassium, calcium, scandium, or titanium
Jane is doing an experiment with plants. She makes a good scientific guess that one will grow taller than the other. What is this guess called? A. Prediction B. Procedure C. Observation D. Data
Answer:
A
Explanation:
61. Given the following information:
Ag2 CrO4(s)=2Agt (aq) + CrO4²- (aq)
Ag+ (aq) + e- Ag(s)
find the standard reduction potential at 25°C for the half-reaction
Ksp = 1 × 10-12
E = +0.799 V
Ag2 CrO4(s) + 2e¯ 2Ag(s) + CrO4²- (aq)
Q = Ksp = 1 × 10^(-12).
Substituting the values into the Nernst equation, we have:
0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))
Now, solving for E°:
E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))
The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.
To find the standard reduction potential at 25°C for the half-reaction Ag2CrO4(s) + 2e¯ → 2Ag(s) + CrO4²-(aq), we can use the Nernst equation, which relates the standard reduction potential (E°) to the equilibrium constant (K) and the reaction quotient (Q).
The Nernst equation is given as follows:
E = E° - (RT/nF) * ln(Q)
Given information:
Ksp = 1 × 10^(-12)
E = +0.799 V (standard reduction potential of Ag+ to Ag)
Since the reaction involves the dissolution of Ag2CrO4(s), the reaction quotient Q can be expressed as [Ag+]²/[CrO4²-].
Since the stoichiometry of the reaction is 2:1 for Ag2CrO4 to Ag+, we can say that [Ag+]² = Ksp.
Therefore, Q = Ksp = 1 × 10^(-12).
Substituting the values into the Nernst equation, we have:
0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))
Now, solving for E°:
E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))
The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.
Please note that without specific values for temperature (T) and the ideal gas constant (R), the exact standard reduction potential at 25°C cannot be determined.
For more question on temperature
https://brainly.com/question/4735135
#SPJ8
Give reasons ,Argon is an inert gas.
Answer:
The outermost (valence) shell of argon has eight electrons, making it exceedingly stable and, thus, chemically inert. Argon atoms do not combine with one another; nor have they been observed to combine chemically with atoms of any other element.So argon is an inert gas
Answer:
because argon have 8 electrons in there outmost shell
which is enough to make it stable
A small amount of chemical splashes in Frank’s eye. What should Frank do immediately?
Answer:
A small amount of chemical splashes in Frank's eye. What should happen next? Frank should go to the eyewash station while his lab partner tells the teacher what happened.
Explanation:
Brainlist
Convert a density of 1,235 kg/m3 to grams per cubic centimeter
Answer:
Density, \(d=1.235\ g/cm^3\)
Explanation:
It is given that, the density is 1,235 kg/m³.
We need to convert the density to g/cm³.
We know that,
1 kg = 1000 g
1 m = 100 cm
\(1235\ kg/m^3=1235\ \dfrac{kg}{m^3} \\\\=1235\times \dfrac{1000\ g}{(100\ cm)^3}\\\\=1.235\ g/cm^3\)
So, the density is \(1.235\ g/cm^3\).
What is the chemical formula for the ionic compound whose unit cell is shown? (A and B are cations; X is an anion.)
The chemical formula is AB3X, A occupies all the corners & B occupies the faces, So the contribution = ½ × 6 = 3 . X occupies body center So contribution= 1,So atomic formula= AB3X
What is Chemical formula?
A chemical formula is a way of presenting information about the chemical ratios of atoms that make up a particular chemical compound or molecule, using chemical element symbols, numbers, and sometimes other symbols such as parentheses, dashes, parentheses, commas, and plus and minus signs
What is chemical compound?
A chemical compound is a chemical substance composed of two or more different chemical elements held together by chemical bonds. It can be either a molecular compound composed of atoms held together by covalent bonds, or an ionic compound composed of ions held together by ionic bonds. Compounds can be composed of elements from the same group, or from different groups.
To know more about Chemical formula,
brainly.com/question/29031056
#SPJ1
calculate the wave length associated with an electron travelling a 40% velocity of light
2.5 A° is wave length associated with an electron travelling a 40% velocity of light.
40% velocity of light=40/100×3×10^8
40% velocity of light=1.2×10^8 m/s
\(\lambda=c/v\)
\(\lambda\)=3×10^8/1.2×10^8 m/s=2.5 A°
Since the relationship between wave frequency and wavelength is inverse, gamma rays have extremely tiny wavelengths that are only a small portion of the size of atoms, whereas other wavelengths can extend as far as the universe. No of the medium they are passing through, electromagnetic radiation's wavelengths are typically expressed in terms of the vacuum wavelength, but this isn't always stated explicitly.
The wavelength of electromagnetic radiation affects how it behaves. Speed of light = wavelength x frequency Energy = Planck's constant x frequency Wave number = 1/wavelength in cm. The wavelengths of different parts of the electromagnetic spectrum are displayed together with a rough approximation of the wavelength size.
To know more about wave length visit : https://brainly.com/question/12924624
#SPJ9
How much heat is required to raise the temperature of a 175 g piece of aluminum from 37.0 oC to 92.0 oC?
Answer:
2.07 × 10³ cal
Explanation:
Step 1: Given and required data
Initial temperature: 37.0 °CFinal temperature: 92.0 °CMass of aluminum: 175 gSpecific heat capacity of aluminum (c): 0.215 cal/g.°CStep 2: Calculate the change in the temperature experienced by the aluminum piece
ΔT = 92.0 °C - 37.0 °C = 55.0 °C
Step 3: Calculate the heat required (Q)
We will use the following expression.
Q = c × m × ΔT
Q = 0.215 cal/g.°C × 175 g × 55.0 °C
Q = 2.07 × 10³ cal
Which of the following technique is used to purify the impurities that are not very different in chemical properties of element? [a] Gas chromatography [b] Column chromatography [c] TLC [d] HPLC
Answer:
Explanation: Liquid Chromatography
I'm sorry if i'm wrong
Why wouldn’t you use Avogadro’s number to change 32.4 grams of Lithium into moles of Lithium?
A 0.682 g sample of a weak monoprotic acid, HA was dissolved in sufficient water to make 50.0 mL of solution and was titrated with a 0.135 molar NaOH solution. After the addition of 10.6 milliliters of base, a pH of 5.65 was recorded. The equivalence point was reached after the addition of 27.4 milliliters of the 0.135 molar NaOH.
a. Calculate the number of moles of acid in the original sample.
b. Calculate the molar mass of the acid HA.
c. Calculate the [H3O+] at pH = 5.65
d. Calculate the number of moles of unreacted HA remaining in solution when the pH was 5.65.
e. Calculate the value of the ionization constant, Ka, of the acid HA.
f. Calculate the value of the ionization constant, Kb, and explain how you would use it to determine the pH of a solution of a known mass of the sodium salt (Na)(A) dissolved in a known volume of water.
The sugars we have been discussing are made directly through a series of reactions in the____ , which uses co2 as a starting input. a. light reaction a. recall, that under thermodynamic laws, building complex molecules requires the input of energy in the form of sunlight. that energy in photosynthesis comes from the . b. calvin cycle a. through a series of reactions in the , light energy is transformed into energy that is in the form of atp and high-energy electrons carried by nadph. b. in the , h2o is used and outputs as o2. a. in the , atp and nadph enter and output as adp and nadp.
The sugars we have been discussing are made directly through a series of reactions in the Calvin Cycle, which uses CO2 as a starting input.
Recall that under thermodynamic laws, building complex molecules requires the input of energy in the form of sunlight. That energy in photosynthesis comes from the Light Reaction. Through a series of reactions in the Light Reaction, light energy is transformed into energy that is in the form of ATP and high-energy electrons carried by NADPH. In the Light Reaction, H2O is used and outputs as O2. In the Calvin Cycle, ATP and NADPH enter and output as ADP and NADP. These processes work together to produce glucose and other sugars that are essential for life. The sugars we have been discussing are made directly through a series of reactions in the Calvin Cycle, which uses CO2 as a starting input.
Learn more about Calvin Cycle :
https://brainly.com/question/17600594
#SPJ4
What is kintec energy?
What volume of hydrogen iodide is produced when 118 liters of hydrogen gas react according to the following reaction? (All gases are at the same temperature and pressure.) hydrogen(g) + iodine(s) hydrogen iodide(g) liters hydrogen iodide
Answer:
\(V_{HI}=236LHI\)
Explanation:
Hello,
In this case, for the given balanced chemical reaction:
\(H_2(g)+I_2(g)\rightarrow 2HI(g)\)
Thus, since hydrogen and hydrogen iodide are in a 1:2 mole ratio, we can easily compute the yielded volume as shown below:
\(V_{HI}=118LH_2*\frac{2molHI}{1molH_2} \\\\V_{HI}=236LHI\)
Thus, is possible, due to the Avogadro's law which allows to relate moles and volume by a directly proportional relationship.
Regards.
what keeps molecules together in a liquid and stops them from becoming a gas?
Answer:
intermolecular interactions
Explanation:
hope this helps
The intermolecular attraction keeps molecules together in a liquid and stops them from becoming a gas.
What is intermolecular attraction ?The electromagnetic forces of attraction and repulsion that act between atoms and other types of nearby particles, such as atoms or ions, are examples of intermolecular forces.
Liquids have qualities that are halfway between gases and solids, yet they are closer to solids. Intermolecular forces, in opposed to intramolecular forces like covalent ties that bind atoms together in molecules as well as polyatomic ions, keep molecules with each other in a liquid or solid.
To know more about intermolecular force click here.
https://brainly.com/question/9007693.
#SPJ2
Please help me a is due today and I don’t know this last question!!
Answer:
b
Explanation:
cause it stops at 8 and it starts going up until it hits 14