why does ocean water found near the poles often have a higher leaves of salinity than ocean water found near the equator

Answers

Answer 1

The ocean water found near the poles has a higher level of salinity because the area of rain reduces as one moves toward the poles, and as a result of less rain and more sunshine, evaporation increases.

What is salinity?

Salinity is the presence of salt in the water. Freshwater bodies have very less amount of salt, but ocean water has a large amount of salt dissolved in it.

Because cold polar air cools the water and decreases its temperature, raising its salinity, water close to the poles frequently has more salinity. When fresh water freezes out of seawater to form sea ice, the salinity of the remaining water likewise rises.

Therefore, as one travels toward the poles, the area of rain decreases, and as a result of less rain and more sunshine, evaporation increases, and the ocean water there has a higher level of salinity.

To learn more about salinity, refer to the link:

https://brainly.com/question/11798887

#SPJ2


Related Questions

If sodium arsenite is Na3AsO3, the formula for calcium arsenite would be

Answers

Answer:

Ca₃(AsO₃)₂

Explanation:

Sodium arsenite, with the chemical formula Na₃AsO₃, is formed  by the cation Na⁺ and the anion AsO₃³⁻. For the molecule to be neutral, 3 cations Na⁺ and 1 anion AsO₃³⁻ are required.

Calcium arsenite would be formed by the cation Ca²⁺ and the anion AsO₃³⁻. For the molecule to be neutral, we require 3 cations Ca²⁺ and 2 anions AsO₃³⁻. The resulting chemical formula is Ca₃(AsO₃)₂.

Use this equation for the next question:
2NaOH + H2SO4 ® Na2SO4 + 2H20
If a reaction produces 0.75 moles Na2SO4, how many moles of NaOH were used?
0.75 moles NaOH
2 moles NaOH
.375 moles NaOH
1.5 moles NaOH

Answers

The answers is: 375 moles NaOH

What is true of a Lewis base?
A. A Lewis base donates electron pairs.
B. A Lewis base donates H* ions.
C. A Lewis base donates a salt in solution.
D. A Lewis base donates OH ions.

Answers

The statement that is true of a Lewis base is that a Lewis base donates electron pairs (option A).

What is a Lewis base and acid?

A Lewis base is any nucleophylic compound that can donate a pair of electrons and form a coordinate covalent bond.

On the other hand, a Lewis acid is any electrophylic compound that can accept a pair of electrons and form a coordinate covalent bond.

This means that a Lewis base can donate a pair of electrons to a Lewis acid to form a product containing a coordinate covalent bond. This product is also referred to as a Lewis adduct.

Therefore, option A is correct about Lewis base

Learn more about Lewis base at: https://brainly.com/question/24076507

#SPJ1

True or False: Based on the evidence in the graph, when 10 g of Ce2(SO4)3 is dissolved in 100 mL of water at 20°C, the solution is said to be unsaturated.

True or False: Based on the evidence in the graph, when 10 g of Ce2(SO4)3 is dissolved in 100 mL of water

Answers

Based on the evidence in the solubility graph, when 10 g of Ce2(SO4)3 is dissolved in 100 mL of water at 20°C, the solution is said to be saturated.

What are unsaturated solutions?

An unsaturated solution is a solution which contains less solute than it can actually dissolved in a given volume of solvent at a given temperature.

A solubility curve or graph provides information about the solubility of a solute at a given temperature.

From the solubility graph given, at 20°C, less than 10 g of Ce2(SO4)3 will be dissolved in 100 mL of water.

Therefore, when 10 g of Ce2(SO4)3 is dissolved in 100 mL of water at 20°C, the solution is said to be saturated.

Learn more about saturated and unsaturated solutions at: https://brainly.com/question/14294957


What do all the elements in one row of the periodio fable have in common?

Answers

Answer:

Energy levels

Explanation:

Elements in one row of the periodic table have the same energy levels. A row on the periodic table is the horizontal arrangement of elements. These rows are called periods.

There are 7 periods on the periodic table.

Each elements on a period begins with an atom having one valence electrons and then ending with completely filled orbitals. Elements in the same period are known to have the same electronic shells which is the energy level. The principal quantum number of their electrons is the same.

1) Sodium hydroxide is deliquescent. A sample of 3.0 g was dissolved in 100 mL; 10 mL was titrated with 34.9 mL HCl 0.2 M. What is the percent of absorbed water in the sample? ​

Answers

From the calculation, the percentage of water in the sodium hydroxide sample is 7%.

What is neutralization?

The term neutralization has to do with the reaction between an acid and a base to yiled salt and water.

Now we have  to apply the titration formula;

CAVA/CBVB = NA/NB

CA = concentration of acid

CB = concentration of base

VA = volume of acid

VB = volume of base

NA = number of moles of acid

NB = number of moles of base

The reaction equation is; HCl + NaOH ----->NaCl + H2O

CAVANB = CBVBNA

CB = CAVANB /VBNA

CB = 34.9 * 0.2 M * 1/10 * 1

CB = 0.698 M

Number of moles = Conncentration * volume

= 0.698 M * 100/1000 L = 0.0698 moles

Mass = Number of moles * molar mass

Mass =  0.0698 moles * 40 g/mol = 2.79 g

percent of NaOH = 2.79 g/ 3g * 100/1 = 93%

Percent of water = 100- 93 = 7%

Learn more about neutralization: https://brainly.com/question/15395418

for each electrolyte, indicate whether it is more abundant in the intracellular fluid (icf) or the extracellular fluid (ecf).

Answers

Intracellular fluid (ICF):Potassium, Magnesium & Phosphate ions

Extracellular fluid (ECF): Sodium. Chloride, Calcium & Bicarbonate ion

What is the difference between ECF and ICF?The cytosol found inside a cell is known as intracellular fluid (ICF). ECF, which surrounds the cells and acts as a circulating reservoir, is present. The ECF is separated into intravascular fluid and interstitial fluid, which bathes the exterior of the cells (i.e., plasma, lymph, and cerebral spinal fluid).The extracellular compartment is made up of the interstitial, intravascular, and transcellular compartments. About one-third of its body's water content is found in its extracellular fluid (ECF).The system that comprises all fluid contained in cells by their plasma membranes is known as the intracellular fluid (ICF) compartment. Every cell in the body is surrounded by extracellular fluid (ECF).Water, dissolved electrolytes, and proteins make up the intracellular fluid, which makes up around 40% of a person's total body weight. Phosphate (PO4 P O 4), magnesium (Mg2+ M g 2 +), and potassium (K+) are a few of the major electrolytes present in intracellular fluid.

Learn more about ECF and ICF refer to :

https://brainly.com/question/14969978

#SPJ1

Question 3 of 10
Which type of bond is found in an alkene?
OA. Single and triple
OB. Single and double
O C. Double only
O D. Single only

Question 3 of 10Which type of bond is found in an alkene?OA. Single and tripleOB. Single and doubleO

Answers

Single it's in the namei

Alkane-single bonds
Alkene-double bonds
Alkyne-triple bonds

For example ethane would have only single bonded carbons
Ethene would have double bonded as well as single bonded carbons
Ethyne would have triple as well as double and single bonds

Answer: single and double

Explanation:

they was wrong for mine

This is Yolanda's desk. What could Yolanda do to increase the amount of force needed to move the desk?

This is Yolanda's desk. What could Yolanda do to increase the amount of force needed to move the desk?

Answers

Answer:

The last one.

Explanation:

The other ones add more force or give the same but the last one reduces it.

143°C =

О-130 к
OOK
o143 К
416 К

Answers

Answer:

143°C = 416K

Substance A dissolves in water. What can be said about substance A?
O It is unsaturated.
It is nonpolar.
It is saturated.
It is polar.

Answers

Answer:

It is polar.

Explanation:

Water is a polar solvent and it can only dissolve another solute or substance.

As a general rule of solubility "likes dissolves likes".

This implies that when a polar solvent is used, it will dissolve a polar solute.

Also, a non-polar solute will only dissolve in a non-polar solvent.

Water is an example of polar solute. Other solutes such as salt can dissolve in water because they are polar in nature. A non-polar solvent is oil.

How many moles of CO2 will be produced in the following reaction if the initial amount of reactants was 0.50 moles?

2NaHCO3 —> Na2CO3 + CO2 + H2O

Answers

Answer:

In the following reaction, how many moles of

CO2

can be made by reacting 0.50 moles of

CH4

with excess oxygen?

CH4+O2>CO2+H2O

Explanation:

How many moles of CO2 will be produced in the following reaction if the initial amount of reactants was


How many moles of C5H120 would it take to generate 4.2 moles of CO2 from combustion?
2 CsH120 + 15 O2 → 10 CO2 + 12 H2O

Answers

Answer:

0.84 moles

Explanation:

from the equation 2 moles of pentanol generated 10 moles of CO2 therefore, x mol of pentanol will generate 4.2mol of CO2.

making x the subject of formula=4.2*2/10

=0.84 moles of

pentanol

The frequency of an x-ray wave is 3.0 x 1012MHz. Its wave speed is 3.0x 108m/s. Calculate the wavelength of the x-ray wave below. I need to know by 11 pm, also I can crown brainliest :)

Answers

Answer: The wavelength of the x-ray wave is \(10^{-10}m\)

Explanation:

To calculate the wavelength of light, we use the equation:

\(\lambda=\frac{c}{\nu}\)

where,

\(\lambda\) = wavelength of the light  = ?

c = speed of x-ray= \(3.0\times 10^8m/s\)

\(\nu\) = frequency of x-ray = \(3.0\times 10^{12}MHz=3.0\times 10^{18}Hz= 3.0\times 10^{18}s^{-1}\)     \((1Hz=1s^{-1})\)

Putting in the values:

\(\lambda=\frac{3.0\times 10^8m/s}{3.0\times 10^{18}s^{-1}}=10^{-10}m\)

Thus the wavelength of the x-ray wave is \(10^{-10}m\)

The wavelength of the x-ray should be considered as the 10^-10m.

Calculation of the wavelength:

Here the final equation should be considered

So,

wavelength = c / v

Here

The frequency of an x-ray wave is 3.0 x 1012MHz.

Its wave speed is 3.0x 108m/s

So,

= 3.0x 108m/s/ 3.0*10^18

= 10^-10m.

hence, The wavelength of the x-ray should be considered as the 10^-10m.

Learn more about wavelength here: https://brainly.com/question/19587294

How does the chemical structure of a substance affect its interaction with other substances?

Answers

This is due to the fact that a substance's chemical qualities, such as its molecular form, polarity, and functional groups, govern how it behaves and interacts with other substances.

How does their chemical makeup impact their chemical characteristics?

By illustrating the spatial arrangement of atoms and chemical bonds within the molecule, chemical structure establishes the molecular geometry of a compound. In doing so, chemists are given a crucial visual depiction of a chemical formula.

In what ways do drugs interact with one another?

In a chemical reaction, reactants come into contact with one another, atoms in the reactants break their connections with one another, and then the atoms reorganise and form new bonds to create the products.

To know more about molecule visit:-

https://brainly.com/question/19556990

#SPJ1

How many atoms of germanium are present in a sample containing 4.20 moles Ge

Answers

Explanation:

We have to find the number of Ge atoms present in a sample that contains 4.20 moles of Ge. By definition we know that 1 mol of Ge atoms contains 6.022 *10^23 atoms of it. We can use that ratio to find the answer to our problem.

1 mol of Ge : 6.022 *10^23 atoms

number of atoms = 4.20 moles of Ge * 6.022 *10^23 atoms/(1 mol of Ge)

number of atoms = 2.53 *10^24 atoms

Answer: 2.53 *10^24 atoms of Ge are present in 4.20 moles of it.

The new hybrid car can get 51.5 km/gal. It has a top speed of 40000.00 cm/min and is 4m long. How fast can the car go in m/hr?


Answers

Answer:

The anawer of this question is 0.024 m/h

Explanation:

Other explanations of the question are additional.

The new hybrid car can get 51.5 km/gal. It has a top speed of 40000.00 cm/min and is 4m long. How fast

Given the reaction at equilibrium:
2NO2(g) → N204(g) Heat of
reaction is -55.3 kJ) What type of
reaction is this?
O Endothermic
O Exothermic

Answers

When the equilibrium constant is higher than one, it indicates that the reaction prefers to produce products, whereas if the equilibrium constant is less than one, it indicates that the reaction prefers to produce reactants. If the equilibrium constant is equal to one, the reaction proceeds in both directions equally.

In a chemical reaction, exothermic reactions are defined as reactions that release heat into their environment. It implies that heat is given off when reactants are converted to products. At equilibrium, an exothermic reaction continues to be exothermic, meaning that heat is given off even after the reaction reaches a state of equilibrium.There are two types of reactions: exothermic and endothermic.

A reaction is classified as exothermic if it releases heat, and endothermic if it absorbs heat. The direction of the reaction is determined by whether it is exothermic or endothermic. At equilibrium, the reaction is no longer moving forwards or backwards. It's also worth noting that reactions can be exothermic in one direction and endothermic in the other.

The equilibrium constant (K) is defined as the ratio of the concentration of products to the concentration of reactants in the chemical reaction equation. It is used to express how much of the products is generated by the reaction in comparison to the reactants.  the equilibrium constant aids in the identification of the direction in which the reaction will proceed at equilibrium.

for more questions on equilibrium

https://brainly.com/question/3159758

#SPJ8

what is possible mass number of a sodium atom, Na?

Answers

Answer:

The possible mass of the number of sodium is 23amu

Find out the pH of the solution using a hydrogen electrode which is coupled with a saturated calomel electrode . The emf of the combined cell is 0.523 at 25 degree celsius

Answers

The pH of the solution, determined by the hydrogen electrode coupled with the saturated calomel electrode, is approximately 9.53.

To find the pH of the solution using a hydrogen electrode coupled with a saturated calomel electrode, we can utilize the Nernst equation, which relates the measured cell potential to the concentration of hydrogen ions in the solution. The Nernst equation is given by:

E = E° - (0.0592/n) * log[H+]

Where E is the measured cell potential, E° is the standard cell potential, n is the number of electrons transferred in the half-reaction (which is 2 for the hydrogen electrode), and [H+] is the concentration of hydrogen ions.

In this case, the emf of the combined cell is given as 0.523 V. Since the saturated calomel electrode (SCE) is the reference electrode, we can consider its standard cell potential (E°) to be 0.241 V at 25 degrees Celsius.

0.523 V = 0.241 V - (0.0592/2) * log[H+]

Simplifying the equation:

0.523 V - 0.241 V = -0.0296 * log[H+]

0.282 V = -0.0296 * log[H+]

Dividing both sides by -0.0296:

log[H+] = -0.282 V / -0.0296

log[H+] ≈ 9.53

Taking the antilog (base 10) of both sides:

[H+] ≈ 10^9.53

[H+] ≈ 3.2 × 10^9 M

Therefore, the pH of the solution, determined by the hydrogen electrode coupled with the saturated calomel electrode, is approximately 9.53.

for more questions on pH

https://brainly.com/question/12609985
#SPJ8

M is a mysterious element whose molar mass is 141.0 g/mol. When combined with oxygen, the formula of the compound is M2O5. What is the percent of M in the compound?​

Answers

Answer:

I d k

Explanation:

Exponential notation
2.23 X 107 * 3.0 X 10-4

Answers

the answer would be 56.096 x 68.932

true or false: The nucleus of an atom contains protons and neutrons.

Answers

Answer:

true

Explanation:

google

What else is produced when sodium carbonate decomposes?
Na2Co3 - Na2O+

Answers

Answer:When a single compound breaks down into two or more compounds or elements in a chemical reaction then it is known as decomposition reaction.

The chemical symbol for sodium carbonate is .

The decomposition of sodium carbonate is:

The decomposition of sodium bicarbonate,  will result in the formation of sodium oxide,  and carbon dioxide, .

Hence, carbon dioxide,  will produce with sodium oxide,  on decomposition of .

Explanation:Na2CO3 Na2O +CO2   CO2 is the answer

Does the sodium-potassium pump go to work prior to or after the contraction has occurred? Explain your response.
(NEED HELP ASAP. THANK U FOR UR HELP)

Answers

The sodium-potassium pump goes to work after the contraction has occurred in order to repolarize the cells.

What is the sodium-potassium pump?

The sodium-potassium pump is a pump that functions in transporting sodium ions out of the cell and potassium ions inside the cell.

At the resting membrane potential, the sodium-potassium pump ensures that the interior of the cell is negative relative to outside the cell because three sodium ions are pumped out of the cell for every two potassium ions that are pumped into the cell.

When an action potential reaches the cell, the pump opens and allows sodium ions into the cell thereby depolarizing it. Afterward, the sodium-potassium pump works to repolarize the cell by pumping sodium out and potassium in.

Learn more about sodium-potassium pump at: https://brainly.com/question/11673875

#SPJ1

Describe the advantages of the hydrogen-rich fuel cell when compared to the conventional electrochemical cells such as lead-acid battery. (4)​

Answers

The hydrogen-rich fuel cell offers advantages in terms of efficiency, environmental impact, operating time, refueling speed, weight, size, and lifespan when compared to conventional electrochemical cells like the lead-acid battery.

The hydrogen-rich fuel cell offers several advantages over conventional electrochemical cells like the lead-acid battery. Here are some of the key advantages:

1. Higher Efficiency: Hydrogen fuel cells have higher energy conversion efficiencies compared to lead-acid batteries. Fuel cells can convert chemical energy directly into electrical energy with minimal loss, while lead-acid batteries have inherent energy losses due to factors such as internal resistance and heat dissipation.

2. Clean and Environmentally Friendly: Hydrogen fuel cells produce electricity through the reaction of hydrogen and oxygen, with water being the only byproduct. They do not produce harmful emissions or contribute to air pollution, making them a cleaner and more sustainable power source compared to lead-acid batteries, which require the use of chemicals like sulfuric acid.

3. Longer Operating Time: Fuel cells have longer operating times compared to lead-acid batteries. Lead-acid batteries have a limited capacity and need to be recharged frequently, while fuel cells can continuously generate electricity as long as there is a supply of hydrogen.

4. Faster Refueling: Refueling a fuel cell is faster compared to recharging a lead-acid battery. Fuel cells can be refueled by replenishing the hydrogen supply, which can be done relatively quickly. In contrast, lead-acid batteries require a longer time to recharge, typically hours, depending on the battery's capacity and charging rate.

5. Lighter Weight and Compact Size: Hydrogen fuel cells have a higher energy density compared to lead-acid batteries, meaning they can store more energy in a smaller and lighter package. This makes fuel cells more suitable for applications where weight and space are critical, such as in portable devices or electric vehicles.

6. Longer Lifespan: Fuel cells generally have a longer lifespan compared to lead-acid batteries. Lead-acid batteries can experience degradation over time due to factors like sulfation, which can reduce their overall capacity and lifespan. Fuel cells, on the other hand, can provide consistent performance over an extended period with proper maintenance.

These advantages make fuel cells a promising technology for various applications, including transportation, stationary power generation, and portable electronics.

for more questions on fuel cell

https://brainly.com/question/14122421

#SPJ8

5) How many moles of nitrogen atoms are combined with 6.79 mol of oxygen atoms in dinitrogen pentoxide?

Answers

First, we write our reaction:

2N2 + 5O2 → 2N2O5 (balanced)

Procedure:

2 x 1 mole N2 -------- 5 x 1 mole O2

X ---------6.79 moles O2

X = 2.72 moles N2

Answer: 2.72 moles N2

why is it difficult to measure the mass of an atom?​

Answers

Answer:

It's difficult to measure the mass of an atom because they are simply so tiny. It's not like we can just put it on a weighing scale, as it wouldn't show up at all

Answer:

Because atoms are much too small to measure individually and do not have charges, there is no convenient way to accurately measure absolute atomic masses.

What happens to the energy produced by blocks of Earth's crust slipping past each other? (1 point)
O It disappears at it moves through the crust.
OIt spreads out in random directions.
OIt radiates outward in all directions.
OIt increases as it reaches the surface.

Answers

What happens to the energy produced by blocks of Earth's crust slipping past each other is it radiates outward in all directions. (Option C).

What happens to the energy?

When blocks of the Earth's crust slip past each other during an earthquake, the energy that is released does not disappear, spread out randomly, or increase as it reaches the surface.

Instead, the energy radiates outward in the form of seismic waves. These seismic waves travel through the Earth in all directions from the point of the earthquake's origin causing the ground to shake.

The energy carried by these waves is what is felt as the shaking during an earthquake and can be detected and measured by seismometers.

Thus, what happens to the energy produced by blocks of Earth's crust slipping past each other is it radiates outward in all directions.

Learn more about earth's rotation here: https://brainly.com/question/1808956

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Other Questions
4. What were the main results of the rise in nativism during the 1920s? *Can anyone help me, please!*Write an introduction for the following thesis statement. Your hook must be either aninteresting story, a metaphor, or a description.Thesis statement: Not all high school students should get a university degree directlyafter graduation, because getting a job or enlisting in the military can help students makebetter decisions about their future careers.Your introduction: Hank was transferred from Arizona to North Dakota on March 1 of the current year. He immediately put his home in Phoenix up for rent. The home was rented May 1 to November 30 and was vacant during the month of December. It was rented again on January 1 for six months. What expenses related to the home, if any, can Hank deduct on his return In a one-paragraph essay, describe the ways that England and France exerted influence over the Ottoman Empire Keep in mind what an independent variable is. What are some variables that can affect a persons heart rate? Choose one variable that you would like to design an experiment for. State your hypothesis of how the independent variable might affect heart rate. Please be specific about what the independent variable is. If you have a credit card, it's good to spend more money than you have in the bank.TRUE OR FALSE Edpuzzle find the slope of each line. which statements best explain why many white southern citizens were concerned about thearrival of carpetbaggers?Select the two correct answers.A. Carpetbaggers were accused of delaying the goals of Reconstruction.B. Carpetbaggers were associated with the values of the northern Radical Republicans.C. Carpetbaggers migrated from foreign countries and introduced new customs.D. Carpetbaggers were thought to be stealing the wealth of the South.E. Carpetbaggers often moved to southern cities and opposed modern ways of life.F. Carpetbaggers were fully protected by the federal government during Reconstruction. Why do you think women, Aboriginals,inmates, and many immigrant groups werehistorically disadvantaged in regard to theirright to vote? What is an example of mass in your house? What happens to nations agricultural sector as it industrializes? What expectations did Mexico have when it signed the NAFTA? Since 1980 in which Mexican field crops has production declined the most? Do the data on field crops clearly indicate that NAFTA has harmed Mexican agriculture? According to bowen,___________ is the capacity to think and reflect, to not respond automatically to emotional pressures. i will rateCost, revenue, and profit are in dollars and x is the number of units. If the total profit function is P(x) = 9x 27, find the marginal profit MP. MP = Given sinx=2/3 find cos2x Why can endothermic reactions be spontaneous?Even though an endothermic process requires energy from the surroundings, it can be spontaneous if the reaction results in a net increase of entropy.Even though an endothermic process requires energy from the surroundings, it can be spontaneous if the reaction results in a net decrease of entropy.Even though an endothermic process releases energy to the surroundings, it can be spontaneous if the reaction results in a net increase of entropy.Even though an endothermic process releases energy to the surroundings, it can be spontaneous if the reaction results in a net decrease of entropy. Model the data using an exponential function f(x) = Abx.x012f(x)1009081 if the volume of a fixed mass of hydrogen in a container is 30cm at a pressure of 50mmHg find the volume of the gas if the pressure is 60mmHg at constant pressure Plz help 100 POINTS!!!!!!!!!!!!Muriel translated the phrase below into an algebraic expression and then evaluated it for n = 4. the product of a number and 8 Which of the following contains the correct expression and value? A.8 + n = 12 B. StartFraction 8 Over EndFraction = 2 C. 8 Over EndFraction = 2 D. 8 n = 32 8 minus n = 4 CAN SOMEBODY PLS HELP MEEEEEEEEEEE AND RUDE ANSWERS WILL BE RE PORTEDDDDDD gorman and morton form a partnership on may 1, 2019. gorman contributes cash of $50,000; morton conveys title to the following properties to the partnership: book value fair value equipment $ 15,000 $ 28,000 licensing agreements 35,000 36,000 the partners agree to start their partnership with equal capital balances. no goodwill is to be recognized. according to the articles of partnership written by the partners, profits and losses are allocated based on the following formula: gorman receives a compensation allowance of $1,000 per month. all remaining profits and losses are split 40:60 between gorman and morton, respectively. each partner can make annual cash drawings of $25,000 beginning in 2020. net income of $11,000 is earned by the business during 2019. steele is invited to join the partnership on january 1, 2020. because of her business reputation and financial expertise, she is given a 40 percent interest for $54,000 cash. the bonus approach is used to record this investment, made directly to the business. the articles of partnership are amended to give steele a $2,000 compensation allowance per month and an annual cash drawing of $20,000. remaining profits are now allocated: