Answer:
B
Explanation:
Not C or D becuase it is data would not show a conclusion and observations does show the conclsuion of the scientists. Not A becuase explanation does not mean they have data to support their conclusion. Therefore, it would be B becuase results show what was the effect of something and is often supported with data
Hope that helped :)
what pressure would 1.75 L of disulfur monoxide gas have if it occupied a volume of 16.60 L at 1 atm?
Okay, let's solve this step-by-step:
* We are given that the initial volume of the gas is 1.75 L at 1 atm pressure
* We want to know the pressure if the volume increases to 16.60 L
* According to Boyle's Law: Pressure x Volume = Constant
* Since the initial pressure is 1 atm and volume is 1.75 L, the constant is:
1 atm x 1.75 L = 1.75 atm*L
* When the volume increases to 16.60 L, plugging into Boyle's Law:
P x 16.60 L = 1.75 atm*L
* Solving for P (pressure):
P = 1.75 atm*L / 16.60 L
P = 0.105 atm
Therefore, the pressure of the 1.75 L of disulfur monoxide gas if it occupied a volume of 16.60 L would be 0.105 atm.
what are the colors of a rainbow
Classify each of the picture below by placing the correct label in the blanks below. SOMEONE PLEASE HELP ME
The classification of the substances are as follows;
1) C
2) MOE
3) MOEAC
4) MOC
5) E
6) C
7) E
8) MOEAC
9) MOE
10) MOEAC
11) C
12) MOC
13) MOC
14) MOC
15) MOC
What are compounds, mixtures and elements?An element is a pure substance that cannot be broken down into simpler substances by chemical means. Elements are composed of only one type of atom, and they are listed on the periodic table. For example, oxygen, gold, and carbon are all elements.
A compound is a substance composed of two or more elements chemically combined in a fixed ratio. The properties of a compound are different from those of the elements that make it up. For example, water is a compound made up of two elements, hydrogen and oxygen, and has different properties than its constituent elements.
A mixture is a combination of two or more substances that are not chemically combined. Mixtures can be composed of elements, compounds, or both, and they can be separated by physical means.
Learn more about compound:https://brainly.com/question/13516179
#SPJ1
formula for trichlorine tetroxide
Consider the following chemical reaction:
C(s)+H2O(g)→CO(g)+H2(g)
How many liters of hydrogen gas are formed from the complete reaction of 1.07 mol of C? Assume that the hydrogen gas is collected at a pressure of 1.0 atm
and a temperature of 317 K.
Express your answer using two significant figures.
Answer: 27.85 L
Explanation:
Ideal gas law
V = nRT/P
V = 1.07 X 0.0821 X 317 / 1= 27.85 L
calculate the final
pressure of a sample of
water vapour That expands reversibily and
adiabaticaly from 8.73 toir at 500 cm³ to a
final volume 3dm³ take gamma 1.3.
which of the following should be compared when deciding whether a given nucleophilic acyl substitution reaction will occur as written? select all that apply.
The following should be compared when deciding whether a given nucleophilic acyl substitution reaction will occur as written :
the relative basicity of the nucleophile and leaving group.The nucleophilic acyl substitution reaction will occur as written there are the following that we should compare is given as follows :
we should compare the relative basicity of the nucleophile and the basicity of the leaving group.the abilities of the relative abilities of the leaving group to nucleophile and the leaving group.The nucleophilic acyl substitution is the reaction in which the carbonyl and the nucleophile will forms a new bond of the acyl group.
To learn more about nucleophilic acyl substitution here
https://brainly.com/question/28383861
#SPJ4
Carbon-13 is an isotope of carbon with a mass number of 13. How many neutrons are in a carbon-13 ?
Answer:
7
Explanation:
The 13 in C-13 shows the relative atomic mass of the isotope. the number of protons in carbon stay the same, while the number of neutrons changes. To find the number of neutrons in an atom, you must subtract the Atomic Mass Number with the Atomic Number. 13-6 = 7
Acceleration is a derived quantity. Give reason. Class 8
Answer:
Acceleration is a derived quantity because it depends on fundamental quantities.
list three statements for transverse waves
Convert 2.44 x 1024 H₂O molecules into moles.
The number of moles 2.44 x 10²⁴ H₂O molecules will be having is 4.05.
Converting between molecules and moles is done by either multiplying by or dividing by Avogadro's number. To go from molecules to moles, divide the number of molecules by 6.02 x 10²³.
Avogadro's number, which is equal to 6.022 × 10²³, is the number of units in one mole of any material (defined as its molecular weight in grams). Depending on the substance and the nature of the reaction, the units could be electrons, atoms, ions, or molecules.
Thus,
No. of molecules = No. of moles × Avogadro no.
from the question we know,
No. of molecules = 2.44 × 10 ²⁴
Avogadro no. = 6.02 × 10²³
i.e. 2.44 × 10²⁴ = No. of moles × 6.02 × 10²³
No. of moles = 2.44 × 10 ²⁴
6.02 × 10²³
No. of moles = 4.05
The number of moles 2.44 x 10²⁴ H₂O molecules will be having is 4.05.
To know more about Avogadro no. visit the link:
https://brainly.com/question/11907018?referrer=searchResults
#SPJ9
Question 4 (4 points)
(01.03 MC)
An energy transformation flow diagram is shown.
X-
ELECTRICAL
ENERGY
What type of energy does X most likely represent? (4 points)
O a
X = gravitational energy
Oь
X = mechanical energy
Ос
= thermal energy
Od
X = radiant energy
Answer:
I think radiant I’m not sure
Explanation:
If the pressure is 0.9 kPa. and the volume is 4.0L, then the pressure changes to 0.20 kPa. What is the new volume?
Answer:
18 L
Explanation:
boyles law
P1V1 = P2V2
V2 = P1V1/P2
V2 = (.9 * 4)/.2
V2 = 18
This question is based on Boyle's law as temperature is constant. Boyle's law is derived from ideal gas equation only at constant temperature. Therefore, the new pressure is 18L.
What is Boyle's law?Boyle's law is a law which states that at constant temperature, the pressure that is exerted by an ideal gas on the walls of the container is inversely proportional to the volume occupied that gas.
Ideal gas is a gas where there is no forces of attraction or forces of repulsion between the particles . The volume of container is equal to the volume occupied by the gas.
Mathematically, Boyle's law can be written as
P₁V₁ = P₂V₂
P₁=initial pressure
P₂=final pressure
V₁ = initial volume
V₂=final pressure
V₂ = P₁V₁/P₂
V₂ = (0.9 × 4)/0.2
V₂ = 18L
Therefore, the new volume is 18L.
To know more about Boyle's law, here:
https://brainly.com/question/1437490
#SPJ2
Classify each given species as a strong acid, weak acid, strong base or weak base
KOH, Sr(OH)2, HaPO4, NH3, NaOH, LiOH, HBr, HCl, H2SO4, Ca(OH)2.
Strong base KOH, Sr(OH)2, NaOH, LiOH, Ca(OH)2. Strong acid HBr, HCl, H2SO4. Weak acid H3PO4. Weak base NH3.
KOH - Strong base: KOH is a strong base because it dissociates completely in water to form hydroxide ions (OH-), which are strong bases.Sr(OH)2 - Strong base: Sr(OH)2 is a strong base because it dissociates completely in water to form hydroxide ions (OH-), which are strong bases.H3PO4 - Weak acid: H3PO4 is a weak acid because it only partially dissociates in water to form hydrogen ions (H+) and phosphate ions (PO4^3-).NH3 - Weak base: NH3 is a weak base because it only partially reacts with water to form hydroxide ions (OH-) and ammonium ions (NH4+).NaOH - Strong base: NaOH is a strong base because it dissociates completely in water to form hydroxide ions (OH-), which are strong bases.LiOH - Strong base: LiOH is a strong base because it dissociates completely in water to form hydroxide ions (OH-), which are strong bases.HBr - Strong acid: HBr is a strong acid because it dissociates completely in water to form hydrogen ions (H+) and bromide ions (Br-).HCl - Strong acid: HCl is a strong acid because it dissociates completely in water to form hydrogen ions (H+) and chloride ions (Cl-).H2SO4 - Strong acid: H2SO4 is a strong acid because it dissociates completely in water to form hydrogen ions (H+) and sulfate ions (SO4^2-).Ca(OH)2 - Strong base: Ca(OH)2 is a strong base because it dissociates completely in water to form hydroxide ions (OH-), which are strong bases.To know more about acid please refer:
https://brainly.com/question/29796621
#SPJ4
Predict how blockage of both fallopian tubes would affect a woman’s ability to reproduce naturally. Explain your answer.
Examine the equation.
C3H8 +502 3CO2 + 4H₂O
The roles of the substances in the equation is substances C₃H₈ and 5O₂ are reactants that react to form the products 3CO₂ and 4H₂O. The correct option is d.
What is a chemical equation?A balanced chemical reaction is one in which the number of individual element atoms present on the reactant side and the number of individual element atoms present on the product side must match.
The species present on the left side of the right arrow are reactants in the balanced chemical reaction, and the species present on the right side of the right arrow are products.
Therefore, the correct option is d, the substances C₃H₈ and 5O₂ are reactants that react to form the products 3CO₂ and 4H₂O.
To learn more about the chemical equations, refer to the link:
https://brainly.com/question/28294176
#SPJ1
The question is incomplete. Your most probably complete question is given below:
What are the roles of the substances in the equation?
The substances C3H8 and 3CO2 are reactants that react to form the products 5O2 and 4H2O.
The substances 3CO2 and 4H2O are reactants that react to form the products C3H8 and 5O2.
The substances 5O2 and 3CO2 are reactants that react to form the products C3H8 and 4H2O.
The substances C3H8 and 5O2 are reactants that react to form the products 3CO2 and 4H2O.
GivenL C2H2 + 5O2 ------> 4 CO2 + 2H2O
If 9.5 L of CO2 are produced, how many liters of O2 will be needed for this reaction? Show work
Answer:
101 L
Explanation:
35.0 g KOH ÷ 56.09 g/mol KOH × (1 mol H2O/ 1 mol KOH) × 18 g/mol H2O = 11.2 g H2O
35.0 g HCl ÷ 36.45 g/mol HCl × (1 mol H2O/ 1 mol HCl) × 18 g/mol H2O = 17.3 g H2O
35.0 g KOH is the limiting reactant
calculate the enthalpy change for reaction in kjmol-1
Answer:
I got
−
902 kJ
for the reaction as-written. How would you rewrite this into
kJ/mol NH
3
?
The standard molar enthalpy of formation is for the formation of
1 mol
of product from its elements as they exist in nature at
25
∘
C
and
1 atm
. For example...
1
2
N
2
(
g
)
+
3
2
H
2
(
g
)
→
NH
3
(
g
)
,
Δ
H
∘
f
(
NH
3
(
g
)
)
=
−
45.9 kJ/mol
But that also means formation of elements in their standard states must yield zero enthalpy change:
1
2
O
2
(
g
)
→
1
2
O
2
(
g
)
,
Δ
H
∘
f
(
O
2
(
g
)
)
=
0
That means we can simply derive from Hess's law and that fact to get:
Δ
H
∘
r
x
n
=
∑
P
n
P
Δ
H
∘
f
,
P
−
∑
R
n
R
Δ
H
∘
f
,
R
where
n
indicates the mols of product
P
or reactant
R
. Here we actually have just summed many formation reactions together that we know have
Δ
H
∘
r
x
n
=
Δ
H
∘
f
.
Here we have:
Δ
H
∘
r
x
n
=
[
4 mols NO
(
g
)
⋅
Δ
H
∘
f
,
N
O
(
g
)
+
6 mols H
2
O
(
g
)
⋅
Δ
H
∘
f
,
H
2
O
(
g
)
]
−
[
4 mols NH
3
(
g
)
⋅
Δ
H
∘
f
,
N
H
3
(
g
)
+
0 kJ/mol
]
where we have set a zero contribution
O
2
(
g
)
right off the bat.
=
[
4 mols NO
(
g
)
⋅
91.3 kJ/mol
+
6 mols H
2
O
(
g
)
⋅
−
241.8 kJ/mol
]
−
[
4 mols NH
3
(
g
)
⋅
−
45.9 kJ/mol
+
0 kJ/mol
]
=
[
−
1085.6 kJ
]
−
[
−
183.6 kJ
]
=
−
902 kJ
for the reaction as-written.
Explanation:
How many mL of a 0.75 N KOH solution
should be added to a 500 mL flask to make
500 mL of a 0.300 M KOH solution?
The amount of volume of KOH solution that should be added to make 500mL of a 0.300M solution is 200mL.
How to calculate volume?The volume of a solution given the concentration can be calculated using the following expression;
CaVa = CbVb
Where;
Ca = initial concentrationVa = initial volumeCb = final concentrationVb = final volumeAccording to this question, we are to calculate how many mL of a 0.75 M OH solution that should be added to a 500 mL flask to make 500 mL of a 0.300 M KOH solution.
0.75 × Va = 500 × 0.3
0.75Va = 150
Va = 150/0.75
Va = 200mL
Learn more about volume at: https://brainly.com/question/14710169
#SPJ1
what is the of the 8 phases of the moon
Answer:
These eight phases are, in order, new Moon, waxing crescent, first quarter, waxing gibbous, full Moon, waning gibbous, third quarter and waning crescent.
A group of organs working together to perfrom a certain function called
Answer:
group. hfdzybidddiklllnjjooolll
Answer:
An organ system
Explanation:
:>
What are the possible values of 1 and m for
n=4 ?
Answer:
If n = 4, then the possible values of 1 and m depend on the equation or expression being used. Without more information, it is impossible to determine what the possible values of 1 and m might be. Can you please provide more context or information about the problem you are trying to solve?
I need help with my chemistry
Answer:
I believe the ans is FeO and Cl2
Answer:
\(\boxed {\boxed {\sf FeO and Cl_2}}\)
Explanation:
In a chemical reaction, there are reactants and products.
The reactants are the substances at the beginning of the reaction. They go into the reaction and are changed.
The products are the substances created in the reaction and what you end up with after the reaction.
In an equation, the reactants are to the left of the arrow and the products are to the right.
Let's look at the equation given:
\(2FeO+ 2Cl_2 \rightarrow 2FeCl_2+O_2\)
FeO and Cl₂ start the reaction and are to the left of the arrow, so they must be the reactants.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Which description of groundwater is correct?
Groundwater cannot be replenished and is, therefore, a limited resource.
Groundwater cannot be replenished, but its supply is practically infinite.
Groundwater can be replenished by rainfall.
Groundwater can be replenished through reactions in Earth’s core.
not a timed or graded assignment. quick, not too long answer = amazing review :)
1004kPa
ExplanationsAccording to the dalton's law of partial pressure, the total pressure of by a gas is equal to the sum of its partial pressure
Given the following parameters
• Pressure of Oxygen = 287kPa
,• Pressure of Nitrogen = 429kPa
If the pressure in container A is tripled, the new pressure will be:
New Pressure of Oxygen = 3(287) = 861kPa
If the pressure in B is reduced by one-third, then;
New Pressure of nitrogen = 429/3 = 143kPa
Pressure inside the container C = 861 + 143
Pressure inside the container C = 1004kPa
Hence the new pressure in the container C after the changes will be 1004kPa
The law above fits into the situation because it is a way of measuring a gas's partial pressure
Describe an experiment to show that pressure acts in all directions in liquids.
We frequently observe kids playing with polythene bags filled with water that have little holes drilled into them at various locations so they can sprinkle water on other kids. Through this experiment, we can say that pressure acts in all directions in liquids.
Liquid's pressureSince both liquids and gases may flow, they are both referred to as fluids. Fluids under rest pressure behave uniformly in all directions.
Weather forecasts can be made using barometers. They track the evolution of atmospheric pressure throughout time.
On weather forecast maps, pressure variations appear as an isobar pattern. Predictions are made using these changes in pressure, and they are fairly accurate when combined with wind observations.
Pressure and depth in liquidsAs you go away from a liquid's surface, pressure rises. for instance: A bucket has three holes that are all the same size. Since there is more pressure at the bucket's bottom, the water spills out more forcefully. Dams are thicker at the bottom for this reason.
Learn more about Pressure here:-
https://brainly.com/question/27984798
#SPJ9
how do you find protons in an atom?
Answer:
Protons are always found in the nucleus of an atom.
Explanation:
Protons and neutrons make up the nucleus of an atom, which is in the center. The electrons "orbit" the nucleus.
Answer:
The number of protons, neutrons, and electrons in an atom can be determined from a set of simple rules.
Explanation:
The number of protons in the nucleus of the atom is equal to the atomic number (z). The number of electrons in a neutral atom is equal to the number of protons.
b) Verify by calculation what volume of the base it should take to neutralize 50.0 mL of 0.1 M HCl (aq)
with 0.1 M NaOH(aq).
Answer:
50 ml
Explanation:
n = moles
c = concentration
v = volume
n = c × v
HCl + NaOH --> NaCl + H2O
HCl:
50 ml = 50 cm³ = 0.05 dm³
n = 0.05 × 0.1
n = 0.005
Ratio of HCl to NaOH:
HCl : NaOH
Based on reaction equation:
1 : 1
0.005 : x
x = 0.005
NaOH:
0.005 = 0.1 × v
v = 0.05
0.05 dm³ = 50 cm³ = 50 ml
burning 12g of urea raise temp of water by 30C what is the enthalpy of combustion for 1kg urea
The enthalpy of combustion for 1kg of urea is -1223525.84 J/mol.
Urea is a compound that is used in fertilizers and in some plastics.The enthalpy of combustion for urea is the amount of energy that is released when urea is burned. In order to calculate the enthalpy of combustion for 1kg of urea, we need to use the information that is provided to us in the question. Let us start by writing down the balanced equation for the combustion of urea: CO(NH2)2 + 3/2 O2 → CO2 + 2H2O + N2
The balanced equation shows that 1 mole of urea reacts with 1.5 moles of oxygen gas to produce 1 mole of carbon dioxide, 2 moles of water, and 1 mole of nitrogen gas. The enthalpy change for this reaction is equal to the amount of energy that is released when 1 mole of urea is burned.
The heat of combustion (ΔHc) of urea is -632.6 kJ/mol. This means that 632.6 kJ of energy is released when 1 mole of urea is burned. We know that 12g of urea raised the temperature of water by 30°C. We can use this information to calculate the amount of energy that was released when 12g of urea was burned.
The specific heat capacity of water is 4.18 J/g°C. This means that it takes 4.18 J of energy to raise the temperature of 1 gram of water by 1°C. Therefore, it takes 4.18 x 1000 = 4180 J of energy to raise the temperature of 1 kg of water by 1°C.
We know that 12g of urea raised the temperature of water by 30°C. Therefore, the amount of energy that was released when 12g of urea was burned is:
Energy = mass x specific heat capacity x temperature change
Energy = 0.012 kg x 4180 J/kg°C x 30°C
Energy = 1497.6 J
We can now use this information to calculate the enthalpy of combustion for 1kg of urea:
Enthalpy of combustion = energy released / moles of urea burned
Enthalpy of combustion = 1497.6 J / (0.012 kg / 60.06 g/mol)
Enthalpy of combustion = - 1223525.84 J/mol
for such more questions on enthalpy
https://brainly.com/question/14047927
#SPJ8