Answer: D
Step-by-step explanation:
only answer that makes sense. one at -2 is definitely an endpoint, one at 0 is infinite because you can’t see ends aren’t indicated.
A right triangular pyramid has a 12-meter height and a base with legs that are 3meters and 4 meters long. Find the volume of the triangular pyramid.O 24 m3O 144 m3O 72 m30 48 m3
ANSWER
EXPLANATION
We want to find the volume of the right triangular pyramid given.
The volume of a pyramid is given as:
where B = base area; h = height
We have to first find the area of the base, B.
The base is a right-angle triangle with legs 3 meters and 4 meters. Let us make a quick sketch of the triangle:
Therefore, we can find the area of this triangle using:
where b = base length = 3 m
h = height = 4 m
Therefore, we have that:
Hence, the volume of the right triangular pyramid is:
The answer is Option A.
Find the equation in standard form of the circle with center at (4, −1) and that passes through the point (−4, 1).
Answer:
The standard form of the equation of a circle with center at (h, k) and radius r is:
(x - h)^2 + (y - k)^2 = r^2
We are given that the center of the circle is (4, -1), so h = 4 and k = -1. We also know that the circle passes through the point (-4, 1), which means that the distance from the center of the circle to (-4, 1) is the radius of the circle.
The distance between two points (x1, y1) and (x2, y2) is given by the distance formula:
d = sqrt((x2 - x1)^2 + (y2 - y1)^2)
So the radius of the circle is:
r = sqrt((-4 - 4)^2 + (1 - (-1))^2) = sqrt(100) = 10
Now we can substitute the values of h, k, and r into the standard form equation of a circle:
(x - 4)^2 + (y + 1)^2 = 10^2
Expanding the equation gives:
x^2 - 8x + 16 + y^2 + 2y + 1 = 100
Simplifying and putting the equation in standard form, we get:
x^2 + y^2 - 8x + 2y - 83 = 0
Therefore, the equation in standard form of the circle with center at (4, −1) and that passes through the point (−4, 1) is:
x^2 + y^2 - 8x + 2y - 83 = 0
PLEASE HELP!!!!
IM SO LOST
Answer:
To calculate
For all
In India, many families use mini solar cookers on their balconies. In most instances, the sun’s rays reflect off the parabolic mirror toward the dish, which is placed 32 cm from the center of the cooker. The distance from the vertex to the edge of the cooker is 68 cm.
A parabolic reflector in orange that is 32 cm away from the center of the cooker. The center of the cooker is labeled as (0,0) and the vertex of the parabola is labeled as (-32,0). The distance from the vertex to the edge of the cooker is 68 cm.
1. What are the coordinates of the edges of the cooker? What is the distance all the way across the cooker from the two points labeled "edge of the cooker?"
2. Write an equation for the parabolic mirror using the coordinates. Explain how you wrote the equation.
1. The distance all the way across the cooker. In this case, 136 cm.
1. The coordinates of the edges of the cooker can be determined by considering the distance from the vertex to the edge of the cooker. Given that the distance from the vertex to the edge is 68 cm, and the vertex is at (-32, 0), we can find the coordinates of the edges as follows:
One edge of the cooker: (-32 + 68, 0) = (36, 0)
The other edge of the cooker: (-32 - 68, 0) = (-100, 0)
The distance all the way across the cooker. In this case, it is 36 - (-100) = 136 cm.
2. To write an equation for the parabolic mirror, we can use the standard form of a parabolic equation, which is y = a(x - h)² + k, where (h, k) represents the vertex of the parabola.
In this case, the vertex is at (-32, 0).
The equation becomes y = a(x + 32)² + 0.
Substituting these coordinates into the equation, we get:
0 = a(36 + 32)² + 0
0 = a(68)²
0 = 4624a
From this, we can see that a = 0, which means the equation simplifies to y = 0, indicating that the parabolic mirror is a straight line along the x-axis.
Learn more about Parabola here:
https://brainly.com/question/29267743
#SPJ1
In the exponential decay function ƒ(x) = a • bx, the b is between 0 and 1.
True
False
False, In the exponential decay function ƒ(x) = a • bx, the b is between 0 and 1.
What is exponential decay function?
In mathematics, the term "exponential decay" refers to the process of a constant percentage rate decline in a value over time.
It can be written as y=a(1-b)x, where y represents the final amount, a represents the initial amount, b represents the decay factor, and x is the amount of time that has passed.
How do you calculate an exponential function?
The equation f(x) = ax, in which the input variable x appears as an exponent, describes an exponential function. Both the exponential function and the value of x are dependent on the exponential curve.
The exponential function, which has the form, is a significant mathematical function. f(x) = ax.
Learn more about exponential decay function
brainly.com/question/14355665
#SPJ1
An airline ticket costs $220. Jameson receives a 10% discount on the ticket but is also charged an 8.25% service fee. what is the discounted price of the ticket? What is the total cost of the ticket with the discount and service fee?
The discounted price of the ticket is $198.
The total cost of the ticket with the discount and service fee is $214.33.
What is a percentage?A percentage is a ratio or number that may be expressed as a fraction of 100. Moreover, it is denoted by the sign "%."
Given:
The cost of a ticket on an airline is $220.
And Jameson receives a discount of 10%.
To find the discounted price:
The discounted price = 220 - 220 x 10 / 100
The discounted price = $198.
And the service charge is 8.25%.
So, the amount of service charge,
= 198 x 8.25/100
= 16.33
The total cost of a ticket = $198 + $16.33 = $214.33
Therefore, the cost is $214.33.
To learn more about the percentage;
https://brainly.com/question/24159063
#SPJ9
Find the volume of the composed figure. 8 cm 8 cm 2 cm 4 cm 3cm Enter the correct number in the box. Hint cu cm 7 8 9 4 5 6
Answer:
152 cubic centimeters.
Explanation
To find the volume of the composed figure, we divide it into two as shown below:
This divides the figure into two rectangular prisms with the following dimensions:
• 8cm by 8cm by 2cm
,• 4cm by 3cm by 2cm
The volume of any rectangular prism is obtained using the formula:
Therefore, we add the volume of the two prisms:
For questions 3 and 4, find F -1(x), the inverse of F(x)
A function g(x) is the inverse funtion of f(x) if for y = f(x), x = g(y).
The given function is,
where,
Therefore,
Replace x with y
Solve for y by add 10 to both sides of the equation
Hence,
Therefore, the inverse of f(x) is x + 10.
TODAY'S BRAIN TEASER
Solve it and gain 50 points plus BRAINLIEST
Solve any two questions out of three
WRONG COPIED OR SPAM WILL BE INTOLERABLE
SO SO SO NOT WASTE TIME IF YOU DON'T KNOW
GOOD LUCK
Answer:
Question 3
Find the range of the function for the domain 2 < x < 3
Therefore, the range of
This means that for the function to be continuous, when the domain is x=3, f(x) = 8
Similarly, when the domain is x > 3, f(x) > 8
Therefore,
Question 5
Use integration by parts:
A Norman window has the shape of a rectangle surmounted by a semicircle. Suppose the outer perimeter of such a window must
be 600 cm. In this problem you will find the base length a which will maximize the area of such a window. Use calculus to find
an exact answer.
When the base length is zero, the area of the window will be zero. There is also a limit on how large scan be: when x is large
enough, the rectangular portion of the window shrinks down to zero height. What is the exact largest value of r when this
occurs?
Largest x = ?
The base length that will maximize the area for such a window is 168.03 cm. The exact largest value of x when this occurs is 233.39 cm
Suppose we make an assumption that:
(x) should be the width of the rectangle base;(h) should be the height of the rectangleAlso, provided that the diameter of the semi-circle appears to be the base of the rectangle, then;
the radiusand, the perimeter of the window can now be expressed as:
Given that the perimeter = 600 cm
∴
Since h > 0, then:
By rearrangement and using the inverse rule:
Thus, the largest length x = 233.39 cm
However, the area of the window is given as:
Now, at maximum, when the area A = 0. Taking the differentiation, we have:
Making x the subject of the formula, we have:
x = 168.03 cm
Taking the second derivative:
Therefore, we can conclude that the maximum area that exists for such a window is 168.03 cm
Learn more about derivative here:
https://brainly.com/question/9964510?referrer=searchResults
Natalie invests $2,000 into a savings account
which earns 11% per year. In 20 years, how
much will Natalie's investment be worth if
interest is compounded monthly? Round to the
nearest dollar.
Answer:
We can use the formula for compound interest to find the future value (FV) of Natalie's investment:
FV = P * (1 + r/n)^(n*t)
Where:
P is the principal amount (the initial investment), which is $2,000 in this case
r is the annual interest rate as a decimal, which is 11% or 0.11
n is the number of times the interest is compounded per year, which is 12 since interest is compounded monthly
t is the number of years, which is 20
Substituting the values into the formula, we get:
FV =
2
,
000
∗
(
1
+
0.11
/
12
)
(
12
∗
20
)
�
�
=
2,000 * (1.00917)^240
FV = $18,255.74
Therefore, after 20 years of compounded monthly interest at a rate of 11%, Natalie's investment of 2,000 will be worth approximately 18,256.
Answer:
$17,870
Step-by-step explanation:
You must use the formula for compound interest.
A = P(1 + r/n)^nt
I suggest you look it up at some point so that you can do these more easily in the future!
Kaitlyn sells mini donuts by the box size. The amount of space in the boxes is known as the ________. A. Volume B. Area C. Perimeter
Answer: Area
Step-by-step explanation:
god bless
Is 10 pints greater less or equal to 5 quarts
Answer:
10 pints is equal to 5 quarts
Step-by-step explanation:
PLEASE HELP ME IM TAKING A TIMED TEST
IF YOUR THE FIRST PERSON TO ANSWER AND IT'S RIGHT I WILL GIVE YOU BRAINLEST
Answer:
0.1 = -0.1
1/7 = 1/7
10 = -10
-7 = 7
Explaination: They are opposite
0.1 = -0.1
1/7 = -1/7
10 = -10
-7 = 7
If the answer has no negative sign than the answer will be positive but if the answer is positive the answer will be negitive
If sine of the quantity x plus y end quantity equals radical 2 over 2 times sine of x plus radical 2 over 2 times cosine of x comma what is the value of y?.
If the sine of the quantity x plus y end quantity equals radical 2 over 2 times the sine of x plus radical 2 over 2 times cosine of x , the value of y is -2cos(x)
To determine the value of y in this equation, we can use the trigonometric identity sin(A+B)= sin(A)cos(B)+cos(A)sin(B).By rearranging this identity, we can isolate y on side of the equation and solve for it. first, we can isolate the sine of x by subtracting radical 2 over 2 times the cosine of x from both sides of the equation, and we can isolate radical 2 over 2 times the sine of x by dividing both sides of the equation by radical 2 over 2.
We then have the follwoing equation : sin(x+y)=sin(x). Now, we can use the same trigonometric identity from the beginning to isolate y. To do this, we subtract sin(x) from both sides of the equation, and we divide both sides of the equation by cos(x). We now have the following equation: y= -2xos(x). Therefore the value of y is equal to -2cos(x)/
To know more about trigonometric identity refer to the link brainly.com/question/24377281
#SPJ4
What percent of the respondents feel that they expert player
its 68
The expert part says 68
What is the image point of (2,-5) after a translation right 4 units and up 3 units?
Answer:
(6,-2)
Step-by-step explanation:
You have the shape on your graph and move it up how ever many spaces it tells you and to the left or right however many times it tells you
Answer:
(6,-2)
Step-by-step explanation:
i hope this helps
A new gaming chair costs $309.99. You have already saved $144.99 and earn $27.50 each week babysitting. Write and solve an equation to determine how many weeks, w, you must babysit to earn enough money to buy the new gaming chair.
27.5w − 144.99 = 309.99; w = 17
27.5 + 144.99w = 309.99; w = 6
27.5w − 309.99 = 144.99; w = 17
27.5w + 144.99 = 309.99; w = 6
The linear equation we need to solve is:
$27.50*w = $309.99 - $144.99
And the solution is w = 6.
How to write and solve the equation?
We know that the cost of the gaming chair is $309.99.
To buy this, you already have saved $144.99, and save another $27.50 per week, then the amount you have after w weeks is:
f(w) = $144.99 + $27.50*w
So the linear equation we need to solve is:
$144.99 + $27.50*w = $309.99
To solve this we need to isolate w.
$144.99 + $27.50*w = $309.99
$27.50*w = $309.99 - $144.99
w = ($309.99 - $144.99)/$27.50 = 6
So they can buy the chair after 6 weeks.
Learn more about linear equations at:
brainly.com/question/13763238
#SPJ1
Ten less than twice a number is equal to at least 52. What are all the possible values of the number? Write an inequality so that X term comes first.
The inequality equation which represents Ten less than twice a number is equal to at least 52 is 10 - 2x ≥ 52 and x ≤ -21
How to write and solve inequality?Let
The unknown number = x
Ten less than twice a number is equal to at least 52;
10 - 2x ≥ 52
Subtract 10 from both sides
- 2x ≥ 52 - 10
- 2x ≥ 42
divide both sides by - 2
x ≤ 42/-2
x ≤ -21
Hence, x ≤ -21 is the solution to the inequality 10 - 2x ≥ 52 if x comes first.
Read more on inequality:
https://brainly.com/question/25275758
#SPJ1
Urgenteee
Un tronco de madera de 3,080 kg de 1m de diametro
y 10m de largo, flota en el agua ¿Cuanto es el volumen de tronco
por arriba de la superficie del agua?
The volume of the log will be 30,70,760 m³.
What is Archimedes principle?Mathematically, we can write Archimedes principle as -
F{buoyant} = - fluid density {ρ} x acceleration due to gravity {g} x volume {v}
Given is that a 3080 kg log of wood with a diameter of 1 m and 10 m long, it floats in the water.
Since the log floats on water, the density of both the log and water is same.
So, we can write volume as -
Volume = 3080 x 997 Volume = 30,70,760 m³
Therefore, the volume of the log will be 30,70,760 m³.
To solve more questions on Archimedes principle, visit the link below
https://brainly.com/question/787619
#SPJ9
{QUESTION IN ENGLISH -urgent A 3,080 kg log of wood with a diameter of 1 m and 10 m long, it floats in the water. What is the volume of the trunk above the surface of the water?}
5x - 9 = -24 + 10x
O One solution: -33
O One Solution: 3
O No Solution
O Infinite Solutions
Answer:
One Solution: 3
Step-by-step explanation:
5x - 9 = -24 + 10x
Subtract 5x from both sides. -9 = -24 + 5x
Add 24 to both sides. 15 = 5x
Dived 15/5. 3 = x
helpppp...........................
Answer:
see explanation
Step-by-step explanation:
the sum of the interior angles of a polygon is
sum = 180° (n - 2) ← n is the number of sides
a hexagon has 6 sides , then
sum = 180° × (6 - 2) = 180° × 4 = 720°
12
the polygon has 5 sides , so
sum = 180° × (5 - 2) = 180° × 3 = 540°
sum the interior angles and equate to 540
y + 90 + 120 + 90 + 110 = 540
y + 410 = 540 ( subtract 410 from both sides )
y = 130
13
the polygon has 7 sides , so
sum = 180° × (7 - 2) = 180° × 5 = 900°
sum the interior angles and equate to 900
p + 90 + 141 + 130 + 136 + 123 + 140 = 900
p + 760 = 900 ( subtract 760 from both sides )
p = 140
PLEASE HELP ME QUICK!!!
Answer:
Option D.
Step-by-step explanation:
Main concepts
Concept 1: identifying horizontal asymptote
Concept 2: assuring decreasing exponential function
Concept 1. identifying horizontal asymptote
Any exponential function of the form
Concept 2. assuring decreasing exponential function
Exponential functions of the form
Observe that the graph of the function f(x) is decreasing, and the value of b=0.5.
To ensure that g(x) also decreases, the b-value must be between 0 and 1, which eliminates option B.
Option D is the correct answer because the value of "b" is between 0 and 1 (making the graph of the function a decreasing exponential), and the number added at the end is "+2", causing the horizontal asymptote to be at a height of positive 2.
Given (x – 7)2 = 36, select the values of x. x = 13 x = 1 x = –29 x = 42
Answer:
x = 1 , x = 13
Step-by-step explanation:
(x - 7)² = 36 ( take square root of both sides )
x - 7 = ±
x = 7 ± 6
then
x = 7 - 6 = 1
x = 7 + 6 = 13
find the sum
-84 + (-11)
Answer:
-84+(-11)= -95
-84 + (-11) = -84 - 11 = -95
By the commutative property, adding a negative number is the same as subtracting that number as a positive; therefore, something + (-11) = something - 11. After changing the equation from -84 + (-11) to -84 - 11, we use regular addition properties, adding the tens place and ones place to get -95.
I need help asappppppp
Answer:150?
Step-by-step explanation:
Based on the circle graph how many pounds of milk and eggs does the average American consume each year PLS EXPLAIN FOR BRAINLEST
Answer:
Milk and Eggs = 552
Step-by-step explanation:
First add all of the other percentages together. (70%), 100%-70%=30%. 30% of 1840 = 552.
Answer:
H. 552
Step-by-step explanation:
Circle graph information:
Milk and eggs = x%Fruits and vegetables = 38%Cereals = 10%Meat and fish = 10%Sugar = 8%Fats and oils = 4%Total consumption = 1840 pounds per person
First, calculate the percentage of milk and eggs (the value of x).
Total percentages = 100%
⇒ x + 38 + 10 + 10 + 8 + 4 = 100
⇒ x + 70 = 100
⇒ x = 30
Therefore, 30% of food consumption is milk and eggs.
To calculate the number of pounds of milk and eggs the average American consumes each year, simply find 30% of the total consumption:
= 30% of 1840
= 30% × 1840
= 552
Therefore, the average American consumes 552 pounds of milk and eggs each year.
HELP SOLVE THANK YOU!
Answer:
Solution 1: 1+1
Solution 2: 1-
Step-by-step explanation:
x^2-2=2x
x^2-2x-2=0
Use quadratic equation.
(-b+-
(2+-
(2+-
(2+-
Solution 1: (2+2
Solution 2: 1-
Let's first move everything, the constants and variables to one side
The second form is in the general form of the quadratic equation:
⇒
To find the value of x, we can use the quadratic formula:
⇒ look at the diagram attached
/\
| |
| |
Answer
To answer the question, just answer in the order I solved it, because the question asks you to put the answer in ascending order which means from least to greatest.
Hope that helps!
evaluate the expression 3 to the third power multiplied by 12-2 divided by 2 iready
Find the measure of ∠AED for m∠BEC = 36.
Hello!
∠AED and ∠BEC are opposite angles
so ∠AED = ∠BEC = 36°.
∠AED = 36°