which of the following must be used to protect dental personnel from the occupational risks of nitrous oxide by reducing the n2o released into the treatment room?

Therefore, at 1.82 atm and 22°C, 218 mol of H2 will fill a volume of 888 L.

1 mole of any gas will take up 22.4 L of space at Standard Temperature and Pressure (STP). The quantity may be determined using the Ideal Gas Law and a balanced chemical equation.

The ideal gas law can be used to resolve this issue:

PV = nRT

The temperature must first be converted to Kelvin by adding 273.15:

T =22°C+273.15

= 295.15 K

After that, we may enter the following values:

P = 1.82 atm

n = 218 mol

R = 0.0821 L·atm/mol·K (gas constant)

So the equation becomes:

V = nRT / P

V = (218 mol)(0.0821 L·atm/mol·K)(295.15 K) / (1.82 atm)

V = 888 L.

To know more about volume visit:-

https://brainly.com/question/18124975

#SPJ1

The result of the computation when you follow the steps is 1.699.

A logarithm is a mathematical function that represents the exponent or power to which a specific base must be raised to obtain a given number. In simpler terms, it answers the question: "To what power must we raise a base number to obtain a certain value?"

What you should do is that on your calculator, you could press the logarithm key and then put in the value that has been shown and then the result would be displayed on your calculator.

Learn more about logarithm:https://brainly.com/question/30226560

#SPJ1

Explanation:

brain and heart froce acts between two chloramine

Answer:

Dispersion, Hydrogen-bonding, and Dipole forces act between two chloramine (NH2CI) molecules.

Explanation:

Dispersion is exerted between all molecules. Chloramine is polar, therefore dipole forces are present. The molecular geometry of chloramine (NH2Cl) is a trigonal pyramidal, therefore hydrogen-bonding forces are present.

Answer:

Explanation:

Answer:

when placed in water, a sodium pellet catches on fire as hydrogen gas is liberated and sodium hydroxide forms. chemical change = fire is a sign of chemical reaction.

Explanation:

When placed in water the sodium pellets catch the fire and liberate the hydrogen gas. On mixing with water solid sodium forms a colorless basic solution.

Sodium is a soft metal. It is a very reactive element with a low melting point. Sodium reacts very quickly with water, snow, and ice to produce sodium hydroxide and hydrogen. It is an alkali metal and the sixth most abundant metal on earth. It has a silvery white color.

It has a strong metallic luster. On reacting with oxygen it produces sodium oxide which on reacting with the water produces sodium hydroxide.

It is used to improve the structure of certain alloys and soaps. It is also used in the purification of metals. Sodium is also present in sodium chloride, an important compound found in the environment.

To learn more about sodium, refer to the link:

https://brainly.com/question/29327783

#SPJ2

In keeping with the general trends, K-Br will have the smallest bond energy. The bond energy refers to the energy that keeps the atoms in a bond together.

Bond energy is the energy that is required to hold atoms together in a bond. This energy must also be supplied when the atoms are to be separated.

We have the bond energies of each of the bons in the question, we have to note that the the smallest value of bond energy is Na-Br hence in keeping with the general trends, K-Br will have the smallest bond energy.

Learn more about bond energies: https://brainly.com/question/14842720?

Answer:

Chemistry B Semester Exam 5/4/2023

1. Cs-Br

2. K-C is ionic, and C-O is polar covalent

3. All molecules are in constant motion, so they all have some kinetic energy.

4. The reaction between substances A and B has a lower activation energy than the reaction between substances B and C.

5. More bond energy is absorbed on the reactants side than is released on the products side.

6. an exothermic reaction

7. Endothermic reactions have a higher activation energy. Endothermic reactions require more energy to break up the bonds of the reactants.

8. Heat must be released by the products in order to convert from the reactants.

9. Cooling a purple solution will turn it pink.

10.  Both are flexible, but one conducts electricity while the other insulates.

11. high pressure, high-temperature water extraction

12. steel + vanadium for shock absorption

13. 15

14. the number of atoms, type of elements, and mass of reactants and products are equal.

15. 64 grams

16. 1.503x10^23

17. The relative numbers of protons and neutrons can differ before and after the change, but the total number of those particles remains the same.

18. The plastic balls are a good representation of neutrons, but there is no splitting of nuclei as happens in fission.

19. beta minus decay

20. alpha decay

21. Greenhouse gases have more than two atoms, allowing them to vibrate and release radiation, warming the atmosphere.

22. cause: acid rain, consequence: destruction of crops

23. toxic bacteria in the water supply

24. it reaches hard to get to oil and gas deposits.

Atoms are defined as the indivisible particle of an element. An atom is a particle of matter that characterizes a chemical element.

For instance, the element of sodium is made up of only sodium atoms. Take the example of chalk. Chalk can be categorized as an element but if the chalk is broken down up to a point where it can not be divided further, this smallest element that cannot be divided further is an atom and the combination of this atom is known as an element.

Based on the above explanations, we can conclude that elements are made of atoms.

Answer: 720 g

Explanation:

To solve this we must be knowing each and every concept related to mole. Therefore, shivani measures out 6.0 moles of epsom salt (MgSO\(_4\)) to put her bath. 1,566g MgSO\(_4\) went in the bath.

A mole is merely a measuring unit. In reality, it is one of its International System of Units' seven foundation units. When current units are insufficient, new units are created.

Chemical reactions frequently occur at levels where employing grams would be inappropriate, but using absolute quantities of atoms/molecules/ions would also be misleading.

For all practical reasons, one mole of a substance in grams is nearly equal to 1 molecule for the compound per daltons.

Mathematically,

number of mole =given mass ÷ molar mass

number of mole=6.0 moles

molar mass of epsom= 261.47g/mol

substituting all the given values in the above equation, we get

6.0 moles =mass of epsom ÷ 261.47g/mol

mass of epsom =1,566g

Therefore, 1,566g  MgSO\(_4\) went in the bath.

To know more about mole, here:

brainly.com/question/15209553

#SPJ2

The force that helps keep the Earth in its orbit around the Sun is the gravitational force.

The Sun has a massive gravitational pull due to its large mass, which causes the Earth to be attracted towards it. This force of attraction is what keeps the Earth in its stable orbit around the Sun.

The gravitational force between the Sun and the Earth is balanced by the Earth's velocity and centrifugal force, which allows it to maintain a stable orbit around the Sun.

The gravitational force is the attractive force that exists between any two objects with mass. The magnitude of the gravitational force between two objects is proportional to the product of their masses and inversely proportional to the square of the distance between them.

This means that the larger the mass of the objects and the closer they are to each other, the stronger the gravitational force between them.

In the case of the Earth and the Sun, the Sun is much more massive than the Earth, which means it exerts a much stronger gravitational force on the Earth. The Earth is constantly falling towards the Sun due to the force of gravity.

However, the Earth also has a tangential velocity that keeps it moving in a circular orbit around the Sun. This is known as centrifugal force, which is the force that acts on an object moving in a circular path, pulling it away from the center of the circle.

For more question on gravitational force click on

https://brainly.com/question/28623512

#SPJ11

Claim 1: Yes, there probably will be a lunar eclipse of the moon of Kepler-47c during a year.

Claim 2: No, there probably won't be a lunar eclipse of the moon of Kepler-47c during a year.

Kepler-47c is a moon orbiting Kepler-47 AB, a binary star system. This implies that the moon's light varies on a regular basis as it circles the two stars. These changes in light might result in a lunar eclipse.

Lunar eclipses occur when the moon passes through the Earth's shadow. While Kepler-47c circles two stars, it is still subject to Earth's gravitational pull and may pass into its shadow.

Lunar eclipses occur on a regular basis, with two to four eclipses occurring on average per year. Given the frequency of lunar eclipses, Kepler-47c is likely to see at least one lunar eclipse every year.

Evidence to support this claim 2:

Lunar eclipses occur when the moon passes through the Earth's shadow. While Kepler-47c is in the Earth's gravitational field, it is not on the same orbital plane as the Earth.

While Kepler-47c circles two stars, its orbit is not known to be stable. Variations in Kepler-47c's orbit may reduce the likelihood of a lunar eclipse.

While lunar eclipses are common, they are not uniformly distributed throughout the year. The locations and motions of the Earth, moon, and sun govern the timing and frequency of lunar eclipses.

Find out more on Kepler-47c here: https://brainly.com/question/28741788

#SPJ1

The decomposition of aspirin (acetylsalicylic acid,\(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)).

The decomposition of aspirin (acetylsalicylic acid, \(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)). To determine the moles of each product formed, we need to consider the balanced chemical equation for the reaction:

\(C_{9} H_{8} O_{4} = > C_{7} H_{6}O_{3} +CH_{3} COOH\)

From the equation, we can see that for every 1 mole of aspirin, 1 mole of salicylic acid and 1 mole of acetic acid are produced.

Therefore, the moles of salicylic acid and acetic acid formed will be equal to the number of moles of aspirin that decomposes. If we know the amount of aspirin in moles, we can directly calculate the moles of each product based on stoichiometry.

For more question on aspirin

https://brainly.com/question/25794846

#SPJ8

The mass of HF produced from the given amounts of BF₃ and H₂ is 99.5 grams.

To solve this problem, we need to use stoichiometry to determine the amount of HF produced from the given amounts of BF₃ and H₂.

From the balanced equation;

2 BF₃ + 3 H₂ → 2 B + 6 HF

We can see that 2 moles of BF₃ react with 3 moles of H₂ to produce 6 moles of HF. This means that the ratio of BF₃ to HF is 2:6, or 1:3.

First, we need to calculate the number of moles of BF₃ and H₂ from their given masses and molar masses;

n(BF₃) = m(BF₃) / M(BF₃) = 40 g / 67.81 g/mol = 0.59 mol

n(H₂) = m(H₂) / M(H₂) = 5 g / 2.02 g/mol = 2.48 mol

Next, we can determine which reactant is limiting by comparing their mole ratios. The ratio of BF₃ to H₂ is 1:1.67, which means there is not enough H₂ to react with all of the BF₃. This makes H₂ the limiting reactant.

To find the number of moles of HF produced, we use the mole ratio from the balanced equation;

n(HF) = n(H₂) × (6 mol HF / 3 mol H₂) = 2.48 mol × 2

= 4.96 mol

Finally, we calculate the mass of HF produced from its number of moles and molar mass;

m(HF) = n(HF) × M(HF) = 4.96 mol × 20.01 g/mol

= 99.5 g

Therefore, the mass of HF is 99.5 grams.

To know more about mass here

https://brainly.com/question/18064917

#SPJ1

a) There are electrons of parallel spins in the same orbital

b) The electron spins should be converted to antiparallel in the orbital

c) The element belongs to group six.

We know that the orbital diagram is the diagram that can be used to show how electrons are arranged in the orbitals of an element. As such, the segment of the orbital diagram that is shown would have to correspond to a give orbital and preferable part of the outermost orbital configuration of the elements that is in question.

The orbital diagram is incorrect because two electrons in the same orbital can be seen to have parallel spins and this against the postulate of the Pauli exclusion rule. We can correct this making one of the electron to have anti parallel spin.

Learn more about orbital diagram:https://brainly.com/question/28809808

#SPJ1

Answer:The rate of enzyme reaction increases with increase in substrate concentration. Upon saturation of active site of the enzyme with the substrate, there will be no effect on the rate of reaction.

Explanation:

Enzymes are protein molecules secreted by special cells in a living organism. They are organic catalysts responsible for the metabolic reactions that take place in living organisms. Thus, glycolysis, synthesis of proteins and photosynthesis are mediated by numerous enzymes.

Also, enzymes may be classified according to the type of reaction they catalyze. They include: oxidoreductases, transferases, hydrolases, lyases, isomerases, ligases, and translocases.

From the question, catalase enzyme is a type of oxidoreductase enzyme that catalyzes the decomposition of hydrogen peroxide (substrate) into water and molecular oxygen.

The regions on the enzyme into which the substrate molecules fit are known as the ACTIVE SITES of the enzyme.

Substrate concentration is one of the factors that affect enzyme rate of reaction. The enzyme function varies with substrate concentration because the rate of enzyme reaction increases with increase in substrate concentration. Upon saturation of ACTIVE SITE of the enzyme with the substrate, there will be no effect on the rate of reaction.

Answer:

12.125 moles of Z

Explanation:

Hi! Here, since you only know the number of moles for one of the reactants, you will use the coefficients in the reaction to use the mole ratio to find your answer. Since the question states that there are 4.85 mol A and excess B, A is your limiting reactant. This means that once all of the A is used up in the reaction, you will have your maximum amount of Z left behind because there will only be B left and no A to make more Z.

The mole ratio of A:Z is 2:5, found from the coefficients in the chemical equation(2 moles of A for every 5 moles of Z).

So, start with the information that is given to you (4.85 mol A) and then use the mole ratio, like this:

4.85 mol A(\(\frac{5 mol Z}{2 mol A}\))

This way, the mol A will cancel out, leaving behind mol Z (always put the unit you are looking for on top).

Doing this leads to mol Z = 12.125 mol.

I hope this helps! Good luck with your finals!

As per the given 4.85 moles of A will produce 12.125 moles of Z, assuming excess B.

A chemical reaction is the transformation of one or more substances, known as reactants, into one or more different substances, known as products.

Chemical reactions involve the breaking and forming of chemical bonds between atoms and molecules, causing atoms to rearrange and the chemical and physical properties of the substances involved to change.

From the balanced chemical equation, we can see that 2 moles of A react with 3 moles of B to produce 5 moles of Z.

So the mole ratio of A to Z is 2:5.

Therefore, if 2 moles of A react to produce 5 moles of Z, then 4.85 moles of A will produce:

(4.85 mol A) x (5 mol Z / 2 mol A) = 12.125 mol Z

Thus, 4.85 moles of A will produce 12.125 moles of Z, assuming excess B.

For more details regarding chemical reaction, visit:

https://brainly.com/question/29762834

#SPJ2

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Similar, much older remnants of flooded forests have been discovered in Cascadia by earth scientists. On the coasts of British Columbia, Washington, Oregon, and northern California, they were found near bays and river mouths. Researchers discovered additional proof of powerful earthquakes in the same regions.

In 1997, scientists used dendrochronology — a method of dating trees by comparing ring patterns to samples of known age — on the ghost forest trees.1997 by scientists.

Because of the thinned coast, tides were able to drown coastal forests. Today's ghostly tree trunks serve as physical evidence of the devastating earthquakes. In Cascadia, similar, much older remnants of inundated forests have been discovered by earth scientists.

To know more about earthquakes visit:

https://brainly.com/question/29368492

#SPJ1

It turns electrical energy into KE.

This is the correct statement of how a generator works:

A generator is described as a device that converts motive power or fuel-based power into electric power for use in an external circuit.

Generators contrary to general opinion do not create electricity instead it uses the mechanical energy supplied to it to force the movement of electric charges present in the wire of its windings through an external electric circuit. This flow of electrons makes up  the output electric current supplied by the generator.

The present-day generators work on the principle of electromagnetic induction that was discovered by Michael Faraday.

Faraday realized that the above flow of current can be created by moving an electrical conductor in a magnetic field and this movement creates a voltage difference between the two ends of the conductor which causes the electric charges to flow, hence generating electric current.

Learn more about generators at:  https://brainly.com/question/12950635

#SPJ1

Complete question:

How does the generator work? Select the statement that describes that.

______It turns electrical energy into KE.

_____ It turns sound energy into electrical energy.

_____ It turns electrical energy into sound energy.

_____ It turns electrical energy into thermal energy.

_____ It turns KE into electrical energy.

Answer:

B. O₂

Explanation:

First we convert 192 g of O₂ into moles, using its molar mass:

Now we calculate with how many CS₂ moles would 6 moles of O₂ react with, using the stoichiometric coefficients:

As there are 4.50 moles of CS₂ and only 2 moles would react, CS₂ is in excess and O₂ is the limiting reactant.

The correct answer is option B.

Answer:

D

Explanation:

Answer:

ions

not sure but I think that's what it is

answer and explanation

we are given initial values of temperature, pressure and volume as well as the final value of temperature and pressure and we are asked to find the final volume.

we can do this using the combined gas equation

P1V1/T1 = P2V2/T2

when we plug in the values we get:

(6atm x78L)/53K = (85atm x V2/17K

8.83 = 85atm x V2 / 17K

V2 = 1.77 Liters

a)There are 0.45 moles of HNO₃ in the bottle.

b)Approximately 13 ml of the solution are required for the reaction.

a. To find the number of moles of HNO₃  in the bottle, we can use the formula:

moles = concentration (M) x volume (L)

Given that the concentration of the nitric acid solution is 6.0 M and the volume is 75.0 ml, we need to convert the volume to liters:

75.0 ml = 75.0 ml x (1 L/1000 ml) = 0.075 L

Now, we can calculate the number of moles:

moles = 6.0 M x 0.075 L = 0.45 moles

So, there are 0.45 moles of HNO₃  in the bottle.

b. To determine the volume of solution required for 5.00 g of HNO3, we need to use the molar mass of HNO3 to convert grams to moles:

moles = mass (g) / molar mass (g/mol)

Given that the molar mass of HNO₃  is 63.01 g/mol and the mass required is 5.00 g, we can calculate the number of moles:

moles = 5.00 g / 63.01 g/mol ≈ 0.079 moles

Now, we can use the concentration to find the volume:

volume (L) = moles / concentration (M)

volume (L) = 0.079 moles / 6.0 M ≈ 0.013 L

Finally, we need to convert the volume to milliliters:

volume (ml) = 0.013 L x (1000 ml/1 L) ≈ 13 ml

So, approximately 13 ml of the solution are required for the reaction.

Know more about moles    here:

https://brainly.com/question/29367909

#SPJ8

Answer: Meat and veggies/producer/plants/consumer/meat

Answer:

Singular value decomposition (SVD)

Explanation:

If u search go ogle u could find a good definition here is one I found:

"Singular value decomposition (SVD) is a technique commonly used in the analysis of spectroscopic data that both acts as a noise filter and reduces the dimensionality of subsequent least-squares fits." credit: science direct <3

Hope this helps! :) Plz mark brainliest!