Which of the following describes an adaptation?
A. a place where an organism lives
B. something that does not help an organism survive
C. something that improves an organism's ability to survive
D. a part of the animal's life cycle

The value of the partition coefficient is 11.25.  The ratio of the equilibrium concentrations of a dissolved chemical in a two-phase system made up of two mainly immiscible solvents is known as the partition coefficient (P).

A partition coefficient, also known as a distribution coefficient, in the physical sciences is the ratio of a compound's equilibrium concentrations in a mixture of two immiscible liquids.

As a result, this ratio compares how soluble the solute is in each of these two liquids. The ratio of the equilibrium concentrations of a dissolved chemical in a two-phase system made up of two mainly immiscible solvents is known as the partition coefficient (P).

When two concentrations are in equilibrium, a substance's concentration in one medium or phase (C1) is equal to its concentration in the other (C2), meaning that the partition coefficient is equal to (C1/C2)equil.

Hence, The value of the partition coefficient is 11.25.

To learn more about partition coefficient refer to:

https://brainly.com/question/16953107

#SPJ4

Answer:

The 3rd option is correct

Explanation:

The element in group 13 and period 3 is aluminium which has the electron configuration

\(1{s}^{2} 2 {s}^{2} 2 {p}^{6} 3 {s}^{2} 3 {p}^{1} \)

or [Ne] 3s^2 3p^1

The acid that is the best choice for preparing a pH = 2.00 buffer is HC2H3O2.

Let's understand this in detail:

A buffer is a chemical solution that can resist changes in pH when an acid or base is added. A pH buffer is a solution containing a weak acid and its conjugate base or a weak base and its conjugate acid.

A pH is a scale that measures the acidity or basicity of a solution. On a scale of 1 to 14, the pH range is from acid to base. Acidic solutions have a pH of less than 7, neutral solutions have a pH of 7, and basic solutions have a pH of more than 7.

An acid is a chemical that has a sour taste and reacts with a base or metal to form salt and water. The acid that is the best choice for preparing a pH = 2.00 buffer is HC2H3O2. This is because the dissociation constant Ka of HC2H3O2 is low, and pH value of 4.76. This means that its pKa value is 4.76. Hence, at pH 2, HC2H3O2 will behave as a weak acid, and its conjugate base will be its conjugate base, C2H3O2–.

The pH of a buffer solution can be calculated using the Henderson-Hasselbalch equation:

pH = pKa + log([A–]/[HA])

where pKa is the dissociation constant, and [A–] and [HA] are the conjugate base and acid concentrations, respectively.

The chemical energy contained in gas changed into energy to run the car. The plants store chemical energy produced during photosynthesis. Mr. Tracy had the energy to pick up the plants and carry them to the car because of the chemical energy stored in foods.

Mr. Tracy drove to the nursery to buy plants for his garden. While driving, the chemical energy stored in the gas present in the gas tank in his car is burned to produce energy that drives the engine of the car.

The plants that Mr. Tracy was going to buy store chemical energy through the production of carbohydrates via the process of photosynthesis. Mr. Tracy had the energy to pick up the plants and carry them to the car because of the energy stored in foods.

The foods are oxidized during respiration to unlock the energy and convert them to usable energy by the body, usally in the form of ATP. Respiration involves series of steps, including the conversion of glucose to pyruvate molecules and the conversion of the pyruvates to carbon dioxide and water.

More on energy conversion can be found here: https://brainly.com/question/12503064

#SPJ1

(a). First, we need to identify the limiting reactant. Let's calculate the number of moles of each reactant:

For salicylic acid, we have that its molar mass is 138.1 g/mol (you can calculate it using the periodic table and doing the algebraic sum):

And now, let's see the number of moles of 17.7 g of acetic anhydride, where its molar mass is 102.1 g/mol:

Now, you can realize that in the reaction 2 moles of salicylic acid react with 1 mol of acetic anhydride. Let's see how many moles of acetic anhydride requires to react with 0.19 moles of salicylic acid:

You can realize that we obtained less number of moles for acetic anhydride, meaning that the acetic anhydride is in excess and the salicylic acid is the limiting reactant, so we're going to work with this compound to find how many grams of aspirin is produced:

In the chemical equation, 2 moles of salicylic acid reacted produces 2 moles of aspirin, so the mole ratio between these two is 1:1 which is telling us that 0.19 moles of salicylic acid are producing 0.19 moles of aspirin. With this value, we can calculate the mass of aspirin as our theoretical yield. The molar mass of aspirin is 180.2 g/mol:

Remember that the theoretical yield is the amount that we expect to get in the reaction, in this case, is 34.24 grams of aspirin.

(b). Let's see the formula for percent yield:

where the actual amount of product is what we obtained from the reaction, in this case, 30.7 grams of aspirin and the theoretical yield that we've already found (34.24 g). Replacing these values, we're going to have:

The percentage yield of the experiment is 89.66%.

The addition of alcohol dehydrogenase plus its substrate allows regeneration of NAD+. Now oxidized NAD+ is available for the additional TCA reactions in which additional CO2 can be produced.

The reduction of nicotinamide adenine dinucleotide to NADH by a class of dehydrogenases known as alcohol dehydrogenases allows for the interconversion of alcohols with aldehydes or ketones.

Alcohol is made of ethanol, which is metabolized by the enzyme alcohol dehydrogenase (ADH) into the poisonous compound acetaldehyde. Acetaldehyde is then converted by the liver enzyme aldehyde dehydrogenase (ALDH) into acetate, a less harmful substance that decomposes into water and carbon dioxide.

Alcohol is metabolized by the liver using cytochrome P450 2E1 and alcohol dehydrogenase (ADH) (CYP2E1). Although ethanol is metabolized into acetaldehyde by both enzymes, CYP2E1 activity also generates reactive oxygen species (ROS) that encourage oxidative stress.

To know more about alcohol dehydrogenase visit the link:

https://brainly.com/question/15409049?referrer=searchResults

#SPJ4

Answer:

covection

Explanation:

Answer:

Explanation:

Overuse of antibiotics leads to bacteria's resistance against our drugs. This is increasing at an alarming rate and the reason is that overuse of antibiotics kills bacteria that lack the "resistance" gene or gene that can help them survive the antibiotics (similar is the case for insects that die to insecticides). But, some bacteria can have random mutations in their gene that can help them survive the antibiotic (similar is the case for some insects that can survive the insecticide), thus the surviving bacteria give rise to next generation of bacteria that are resistant to the given antibiotic (similar to how insects that survive the insecticide give birth to new insects that are resistant to insecticide too). Soon, every generation adds new antibiotic resistant bacteria (or new insecticide resistant insects in the case of insects) which is dangerous for all of life on this planet. Therefore, both are similar in the sense that new generations of these organisms will be resistant to our weapons against them.

Explanation:

Jen runs at a little under 10m per second. Ann runs about 6m per second. Jen won because her time was faster. She reached 50m by 6 seconds while it took Ann 8 seconds. If the graph displayed their motion stopping, the line would continue straight horizontally along the 50m line as they would not be running anymore.

The percent ionization of a 0.250 m solution of benzoic acid is approximately 2.04%.

For benzoic acid (C6H5COOH), the ionization reaction is:

C6H5COOH + H2O ↔ C6H5COO- + H3O+

The equilibrium constant for this reaction is denoted as Ka.

Ka = [C6H5COO-][H3O+]/[C6H5COOH]

Ka = x^2 / (C - x)

Solving for x, we get:

x = sqrt(Ka * (C - x))

x = sqrt(6.46 × 10^-5 * 0.250) = 0.0051 M

% ionization = (x / C) * 100% = (0.0051 / 0.250) * 100% ≈ 2.04%

Ionization is a process in which an atom, molecule or ion loses or gains one or more electrons, resulting in the formation of an ion. This can occur through various mechanisms, such as through collisions with other particles, exposure to radiation, or chemical reactions.

When an atom loses an electron, it becomes positively charged and is called a cation. Conversely, when an atom gains an electron, it becomes negatively charged and is called an anion. The resulting ions may have different chemical and physical properties compared to the neutral atom or molecule. Ionization plays a crucial role in various chemical and biological processes, including the formation of chemical bonds, the functioning of enzymes, and the transmission of nerve impulses.

To learn more about Ionization visit here:

brainly.com/question/28385102

#SPJ4

The net ionic equation for the reaction of formic acid (HCOOH) with ammonia (NH₃) is:

HCOOH + NH₃ → NH₄⁺ + HCOO⁻

To write the net ionic equation, we need to first write the balanced molecular equation for the reaction between formic acid and ammonia:

HCOOH + NH₃ → NH₄⁺ + HCOO⁻

In this equation, formic acid (HCOOH) reacts with ammonia (NH₃) to form ammonium ion (NH₄⁺) and formate ion (HCOO⁻).

Next, we identify the spectator ions, which are ions that do not participate in the actual chemical reaction. In this case, the spectator ions are H⁺ and OH⁻.

The net ionic equation is obtained by removing the spectator ions from the balanced molecular equation. In this reaction, the spectator ions are H⁺ and OH⁻. Therefore, the net ionic equation is:

HCOOH + NH₃ → NH₄⁺ + HCOO⁻

The net ionic equation focuses only on the species that are directly involved in the reaction, simplifying the representation of the chemical process. It shows the essential components of the reaction without including the spectator ions.

To know more about ionic equation refer here:

https://brainly.com/question/32721028#

#SPJ11

Answer: The limiting reactant is hydrogen gas and the mass of excess reactant \((SnO_2)\) left over is 197.43 g

Explanation:

Limiting reagent is defined as the reagent which is completely consumed in the reaction and limits the formation of the product.

Excess reagent is defined as the reagent which is left behind after the completion of the reaction.

The number of moles is defined as the ratio of the mass of a substance to its molar mass.

The equation used is:

......(1)

We are given:

Given mass of \(SnO_2\) = 351.3 g

Molar mass of \(SnO_2\) = 150.71 g/mol

Putting values in equation 1, we get:

\(\text{Moles of }SnO_2=\frac{351.3g}{150.71g/mol}=2.33mol\)

At STP conditions:

22.4 L of volume is occupied by 1 mole of a gas

Applying unitary method:

45.8 L of volume will be occupied by = \(\frac{1mol}{22.4L}\times 45.8L=2.04mol\) of hydrogen gas

For the given chemical reaction:

\(SnO_2+2H_2\rightarrow Sn+2H_2O\)

By stoichiometry of the reaction:

If 2 moles of hydrogen gas reacts with 1 mole of \(SnO_2\)

So, 2.04 moles of hydrogen gas will react with = \(\frac{1}{2}\times 2.04=1.02mol\) of \(SnO_2\)

As the given amount of \(SnO_2\) is more than the required amount. Thus, it is present in excess and is considered as an excess reagent.

Thus, hydrogen gas is considered a limiting reagent because it limits the formation of the product.

Moles of excess reactant (\(SnO_2\)) left = [2.33 - 1.02] = 1.31 moles

We know, molar mass of \(SnO_2\) = 150.71 g/mol

Putting values in equation 1, we get:

\(\text{Mass of }SnO_2=(1.31mol\times 150.71g/mol)=197.43g\)

Hence, the limiting reactant is hydrogen gas and the mass of excess reactant \((SnO_2)\) left over is 197.43 g

The equilibrium constant, K, is a value that indicates the extent to which a reaction will proceed towards products at equilibrium.

If the value of K is greater than 1, it means that the products are favored at equilibrium, indicating that the reaction will proceed more towards products. On the other hand, if the value of K is less than 1, it means that the reactants are favored at equilibrium, indicating that the reaction will proceed more towards reactants.
To determine whether the value of K is greater than 1 or less than 1 for a specific reaction, we need to look at the balanced chemical equation for the reaction and calculate the equilibrium constant using the concentrations or pressures of the reactants and products at equilibrium. Without knowing the specific reaction, we cannot provide a definitive answer.

To determine if the value of the equilibrium constant, K, for the reaction is greater than 1 or less than 1, you need to consider the relationship between the concentrations of products and reactants at equilibrium. The equilibrium constant, K, is defined as the ratio of the concentrations of products to the concentrations of reactants, raised to the power of their respective stoichiometric coefficients.
If K > 1, it indicates that the concentration of products is greater than the concentration of reactants at equilibrium, meaning the reaction favors the formation of products.
If K < 1, it indicates that the concentration of reactants is greater than the concentration of products at equilibrium, meaning the reaction favors the formation of reactants.
In order to justify the value of K for the given reaction, you would need the equilibrium concentrations of the products and reactants or other information that allows you to determine the ratio of product concentrations to reactant concentrations at equilibrium.

Visit here to learn more about  equilibrium constant:

brainly.com/question/10038290

#SPJ11

Answer:

∴ Q = -7.52kCal

Explanation:

Using the formula for specific heat capacity:

Q = mcΔT

where ΔT = change in temperature (final - initial)  = (0 - 100)°C = -100°C

m = mass (g) = 75g

c = specific heat capacity = 4.2 J/g°C in water

⇒ Q = 75 × 4.2 × -100

= -31,500J

But 1J - 0.000239kCal

∴ Q = -7.52kCal

Let me know if I can be of further assistance.

The amount of octane needed is equal to the amount of carbon dioxide and water produced, which is 16 + 18 = 34 molecules.

The given response is displayed below. When this hydrocarbon (C8H18 C 8 H 18) burns with oxygen (O2) to produce carbon dioxide (CO2 C O 2) and water, this chemical reaction is a combustion reaction ( H2O H 2 O ).

Determine the substance's molecular weight for one mole in order to calculate the necessary number of molecules. Next, divide the molar mass value by the molecular mass, and multiply the result by the Avogadro constant.

To know more about molecules visit:-

https://brainly.com/question/19556990

#SPJ1

The maximum safe operating temperature the engineer should recommend for this reaction is approximately 1063.77 degrees Celsius.

To calculate the maximum safe operating temperature, we need to consider the dimensions of the vessel, the maximum safe pressure, and the amount of gas inside.

First, let's convert the dimensions of the vessel from centimeters to meters:

Width = 48.0 cm = 0.48 m

Height = 57.6 cm = 0.576 m

Next, we need to calculate the volume of the vessel:

Volume = π * (radius)^2 * height

The radius of the vessel can be calculated as half of the width:

Radius = 0.48 m / 2 = 0.24 m

Volume = π * (0.24 m)^2 * 0.576 m

Volume ≈ 0.099 m^3

Now, we can use the ideal gas law to determine the maximum safe operating temperature. The ideal gas law is given by:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature.

Rearranging the equation to solve for T:

T = (PV) / (nR)

To calculate the number of moles, we can use the molar mass of carbon dioxide (CO2):

Molar mass of CO2 = 12.01 g/mol (for carbon) + 2 * 16.00 g/mol (for oxygen)

Molar mass of CO2 ≈ 44.01 g/mol

Converting the mass of carbon dioxide from kilograms to grams:

Mass of CO2 = 2.45 kg * 1000 g/kg

Mass of CO2 = 2450 g

Now, we can calculate the number of moles:

Number of moles = Mass of CO2 / Molar mass of CO2

Number of moles = 2450 g / 44.01 g/mol

Number of moles ≈ 55.67 mol

The gas constant R is approximately 8.314 J/(mol·K).

Now, we can substitute the values into the equation:

T = (3.40 MPa * 0.099 m^3) / (55.67 mol * 8.314 J/(mol·K))

T ≈ 1063.77 K

Converting from Kelvin to Celsius:

T ≈ 1063.77 °C

The maximum safe operating temperature that the engineer should recommend for this reaction is approximately 1063.77 degrees Celsius.

To know more about temperature visit :

https://brainly.com/question/27944554

#SPJ11

Answer:

A

Explanation:

Answer:

B

Explanation:

In a chemical reaction, the number of each element should be equal on both the reactant and product side.

When 156.32 g of barium hydroxide is reacted, approximately 142.34 g of aluminum hydroxide can be produced, based on the balanced chemical equation and stoichiometry.

To determine the amount of aluminum hydroxide that can be produced when 156.32 g of barium hydroxide is reacted, we need to consider the balanced chemical equation for the reaction and use stoichiometry.

The balanced chemical equation for the reaction is:

Ba(OH)2 + 2AlCl3 → 2Al(OH)3 + 3BaCl2

From the balanced equation, we can see that for every 1 mole of Ba(OH)2, 2 moles of Al(OH)3 are produced.

First, we need to calculate the number of moles of barium hydroxide (Ba(OH)2) in 156.32 g:

Molar mass of Ba(OH)2 = (137.33 g/mol + 2(16.00 g/mol + 1.01 g/mol)) = 171.34 g/mol

Moles of Ba(OH)2 = mass / molar mass = 156.32 g / 171.34 g/mol = 0.911 mol

Now, using the stoichiometry of the balanced equation, we can determine the moles of aluminum hydroxide (Al(OH)3) produced:

Moles of Al(OH)3 = 2 × Moles of Ba(OH)2 = 2 × 0.911 mol = 1.822 mol

Finally, to convert the moles of aluminum hydroxide to grams, we need to multiply by the molar mass of Al(OH)3:

Molar mass of Al(OH)3 = (26.98 g/mol + 3(16.00 g/mol + 1.01 g/mol)) = 78.00 g/mol

Mass of Al(OH)3 = Moles of Al(OH)3 × molar mass = 1.822 mol × 78.00 g/mol = 142.34 g

Therefore, when 156.32 g of barium hydroxide is reacted, approximately 142.34 g of aluminum hydroxide can be produced.

For more such questions on barium hydroxide visit;

https://brainly.com/question/29344018

#SPJ8

Tetrodotoxin (TTX) specifically affects voltage-gated sodium channels.

These channels are responsible for the generation and propagation of action potentials in excitable cells, including neurons and muscle cells. TTX binds tightly to a specific site on the outside of the sodium channel, blocking the movement of sodium ions through the channel pore.

By blocking sodium channels, TTX prevents the influx of sodium ions into cells during depolarization, effectively inhibiting the generation and propagation of action potentials. This leads to the disruption of normal electrical signaling in excitable tissues, resulting in various physiological effects depending on the affected tissues.

Due to its potent inhibitory effects on sodium channels, TTX is known for its use as a toxin, primarily found in pufferfish and certain other marine organisms. Ingesting TTX-contaminated seafood can lead to severe poisoning, characterized by paralysis, respiratory failure, and potentially fatal consequences.

Research on TTX and its interactions with sodium channels has also provided valuable insights into the function and structure of these channels, contributing to our understanding of electrical signaling in cells and the development of drugs targeting sodium channels for therapeutic purposes.

Learn more about Tetrodotoxin from the link given below.

https://brainly.com/question/2927710

#SPJ4

Answer:

Yes, water molecules remain the same despite the phase

Explanation:

When water is in the form of ice, it molecules remain the same only the distance between the molecule. This distance is higher than that of the inter molecular distance between liquid water molecules. Due to this reason ice is lighter than water.  

Now in gaseous phase, the intermolecular distance increases thereby making it lighter than solid ice and liquid water.

Answer:

4.2 gigagrams

Explanation:

kilo = 1,000

giga = 1,000,000,000

milli = .001

Answer:

Choice B

They are polar climates because they are dry

and cold

The wall of copper (thermal conductivity = 400 W/m*K) that needs to provide the same insulation as a 4-cm polystyrene board (thermal conductivity = 0.04 W/m*K) must have a thickness of 400 meters.

The insulation of a material is directly proportional to the R factor. The higher the R the higher is the insulation of the material.

The R factor is given by:  

\( R = \frac{L}{k} \)   (1)

Where:

L: is the thickness

k: is the thermal conductivity

The thickness of the copper wall can be calculated with equation (1):

\( L_{copper} = R*k_{copper} \)

Where:

\( k_{copper} \): is the thermal conductivity of copper = 400 W/(m*K)  

Since the copper wall must provide the same insulation as a polystyrene board, we have:

\( L_{copper} = R*k_{copper} = \frac{L_{polystyrene}}{k_{polystyrene}}*k_{copper} = \frac{0.04 m}{0.04 W/(m*K)}*400 W/(m*K) = 400 m \)

Therefore, the copper wall must have a thickness of 400 meters.

Learn more about thermal conductivity here:

I hope it helps you!  

Answer:

1 × 10-¹ moldm-³

Explanation:

Pkw = PH + POH

14 = 13 + POH

POH = 1

so , [OH-] = 1 × 10-¹ moldm-³

The given problems are related to isotopes for 1 st solution it is ¹²O isotope with 8 protons and electrons and for ³He there are 1 neutron ,2 electron and mass number is 3.

Isotopes are defined as substances having same number of protons but different number of neutrons.Number of protons is characteristic for determining position of elements in the periodic table.

Since,all isotopes have the same number of protons and hence have same position.They have similar chemical properties as they have same number of electrons.

They find applications in the field of nuclear medicine and oil and gas research . There are 2 types of isotopes : stable and unstable

Learn more about isotopes,here:

https://brainly.com/question/27475737

#SPJ1

1) The speed of the particles would increase when heated

2) The balloon would expand when heated and contract when cooled.

3) On a hot day, the pressure of the gas in a beverage increases

4) The mercury thermometer works by expanding or contracting in response to temperature change.

We know that one of the effects of temperature is that it is able change the molecular motion of an object. Thus the molecules of an object are able to move faster when heat is applied and they are able to slow down when the heat is removed.

This is why a balloon would have a greater volume when the temperature is increased as the gas molecules spread out. The volume would reduce or decrease when the temperature is reduced.

Also, on a hot day, a beverage would tend to be more fuzzy as the pressure of the gas in the beverage would increase as the temperature is increased.

Lastly, when we use the mercury thermometer, the volume of the mercury would increase and this is the reason for the expansion of the mercury during temperature measurement.

Learn more about temperature:https://brainly.com/question/11464844

#SPJ1

Answer:

there is no question posted