Which of the following changes in reaction conditions will alter the composition of an equilibrium mixture of gases for a reaction having unequal moles of gaseous products and gaseous reactants?
removing of products
increasing the temperature
decreasing the pressure
All of these will alter the equilibrium concentrations.

Answers

Answer 1

Removing of products, increasing the temperature and decreasing the pressure all of these will alter the equilibrium concentration. The correct option to this question is D.

The Le Chatelier principle is as follows: A movement in the equilibrium's location counteracts the effect of a change in one of the variables that characterize a system at equilibrium.

Equilibrium-affecting variables and the Le Chatelier principle

Alterations in concentration

Alterations in pressure.

Temperatures fluctuate.

The system's balance is thrown off when one of these elements changes, and it then readjusts itself until it achieves equilibrium again. The sections that follow discuss some of the most significant factors that affect equilibria.

For more information on Le Chatelier  principle kindly visit to

https://brainly.com/question/14967447

#SPJ4

Complete question:

Which of the following changes in reaction conditions will alter the composition of an equilibrium mixture of gases for a reaction having unequal moles of gaseous products and gaseous reactants?

A) removing of products

B) increasing the temperature

C) decreasing the pressure

D) All of these will alter the equilibrium concentrations.


Related Questions

When a substance is reduced:
A. It is called the oxidizing agent
B. Some other substance must be reduced
C. It loses electrons
D. It is called the reducing agent

Answers

Answer:

Explanation:

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

Iron reacts with chlorine to form iron(III) chloride.


2Fe + 3Cl2 → 2FeCl3


What mass (in grams) of chlorine gas is needed to react with 251 grams of iron?

Select one:

a.
71 grams


b.
392 grams


c.
479 grams


d.
622 grams

Answers

The mass (in grams) of chlorine gas is needed to react with 251 grams of iron is 479 grams. Option C.

To determine the mass of chlorine gas needed to react with 251 grams of iron, we need to use the stoichiometry of the balanced chemical equation:

2Fe + 3Cl2 → 2FeCl3

From the balanced equation, we can see that 2 moles of iron (Fe) react with 3 moles of chlorine gas (Cl2) to produce 2 moles of iron(III) chloride (FeCl3).

To calculate the mass of chlorine gas, we can follow these steps:

Step 1: Convert the given mass of iron (Fe) to moles.

Using the molar mass of iron (Fe), which is approximately 55.85 g/mol, we can calculate the number of moles of iron:

moles of Fe = mass of Fe / molar mass of Fe

moles of Fe = 251 g / 55.85 g/mol

moles of Fe ≈ 4.5 mol (rounded to one decimal place)

Step 2: Use the mole ratio from the balanced equation to find the moles of chlorine gas (Cl2) needed.

From the balanced equation, we know that 2 moles of Fe react with 3 moles of Cl2. Therefore, the moles of Cl2 can be calculated as:

moles of Cl2 = (moles of Fe / 2) * 3

moles of Cl2 = (4.5 mol / 2) * 3

moles of Cl2 ≈ 6.75 mol (rounded to two decimal places)

Step 3: Convert the moles of chlorine gas to grams.

Using the molar mass of chlorine gas (Cl2), which is approximately 70.90 g/mol, we can calculate the mass of chlorine gas:

mass of Cl2 = moles of Cl2 * molar mass of Cl2

mass of Cl2 = 6.75 mol * 70.90 g/mol

mass of Cl2 ≈ 479 grams (rounded to the nearest whole number) Option C is correct.

For more such question on mass. visit :

https://brainly.com/question/19385703

#SPJ8

\blue«\pinkQ\orangeU\redE\greenS\purpleTI\pinkON
What is the difference between an acid and a base? Provide examples of each.​

Answers

Answer:

An acid is any hydrogen-containing substance that is capable of donating a proton (hydrogen ion) to another substance. A base is a molecule or ion able to accept a hydrogen ion from an acid.

Answer:

Acids::

1.Sour in taste

2. Tum blue litmus into red

3. Acids change methyl orange to red

4.Phenolphthalein remains colourless

5. Acids do not give soapy touch

6. Give hydrogen ions in solution

Bases::

Bitter in taste

Bitter in tasteTurn red litmus blue Bases change methyl orange to yellowPhenolphthalein gives pink colour Soapy to touchGive hydroxyl ions in solution

if it helped uh please mark me a BRAINLIEST :-))

How much heat is gained by nickel when 31.4 g of nickel is warmed from 27.2 °C to 64.2 °C? The specific heat of nickel is 0.443 J/g · °C.

Answers

Explanation:

To calculate the heat gained by nickel, we can use the formula:

q = m * c * ΔT

where q is the heat gained, m is the mass of the nickel, c is the specific heat of nickel, and ΔT is the change in temperature.

Given:

- Mass of nickel, m = 31.4 g

- Specific heat of nickel, c = 0.443 J/g · °C

- Change in temperature, ΔT = 64.2 °C - 27.2 °C = 37.0 °C

Substituting the values into the formula, we get:

q = (31.4 g) * (0.443 J/g · °C) * (37.0 °C)

Simplifying the calculation, we get:

q = 584 J

Therefore, the heat gained by nickel when 31.4 g of nickel is warmed from 27.2 °C to 64.2 °C is 584 J.

-Convert 6.02 x 1020 formula units of MgCl₂ to mol of MgCl₂:​

Answers

6.02 x \(10^{20\) formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

To convert formula units of MgCl₂ to moles of MgCl₂, we need to use Avogadro's number, which relates the number of formula units to the number of moles.

Avogadro's number (NA) is approximately 6.022 x 10^23 formula units per mole.

Given that we have 6.02 x 10^20 formula units of MgCl₂, we can set up a conversion factor to convert to moles:

(6.02 x 10^20 formula units MgCl₂) * (1 mol MgCl₂ / (6.022 x 10^23 formula units MgCl₂))

The formula units of MgCl₂ cancel out, and we are left with moles of MgCl₂:

(6.02 x 10^20) * (1 mol / 6.022 x 10^23) = 0.1 mol

Therefore, 6.02 x 10^20 formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

It's important to note that this conversion assumes that each formula unit of MgCl₂ represents one mole of MgCl₂. This is based on the stoichiometry of the compound, where there is one mole of MgCl₂ for every one formula unit.

Additionally, this conversion is valid for any substance, not just MgCl₂, as long as you know the value of Avogadro's number and the number of formula units or particles you have.

For more such questions on MgCl₂ visit:

https://brainly.com/question/26311875

#SPJ8

50 POINTS
which of the following best describes what air is made up of
energy
matter
non matter
solids​

Answers

Answer:

matter is what air is made up of

Answer:

Matter

Explanation

Air takes up space. Matter is something that takes up space and is made of mass.

Hope this helps!

between ethane, ethene and ethyne which is having shortest bond?​

Answers

As you can see the picture, in the three given compounds i.e. ethane, ethene and ethyne, ethyne have shortest bond. Bond length of ethyne is very short when compared to the ethane and ethene. Shorter the bond, bond strength will be more. Hence, our answer is ethyne.

between ethane, ethene and ethyne which is having shortest bond?

Answer:

ethyne has shortest bond

Question 4
Write a chemical reaction depicting what happens to the sugar in water.

Answers

Answer:

When sugar dissolves,these whole sucrose molecules separate from one another

What does percent composition tell you about a molecule?

Answers

Answer:

Percent composition tells you the relative amounts of each element in a molecule by mass. It can be used to determine the empirical formula of a compound, as well as to compare the composition of different molecules.

For example, the percent composition of water (H2O) is 11.19% hydrogen and 88.81% oxygen by mass. This tells us that there are two hydrogen atoms for every one oxygen atom in the molecule.

Explanation:

Brainliest Plsss

coenzyme q carries electrons between which stages of the electron-transport chain? check all that apply.

Answers

Coenzyme q carries electrons from complex I to complex III  and complex II to complex III  in the electron-transport chain.

Coenzyme q  (CoQ), also known as ubiquinone, is the electron carrier in the electron transport system (ETS) present on the inner membrane of mitochondria.

Ubiquinone is a ubiquitous quinone, which accepts electrons from complex II ( succinate dehydrogenase) and  reduces to ubiquinol ( reduced form)

The purpose of the ETS is to generate an H+ ion concentration, by carrying electrons obtained from NADH AND FADH2   produced by the Krebs cycle and glycolysis in the mitochondrial matrix. This  H+ ion potential will be used by ATP synthase to generate ATP.

To know more about ETS :

https://brainly.com/question/876880

https://brainly.com/question/18686654

The inner mitochondrial membrane contains CoQ, a key part of the mitochondrial electron transport chain (ETC), which moves electrons from complexes I and II to complex III to provide energy for proton translocation to the intermembrane gap.

What is mitochondria ?

An organelle called a mitochondrion can be found in the cells of the majority of Eukaryotes, including mammals, plants, and fungi. Adenosine triphosphate, which is produced by aerobic respiration in mitochondria with their double membrane structure, is used as a source of chemical energy throughout the entire cell.

Coenzyme Q10 takes electrons from reducing equivalents produced during the metabolism of fatty acids and glucose and then transports them to electron acceptors as part of the mitochondrial electron transport chain.

Ubiquinone, also known as coenzyme Q, is a lipophilic molecule that is found in all tissues and cells and is mostly found in the inner mitochondrial membrane. It is generally known that Coenzyme Q is an essential part of the oxidative phosphorylation process in mitochondria.

Thus, The inner mitochondrial membrane contains CoQ, a key part of the mitochondrial electron transport chain (ETC).

To learn more about mitochondria, follow the link;

https://brainly.com/question/10688306

#SPJ12

What is the identity of a cation solution that burns in a flame test with a mix of red and yellow, but viewed through a cobalt filter the flame is red?

Answers

The identity of a cation solution that produces a mix of red and yellow colors in a flame test, but appears red when viewed through a cobalt filter, can be attributed to the presence of the strontium (Sr) cation.

During a flame test, different metal cations emit characteristic colors due to the excitation of electrons and their subsequent emission of light. Strontium, in particular, is known to produce a vibrant red color in flame tests.

The presence of both red and yellow colors indicates the possibility of multiple metal cations in the solution. While the specific metal responsible for the yellow color is uncertain, it could potentially be sodium or another metal that emits a yellow flame.

When the flame is viewed through a cobalt filter, which absorbs yellow wavelengths of light, the yellow color is filtered out, resulting in only the red color being observed. Since strontium is known for its distinctive red flame color and its emission is not affected by the cobalt filter, it is likely the metal cation responsible for the observed red color. Therefore, based on these characteristics, the identity of the cation solution is most likely strontium (Sr).

Know more about cation solution here:

https://brainly.com/question/30754382

#SPJ8

4. One molecule of propanol contains a total of
flonsoona
(1) one -OH group
(2) two -CH3 groups
(3) three -OH groups
(4) three -CH3 groups

Answers

One molecule of propanol contains only one -OH group and not three -OH groups or three -CH3 groups.

The -OH group is attached to the central carbon atom and makes propanol a useful solvent and intermediate in organic chemistry.Propanol is a colorless liquid that belongs to the family of alcohols. It has the formula C3H8O, and it contains three carbon atoms, eight hydrogen atoms, and one hydroxyl group (-OH) attached to one of the carbons. One molecule of propanol contains only one -OH group, which is attached to the central carbon atom.

Thus, option (2) is the correct answer, and the other options are incorrect.The -OH group in propanol is responsible for its unique chemical and physical properties. It makes propanol soluble in water and other polar solvents and gives it a high boiling point of around 97°C. The hydroxyl group can also participate in chemical reactions, such as esterification, dehydration, oxidation, and reduction. For example, propanol can be oxidized to form propanal and then propanoic acid, which is a useful synthetic intermediate for many organic compounds.Apart from the -OH group, propanol also contains two other functional groups called methyl groups (-CH3). These are attached to the two carbon atoms adjacent to the central carbon. However, the question only asks about the number of -OH groups in propanol, so the methyl groups are irrelevant.
for such more questions on propanol

https://brainly.com/question/30086385

#SPJ8

After creating a Beer's Law plot using standard solutions of Q, you determined the slope of Beer's Law to be 0.598 M-1. Your unknown solution of Q tested had an absorbance of 0.148. Determine the concentration (in molarity) of the unknown solution.

Answers

Answer:

C=0.247 M

Explanation:

We have to start this question with Beer's Law, A=EbC. On this equation we will have:

A=Absorbance

E=Molar absorption coefficient

b= Optical path

C=Concentration

So, the question is: what values of this equation we know?. If we check the question we have the absorbance value "0.148" additionally we have the slope of the plot, this slope is the molar absorption coefficient, therefore E=0.598 M-1, finally we have also the optical path. The optical path is 1 cm for all devices, so b=1 cm. With all these values we can calculate the concentration "C".

C=AbE

C=0.14810.598

C=0.247 M

So, we will have a concentration of 0.247 M

I hope it helps!

What is the molar mass
MgCrO4

Answers

The molar mass of MgCrO4 is approximately 140.30 g/mol.

To determine the molar mass of MgCrO4 (magnesium chromate), we need to calculate the sum of the atomic masses of each individual element in the compound.

The chemical formula MgCrO4 indicates that the compound consists of one magnesium atom (Mg), one chromium atom (Cr), and four oxygen atoms (O).

The atomic masses of the elements can be found on the periodic table:

Magnesium (Mg) has an atomic mass of approximately 24.31 g/mol.

Chromium (Cr) has an atomic mass of around 51.99 g/mol.

Oxygen (O) has an atomic mass of about 16.00 g/mol.

Now, we can calculate the molar mass of MgCrO4 by summing up the atomic masses of each element, considering the respective subscripts:

Molar mass = (Atomic mass of Mg) + (Atomic mass of Cr) + 4 × (Atomic mass of O)

Molar mass = (24.31 g/mol) + (51.99 g/mol) + 4 × (16.00 g/mol)

Molar mass = 24.31 g/mol + 51.99 g/mol + 64.00 g/mol

Molar mass ≈ 140.30 g/mol

for more such questions on mass

https://brainly.com/question/24191825

#SPJ8

Which equation is a correctly written thermochemical equation?
OC3H8 (g) +502 (g) → 3CO2 (g) + 4H₂O (1), AH= -2,220 kJ/mol
OFe (s) + O2 (g) → Fe₂O3 (s), AH= -3,926 kJ
ONH₂Cl → NH₂ + + Cl
O2C8H18 + 250216CO2 + 18H₂O, AH=-5,471 kJ/mol

Answers

Answer:

The correctly written thermochemical equation is:

C3H8 (g) + 5O2 (g) → 3CO2 (g) + 4H2O (l), ΔH = -2,220 kJ/mol

This equation represents the combustion of propane (C3H8) in the presence of oxygen (O2) to produce carbon dioxide (CO2) and water (H2O), with a heat release of -2,220 kJ/mol. The state symbols (g) for gases and (l) for liquids indicate the physical state of each substance at standard conditions.

Explanation:

ABOVE

A 23.6 g sample of NagPO4 (molar mass 163.94 g/mol) is dissolved in enough water to produce
g
750. mL of solution.
Calculate the concentration of Nations in solution.

Answers

Taking into account the definition of molarity,  the concentration of Na₃PO₄ in solution is 0.192moleslliter.

Definition of molarity

Molar concentration or molarity is a measure of the concentration of a solute in a solution and indicates the number of moles of solute that are dissolved in a given volume.

The molarity of a solution is calculated by dividing the moles of solute by the volume of the solution:

Molarity=numberofmolesvolume

Molarity is expressed in units moleslliter.

Concentration of Na₃PO₄ in solution

Being the molar mass of Na₃PO₄ 163.94 g/mole, that is, the amount of mass that a substance contains in one mole, the amount of moles that contains 23.6 g sample of Na₃PO₄ is calculated as:

23.6gramsx1mole163.94grams=0.144moles

Then you know:

number of moles= 0.144 molesvolume= 750 mL= 0.750 L (being 1000 mL= 1 L)

Replacing in the definition of molarity:

Molarity=0.144moles0.750L

Solving:

Molarity= 0.192moleslliter

Finally, the concentration of Na₃PO₄ in solution is 0.192moleslliter.

Learn more about

molarity:

brainly.com/question/9324116

brainly.com/question/10608366

brainly.com/question/7429224

molar mass:

brainly.com/question/5216907

brainly.com/question/11209783

brainly.com/question/7132033

brainly.com/question/17249726

Given the following thermochemical equation detailing the combustion of glucose
C6H12O6(s) +602(g) → CO₂(g) + 6H₂O(g) AHxn=-2803 kJ/mol C6H12O6
determine the amount of glucose needed to release 30 kJ of energy.

Answers

1.93g of glucose is required to produce 30KJ of energy

One of the carbohydrates referred to as simple sugars is glucose, commonly known as dextrose (monosaccharides). The chemical formula for glucose is C6H12O6, which means "sweet" in Greek. It is the main free sugar present in higher animals' blood and can be found in fruits and honey. It is the source of energy for cellular activity, hence controlling its metabolism is crucial (see fermentation; gluconeogenesis).

Starch molecules, which make up the majority of plant's energy reserves, are made up of countless linear glucose units. Cellulose is a significant molecule made primarily of glucose and is likewise linear. D-glucose is a chemical found in dextrose. Glycogen, the reserve carbohydrate found in the majority of vertebrate and invertebrate animal cells as well as those of countless fungi and protozoans, is a similar molecule in mammals.

To learn more about glucose please visit-
https://brainly.com/question/2396657
#SPJ9

Calculate the energy of a photon emitted when an electron in a hydrogen atom undergoes a transition from n = 3 to n = 1.

Answers

Final answer:

The energy of a photon emitted when an electron in a hydrogen atom transitions from the third to the first energy state can be calculated using the Rydberg formula. For the given transition, the energy equates to approximately 1.63 x 10^-18 Joules.

Explanation:

In quantum physics, the energy of a photon emitted when an electron moves from one energy level to another in a hydrogen atom can be calculated using the Rydberg formula. The formula is E = R_H *(1/ni^2 - 1/nf^2), where R_H is the Rydberg constant for hydrogen (approximately 2.18 x 10^-18 Joules), ni is the initial energy level (3 in this case), and nf is the final energy level (1 in this case).

Plugging these into the equation, we get E = 2.18 x 10^-18 Joules *(1/3^2 - 1/1^2). Then, we find that the energy of the photon is about 1.63 x 10^-18 Joules. This energy corresponds to the energy difference between the two energy levels.

Learn more about Photon Energy Calculation here:

https://brainly.com/question/33716967

#SPJ2

Final answer:

The energy of a photon emitted when an electron in a hydrogen atom undergoes a transition from n=3 to n=1 can be calculated using the Rydberg formula for hydrogen and the formula for the energy of a photon.

Explanation:

The energy of a photon emitted during an electron transition in a hydrogen atom can be calculated using the formula for the energy of a photon: E = hf, where 'E' is energy, 'h' is Planck's constant, and 'f' is frequency. Moreover, when an electron in a hydrogen atom undergoes a transition from n=3 to n=1, the energy difference between these two energy levels can be calculated using the Rydberg formula for hydrogen: ΔE = RH (1/n1² - 1/n2²), where 'RH' is the Rydberg constant for hydrogen, 'n1' and 'n2' are the initial and final energy levels respectively. By substituting the values, we get ΔE = RH (1/1² - 1/3²). So, this is the energy of the emitted photon when an electron undergoes a transition from n=3 to n=1.

Learn more about Photon Energy here:

https://brainly.com/question/33820277

#SPJ2

For elements (Br, Ca, Fe, Na, S, Si, and Xe) which of the following term(s) apply?
a. metal
b. nonmetal
c. metalloid
d. noble gas
e. halogen
f. alkali metal
g. alkaline earth metal
h. transition metal
i. main group element
j. gas at room temperature

Answers

Answer:

Detail is given below.

Explanation:

Bromine: Br (Halogen and non metal)

Bromine is present in group 17 and it is called halogen.

All halogens are very reactive.

Calcium; Ca ( alkaline earth metal)

Calcium is present in group 2. It is alkaline earth metal.

It has two valance electrons.

Iron; Fe (Transition metal)

Iron is transition metal and also called d-block element.

Sodium: Na (Metal, main group element)

Sodium is metal and present in group one.

It has one valance electron.

Sulfur: S (non metal)

Sulfur is non metal. It is present in group 16.

It has six valance electrons.

Silicon: Si (metalloid)

Silicon is metalloid. It is present in group 14.

It has four valance electrons.

Xenon: Xe (Noble gas, gas at a room temperature)

it is noble gas. Xenon is present in group 18.

It is gas at a room temperature.

Explain how the immune system responds to pathegons

Answers

Answer:

The immune system responds to antigens by producing cells that directly attack the pathogen, or by producing special proteins called antibodies. Antibodies attach to an antigen and attract cells that will engulf and destroy the pathogen. The main cells of the immune system are lymphocytes known as B cells and T cells.

Which of the following will increase the rate of dissolution of a gas in a liquid?
a
decrease pressure
b
increase temperature
c
decrease agitation

(30 points)

Answers

Answer:

the answer is C. decrease agitation

How many atoms are in 12 g of Carbon-12 (12C)?

Answers

There are approximately 6.022 × 10^23 atoms in 12 grams of Carbon-12 (12C).

The number of atoms in a given amount of a substance can be calculated using Avogadro's number, which represents the number of atoms or molecules in one mole of a substance. Avogadro's number is approximately 6.022 × 10^23.

Carbon-12 is a specific isotope of carbon, with an atomic mass of 12 atomic mass units (amu). One mole of Carbon-12 has a mass of 12 grams. Since one mole of any substance contains Avogadro's number of particles, in the case of Carbon-12, it contains 6.022 × 10^23 atoms.

Therefore, if we have 12 grams of Carbon-12, which is equal to one mole, we can conclude that there are approximately 6.022 × 10^23 atoms in this amount of Carbon-12.

In summary, 12 grams of Carbon-12 contains approximately 6.022 × 10^23 atoms. Avogadro's number allows us to relate the mass of a substance to the number of atoms or molecules it contains, providing a fundamental concept in chemistry and enabling us to quantify and understand the microscopic world of atoms and molecules.

for such more questions on atoms

https://brainly.com/question/6258301

#SPJ8

How much carbon dioxide is released when it is fully combusted with 4Kg of ethanol with more than enough oxygen? How do you work it out?

Answers

Answer:

7.640 kg

Explanation:

Step 1: Write the balanced complete combustion equation for ethanol

C₂H₆O + 3 O₂ ⇒ 2 CO₂ + 3 H₂O

Step 2: Calculate the moles corresponding to 4 kg (4000 g) of C₂H₆O

The molar mass of C₂H₆O is 46.07 g/mol.

4000 g × 1 mol/46.07 g = 86.82 mol

Step 3: Calculate the moles of CO₂ released

86.82 mol C₂H₆O × 2 mol CO₂/1 mol C₂H₆O = 173.6 mol CO₂

Step 4: Calculate the mass corresponding to 173.6 moles of CO₂

The molar mass of CO₂ is 44.01 g/mol.

173.6 mol × 44.01 g/mol = 7640 g = 7.640 kg

which of the following explains why methane gas is an important greenhouse gas to reduce

Answers

Methane can absorb more heat

which term describes the repeated arrangement of the same molecule; total number of c h bonds in propanone is

Answers

The term (D) extended structure describes the repeated arrangement of the same molecule.

The extended structure is a type of structure that may be described as one in which the subunits are organized in a pattern that is repeated and occur in a ratio that is constant. Diamond and sodium chloride are two examples of extended structures. Extended structures have well-separated hydrophilic and hydrophobic layers made of propagating chains along the calixarene cavity axis. Therefore, the word "extended structure" is the one that is used to describe the repeating arrangement of the same molecules. So, choice D is the right one.

The correct question is as:

Which term describes the repeated arrangement of the molecule?

A. Bonds

B. Atoms

C. Molecular Model

D. Extended Structure

You can also learn about extended structure from the following question:

https://brainly.com/question/12077155

#SPJ4

The reaction of 50 mL of gas with 150 mL of gas to form ammonia via the equation:
N (g) + 3H (g) -----> 2NH (g)
will produce __________ mL of ammonia if pressure and temperature are kept

Answers

At constant temperature and pressure, 100mL of ammonia will be produced.

What is ammonia?

Ammonia is described as an inorganic compound of nitrogen and hydrogen with the formula NH₃. It is a stable binary hydride, and the simplest pnictogen hydride, ammonia is a colorless gas with a distinct pungent smell.

Gay-Lussac's law of combining volumes states that the volume of gases which take part in a chemical reaction bear a simple whole number ratio to one another and to the volume of products if gaseous, when measured at constant temperature and pressure.

According to the Equation of reaction: N₂(g) + 3H₂(g) ----> 2NH₃(g)

From the equation of reaction given above,

1 mole of nitrogen gas reacts with 3 moles of hydrogen to produce 2 moles of ammonia. Therefore,

50 mL of nitrogen will react to produce produce 2 * 50 mL of ammonia = 100ml of ammonia

Also, 150mL of hydrogen will react to produce 2 *150mL/3 of ammonia = 100ml of ammonia.

Learn more about ammonia at: https://brainly.com/question/14445062

#SPJ1

when an object kinetic energy changes what happens to the object??

when an object kinetic energy changes what happens to the object??

Answers

Answer:

2. A 3.C

Explanation:

Use bond enthalpies in the table below to estimate ΔH
for each of the following reactions.

Average Bond Enthalpies (kJ/mol)
C−H413
N−H391
O−H463
F−F155
C−C348
N−N163
O−O146
C=C614
N−O201
O=O495
Cl−F253
C−N293
N−F272
O−F190
Cl−Cl242
C−O358
N−Cl200
O−Cl203
Br−F237
C=O799
N−Br243
O−I234
Br−Cl218
C−F485
H−H436
Br−Br193
C−Cl328
H−F567
C−Br276
H−Cl431
I−Cl208
C−I240
H−Br366
I−Br175
H−I299
I−I151
Part A
H−H(g)+Br−Br(g)→2H−Br(g)

Answers

The enthalpy change, ΔH, of the reaction is  -103 kJ/mol.

What is the enthalpy change, ΔH, of the reaction?

The enthalpy change, ΔH, of the reaction is obtained from the bond enthalpies and the equation of the reaction.

Equation of the reaction:  H−H (g) +  Br−Br(g) → 2 H−Br(g)

To estimate ΔH for the reaction is calculated from the formula below:

ΔH = Σ (bonds broken) - Σ (bonds formed)

ΔH = (1 × 436 kJ/mol) + (1 × 193 kJ/mol) - (2 × 366 kJ/mol)

ΔH = 436 kJ/mol + 193 kJ/mol - 732 kJ/mol

ΔH = -103 kJ/mol

Learn more about bond enthalpies at: https://brainly.com/question/29633366

#SPJ1

6. How many moles are in 8.30 x 1023 molecules of CO₂?
a.
b.
C.
d.
1.37
2.8
55.5
100

Answers

the answer should be 1.38 molecules
Other Questions
Which of the following is the best application of a line graph? a to make observations and gather information b to show trends and how the data changes over time c to show how some fixed quantity is broken down into parts d to compare information collected by counting Please help!!!!!!!!!!!! What were the Articles of Confederation? A. A list of amendments which describe the rights of Americans B. A collection of articles used as the first constitution of the United StatesC. A document used to declare independence from the BritishD. A document describing the boundaries of the first 13 states which best describes the kinetochore? group of answer choices the array of vesicles that will form between two dividing nuclei and give rise to the metaphase plate the centromere region of a metaphase chromosome where the dna can bind with spindle proteins a structure composed of several proteins that associate with the centromere region of a chromosome and that can bind to spindle microtubules the ring of actin microfilaments that will cause the appearance of the cleavage furrow What impact do you think the toltecs introduction of metalworking to mesoamerica might have had Identify the most and the least basic compound in each of the following sets. Leave the remaining answer in each set blank.a) Sodium acetate: --B Sodium methoxide: Sodium phenoxide: b) Sodium acetate: Sodium chloroacetate: Sodium fluoroacetate: c) Lithium ethoxide: Lithium hydroxide: Lithium formate: 5(2k3)+2k5, left parenthesis, minus, 2, k, minus, 3, right parenthesis, plus, 2, k ?Choose all answers that apply: Which poetic device describes the end rhymes in this stanza from the poem "A narrow Fellow in the Grass"?The Grass divides as with a Comb,A spotted Shaft is seen,And then it closes at your FeetAnd opens further on A. non-rhymesB. simple rhymesC. exact rhymesD. off rhymes Please help me!!! Thanks! copper exists as a mixture of two isotopes. Copper is 69.17% abundant and it has a mass of 62.9296 amu. Copper-65 is 30.83% abundant and it has a mass of 64.9278 amu. Calculate the atomic mass of copper SOMEONE PLEASE HELP ME THE ANSWER IS EITHER THE FIRST CHOICE OR THE LAST If under Financial Asset under HTM (Hold Till Maturity), Investment done in Debt Securities as on 1-1-2015 with Market Value USD 250,000 with annual Coupon 8% wit Par value of Security as $ 200000. At time of Purchase Market Interest rate is 5%. The Fair value of Security is estimated as $ 275000 as on 31st Dec. If this Security is sold at $ 280,000 (5 Marks) Calculate the carrying value with Amortized principle along with Realized gain in above case. Can yall help me with this? what are the primary duties of salespeople? (choose every correct answer.) multiple select question. sales support accounting services scheduling employees taking orders getting orders recruiting staff Vol. XI Five Lectures on Psycho-Analysis, Leonardo and Other Works (1910) The Standard Edition of the Complete Psychological Works of Sigmund Freud A: Find the solution to the following linear programming problem using the simplex method Max (Z)=50x1+60x2 Subjected to: 2x1+x2 < 300 3x1+4x2 509 4x1+7x2812 x1,x220 Translate the following into hiragana: "Both Daichi's father and Sakura's father are company employees." Solve the giving equation 2x-4=24 whats the first step. Explain the purpose of bile Hello I would be very happy if you could solve this for me. Please help me.