The balnaced equation is:
\(2H_2+O_2\rightarrow2H_2O\)so 2 mol of H2 react with 1 mol of O2 and give 2 mol of water. Now we have to transform mols into mass. For that we use the molar mass of each molecule
Mm of H2 is 2g/mol
Mm of O2 is 32g/mol
and Mm of water is 18 g/mol
To pass the molar basis reaction into mass based we just have multiply the stechiometric factor by the molar mass of that molecule:
for Hydrogen:
\(2molofH_2\text{ }\times2\frac{gofH_2}{molofH_2}=4gofH_2\)Oxygen:
\(1molofO_2\text{ }\times32\frac{gofO_2}{molofO_2}=32gofO_2\)Water:
\(2molofH_2O\text{ }\times18\frac{gofH_2O}{molofHO_2}=36gofH_2\)so now in mass based proportions the reaction can be expresed as 4 grams of H2 react with 32 grams of O2 to give 36 grams of water.
To answer the questions we need to find which is the limiting reactant, H2 or O2. To do that we calculate how much O2 is requiried to react with 5 grams of H2 knowin that we need 32 g of O2 for 4 g of H2. we use this as a conversion factor:
\(5gofH_2\times\frac{32gofO_2}{4gofH_2}=40gofO2\text{ }\)So to consume 5 grams of H2 we need at least 40 g of O2 and we only have 10 grams of O2. this means the limiting reactos is Oxygen.
For question B:
as we have said 32 grams of O2 produce 36 grams of water using conversion factors:
\(10gofO_2\times\frac{36gofH_2O}{32gofO_2}=11.25gofH_2O\)so 11.25 grams of water are produced
Part C.
We need to calculate first how much H2 reacts so we can calculate how much H2 is left
We know the we need 32 grams of O2 to consume 4 H2, we using this as a conversion factor:
\(10gofO_2\times\frac{4gofH_2}{32g\text{ of O2}}=1.25gofH_2\)If only 1.25 grams of H2 are consumed of the initial 4 grams we have left :
4 g - 1.25 g= 2.75 g of H2
2. A person with a body temperature of 37°C holds an ice cube with a temperature of 0°C
in a room where the air temperature is 20°C. The direction of heat flow is
a) From the person to the ice, only
b) From the person to the ice and air, and from the air to the ice
c) From the ice to the person, only
d) From the ice to the person and air, and from the air to the person
Answer:
b) From the person to the ice, and from the air to the ice
Explanation:
The direction of heat flow in the room is from the person to the ice and from the air to the ice.
The ice is at the lowest temperature.
Heat flows from a place with a higher measure of heat to a place with a lower amount of heat. Since the ice has the lowest heat, there is a thermal gradient set up. Heat will flow from the body and air towards to the ice.Benzophenone freezing point= 49.9 C Benzophenone + unknown freezing point= 43.0 C Benzophenone mass= 5.047 g Unknown mass= .480 g 1. From the difference between the freezing points of the pure benzophenone and the unknown + benzophenone solution, calculate the freezing point depression of the solution. 2. Given the freezing point depression constant for benzophenone, Kfp= 9.80 C/molal, calculate the molality of the solution of unknown in benzophenone. (answer in m) 3. Now use the calculated value for the molality of the solution and the mass of the benzophenone to compute the number of moles of solute present in the solution. 4. Use that calculated number of moles and mass of solute to determine the approximate molar mass (Gram molecular weight) of the unknown solute. (answer in g/mol)
Answer:
1
\(T_{d} = 6.9 ^oC\)
2
\(C = 0.7041 M\)
3
\(x = 0.00355 \ mols \)
4
\(Z = 135.3 \ g/mol\)
Explanation:
Considering Question 1
From the question we are told that
The freezing point of Benzophenone is \(T_{pure} = 49.9^oC\)
The freezing point of Benzophenone + unknown is \(T_{im} = 43.0^o C\)
We are told that we can calculate the freezing point depression of the solution by evaluating the difference between the freezing points of the pure benzophenone and the unknown + benzophenone solution
This mathematically represented as
\(T_{d} = 49.9 - 43.0\)
=> \(T_{d} = 6.9 ^oC\)
Considering Question 2
From the question we are told that
The freezing point depression constant for benzophenone is \(K_{fp} = 9.80 \ ^oC /molal\)
Generally freezing point depression is also mathematically represented as
\(T_d = K_{fp} * C\)
Here C is the morality, now making C the subject we have
\(C = \frac{T_d}{K_{kp}}\)
=> \(C = \frac{6.9}{9.80 }\)
=> \(C = 0.7041 M\)
Considering Question 3
From the question we are told that
The mass of Benzophenone is \(m_b = 5.047\)
This morality obtained can be interpreted as
0.7041 moles of the solute(unknown) is in 1000 g of the solvent (benzophenone)
x moles of solute(unknown) is in 5.047 g of the solvent (benzophenone)
=> \(x = \frac{0.7041 * 5.047}{1000 }\)
=> \(x = 0.00355 \ mols \)
Considering Question 4
From the question we are told that
The mass of unknown solute is \(m = 0.480\)
Generally molar mass of the unknown solute is mathematically represented as
\(Z = \frac{m}{x}\)
=> \(Z = \frac{0.480}{0.00355}\)
=> \(Z = 135.3 \ g/mol\)
As per the details given, the molality of the solution of the unknown in benzophenone is approximately 0.704 m. 0.003550 moles of the unknown solute present in the solution. The molar mass of the unknown solute is approximately 135.21 g/mol.
1. Subtract the freezing point of the solution (43.0°C) from the freezing point of pure benzophenone (49.9°C) to compute the freezing point depression:
Freezing point depression = 49.9°C - 43.0°C = 6.9°C
2. By rearranging the equations, we can get the molality of the solution using the freezing point depression constant (Kfp) for benzophenone (9.80°C/molal):
Freezing point depression = Kfp * molality
Molality = Freezing point depression / Kfp = 6.9°C / 9.80°C/molal ≈ 0.704 molal
The molality of the solution of the unknown in benzophenone is approximately 0.704 m.
3. The number of moles:
Moles of solute = Molality * Mass of solvent (in kg)
Moles of solute = 0.704 molal * 0.005047 kg ≈ 0.003550 moles
There are 0.003550 moles of the unknown solute present in the solution.
4. Divide the mass of the solute (0.480 g) by the number of moles estimated in the previous step to get the approximate molar mass (gramme molecular weight) of the unknown solute:
Molar mass = Mass of solute / Moles of solute
= 0.480 g / 0.003550 moles
≈ 135.21 g/mol
Thus, the molar mass (gram molecular weight) of the unknown solute is approximately 135.21 g/mol.
For more details regarding molar mass, visit:
https://brainly.com/question/31545539
#SPJ6
Why are chromosomes important? They play a role in cell division. They pass molecules through the nucleus. They produce food for a plant cell. They provide energy to the cell.
Chromosomes important because they play a role in cell division.
What is cell division?Cell division is described as the process by which a parent cell divides into two daughter cells and usually occurs as part of a larger cell cycle in which the cell grows and replicates its chromosome before dividing.
Chromosomes has another function of ensuring that each new cell receives a complete set of genetic information which is required for proper cell function and development.
In conclusion, there are two types of cell division which are mitosis and meiosis.
Learn more about Cell division at:
https://brainly.com/question/17356405
#SPJ1
What is the temperature (in K) of 0.660 mole of neon in a 2.00 L vessel at 4.68 atm?
\(\\ \sf\longmapsto PV=nRT\)
\(\\ \sf\longmapsto 4.67(2)=0.66(8.314)T\)
\(\\ \sf\longmapsto 9.34=5.48T\)
\(\\ \sf\longmapsto T=1.7°C\)
T=274.7kKey words
P=PressureV=Volumen=No of molesR=Universal gas constantT=TemperatureThe colorless, odorless, tasteless gas carbon monoxide, CO2 is a by – product of incomplete combustion of any material that contains the element carbon. Calculate the volume, in liters, occupied by 1.52 moles of this gas at 0.992 atm pressure and a temperature of 65oC.
look at the picture
Determine the volume occupied by 10 mol of helium at
27 ° C and 82 atm
Answer:
3.00 L
Explanation:
PV = nRT
(82 atm × 101325 Pa/atm) V = (10 mol) (8.314 J/mol/K) (27 + 273) K
V = 0.00300 m³
V = 3.00 L
How many kilojoules of heat are needed to raise the temperature of 10g of aluminum from 22 degrees C to 55 degrees C, if the specific heat of aluminum is .901 j/gc?
Answer:
name four agricultural inputs are subsidized by the government
0.297 kJ of heat is needed to raise the temperature of 10g of aluminum from 22 degrees Celsius to 55 degrees Celsius.
The specific heat is the amount of heat per unit mass required to raise the temperature by one degree Celsius.
It is a measure of how much energy it takes to raise the temperature of a substance. It is the amount of heat necessary to raise one mass unit of that substance by one temperature unit.
It is given by the formula -
Q = mcΔT
where, Q = amount of heat
m = mass
c = specific heat
ΔT = Change in temperature
Given,
mass = 10g
c = 0.901J/g⁰C
Initial temperature (T₁) = 22⁰C
Final Temperature (T₂) = 55⁰C
Q = mcΔT
= 10 × 0.901 × (55 -22)
= 297.33 J = 0.297 kJ
Learn more about Specific heat, here:
https://brainly.com/question/31608647
#SPJ1
A prospector panning for gold (Au) in a river collects 15.00 g of pure gold. How many Au atoms are in this quantity of gold?
Answer:
There are 4.59*10^-24 atoms in 15.00 of pure gold.
Explanation:
Molar mass of gold is 196.996g/mol
\(\frac{15}{196.966} =0.076 mol\)
0.076*(6.022*10^-23)=4.59*10^-24
How many liters of a 0.200 M sodium cyanide solution would be needed to react with 45.0kg of rocks that contain 2.00% by mass of gold?
There are 91.84L of a 0.200 M sodium cyanide solution would be needed to react with 45.0kg of rocks that contain 2.00% by mass of gold
Percentage weight by weightThe formula for % w/w is mass of solute /mass of solution*100
Substituting the values in the equation
2%= mass of solute/45000 *100
mass of solute= 2*45000/100
mass of solute = 900 gram
Now, to calculate the volume we use the molarity given
molecular weight of sodium cyanide is 49 g/mol
Molarity= mass of solute/molecular mass *volume
0.2=900/49* volume
volume= 900/49*0.2
volume= 91.84 liter
The mass percentage of a solute in solution is the percent concentration of a substance (solute) in solution when it is stated as 'w/w'. This phrase is frequently used when the solute and solution are weighted.
For more information on molarity kindly visit to
https://brainly.com/question/8732513
#SPJ1
Identify the element in group 15, period 3 by drawing a Lewis Dot Structure
Answer:
Phosphorus
Explanation:
Lewis Dot Structure is a structural representation of a molecule that shows valence electrons of a molecule.
The element in group 15, period 3 is Phosphorus (P). Phosphorus has an atomic number 15 and valence electrons are 5. So, the lewis structure will show 5 dots around P atom.
How valence electrons does oxygen have.
Answer:
six
Explanation:
Answer:
six valence electrons.
Explanation:
Valence electrons are the electrons in the outermost shell, or energy level, of an atom.
How many molecules is 3.50 g CO2?
Answer: 44.0095 grams
Explanation:
What happens to the atomic radius when an electron is gained?
O A. The negative ionic radius is larger than the neutral atomic radius.
O B. The negative ionic radius does not follow a trend with the neutral
radius.
O C. The negative ionic radius is smaller than the neutral atomic radius.
O D. The negative ionic radius is the same size as the neutral atomic
radius.
Answer: A. The negative ionic radius is larger than the neutral atomic radius.
Explanation: Did the test just now
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Suppose an iron-58 nuclide transforms into an iron-59 nuclide by absorbing a neutron. Complete the nuclear chemical equation below so that it describes this nuclear reaction. 59 26 Fe
Refer to the attachment.
Which two particles are found in the nucleus of an atom?
neutrons and electrons
protons and electrons
protons and neutrons
neutrons and atoms
Answer:
C.) protons and neutrons
Explanation:
Most atoms contain proton(s), neutron(s), and electron(s). Within the nucleus of an atom, there are protons and neutrons. Electrons are located outside of the nucleus.
completion
Use this completion exercise to check your understanding of the concepts and terms
that are introduced in this section. Each blank can be completed with a term, short
phrase, or number,
1.
2.
Solids tend to be dense and difficult to They do not
flow or take the shape of their containers, like liquids do, because
the particles in solids vibrate around 2 points. When a solid
is heated until its particles vibrate so rapidly that they are no longer
held in fixed positions, the solid
3
The
4
is the
3.
4.
5.
6.
temperature at which a solid changes to a liquid. The melting and
5
7.
of a substance are at the same temperature. In general,
Pension Paceman, lek. publisargus Pearson Pombe Hal. A nights seserved
6
8.
Lonic solids tend to have relatively
melting points, while
9.
molecular solids tend to have relatively low melting points. Most
7
10.
solids ane
The partides are arranged in a pattern known
8
as a crystal
The smallest subunit of a crystal lattice
DISTRICT 186
9
Some solids lack an ordered internal structure
... Cac
and are called
Answer:
CompressFixedMeltsMelting PointFreezing PointHighCrystallineLatticeUnit cellAmorphous solidsExplanation:
Solids tend to be dense and difficult to compress.
They do not flow or take the shape of their containers, like liquids do, because the particles in solids vibrate around fixed points.
When a solid is heated until its particles vibrate so rapidly that they are no longer held in fixed positions, the solid melts.
Melting point is the temperature at which a solid changes to a liquid. The melting and freezing point of a substance are at the same temperature.
In general, ionic solids tend to have relatively high melting points, while molecular solids tend to have relatively low melting points.
Most solids are crystalline
The particles are arranged in a pattern known as a crystal lattice
The smallest subunit of a crystal lattice is the unit cell
Some solids lack an ordered internal structure and are called amorphous solids.
the mass of 3.01x10^23 molecules H2O
Answer:
9.00 g of H₂O
Explanation:
First calculate moles,
Moles = No. of Molecules / 6.022 × 10²³ Molecules/mol
Moles = 3.01 × 10²³ Molecules / 6.022 × 10²³ Molecules/mol
Moles = 0.50 moles
Now convert moles to mass,
Mass = Moles × M.Mass
Mass = 0.50 mol × 18.01 g/mol
Mass = 9.00 g of H₂O
The energy related to the motion of an object is called—
H2 + Br2 → 2HBr
How many moles of hydrogen bromide, HBr, can be made from 8.2 L of hydrogen?
0.732 moles of hydrogen bromide (HBr) can be made from 8.2 L of hydrogen gas (H2).
What is chemical reaction?
A chemical reaction is a process in which one or more substances (reactants) are transformed into one or more new substances (products) with different chemical properties. This transformation is accompanied by the breaking and formation of chemical bonds, resulting in a change in the arrangement of atoms in the reacting species.
To answer this question, we need to use the balanced chemical equation for the reaction:
H2 + Br2 → 2HBr
From the equation, we can see that 1 mole of hydrogen gas (H2) reacts with 1 mole of bromine gas (Br2) to produce 2 moles of hydrogen bromide (HBr).
We are given the volume of hydrogen gas (H2) as 8.2 L. To convert this to moles, we need to use the ideal gas law:
PV = nRT
where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature.
Assuming standard temperature and pressure (STP), which is 1 atm and 273 K, the ideal gas law can be simplified to:
n = V/22.4
where V is the volume in liters and 22.4 is the molar volume of an ideal gas at STP.
So, the number of moles of hydrogen gas is:
n(H2) = 8.2 L / 22.4 L/mol = 0.366 moles
Since 1 mole of H2 produces 2 moles of HBr, the number of moles of HBr produced will be:
n(HBr) = 2 × n(H2) = 2 × 0.366 mol = 0.732 mol
Therefore, 0.732 moles of hydrogen bromide (HBr) can be made from 8.2 L of hydrogen gas (H2).
To know more about reaction visit :-
https://brainly.com/question/11231920
#SPJ1
Solid calcium phosphate and aqueous sulfuric acid solution react to give calcium sulfate, which comes out of solution as a solid. The other product is phosphoric acid, which remains in solution. Write an equilibrium equation for the reaction using complete formulas for the compounds with phase labels.
Answer: i also need help on the same question :(
Explanation:
If a student is titrating 10.0 mL of 1 M HNO3 with 1M NaOH and another students is titrating 10.0 mL of 1 M H2SO4 with 1 M NaOH, would they need the same volume of NaOH to reach the equivalence point? Explain your answer.
Given the two different titration reactions, the volume of NaOH required to reach the equivalence point of both reaction will be different.
Titration of HNO₃ and NaOHBalanced equation
HNO₃ + NaOH —> NaNO₃ + H₂O
From the balanced equation above,
The mole ratio of the acid, HNO₃ (nA) = 1The mole ratio of the base, NaOH (nB) = 1How to determine the volume of NaOHVolume of acid, HNO₃ (Va) = 10 mL Molarity of acid, HNO₃ (Ma) = 1 MMolarity of base, NaOH (Mb) = 1 MVolume of base, NaOH (Vb) =?MaVa / MbVb = nA / nB
(1 × 10) / (1 × Vb) = 1
10 / Vb = 1
Cross multiply
1 × Vb = 10
Vb = 10 mL
Titration of H₂SO₄ and NaOHBalanced equation
H₂SO₄ + 2NaOH —> Na₂SO₄ + 2H₂O
From the balanced equation above,
The mole ratio of the acid, H₂SO₄ (nA) = 1The mole ratio of the base, NaOH (nB) = 2How to determine the volume of NaOHVolume of acid, H₂SO₄ (Va) = 10 mL Molarity of acid, H₂SO₄ (Ma) = 1 MMolarity of base, NaOH (Mb) = 1 MVolume of base, NaOH (Vb) =?MaVa / MbVb = nA / nB
(1 × 10) / (1 × Vb) = 1/2
10 / Vb = 1/2
Cross multiply
1 × Vb = 10 × 2
Vb = 20 mL
Conclusion Titration of HNO₃ and NaOH required 10 mL of NaOH Titration of H₂SO₄ and NaOH required 20 mL of NaOHFrom the above calculations, we can conclude that different volume of NaOH will be required for the different reaction.
Learn more about titration:
https://brainly.com/question/14356286
When zinc reacts with copper sulfate solution, zinc sulfate solution and copper are formed.(i) An experiment was carried out to measure the temperature change when zinc powder reactswith copper sulfate solution.initial temperature of copper sulfate solution = 20 °Cfinal temperature of mixture after the reaction = 46 °CExplain what the temperature readings show about the type of heat change that occurs duringthis reaction.
The temperature increase from 20 °C to 46 °C indicates that the reaction between zinc and copper sulfate solution is exothermic, with heat being released into the surroundings.
In the given reaction between zinc and copper sulfate solution, the temperature change can provide insights into the type of heat change occurring during the reaction. Based on the provided information, the initial temperature of the copper sulfate solution was 20 °C, and the final temperature of the mixture after the reaction was 46 °C.
The temperature increase observed in this reaction indicates an exothermic heat change. An exothermic reaction releases heat energy into the surroundings, resulting in a temperature rise. In this case, the reaction between zinc and copper sulfate solution is exothermic because the final temperature is higher than the initial temperature.
During the reaction, zinc displaces copper from copper sulfate to form zinc sulfate and copper metal. This displacement reaction is known as a single displacement or redox reaction. Zinc is more reactive than copper and therefore replaces copper in the compound.
The formation of new chemical bonds during the reaction releases energy in the form of heat. This energy is transferred to the surroundings, leading to an increase in temperature. The heat released is greater than the heat absorbed, resulting in a net increase in temperature.
The exothermic nature of this reaction can be explained by the difference in bond energies between the reactants and products. The breaking of bonds in the reactants requires energy input, while the formation of new bonds in the products releases energy.
In this case, the energy released during the formation of zinc sulfate and copper metal is greater than the energy required to break the bonds in copper sulfate and zinc.
For more such question on temperature visit:
https://brainly.com/question/4735135
#SPJ8
2.
Which mixture could be a useful buffer in a solution?
acetic acid (CH3CO2H) and hydrochloric acid (HCl)
sodium hydroxide (NaOH) and elemental sodium (Na)
ammonia (NH3) and ammonium chloride (NH4Cl)
acetic acid (CH3CO2H) and ammonia (NH3)
Pls answer quickly
Ammonia (\(NH_3\)) and ammonium chloride (\(NH_4Cl\)) mixture could be a useful buffer in a solution. Option C
A buffer is a solution that can resist changes in pH when small amounts of acid or base are added. It consists of a weak acid and its conjugate base or a weak base and its conjugate acid. The buffer system works by the principle of Le Chatelier's principle, where the equilibrium is shifted to counteract the changes caused by the addition of an acid or a base.
In option A, acetic acid (\(CH_3CO_2H\)) is a weak acid, but hydrochloric acid (HCl) is a strong acid. This combination does not form a buffer because HCl is completely dissociated in water and cannot provide a significant concentration of its conjugate base.
Option B consists of sodium hydroxide (NaOH), which is a strong base, and elemental sodium (Na), which is a metal. This combination does not form a buffer as there is no weak acid-base pair involved.
Option D contains acetic acid (\(CH_3CO_2H\)), a weak acid, and ammonia (\(NH_3\)), a weak base. Although they are weak acid and base, they do not form a buffer system together as they are both weak acids or bases and lack the required conjugate acid-base pair.
Option C, ammonia (\(NH_3\)), is a weak base, and ammonium chloride (\(NH_4Cl\)) is its conjugate acid. This combination can form a buffer system. When ammonia reacts with water, it forms ammonium ions (NH4+) and hydroxide ions (OH-).
The ammonium ions act as the weak acid, while the ammonia acts as the weak base. The addition of a small amount of acid will be counteracted by the ammonium ions, and the addition of a small amount of base will be counteracted by the ammonia, thus maintaining the pH of the solution relatively stable.
Therefore, option C, consisting of ammonia (\(NH_3\)) and ammonium chloride (\(NH_4Cl\)), is the suitable mixture that could be a useful buffer in a solution.
For more such question on buffer visit:
https://brainly.com/question/13076037
#SPJ8
HELP ASAP ILL MARK BRAINLIEST
1. Several solids, liquids, and gases can be found in your home. List three examples of each. (9 points) Think about where solids, liquids, and gases might be found in your refrigerator, bathroom, or basement/garage.
2. What states of matter exist within the human body? What state of matter do you think your body is mostly made up of? Why? (4 points) Think about whether the body contains solids, liquids, or gases. Which of the three would you be most likely to find?
3. Your blood contains many dissolved solids. What do you think could be done if you needed to remove the water from a sample of blood in order to study the solids that remained? (4 points) Think about what processes remove water from watery foods, solutions, or objects.
4. Your body contains a considerable amount of dissolved metal ions. Based on what you know about food and nutrition, list at least three metals you think could be found within the human body. (3 points) Refer to the periodic table — do any of the metal element names seem familiar? (Think about the ingredients list printed on food labels.)
1. Examples of solids, liquids, and gases found in a home
Solids: books, furniture, toys
Liquids: water, juice, shampoo
Gases: air, natural gas, propane
2. The human body contains solids, liquids, and gases. Solids include bones, muscles, and organs. Liquids include blood, saliva, and urine. Gases include air in the lungs and dissolved gases in the bloodstream. The body is mostly made up of liquids, as they make up a large percentage of its overall volume.
3. If you needed to remove the water from a sample of blood to study the solids that remained, you could use a process such as evaporation or freeze-drying. Evaporation involves heating the sample to allow the water to evaporate, leaving behind the solids. Freeze-drying involves freezing the sample and then removing the water under vacuum, leaving behind a dry solid.
4. Some metals that could be found within the human body include iron, zinc, and copper. These metals are commonly found in foods such as meat, seafood, nuts, and whole grains. Other metals such as calcium, magnesium, and potassium are also important for the body and are found in a variety of foods.
To know more about solids here
https://brainly.com/question/21500863
#SPJ1
If a negative 1 ion has 10 electrons what element is it
Answer: To be neutral, an atom has to have an equal number of protons (+1 charge) as electrons (-1 charge) . So if our 'mystery' element has 10 electrons, it must also have 10 protons. The number of protons in an atom is given by its Atomic Number in the periodic table. The element with an atomic number of 10 is Neon (Ne).
How to draw a structural formula of 1-pentene?
Answer:
Explanation:
There are 5 carbon and one double hydrogen bond. The 1 indicates where the double bond goes. Each end of a line is a carbon.
3.Which of these is NOT part of the cell theory? * "
all living things are made of cells
Ocells come only from other cells
cells are the smallest living unit of an organism
O all living things have blood cells
Answer:
Cells are the smallest living unit of an organism
Answer:
all living things living things have blood cells
Explanation:
this is because robert hooke did not make this apart of the theory
Select the correct terms to complete this statement about charged particles.
Like charges attract | repel, and opposite charges attract repel. According to Coulomb's law, as the distance between two charged particles decreases, the force between the particles decreases I increases. As the magnitude of the charges decreases, the force decreases | increases.
Like charges repel each other, while opposite charges attract each other. This principle is one of the fundamental aspects of electrostatics. According to Coulomb's law, the force between two charged particles is directly proportional to the product of their charges and inversely proportional to the square of the distance between them.
As the distance between two charged particles decreases, the force between them increases. This is because the closer the particles are, the stronger the electric field they create, leading to a stronger force of interaction.
On the other hand, as the magnitude of the charges decreases, the force between the particles also decreases. This is because the force is directly proportional to the product of the charges. If one or both of the charges are smaller, the force they exert on each other will be weaker.
In summary, according to Coulomb's law, decreasing the distance between charged particles increases the force between them, while decreasing the magnitude of the charges decreases the force. This understanding of the relationship between charge, distance, and force is crucial in explaining the behavior of charged particles and the interactions between them.
Know more about Coulomb's law here:
https://brainly.com/question/26892767
#SPJ8