Which functional group does formic acid contain?OA. -COO-О в. -онO C. -0-OD. -COOH

Answers

Answer 1

Formic acid is defined as the simplest carboxylic acid, containing only a single carbon in the middle of the molecule connected to Hydrogen and a Carboxylic group. A carboxylic group has the following conformation: COOH, which makes letter D the correct answer.


Related Questions

What particle is needed to complete the following equation?

What particle is needed to complete the following equation?

Answers

Explanation:

To balance a nuclear equation the mass number and atomic numbers of all particles on either side of the arrow must be equal.

Answer: A: 1/0N

Explanation:

GRADPOINT

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The temperature of 100 grams of water changes from 16°C to 20°C. What is the total number of calories of heat energy absorbed by the water?
A.
25


B.
40


C.
100


D.
400

Answers

Answer:

D.  400 cal

Explanation:

Spec heat of water   1 cal/gm-C

1 cal / gm-C   * 100 gm * ( 20-16 C) = 400 cal

if the temperature is 345 K, what is the temperature in C°

Answers

Answer:

71.85 Celsius (°C)

Explanation:

If the temperature is 345 K then the temperature is 71.850 Celsius.

during the citric acid cycle a. carbon atoms get reduced during the production of co2. b. nad gets oxidized to form nadh. c. carbon atoms get oxidized during the production of co2.
d. nadh gets oxidized to form nad . e. pyruvate molecules get reduced during the production of co2.

Answers

The correct option is (c) carbon atoms get oxidized during the production of CO2 in the citric acid cycle.

The citric acid cycle, also known as the Krebs cycle or tricarboxylic acid cycle, is a series of chemical reactions that occur in the mitochondria of eukaryotic cells and the cytoplasm of prokaryotic cells. It is an important pathway for the oxidation of carbohydrates, fats, and proteins to generate energy in the form of ATP.

During the citric acid cycle, acetyl-CoA is oxidized to carbon dioxide and water, and energy is released. This involves the oxidation of carbon atoms in the acetyl group of acetyl-CoA to form CO2, which is then released into the atmosphere. The oxidation of carbon atoms is coupled with the reduction of NAD+ to NADH, which is an important energy carrier in the cell.

Therefore, option (c) is correct, and the other options are incorrect because they describe processes that do not occur in the citric acid cycle.

for such more question on molecules

https://brainly.com/question/24191825

#SPJ4

A solution is made by dissolving 38.81 grams of nickel (II) sulfate, NiSO4, in enough water to make 0.467
liters of solution. Calculate the molarity of this solution.

Answers

The molarity of the NiSO₄ solution made by dissolving 38.81 grams of nickel (ii) sulfate, NiSO₄, in enough water to make 0.467 liters of solution is 0.535 M

How do i determine the molarity of the solution?

First, we shall obtain the mole of 38.81 grams of nickel (ii) sulfate, NiSO₄. Details below:

Mass of NiSO₄ = 38.81 grams Molar mass of NiSO₄ = 154.75 g/molMole of NiSO₄ = ?

Mole of NiSO₄ = mass / molar mass

= 38.81 / 154.75

= 0.25 mole

Now, we shall determine the molarity of the solution. Details below:

Mole of NiSO₄ = 0.25 moleVolume of solution = 10.467 LMolarity of solution = ?

Molarity of solution = mole / volume

= 0.25 / 0.467

= 0.535 M

Thus, the molarity of the solution is 0.535 M

Learn more about molarity:

https://brainly.com/question/16073358

#SPJ1

What type of boundary exists at letter b?

What type of boundary exists at letter b?

Answers

Answer:

Convergent boundaries

Explanation:

PLEASE NEEEED HELP drag each label to the correct location on the image here’s one way to follow the scientific method. Place the missing steps in the correct position in the process

PLEASE NEEEED HELP drag each label to the correct location on the image heres one way to follow the scientific

Answers

Answer: Make an observation -> Ask a question. -> Construct a hypothesis. -> Test the hypothesis with an investigation -> Analyze the data -> Explain the results -> (Left) The hypothesis is true ------ (Right) The hypothesis is false. -> Communicate the results.

Explanation:

Make an observation -> Ask a question. -> Construct a hypothesis. -> Test the hypothesis with an investigation -> Analyze the data -> Explain the results -> (Left) The hypothesis is true ------ (Right) The hypothesis is false. -> Communicate the results.

Answer:

Make an observation -> Ask a question. -> Construct a hypothesis. -> Test the hypothesis with an investigation -> Analyze the data -> Explain the results -> (Left) The hypothesis is true ------ (Right) The hypothesis is false. -> Communicate the results.

Explanation:

Which two photos show electric force in action?
DA.

Which two photos show electric force in action?DA.

Answers

Answer:

its c and d i just took the test

Explanation:

Electric force is degenerated when papers are attracted onto the comb and when the nails attached to the stone. In both cases a static electricity is  generated. Thus, option A and C are correct.

What is static electricity ?

When a material is rubbed the electrons gets delocalized and the material gets a negative charge. For instance when comb is rubbed through hair it acquires a negative charge and this when comes in contact with a paper, the paper will attracts on the comb.

The random charges of the paper gets aligned temporarily into two poles by the attraction of electrons from the comb. Thus the positive pole of the comb gets attached to the comb and there creates a static electricity.

The the conducting nails when scratched on the stone a static electricity generates whereas in the case of a bar magnet no electric field is comes in action when it attracts the nails  to the magnetic field. Thus, photos A and C are correct.

To find more on static electricity, refer here:

https://brainly.com/question/12791045

#SPJ5

A researcher observes a reaction and gathers the data in the table below. Observations Mass decreased after reaction Energy is released during reaction New substance is formed Which piece of evidence best identifies they type of reaction as nuclear or chemical? 1. Chemical, because energy is released during the reaction. 2.Nuclear, because energy is released during the reaction. 3.Nuclear, because the mass decreased after the reaction. 4.Chemical, because a new substance is formed.

Answers

The piece of evidence that best identifies the type of reaction as nuclear or chemical is: Chemical, because a new substance is formed. Option 4

In this scenario, the observation that a new substance is formed is a key characteristic of a chemical reaction. Chemical reactions involve the rearrangement of atoms to form different substances with distinct properties. The formation of a new substance indicates a chemical change has occurred.

The other pieces of evidence listed do not necessarily point to a nuclear reaction:

Chemical, because energy is released during the reaction: Energy can be released in both nuclear and chemical reactions, so this observation alone is not sufficient to determine the type of reaction.

Nuclear, because energy is released during the reaction: While energy can be released in nuclear reactions, it is not exclusive to them. Chemical reactions can also release energy, such as in exothermic reactions.

Nuclear, because the mass decreased after the reaction: This observation suggests a change in mass, which could be indicative of a nuclear reaction. However, it is important to consider that chemical reactions can also involve changes in mass, such as the formation of gases or dissolution of a solid.

Overall, the most conclusive evidence to identify the type of reaction is the formation of a new substance, which aligns with a chemical reaction.

Option 4

For more such questions on Chemical visit:

https://brainly.com/question/29886197

#SPJ8

An element's atomic number represents
the number of protons found in that element
the number of protons and electrons found in that element
the number of protons and neutrons found in that element
the number of electrons found in that element

Answers

the second options

the number of protons and electrons found in that element

The atomic number is the amount of protons in the atoms nucleus. The mass number is the amount of protons and neutrons in the atoms nucleus. Hope this helps! :)

Can H2 be broken down? (Not H)

Answers

Hello, this is Bing. I can help you with your question. Based on the information I found on the web, **H2** can be broken down into its two atoms of hydrogen (H) by supplying enough energy to overcome the bond that holds them together⁴. This process is called **dissociation** and requires an energy equal to or greater than the **dissociation energy** of H2, which is about 436 kJ/mol⁴.

One way to break down H2 is by using **electricity** to split water (H2O) into hydrogen (H2) and oxygen (O2) through a process called **electrolysis**¹. In this process, water is decomposed into its elements by passing an electric current through it. The electric current is provided by a battery or another source of electricity and the water needs to have an **electrolyte**, such as salt or acid, added to it to make it conductive¹. Two electrodes, usually made of metal or other conductive material, are inserted into the water and connected to the battery. The electrode connected to the positive terminal of the battery is called the **anode** and the one connected to the negative terminal is called the **cathode**¹. When the electric current flows through the water, hydrogen gas bubbles form at the cathode and oxygen gas bubbles form at the anode¹. The overall chemical reaction for electrolysis of water is:

2 H2O → 2 H2 + O2

Another way to break down H2 is by using **heat** to cause a reaction between hydrogen and oxygen that produces water and releases a large amount of energy. This reaction is called **combustion** or **oxidation** and can be ignited by a spark or a flame³. The reaction is very fast and explosive and can be dangerous if not controlled. The overall chemical reaction for combustion of hydrogen is:

2 H2 + O2 → 2 H2O

I hope this helps you understand how H2 can be broken down and what methods are used to do so.

40. Which of these is an example of an
anhydrous compound?
A) H2O
C) CuSO4.5H2O
B) CaSO4
D) CaSO4 · 2H2O

Answers

Explanation:

CuSO4.5H2O and CaSO4.2H2O

Answer:

CaSO4 is an example of anhydrous compound

Reason:

Calcium Sulphate (CaSO4) does not contain water in its crystal structure, unlike other minerals.

a. You have a stock solution of 14.8 M NH3. How many milliliters of this solution should you dilute to make 1000.0 mL of 0.250 M NH3?
b. If you take a 10.0 mL portion of the stock solution and dilute it to a total volume of 0.500 L, what will be the concentration of the final solution?

Answers

Answer:A) V = 16.892 ml

Explanation:

M1 * V1 = M2 * V2

14.8 M * V1 =0.250 M * 1000 ml

V1 = 16.892 ml

a. The volume of 16.89 milliliters of the stock solution of 14.8 M  should be diluted to make 1000.0 mL of 0.250 M.

b. The concentration of the final solution is 0.296 M.

What is the dilution law?

The concentration or the volume of the concentrated or dilute solution can be calculated by using the equation:

M₁V₁ = M₂V₂

where M₁ and V₁ are the concentration and volume of the concentrated solution respectively and M₂ and V₂ are the concentration and volume of the dilute solution.

A stock solution is a solution that has a high concentration and that will be diluted to a low concentration by the addition of water in it.

Given, a stock solution of concentration, M₁ = 14.8 M

The concentration of the diluted solution, M₂ = 0.250 M

The volume of diluted solution, V₂  = 1000ml

Substitute the value of the molarity and volume in equation (1):

(14.8)× (V₁) = (1000) × (0.250)

V₁ = 16.89 ml

Similarly, for part (b): M₁ = 14.8 M, V₁ = 10 ml and V₂  = 0.5L = 500 ml

(14.8)× (10) = (500) × (M₂)

M₂ = 0.296 M

Learn more about dilution law, here:

https://brainly.com/question/15718488

#SPJ5

Two liquids, A and B, have equal masses and equal initial temperatures. Each is heated for the same length of time over identical burners. Afterward, liquid A is hotter than liquid B. Which has the larger specific heat? Two liquids, A and B, have equal masses and equal initial temperatures. Each is heated for the same length of time over identical burners. Afterward, liquid A is hotter than liquid B. Which has the larger specific heat? Liquid A. There's not enough information to tell. Liquid B.

Answers

Answer:

Liquid A.

Explanation:

Specific heat is defined as the amount of heat required per unit of mass to raise the temperature by one degree celsius.

When two liquids are heated, the liquid with larger specific heat is the one which is hotter. That is because is required more energy to decrease its temperature by 1°C.

Thus, in the problem, liquid A has the larger specific heat

The combustion of octane, C8H18, proceeds according to the reaction shown.

2C8H18(l)+25O2(g)⟶16CO2(g)+18H2O(l)

If 354 mol of octane combusts, what volume of carbon dioxide is produced at 15.0 ∘C
and 0.995 atm?

Answers

The concept ideal gas equation is used here to determine the volume of the carbondioxide. Combustion reactions are generally highly exothermic reactions. The volume of CO₂ is

A combustion is a chemical reaction in which a fuel undergoes oxidation as a result of the reaction with an oxidizing agent which causes the release of energy in the form of heat.

15.0 °C = 288 K

The ideal gas equation is:

PV = nRT

V = nRT / P

V = 354 × 0.0821 × 288 / 0.995 = 8412.3 L

To know more about combustion, visit;

https://brainly.com/question/14335621

#SPJ1

Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in the reaction below. How many molecules of HCl would have to be present to form 34.52 g of MgCl₂?
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

Answers

Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:

Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

The molar mass of MgCl₂ is 95.21 g/mol.

First, we need to calculate the number of moles of MgCl₂ formed:

Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂

Moles of MgCl₂ = 34.52 g / 95.21 g/mol

Moles of MgCl₂ = 0.363 mol

According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:

Moles of HCl = 2 * Moles of MgCl₂

Moles of HCl = 2 * 0.363 mol

Moles of HCl = 0.726 mol

To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.

Number of molecules of HCl = Moles of HCl * Avogadro's number

Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol

Number of molecules of HCl = 4.37 x 10^23 molecules

Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

For more such questions on molecules

https://brainly.com/question/1351818

#SPJ8

Question 3 of 5
Which statement is a hypothesis?
A. If the temperature increases, then crickets will chirp more.
OB. Crickets are cooler than grasshoppers.
C. Does temperature affect how much crickets chirp?
OD. I hear crickets in the summer, so crickets chirp more when it's
warm outside.
SUBMIT

Answers

Answer:

A.) If the temperature increases, then crickets will chirp more.

Explanation:

The hypothesis is a testable statement that can be supported or disproved through experimentation.

A.) is correct. This statement clearly identifies what will (supposedly) happen when a variable is manipulated. Once an experiment is carried out, this hypothesis can be supported or negated.

B.) is incorrect. This is an opinion, not an objective statement. This statement is subjective and cannot be backed by evidence.

C.) is incorrect. Hypotheses are not questions. This statement also does not state how temperature could affect a cricket's chirp. However, questions can often lead to the formation of a hypothesis.

D.) is incorrect. The first part of the statement is an observation, and the second part is an assumption. Like in answer C, this information can be used as the basis in making a hypothesis.

Given the following information, calculate the density in g/mL of an irregular solid.

Mass of weighing vessel 1.005g
Mass of solid + weighing vessel 9.441g
Volume of liquid in graduated cylinder 3.45 mL
Volume of liquid in graduated cylinder + volume of solid 5.45 mL

Answers

Answer:

4.22 g/mL

Explanation:

First we calculate the mass of the solid via mass difference:

Mass of solid = 9.441 g - 1.005 g = 8.436 g

Then we calculate the volume of the solid, once again by difference:

Volume of solid = 5.45 mL - 3.45 mL = 2.00 mL

Finally we calculate the density in g/mL:

Density = 8.436 g / 2.00 mL = 4.22 g/mL

The density of an irregular solid will be "4.96 g/mL".

According to the question,

→ The Mass of solid will be:

= [(Mass of solid+Weighing vessel)(Mass of weighing)]

By substituting the values, we get

= 9.4411.005

= 8.436 g

→ The Volume of solid will be:

= [(Volume of liquid in grad. cylinder+Solid)(Volume of grad. cylinder)]

= 5.153.45

= 1.70 mL

hence,

→ The density of irregular solid will be:

= MassVolume

= 8.4361.70

= 4.96 mL

Thus the above is the correct answer.

Learn more:

https://brainly.com/question/1150199

oxidation number of Ag in Ag2O

Answers

The oxidation number of Ag in Ag2O is +1.

In Ag2O, there are two silver atoms (Ag) and one oxygen atom (O). Oxygen is known to have an oxidation number of -2 in most compounds. Since the compound is neutral, the sum of the oxidation numbers of all the atoms must equal zero.

Therefore, the oxidation numbers of the two silver atoms must add up to +2 to balance out the -2 oxidation number of the oxygen atom. Since there are two silver atoms, each silver atom must have an oxidation number of +1 to yield a total oxidation number of +2 for the compound.

In Ag2O, the silver atoms lose one electron each to form Ag+ ions. This results in an oxidation number of +1 for each silver atom. The oxygen atom gains two electrons from the silver atoms to achieve a stable octet configuration, resulting in an oxidation number of -2 for the oxygen atom. The compound Ag2O is formed through the transfer of electrons, with each silver atom exhibiting an oxidation number of +1.

for such more questions on  oxidation

https://brainly.com/question/13182308

#SPJ8

answers to these 3 practices problems?

answers to these 3 practices problems?

Answers

4) The compounds as they have been shown are diastereomers

5) The compounds as they have been shown are enantiomers

6) The charges on the cyanide carbon and the bromine ion are negative , negative

What are optical isomers?

We know that the optical isomers are the compounds that are mirror images of each other. These images could be super impossible or non super imposible. When the compounds are non super impossible images we call them enantiomers but is they are super impossible mirror images we call them diastereomers.

Recall that both diastereomers and enantiomers are all kinds of stereoisomers. These are isomers that have the same molecular formula but different arrangement of the atoms in space.

Thus we could have enantiomers when we have mirror images and diastereomers when we do not have mirror images.

Learn more about enantiomers:https://brainly.com/question/21506956

#SPJ1

5. If you have 5.0 L of a 3 molar saline solution of sodium chloride in water, how many
grams of NaCl would you find if you boiled off all the water?

Answers

You would have 175.32 grams of NaCl after boiling out all the water from 5.0 L of a 3 M NaCl solution.

When sodium chloride is boiled in water, what happens?

Salt dissolves in water, forming sodium and chloride ions. If all the water were to be evaporated by boiling, the ions would join once more to produce solid salt. NaCl is safe to boil without harm, nevertheless. 2575 F, or 1413 C, is the boiling point of sodium chloride.

Three moles of NaCl would remain after boiling off all the water from a 5.0 L solution of 3 M NaCl. You can use the molar mass of NaCl, which is 58.44 g/mol, to get the mass of NaCl.

Mass of NaCl = moles of NaCl x molar mass of NaCl

Mass of NaCl = 3 mol x 58.44 g/mol

Mass of NaCl = 175.32 g

To know more about solution visit:-

https://brainly.com/question/30886177

#SPJ1

What is the wavelength of radiation emitted when an electron goes from the n = 7 to the n = 4 level of the Bohr hydrogen atom? Give your answer in nm.

Answers

Answer:

the wavelength of radiation emitted  is λ=2169.62 nm

Explanation:

The energy of the Bohr's hydrogen atom can be expressed with the formula:

En=13.6 evn2

For n = 7:

E7=13.6 ev72

E7=0.27755 eV

For n = 4

E4=13.6 ev42

E4=0.85 eV

The  electron goes from the n = 7 to the n = 4, then :

E7E4=(0.27755(0.85)) eV

=0.57245 eV

Wavelength of the radiation emitted:

λ=hc0.57245 eV

where;

hc  = 1242 eV.nm

λ=1242 eV.nm0.57245 eV

λ=2169.62 nm

Build the molecular models of the compounds listed below and draw the Fischer projection for each of them. In the Fischer projection when the compound has more than one stereogenic center the longest carbon chain is drawn from top to bottom (vertical), with the functional group carbon at the top (top). Identify the pairs of molecules that represent enantiomers and diastereomers and identify each stereogenic center by writing R or S next to it.

Answers

The R or S designation is assigned to each stereogenic center based on the priority of the substituents attached to that carbon atom.

Enantiomers are pairs of molecules that are non-superimposable mirror images of each other. Enantiomers have the same chemical and physical properties, except for their interaction with polarized light. Enantiomers have opposite configurations at every stereogenic center, so they have opposite R or S designations.

Diastereomers, on the other hand, are stereoisomers that are not mirror images of each other. Diastereomers have different physical and chemical properties, and they have different configurations at one or more stereogenic centers. Unlike enantiomers, diastereomers do not have opposite R or S designations.

To identify stereogenic centers in a molecule, one needs to determine the number of different substituents attached to a carbon atom. The R or S designation is assigned to each stereogenic center based on the priority of the substituents attached to that carbon atom.

Learn more about Enantiomers :

https://brainly.com/question/21506956

#SPJ4

How many liters of 0.200 M sodium hydroxide do you need to titrate 0.300 L of a 0.100 M diprotic acid to the equivalence point?

Answers

The volume of the sodium hydroxide solution needed for the reaction is 0.3 L

We'll begin by writing the balanced equation for the reaction.

H₂X + 2NaOH → 2H₂O + Na₂X

From the balanced equation above, the following data were obtained:

The mole ratio of the acid, H₂X (nA) = 1The mole ratio of base, NaOH (nB) = 2

From the question given above, the following data were obtained:

Molarity of base, NaOH (Mb) = 0.2 M. Volume of acid, H₂X (Va) = 0.3 L. Molarity of acid, H₂X (Ma) = 0.1 M. Volume of base, NaOH (Vb) =?

MaVa / MbVb = nA / nB

(0.1 × 0.3) / (0.2 × Vb) = 1/2

0.03 / (0.2 × Vb) = 1/2

Cross multiply

0.03 × 2 = 0.2 × Vb

0.06 = 0.2 × Vb

Divide both side by 0.2

Vb = 0.06 / 0.2

Vb = 0.3 L

Therefore, the volume of NaOH needed for the reaction is 0.3 L

Learn more on titration: https://brainly.com/question/23298305

Metamorphic rocks with a non-foliated texture show metamorphic change that involves ____.
a.
mineral grains arranging into layers
b.
growth in the size of the mineral grains
c.
mineral grains flattening under pressure
d.
mineral grain melting

Answers

Answer:

b.  growth in the size of the mineral grains

Explanation:

Non-foliated texture shown by a metamorphic change is depicted by growth in the size of the mineral grains.

Examples of non-foliated metamorphic rocks are quartzite and marble. In these metamorphic rocks, mineral grains are not aligned with their long axis. Non-foliated texture occurs under high temperature and low pressure conditions.As minerals are able to grow, the size can be used to show a metamorphic change.

Answer:

its b home slice

Explanation:

Calculate the standard entropy change
C2H2 (g) + 2H2 (g) → C2H6 (g
C2H2= 201
H2=131
C2H6 = 230

Answers

Entropy is a notion that essentially refers to the universe's propensity for chaos or the spontaneous changes that take place in everyday happenings. Here the standard entropy change for the given reaction is -233.

Entropy is typically referred to as a measurement of a system's randomness or disorder. In the year 1850, a German physicist by the name of Rudolf Clausius first proposed this idea. Entropy is a thermodynamic property that is used to characterize how a system behaves in terms of temperature, pressure, entropy, and heat capacity.

Here the standard entropy change is:

Entropy of products - entropy of reactants

ΔS = 230 - (201 + 2 ( 131)) = -233

To know more about entropy, visit;

https://brainly.com/question/17172535

#SPJ1

The rate constant for the reaction below was determined to be 3.241×10-5 s–1 at 800 K. The activation energy of the reaction is 255 kJ/mol. What would be the value of the rate constant at 9.50×102 K?

Answers

Answer:

k2=1.379x102s1

Explanation:

Hello.

In this case, for a normal reaction, when we know the rate constant at a determined temperature, we can compute at another temperature via the Arrhenius equation specified for temperature change:

k2=k1exp[EaR(1T21T1)]

In such a way, the rate constant at 9.50x10² K is:

k2=3.241x105s1exp[2550008.314(19501800)]k2=1.379x102s1

Best regards!

For the complete redox reaction given, write the half-reactions and identify the oxidizing and reducing agents. H(2)+Cl(2)->2HCl
Part 1 of 4
What is the oxidation half reaction?
Part 2 of 4
What is the reduction half reaction?
Part 3 of 4
What is the oxidizing agent?
Part 4 of 4
What is the reducing agent?

Answers

The half-reaction is; H₂ → 2H⁺ + 2e⁻, the oxidizing agent is chlorine , and the reducing agent is hydrogen. The oxidation half-reaction is where a species loses electrons, the reduction half-reaction is where a species gains electrons, the oxidizing agent is the species that causes another species to be oxidized by accepting electrons itself, and the reducing agent is the species that causes another species to be reduced by donating electrons itself.

The oxidation half-reaction is the half-reaction where a species loses electrons. In this reaction, hydrogen (H₂) is oxidized to form hydrogen ions (H⁺). The half-reaction can be written as;

H₂ → 2H⁺ + 2e⁻

The reduction half-reaction is the half-reaction where a species gains electrons. In this reaction, chlorine (Cl₂) is reduced to form chloride ions (Cl⁻). The half-reaction can be written as follows;

Cl₂ + 2e⁻ → 2Cl⁻

The oxidizing agent is the species that causes another species to be oxidized by accepting electrons itself. In this reaction, chlorine (Cl₂) is the oxidizing agent because it accepts electrons from hydrogen (H₂), causing it to be oxidized.

The reducing agent is the species that causes another species to be reduced by donating electrons itself. In this reaction, hydrogen (H₂) is the reducing agent because it donates electrons to chlorine (Cl₂), causing it to be reduced.

Therefore, chlorine is the oxidizing agent, and hydrogen is the reducing agent.

To know more about oxidation half-reaction here

https://brainly.com/question/9770435

#SPJ1

What is the osmotic pressure of a 0.850M solution of glucose at 245K?


Use R=0.08206 (L atm/mol K) for the gas constant.

Report your answer using three significant figures.

Answers

The osmotic pressure of the system is 17.1 atm.

What is the osmotic pressure?

Osmotic pressure is the pressure that must be applied to a solution in order to prevent the flow of solvent from a region of higher concentration to a region of lower concentration across a semi-permeable membrane. A semi-permeable membrane allows only solvent molecules to pass through, while preventing the passage of solute molecules.

π=i c R T

π= osmotic pressure

i = Van't Hoff factor

c = concentration

R = gas constant

T = temperature

π= 1 * 0.85 * 0.08206 * 245

= 17.1 atm

Learn more about osmotic pressure:https://brainly.com/question/12497098

#SPJ1

Other Questions
the significant changes illustrated by artificial selection provide strong support for the power of ______ selection. select all that apply marketers strive for efficient operations to provide their customers with which of the following? (choose every correct answer.) multiple select question. the products they want low-quality merchandise the correct quantity of merchandise products with lower costs than those of competitors' Which statement is the converse of the following conditional? If a polygon has three sides, then it is a triangle. A. If a polygon does not have three sides, then it is not a triangle. B. If a polygon is not a triangle, then it does not have three sides. C. If a polygon is a triangle, then it does not have three sides. D. If a polygon is a triangle, then it has three sides. what is the maximum number of roads that can be closed while still making sure that for any two buildings in the city, there still exist roads that people can use to travel from one to the other?graph theory math stack math.stackexchange ________ is the functional area in charge of visualizing and creating new products. Which of the following is a factor in choosing a location?Group of answer choices:A. Environmental IssuesB. Seven wastesC. Price break pointD. Process integration Draw and label a rectangle with an area of 32 square units and a perimeter of 36 units Help this is the question pls help I need your help answer correctly23 pts What are the 4 types of sensory input? Find the coefficient of t to the 4th power in the expansion of (-9t-9) to the 7th power select one: a. -25,515 b. -100,442,349 c. -167,403, 915 d. -4,782, 969 PlS HELP QUICKLY :One of the roots of the equation x2bx+c=0 is equal to 5. Find c in terms of b.:Guys pls help and find what C is equal to. This is for a interview what 3 actions government has taken to help people be healthier and safer If x = 2, calculate the value of: 2x2 - x Which African countries political systems are listed as in transition amid ongoing conflict? who was the forerunner of the english reformation, who started the first translation of the bible into english? Imperialism led to a more globalized world true or false A company issues a ten-year $1,000 face value bond at par with a coupon rate of 6.7% paid semiannually. The YTM at the beginning of the third year of the bond (8 years left to maturity) is 8.1%. What was the percentage change in the price of the bond over the past two years American Pet Pro purchases pet grooming supplies from various manufacturers, sorts them, and resells them to retailers. American Pet Pro is a(n) _____ wholesaler.A) functionalB) agentC) merchantD) manufacturers'E) vertical Pls pls pls pls pls pls pls pls ahh