which conversion factor can you use to convert meters to feet?

select all that apply

3fy/1yd

12in/1ft

1.09yd/1m

1m/1.09yd

1ft/12in

1yd/3ft

Answers

Answer 1

The conversion factor to convert meters to feet is 3.281 feet per meter.

What conversion factor should we use to convert meters to feet?

According to dimensional analysis, a quantity in a given unit can be converted into another quantity in a given unit of the same kind by using a conversion factor, whose formula is shown below:

Y = A · X

Unit representation

[Y] = ([Y] / [X]) · [X]

In this problem we need to convert a SI length unit into an US length unit. A meter is approximately equal to 3.281 feet or 1.094 yards.

To learn more on conversion factor: https://brainly.com/question/28366871

#SPJ1


Related Questions

HELPPP PLEASE!!!!!!!!!

HELPPP PLEASE!!!!!!!!!

Answers

Answer:  x = 40

Work Shown:

Focus on the angles at the bottom right

Those two angles add to 180 since they form a straight line. We consider them supplementary angles.

x+(4x-20) = 180

5x-20 = 180

5x = 180+20

5x = 200

x = 200/5

x = 40

What is the answer? What is the answer? What is the answer? What is the answer? What is the answer? What is the answer? What is the answer? What is the answer? What is the answer?

What is the answer? What is the answer? What is the answer? What is the answer? What is the answer? What

Answers

The amount of money Rashon would need to invest is equal to $8,300.46.

How to determine the value of equivalent quarterly interest rate?

Mathematically, the compound interest on an investment can be calculated by using this mathematical expression:

A(t) = P(1 + r/n)^{nt}

Where:

A represents the future value.r represents the interest rate.n represents the number of times compounded.P represents the principal.T represents the time measured in years.

In this scenario, Rashon's investment is compounded quarterly at an interest rate of 6.9% as follows:

Quarterly interest rate = 0.069/4

Quarterly interest rate = 0.01725%

20,200 = P(1 + 0.01725)^{4 × 13}

20,200 = P(1.01725)^52

20,200 = 2.4336P

Principal, P = 20,200/2.4336

Principal, P = $8,300.46.

Read more on interest rate here: brainly.com/question/26343258

#SPJ1

Answer:

In this scenario, Rashon's investment is compounded quarterly at an interest rate of 6.9% as follows:

Quarterly interest rate = 0.069/4

Quarterly interest rate = 0.01725%

20,200 = P(1 + 0.01725)^{4 × 13}

20,200 = P(1.01725)^52

20,200 = 2.4336P

Principal, P = 20,200/2.4336

Principal, P = $8,300.46.

What is the solution of log2 (3x - 7) = 3?
One-third
4
5
Sixteen-thirds

Answers

Answer:

I presume the problem means

ln (3 x - 7) = 3       where ln generally means log to the base 2 as opposed to  

                             log which generally means log to the base 10

(3 x - 7) = 3^2       expanding using definition of ln x

3 x - 7 = 9

x = 16 / 3

 

The solution to the logarithmic equation log₂(3x - 7) = 3 is 5

What is a logarithmic equation?

A logarithmic equation is an equation that is represented by the log or ln expression

How to determine the solution?

The logarithmic equation is given as:

log₂(3x - 7) = 3

Apply the change of base rule

3x - 7 = 2^3

Evaluate the exponent

3x - 7 = 8

Add 7 to both sides

3x = 15

Divide by 3

x = 5

Hence, the solution to  log₂(3x - 7) = 3 is 5

Read more about logarithmic equation at:

https://brainly.com/question/13473114

jill and joel wrote equations for the line passing through the points (2,-1) and (-1,14). which student is correctJill 5x + y = 9Joel y + 1 = -5(x-2)a. jill only b. joel only c. both d. neither

Answers

The equation given by Jill and Joel both are correct. Option C .

The line passing through the points (2, -1) and (-1, 14).

The equation of a line passing through a point \((x_1, y_1)\) is \(y-y_1=m (x-x_1)\) where m is the slope.

To find the slope m, using slope formula.

\(m=\frac{y_2-y_1}{x_2-x_1} \\m=\frac{14-(-1)}{-1-3} \\m=-5\)

Further simplify,

Substitute the values in the given formula.

\(y-y_1=m(x-x_1)\\y-(-1)=-5(x-2)\\y+1=-5(x-2)\)

Further simplify,

5x+y=9

Both the equations are correct.

To learn more about slope refer the link:

https://brainly.com/question/3605446

#SPJ4

A Simple Maximization Problem

Consider the following linear programming problem
a. List all the extreme points of the feasible region. b. Find the optimal solution and the objective function value.
c. List the values of all the slack variables.
a. (0,0),(5,0),(3.75,3.75),(3.5,4.5),(0,8); b. x=3.5,y=4.5,OFV=59.5;c.s1=0,s2=2,s3=0
a. (0,0),(5,0),(3.5,4.5),(0,8); b. x=3.5,y=4.5,OFV=59.5;c.s1=0,s2=2,s3=0.
a. (0,0),(5,0),(3.75,3.75),(6,4),(0,8); b. x=6,y=4,OFV=76;c1.s1=5,s2=0,s3=2.
a. (0,0),(5,0),(8,0),(3.5,4.5),(0,8); b. x=8,y=0,OFV=64;c.s1=45,s2=20,s3=0.
a. (0,0),(5,0),(3.75,3.75),(4,6),(0,8); b. x=4,y=6, OFV =74;c1.s1=0,s2=0, s3=2.
a. (0,0),(5,0),(8,0),(3.5,4.5),(0,8),(0,10); b. x=0,y=10,OFV=70;c.s1=25,s2=0,s3=2
a. (0,0),(3,0),(3.75,3.75),(3,5),(0,4); b. x=3,y=5, OFV =59;c1.s1=5,s2=0,s3=0
a. (0,0),(5,0),(3.75, 3.75),(3.5),(0,8); b. x=3, y=5, OFV=59; c1.s1=5, s2=0, s3=0

Answers

a. (0,0), (5,0), (3.75, 3.75), (3.5,4.5), (0,8);

b. x = 3.5, y = 4.5, OFV = 59.5;

c. s1 = 0, s2 = 2, s3 = 0.

a. The extreme points of the feasible region are the vertices of the polygon formed by the intersection of the constraint lines. In this case, the extreme points are (0,0), (5,0), (3.75, 3.75), (3.5,4.5), and (0,8).

b. To find the optimal solution and the objective function value, we evaluate the objective function at each extreme point and choose the point that maximizes the objective function. In this case, the point (3.5, 4.5) maximizes the objective function with a value of 59.5. Therefore, the optimal solution is x = 3.5 and y = 4.5, and the objective function value is 59.5.

c. The slack variables represent the surplus or slack in each constraint. We calculate the slack variables by subtracting the actual value of the left-hand side of each constraint from the right-hand side. In this case, the values of the slack variables are s1 = 0 (indicating no slack in the first constraint), s2 = 2 (indicating a surplus of 2 in the second constraint), and s3 = 0 (indicating no slack in the third constraint).

Therefore, the correct option is:

a. (0,0), (5,0), (3.75, 3.75), (3.5,4.5), (0,8);

b. x = 3.5, y = 4.5, OFV = 59.5;

c. s1 = 0, s2 = 2, s3 = 0.

Learn more about polygon from

https://brainly.com/question/26583264

#SPJ11

Write –3/8 as a decimal number.

Answers

Answer:

-0.375

Step-by-step explanation:

you just divide the numbers.

Find the value of TN.
A. 32
B. 30
C. 10
D. 38

Find the value of TN.A. 32B. 30C. 10D. 38

Answers

The value of TN for this problem is given as follows:

B. 30.

How to obtain the value of TN?

A chord of a circle is a straight line segment that connects two points on the circle, that is, it is a line segment whose endpoints are on the circumference of a circle.

When two chords intersect each other, then the products of the measures of the segments of the chords are equal.

Then the value of x is obtained as follows:

8(x + 20) = 12 x 20

x + 20 = 12 x 20/8

x + 20 = 30.

x = 10.

Then the length TN is given as follows:

TN = x + 20

TN = 10 + 20

TN = 30.

More can be learned about the chords of a circle at brainly.com/question/16636441

#SPJ1

If you invest $1000 into an account that earns 8.5% interest each year, WHAT
EQUATION WOULD MODEL how much you would have after 35 years?

Answers

Answer:

i believe it would be 35(1000 x 8.5%)

Step-by-step explanation:

how to find the hypotenuse ​

Answers

Answer:

use Pythagoras theorem to find hypotenuse in right angle triangle

Facts of the Case: A man we will call Mr. Smith who weighs 420 pounds walks into a Boston area McDonalds and orders a Happy Meal. He takes it to a table and sits down on one of the plastic-molded seats. It cannot hold his weight and it collapses. Mr. Smith is only injured slightly as his hand hit the table while he was going down and it was bruised. He claims that the experience was quite painful and embarrassing and as a result he is now scared to sit on seats. Mr. Smith sues McDonald’s Corporation for $1 million for pain and suffering. He claims that McDonalds is to blame for having the faulty seat in its restaurant.


Basic Statistics of the Case: The average adult male in the United States weighs 185 pounds and the standard deviation is 31 pounds. As in most measurements of this kind, you can assume that male weight is distributed normally. Although Mr. Smith has a medical problem that makes him weigh as much as he does, the judge in the case has ruled that the reason for Mr. Smith’s girth has no bearing on the case. The company that manufactures the seat says that the average load that its seats can handle before collapse is 450 pounds with a standard deviation of 8 pounds. Again, it makes sense to assume normal distribution. Who is to blame here, if anyone?

Answers

It is unlikely that McDonald's is to blame for having a faulty seat in its restaurant. The company that manufactures the seat may be more likely to blame if the seat was not properly manufactured or tested.

To determine who is to blame, we need to calculate the probability of a 420-pound person causing a seat to collapse that is designed to hold an average load of 450 pounds with a standard deviation of 8 pounds.

Assuming a normal distribution, we can calculate the z-score of a 420-pound person as:

z = (420 - 450) / 8 = -3.75

Looking at a standard normal distribution table, we find that the probability of a z-score of -3.75 or lower is approximately 0.0001. This means that there is a very low chance of a 420-pound person causing a seat designed for an average load of 450 pounds to collapse.

However, it should also be noted that Mr. Smith's medical condition may have contributed to the seat's collapse, even if the judge ruled that it is not relevant to the case. Ultimately, it would be up to a court of law to determine who is to blame and whether or not Mr. Smith's claims for pain and suffering are justified.

Learn more about average at: brainly.com/question/29306232

#SPJ11

What is 2 2/4 rounded to the nearest whole number?

Answers

Answer:

2 2/4 is equal to 2 1/2 which equals to 2.50. So 5 rounds up. So the nearest whole number is 3.

Step-by-step explanation:

Answer:

3

Step-by-step explanation:

3 because 2/4 is closer then 1/4 so rounding it up to the nearest whole number it would be 3. Hope this helps :) <3 have a great day

evaluate the expression 6x + 4 9/10 when x = 2/3.

Answers

x=2/3

6(2/3) + 4 9/10 =4 + 4 9/10 = 8 9/10

Answer:

2x-1=y,2y+3=x

Step-by-step explanation:

no explanation

Help me find the slope please guys
Im struggling

Help me find the slope please guysIm struggling

Answers

Answer:

negative 1

Step-by-step explanation:

\( \frac{y2 - y1}{x2 - x1} = m\)

the 2 points: (-2,0), (-3,1)

(1-0)/(-3+2)

=-1

m=-1

brainliest please

Question 9 of 10
A fellow classmate tosses 3 coins and finds that 2 of them come up tails.
Which of the following is the best conclusion for her to come to?
OA. She needs to keep flipping the coins until she gets 50% heads in
order to determine if they are fair.
OB. If she flips the coins once more, they will all come up heads.
OC. The coins are unfair.
OD. This could easily happen with a fair coin after only 3 flips.

Answers

The best conclusion for her to come to: D. this could easily happen with a fair coin after only 3 flips.

What is a fair coin?

A fair coin can be defined as an idealized type of coin that has an equal probability of revealing both heads and tails when randomly tossed.

This ultimately implies that, the best conclusion for her to come to is that this could easily happen with a fair coin after only 3 flips considering 2 of the three coins come up tails.

Read more on fair coin here: https://brainly.com/question/10837034

#SPJ1

Consider the linear transformation o: P3 P4 such that o(a₂t² +a₁t+to)=(a₂ +a₁ +ãº)t³ +(a₂ +ª₁ −ãº)t² + (a₂-a₁ +ãº)t + ao. What is the matrix representing o with respect to A={1,t,t²} and B={1,t,t²,t³}?

Answers

The matrix representing the linear transformation o with respect to the bases A and B is:

| 1  0  0  0 |

| 0  1  1  0 |

| 0  0  1  1 |

To find the matrix representing the linear transformation o with respect to the given bases A={1, t, t²} and B={1, t, t², t³}, we need to determine the image of each basis vector from A under the transformation o, and then express these images as linear combinations of the basis vectors from B. The coefficients of these linear combinations will form the columns of the matrix representation.

Let's consider the transformation of each basis vector from A:

1: o(1) = 1 + 0t + 0t² + 0t³ = 1

t: o(t) = (0 + 1 + 0) t³ + (0 + 1 - 0) t² + (0 - 1 + 0) t + 0 = t³ + t² - t

t²: o(t²) = (1 + 0 + 0) t³ + (1 + 0 - 0) t² + (1 - 0 + 0) t + 0 = t³ + t² + t

Now, we express these images as linear combinations of the basis vectors from B:

1 = 1 * 1 + 0 * t + 0 * t² + 0 * t³

t³ + t² - t = 0 * 1 + 1 * t + 1 * t² + 0 * t³

t³ + t² + t = 0 * 1 + 0 * t + 1 * t² + 1 * t³

The coefficients in front of each basis vector in B form the columns of the matrix:

[1, 0, 0, 0]

[0, 1, 1, 0]

[0, 0, 1, 1]

Therefore, the matrix representing the linear transformation o with respect to the bases A and B is:

| 1  0  0  0 |

| 0  1  1  0 |

| 0  0  1  1 |

To know more about matrix representation, click here: brainly.com/question/31265589

#SPJ11

14 (multiplied) or (divided) by what gives me -11.2

Answers

Answer:

-0.8

Step-by-step explanation:

firstly do

-11.8 ÷ 14 which will give you -0.8

14 × -11.8 = -0.8

Consider the system x - 3y = 2 - x + ky = 0 a. Find the constant k such that the system has no solution. b. Write the system using vectors like in questions 1 and show the vectors are parallel for the k you found.

Answers

Answer: we can conclude that the two vectors are parallel because they have the same direction.

Step-by-step explanation:

a) To find the constant k such that the system has no solution, we can use the determinant of the system as a criterion.

So, the system will have no solution if and only if the determinant is equal to zero and the equation is as follows:

| 1 - 3 | 2 | 1 || -1 k | 0 | = 0

Expanding the above determinant, we get:

|-3k| - 0 | = 0

We can see that the determinant is zero for any value of k.

So, there are infinitely many solutions.

b) We are given the system:

x - 3y = 2-x + k

y = 0

Now, we will rewrite the system using vectors as follows:

⇒ r. = r0 + td

Where d = (1, -3) and r0 = (2, 0)

Then, the equation x - 3y = 2 can be written as:

r. = (2, 0) + t(1, -3)

Next, we will substitute the value of k in the system to find the equation of the second line.

We know that the system has no solution for

k = 0.

So, the equation of the second line is:

r. = (0, 0) + s(3, 1)

To know more about determinant  visit:

https://brainly.com/question/29898039

#SPJ11

A city doubles its size every 82 years. If the population is currently 139,000, what will the population be in 246 years?

Answers

1,112,000 people in 246 years

Answer: 2224000

Step-by-step explanation:

246 is double twice 82 (x4)

That means 139000 would be double four times

139000*2*2*2*2=139000*16=2224000

Hope that helps! Please make me Brainliest!

Compare using , or =.

8 x 103 ___ 9 × 100

Answers

\(8 \times 103 < 9 \times 100\)

This is because :-

\( = 8 \times 103\)

\( = 824\)

is smaller than :-

\( = 9 \times 100\)

\( = 900\)

As , 824 < 900

Therefore , the correct answer is :-

8 × 103 < 9 × 100

Answer:

9 time 100 is the right answer

Step-by-step explanation:

there are two important properties of probabilities. 1) individual probabilities will always have values between and . 2) the sum of the probabilities of all individual outcomes must equal to .

Answers

1.)  Probabilities range from 0 to 1, denoting impossibility and certainty, respectively.

2.) The sum of probabilities of all possible outcomes is equal to 1.

1.) Individual probabilities will always have values between 0 and 1. This property is known as the "probability bound." Probability is a measure of uncertainty or likelihood, and it is represented as a value between 0 and 1, inclusive.

A probability of 0 indicates impossibility or no chance of an event occurring, while a probability of 1 represents certainty or a guaranteed outcome.

Any probability value between 0 and 1 signifies varying degrees of likelihood, with values closer to 0 indicating lower chances and values closer to 1 indicating higher chances. In simple terms, probabilities cannot be negative or greater than 1.

2.) The sum of the probabilities of all individual outcomes must equal 1. This principle is known as the "probability mass" or the "law of total probability." When considering a set of mutually exclusive and exhaustive events, the sum of their individual probabilities must add up to 1.

Mutually exclusive events are events that cannot occur simultaneously, while exhaustive events are events that cover all possible outcomes. This property ensures that the total probability accounts for all possible outcomes and leaves no room for uncertainty or unaccounted possibilities.

for more question on probabilities visiT:

https://brainly.com/question/25839839

#SPJ8



its graphing linear inequalities
if u can help that would be nice

its graphing linear inequalitiesif u can help that would be nice

Answers

it is y>_ 5/3x+3 that’s the answer

Answer:

y>_ 5/3x+3 is the answer.

Step-by-step explanation:

Identify the solution to a_n = 2a_n − 1 + a_n − 2 − 2a_n − 3 with a_0 = 3, a_1 = 6, and a_2 = 0 for all integers n ≥ 3.
(a) an = 6 + 2( –3)^n – 6^n
(b) an = 6 – 2 · 1^n + 2^n
(c) an = 6 – 2( –1)^n – 2^n
(d) an = 6 + 2( –2)^n – 3^n
please show solution as well. Thanks

Answers

None of the given options correctly represent the solution to the recurrence relation with the provided initial conditions.

To find the solution to the given recurrence relation, we can use the provided initial conditions and iterate to find the value of aₙ for any given n.

Given:

a₀ = 3

a₁ = 6

a₂ = 0

We can start by calculating a₃ using the recurrence relation:

a₃ = 2a₂ + a₁ - 2a₀

= 2(0) + 6 - 2(3)

= 0 + 6 - 6

= 0

Next, let's calculate a₄:

a₄ = 2a₃ + a₂ - 2a₁

= 2(0) + 0 - 2(6)

= 0 + 0 - 12

= -12

Continuing this process, we can calculate a₅, a₆, and so on:

a₅ = 2a₄ + a₃ - 2a₂

= 2(-12) + 0 - 2(0)

= -24 + 0 - 0

= -24

a₆ = 2a₅ + a₄ - 2a₃

= 2(-24) + (-12) - 2(0)

= -48 - 12 - 0

= -60

Based on the values we have calculated, we can see that none of the options provided (a), b), c), or d)) match the sequence of aₙ values we obtained.

Therefore, none of the given options correctly represent the solution to the recurrence relation with the provided initial conditions.

Learn more about initial conditions here:

https://brainly.com/question/30884144

#SPJ4

Telephone call can be classified as voice (V) if someone is speaking, or data (D) if there is a modem or fax transmission.Based on extension observation by the telephone company, we have the following probability model:P[V] 0.75 and P[D] = 0.25.Assume that data calls and voice calls occur independently of one another, and define the random variable K₂ to be the number of voice calls in a collection of n phone calls.Compute the following.(a) EK100]= 75(b) K100 4.330Now use the central limit theorem to estimate the following probabilities. Since this is a discrete random variable, don't forget to use "continuity correction".(c) PK10082] ≈ 0.0668(d) P[68 K10090]≈ In any one-minute interval, the number of requests for a popular Web page is a Poisson random variable with expected value 300 requests.
(a) A Web server has a capacity of C requests per minute. If the number of requests in a one-minute interval is greater than C, the server is overloaded. Use the central limit theorem to estimate the smallest value of C for which the probability of overload is less than 0.06.
Note that your answer must be an integer. Also, since this is a discrete random variable, don't forget to use "continuity correction".
C = 327
(b) Now assume that the server's capacity in any one-second interval is [C/60], where [x] is the largest integer < x. (This is called the floor function.)
For the value of C derived in part (a), what is the probability of overload in a one-second interval? This time, don't approximate via the CLT, but compute the probability exactly.
P[Overload] =0

Answers

(a) E[K100] = 75, since there is a 0.75 probability that a call is a voice call and 100 total calls, we expect there to be 75 voice calls.

(b) Using the formula for the expected value of a binomial distribution, E[K100] = np = 100 * 0.75 = 75 and the variance of a binomial distribution is given by np(1-p) = 100 * 0.75 * 0.25 = 18.75. So the standard deviation of K100 is the square root of the variance, which is approximately 4.330.

(c) Using the central limit theorem, we have Z = (82.5 - 75) / 4.330 ≈ 1.732. Using continuity correction, we get P(K100 ≤ 82) ≈ P(Z ≤ 1.732 - 0.5) ≈ P(Z ≤ 1.232) ≈ 0.8932. Therefore, P(K100 > 82) ≈ 1 - 0.8932 = 0.1068.

(d) Using the same approach as (c), we get P(68.5 < K100 < 90.5) ≈ P(-2.793 < Z < 1.232) ≈ 0.9846. Therefore, P(68 < K100 < 90) ≈ 0.9846 - 0.5 = 0.4846.

For the second part of the question:

(a) Using the central limit theorem, we need to find the value of C such that P(K > C) < 0.06, where K is a Poisson random variable with lambda = 300. We have P(K > C) = 1 - P(K ≤ C) ≈ 1 - Φ((C+0.5-300)/sqrt(300)) < 0.06, where Φ is the standard normal cumulative distribution function. Solving for C, we get C ≈ 327.

(b) In one second, the number of requests follows a Poisson distribution with parameter 300/60 = 5. Using the Poisson distribution, P(overload) = P(K > ⌊C/60⌋), where K is a Poisson random variable with lambda = 5 and ⌊C/60⌋ = 5. Therefore, P(overload) = 1 - P(K ≤ 5) = 1 - Σi=0^5 e^(-5) * 5^i / i! ≈ 0.015.

Learn more about probability here

https://brainly.com/question/13604758

#SPJ11

Comparing two algorithms.

Say we have two different algorithms with respective runtimes of f(n) and g(n). Given the following cases, prove whether or not f(n) = ϴ(g(n)) is true in each case. Show your work but with the crucial steps only. P.S. sqrt(n) means the square-root of n, aka n^(½).

Case

f(n)

g(n)

A

log(n^200)

log(n^2)

B

sqrt(n)

log(n)

C

3^n

5^n

D

sin(n)+3

cos(n)+1

Answers

f(n) = ϴ(g(n)) is not true in cases B(sqrt(n)log(n), C(\(3^n 5^n\)), and D(sin(n)+3 cos(n)+1).

A) \(log(n^200) log(n^2)\)

Here, f(n) = \(log(n^200)\) and g(n) = \(log(n^2)\). Now, if we take the limit of f(n) / g(n) as n approaches infinity, then:

f(n) / g(n) = \([log(n^200) / log(n^2)]\) = 100

This means that as n approaches infinity, the ratio f(n) / g(n) is constant, and so we can say that f(n) = ϴ(g(n)). Therefore, f(n) = ϴ(g(n)) is true in this case.

B) sqrt(n) log(n) Here, f(n) = sqrt(n) and g(n) = log(n). Now, if we take the limit of f(n) / g(n) as n approaches infinity, then:

f(n) / g(n) = [sqrt(n) / log(n)]

As log(n) grows much slower than sqrt(n) as n approaches infinity, this limit approaches infinity. Therefore, we cannot say that f(n) = ϴ(g(n)) is true in this case.

C) 3^n 5^n

Here, f(n) = \(3^n\) and g(n) = \(5^n\) . Now, if we take the limit of f(n) / g(n) as n approaches infinity, then:

f(n) / g(n) = \([3^n / 5^n]\)

As \(3^n\) grows much slower than \(5^n\) as n approaches infinity, this limit approaches zero. Therefore, we cannot say that f(n) = ϴ(g(n)) is true in this case.

D) sin(n) + 3 cos(n) + 1

Here, f(n) = sin(n) + 3 and g(n) = cos(n) + 1. Now, if we take the limit of f(n) / g(n) as n approaches infinity, then:

f(n) / g(n) = [sin(n) + 3] / [cos(n) + 1]

As this limit oscillates between positive and negative infinity as n approaches infinity, we cannot say that f(n) = ϴ(g(n)) is true in this case.

Therefore, f(n) = ϴ(g(n)) is not true in cases B, C, and D.

To know more about log refer here:

https://brainly.com/question/32621120

#SPJ11

B
Peter is an interior house painter. He can paint 1,005 square feet of walls with 3 gallons of paint. He is scheduled to paint a new
house that will have between 1,950 and 2,070 square feet of walls. About how many gallons of paint will he need to paint the
Interior of the new house?
OA. 5 gallons
OB. 6 gallons
OC. 3 gallons
OD. 12 gallons
Reset
Submit

Answers

Peter will be needing 6 gallons of paint to paint the wall of area 2070 sq ft.

Given that Peter uses 3 gallons of paint to paint an area of 1005 ft², we need to find how many gallons of paint would he need to paint a wall having area between 1,950 and 2,070 square feet of walls.

So,

Since he uses 3 gallons for 1005,

So, for 1 sq ft of area he will need = 1/335 gallons

So, for an area of 2070 sq ft he will need = 2070 x 1/335 ≈ 6 gallons.

Hence he will be needing 6 gallons of paint to paint the wall of area 2070 sq ft.

Learn more about unit rates click;

https://brainly.com/question/29781084

#SPJ1

measurements are usually affected by both bias and chance error. (True or False)

Answers

It is correct to say that measurements are affected by both bias and chance error, as these factors contribute to the overall uncertainty and variability in the measurement process.

Measurements are typically affected by both bias and chance error. Bias refers to a systematic error or tendency for measurements to consistently deviate from the true value in the same direction. It can be caused by various factors such as calibration issues, instrument inaccuracies, or human error. Bias affects the accuracy of measurements by introducing a consistent deviation from the true value.

On the other hand, chance error, also known as random error, is the variability or inconsistency in measurements that occurs due to unpredictable factors. These factors can include environmental conditions, variations in measurement techniques, or inherent limitations of the measuring instruments. Chance error leads to fluctuations in measurement values around the true value and affects the precision of measurements.

Therefore, it is correct to say that measurements are affected by both bias and chance error, as these factors contribute to the overall uncertainty and variability in the measurement process.

Learn more about measurements here:

brainly.com/question/28913275

#SPJ11

50 POINTS!! ANSWER CORRECTLY PLEASE!
Consider the dilation:
(a) Is the image of the dilation a reduction or an enlargement of the original figure? Explain.
(b) What is the scale factor? Explain.
Answer:

50 POINTS!! ANSWER CORRECTLY PLEASE!Consider the dilation:(a) Is the image of the dilation a reduction

Answers

Reduction

Why ?

See co-ordinates decreased back in dilated figure .

#b

M=(-3,3)M'=(-2,2)S=(6,3)S'=(4,2)V=(3,-3)V'=(2,-2)

Scale factor:-

\(\\ \rm\rightarrowtail \dfrac{-2}{-3}=\dfrac{4}{6}=\dfrac{2}{3}\)

\(\\ \rm\rightarrowtail \dfrac{2}{3}=\dfrac{2}{3}=\dfrac{2}{3}\)

Scale factor=K=2/3

Answer:

The original figure is MSV and the dilated figure is M'S'V'

Therefore, the dilation is a reduction of the original figure since the side lengths have reduced in length.

To determine the scale factor, choose one of the sides and compare the length before and after the dilation → let's use MS:

length of MS = 9 units

length of M'S' = 6 units

⇒ scale factor = length after dilation ÷ length before dilation

                        = 6 ÷ 9

                        = 2/3

To find the center of dilation, draw a line through each point and its corresponding dilated point.  The point at which the 3 lines meet is the center of dilation.  

Therefore, the center of dilation for this question is the origin (0, 0)

50 POINTS!! ANSWER CORRECTLY PLEASE!Consider the dilation:(a) Is the image of the dilation a reduction

7
14
In the above image 714, find the area of the given shape.
3 points
A. 49
B. 98
C. 12

714In the above image 714, find the area of the given shape.3 pointsA. 49B. 98C. 12

Answers

Answer:

49 sq. units

Step-by-step explanation:

Equation for area of a triangle: l *w / 2

Substitute l & w: 7 * 14/2

= 49 sq.units

Can someone pls explain how to do order of operations

Answers

Answer:

do you mean PEMDAS?

Step-by-step explanation:

parenthesis, exponents, multiplication, division, addition, and subtraction

you solve in order and go left to right

if you give an equation i can explain it better, but it's basically that

Step-by-step explanation:

1- solve operation in parantheses or brackets.

2- we solve any exponent

3- solve all multiplication and division left to right

\(4x+2y=12\\-4x+y=-18\)

Answers

Answer:

(4, - 2 )

Step-by-step explanation:

4x + 2y = 12 → (1)

- 4x + y = - 18 → (2)

adding the 2 equations term by term will eliminate x

(4x - 4x) + (2y + y) = 12 - 18

0 + 3y = - 6

3y = - 6 ( divide both sides by 3 )

y = - 2

substitute y = - 2 into either of the 2 equations and solve for x

substituting into (1)

4x + 2(- 2) = 12

4x - 4 = 12 ( add 4 to both sides )

4x = 16 ( divide both sides by 4 )

x = 4

solution is (4, - 2 )

Other Questions
How did the colonist use and think of guns? 2+2? first time trying this tutor thing sorry! The value of a professional basketball player's autograph rose 30% in the last year. It is now worth $351.00. What was it worth a year ago? Find the surface area of8 m14 m18 m AUSTINE Corporation has provided its contribution format income statement for August: Sales Less: VC CM Less: FC Net operating income The degree of operating leverage is closest to O 18.93 O 7.21 0.05 the hue of pigmentation which are produced by mixing equal amount of a secondary hue and a primary hue, such as red-orange Devise a test to demonstrate the validity of the following formulas. What values of A and B should be used to test these function thoroughly? (a). Sin (A+B) = Sin(A)cos(B)+cos(A)sin(B) (b). Sin (2A) = 2sin(A)cos(A) (c). Sin2 (A) = (1-cos (2A)). if PB= BC =6 what is ED What is the average of these numbers? 45 46 50 52 51 59 55 51 42 4451 55 60 62 52 54 47 74 52 5259 52 65 45 58 59 59 52 54 65 Katie operates a machine that makes 150 crayons per minute.Use the equation c = 150t, where c represents the number of crayons produced and t represents the amount of time (in minutes) to answer the following questions.Which statement is correct?Group of answer choicesThe number of crayons is dependent on the time.The time is dependent on the number of crayons.As the time increases, the number of crayons decreases.As the number of crayons decreases, the time increases. How can we tell the difference between prose and blank verse in the play? Please help!!The distance from Jacksonville to Gainesville on the map is about 0.6 in.What is the actual distance from Jacksonville to Gainesville? Find the heigh of the kite Who going to get the 50 points....................................................:.. HELP ASAP!!!Should education be mandatory for all scholars? (Write an essay)(Think about customs in each country, or how students have to get jobs to help their family) Some animals hibernate during winter. What molecules provides energy to them during the time . Determine the direction angleof the vector to the nearest degree.q=i+2j Intercalated discs serve to transfer ________ from cell to cell How did the Massacre at Mystic on May 26, 1637 forever change the United States? research suggests that there are 10 primary characteristics that, in aggregate, capture the essence of an organization's culture. match these characteristics with their descriptions.