What volume will 5.6 moles of sulfur hexafluoride
(SF6) gas occupy if the temperature and pressure of
the gas are 128°℃ and 9.4 atm?

Answers

Answer 1

Answer:

19.6 L SF₆

Explanation:

To find the volume, you need to use the Ideal Gas Law:

PV = nRT

In this equation,

-----> P = pressure (atm)

-----> V = volume (L)

-----> n = moles

-----> R = Ideal Gas constant (0.08206 atm*L/mol*K)

-----> T = temperature (K)

After converting the temperature from Celsius to Kelvin, you can plug the given values into the equation and simplify to find "V".

P = 9.4 atm                               R = 0.08206 atm*L/mol*K

V = ? L                                      T = 128 °C + 273.15 = 401.15 K

n = 5.6 moles

PV = nRT

(9.4 atm)V = (5.6 moles)(0.08206 atm*L/mol*K)(401.15 K)

(9.4 atm)V = 184.3429

V = 19.6 L


Related Questions

Humans have altered the composition
of Earth's atmosphere by
A. Making the air pressure drop
B. Making the air temperature drop
C. Polluting it with excess ozone
D. Polluting it with carbon dioxide gas

Answers

The answer is most likely D

If your reaction between benzophenone and sodium borohydride
asked you to quench with acid (HCl). What precautions should you
take before adding the acid?
Check all that apply
-You should add a boiling stone before the acid is added.
-The acid should be added dropwise.
-You should add a base before adding the acid to make sure the
solution is neutral when you add the HCl.
-The reaction solution should be cooled to room temperature.
-You should add the acid as quickly as possible to ensure
quenching is complete.

Answers

When quenching with acid (HCl) after a reaction between benzophenone and sodium borohydride, the following precautions should be taken: The acid should be added dropwise, the reaction solution should be cooled to room temperature, and a base should be added before adding the acid to make sure the solution is neutral. Therefore, options b, c and d are the correct answers.

In chemistry, quenching refers to the cooling of a hot object in a liquid to stabilize the shape and other physical properties of the object. This process involves cooling a substance down to a level where it can be manipulated without changing shape or other physical characteristics.

However, when quenching with acid, the objective is different. Acid quenching is used to stop chemical reactions or remove unreacted chemicals after a chemical reaction has taken place. It helps to minimize side reactions and/or remove excess reagents.

To learn more about acid, click here:

https://brainly.com/question/14072179

#SPJ11

How many grams of KBr is required to prepare 100 mL of
2.0 M KBr solution?

Answers

Answer:

23.8g

Explanation :

Convert 2.0M into mol using mol= concentration x volume

2.0M x 0.1L (convert 100mL to L since the units for M is mol/L)

= 0.2 mol

We can now find grams by using the molar mass of KBr

=119.023 g/mol (Found online) webqc.org

but can be be calculated by using the molecular weight of K and Br found on the periodic table

We can now calculate the grams by using grams=mol x molar mass

119.023g/mol x 0.2mol

= 23.8046 g

=23.8g (rounded to 1decimal place)

-. A 100.0 g Chunk of Aluminum with an Initial Temperature of 450.0 C° is added to 100.0
mL of Ethyl Alcohol with an Initial Temperature of 80.0 C° (A) Calculate Equilibrium
Temperature of the Mixture (B) Calculate the Heat Exchange of the System
BA) 198 C° B) 22770 J All answers Approx
D A) 110C° B) 10000 J All answers Approx
A) 150 C° B) 30000 J All answers Approx
A) 300 C° B) 15000 J All answers Approx

Answers

The negative sign means that heat was transferred from the aluminium piece to the ethyl alcohol. Consequently, the heat exchange of the system is roughly -22,770 J, or -2.28 x 10^4 J (to 2 significant figures).

What happens when 100g of 100 C boiling water is introduced to a calorimeter?

The mixture's temperature rises to 20 C. The mixture in the calorimeter is then dipped into by a metallic block of mass 1 kilogramme at 10°C. The temperature rises to 19 C once thermal equilibrium has been reached.

Q = m * c * T, where Q is the heat exchanged, m is the mass of the substance, c is the specific heat capacity, and T is the change in temperature, is the formula used to determine the heat exchanged.

We can use the following formula to determine the equilibrium temperature:

m_al * c_al * (T_eq - T_al) = m_et * c_et * (T_et - T_eq)

By entering the specified values, we obtain:

(0.100 kg) * (0.902 J/g°C) * (T_eq - 450.0°C) = (0.100 kg) * (2.44 J/g°C) * (80.0°C - T_eq)

Simplifying, we get:

90.2 J/C * (T_eq - 450.0) = 244 J/C * (80.0 - T_eq)

90.2 T_eq - 40590 = 19520 - 244 T_eq

334.2 T_eq = 60110

T_eq ≈ 179.7°C ≈ 180°C (to the nearest 10°C)

As a result, the mixture's equilibrium temperature is roughly 180 °C.

(B) We can apply the same formula as before to determine the system's heat exchange. We can suppose that the mixture has a specific heat capacity equal to that of ethyl alcohol.

Q = m_al * c_al * (T_eq - T_al) + m_et * c_et * (T_eq - T_et)

Plugging in the given values, we get:

Q = (0.100 kg) * (0.902 J/g°C) * (180.0°C - 450.0°C) + (0.100 kg) * (2.44 J/g°C) * (180.0°C - 80.0°C)

Q ≈ -22,770 J ≈ -2.28 x 10⁴ J (to 2 significant figures)

To know more about ethyl alcohol visit:-

https://brainly.com/question/29153788

#SPJ1

How many moles of iron(Il) oxide are produced from
3.0 moles of oxygen and excess Iron Sulfide as described by the chemical equation below?
4FeS + 502 - 2Fe,03 + 4502

Answers

Answer:

6 moles of Iron(II) Oxide

Answer:

1.2 mol

Explanation:

Please help! Will mark brainliest!
I’m doing exams please hurry!

The graph below plots the temperature and luminosity of stars on the main
sequence.

Which of these stars had an initial mass greater than the initial mass of the sun?
Star 1 and Star 2
Star 1 and Star 4
Star 2 and Star 3
Star 3 and Star 4

Please help! Will mark brainliest!Im doing exams please hurry!The graph below plots the temperature and

Answers

Answer:

Star 1 and two. Good on exams I'm doing mine two

Answer:star 1 and 2

Explanation:

pls help with this ill give you 50 pts

pls help with this ill give you 50 pts
pls help with this ill give you 50 pts
pls help with this ill give you 50 pts

Answers

It is important because It provides an objective, standardized approach to conducting experiments and, in doing so, improves their results. This allows their experiments to become more widespread.

A solution of KOH is prepared with a [OH-] concentration of 3.3 × 10-2 M. Calculate [H+], pH, and identify whether the solution is acidic, basic, or neutral.

Answers

Answer:

[H⁺] = 3.03x10⁻¹³ MpH = 12.52The solution is basic

Explanation:

We can first calculate [H⁺] by using the formula:

[H⁺] * [OH⁻] = 1x10⁻¹⁴[H⁺] * 3.3x10⁻² = 1x10⁻¹⁴[H⁺] = 3.03x10⁻¹³ M

Now we proceed to calculate pH:

pH = -log [H⁺]pH = -log (3.03x10⁻¹³)pH = 12.52

As the pH is higher than 7, the solution is basic.

For each illustration below, identify the beginning state of matter,phase change that is happening, and the ending state of matter. • Beginning state of matter• Phase change type • Ending state of matter

For each illustration below, identify the beginning state of matter,phase change that is happening, and

Answers

The first one appear to be a pan with some liquid heating up.

The beginning state is liquid, the phase change type is a vaporization and its ending state is gas.

The second one seems to be a ice cube melting.

Its beginning phase is solid, the phase change type is fusion, and its ending state is liquid.

The third one is water, or other liquid, making clouds.

The beginning state is liquid, the phase change type is a vaporization and its ending state is gas.

The fourth illustration seems to be an aluminium can. There aren't really a phase change happening, but when we open the aluminium can containing gaseous drink, there are molecules of gas diluted into the liquid and some of it encouter each other to make a bubble of the gas and is released. It is not an actually phase change, it is the reverse process of diluting gas into liquid. Initially it is diluted gas, it gets released and in the end it is in gas phase.

what is the bond formation of Ag and N

Answers

Answer:

Electrovalent / Ionic bond

Explanation:

Hope it helps!!

2000J of energy is absorbed by 222.97g of the metal, ……
when its temperature rises from 30°C to 40°C?

Answers

The specific heat capacity of the metal is 0.896 J/g°C if 2000J of energy is absorbed by 222.97g of the metal.

To solve this problem, we need to use the specific heat capacity of the metal, which tells us how much energy is required to raise the temperature of a given mass of the metal by a certain amount.

The formula for calculating the amount of energy required to raise the temperature of a substance is

Q = mcΔT

where Q is the amount of energy (in joules), m is the mass of the substance (in grams), c is the specific heat capacity of the substance (in J/g°C), and ΔT is the change in temperature (in °C).

We are given that 2000J of energy is absorbed by 222.97g of the metal, and that its temperature rises from 30°C to 40°C. We can use these values to solve for the specific heat capacity of the metal

Q = mcΔT

2000J = 222.97g × c × (40°C - 30°C)

2000J = 2229.7g°C × c

c = 2000J / 2229.7g°C

c = 0.896 J/g°C

To know more about heat capacity here

https://brainly.com/question/28302909

#SPJ1

-- The given question is incomplete, the complete question is

"Find the specific heat capacity of the metal if 2000J of energy is absorbed by 222.97g of the metal, when its temperature rises from 30°C to 40°C?" --

The international space station (ISS) is 109 m long by 75 m wide and has a volume of about 932 m3 . Assuming air is about 70% nitrogen and 20% oxygen, how many molecules of each are approximately in the ISS knowing that the pressure is 1 atm and the temperature 293 K? Additionally, since the average person exhales 0.500 m3 of CO2 per day, which is about 1 kg, if the oxygen and CO2 scrubber system cuts outs, estimate how long do four astronauts have on the ISS before the air is no longer breathable and they pass out knowing humans need at least 80% of oxygen to keep vital organs healthy. (rO2 = 1.429 kg/m3 and rCO2 = 1.977 kg/m3 )

Answers

Approximately 2.22 x \(10^2^5\) molecules of nitrogen and 6.29 x \(10^2^4\)molecules of oxygen are present in the International Space Station (ISS). If the oxygen and CO2 scrubber system fails, four astronauts on the ISS have approximately 73 hours before the air becomes unbreathable and they risk losing consciousness.

The ISS has a volume of approximately 932\(m^3\). Given that air is approximately 70% nitrogen and 20% oxygen, we can calculate the number of molecules of each gas present in the ISS.

To calculate the number of molecules, we need to use the ideal gas law equation, which states that PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature.

First, we convert the volume of the ISS to liters: 932 \(m^3\) = 932,000 liters.

Next, we calculate the number of moles of each gas using the ideal gas law equation. The pressure is given as 1 atm, and the temperature is 293 K.

For nitrogen:

PV = nRT

(1 atm)(932,000 L) = n(0.0821 L·atm/(mol·K))(293 K)

n ≈ 2.93 x \(10^4\) moles

For oxygen:

PV = nRT

(1 atm)(932,000 L) = n(0.0821 L·atm/(mol·K))(293 K)

n ≈ 8.29 x \(10^3\) moles

Finally, we convert the number of moles to the number of molecules by multiplying by Avogadro's number (6.022 x \(10^2^3\) molecules/mol).

For nitrogen:

2.93 x \(10^4\) moles × 6.022 x \(10^2^3\) molecules/mol ≈ 2.22 x \(10^2^5\) molecules

For oxygen:

8.29 x \(10^3\) moles × 6.022 x \(10^2^3\) molecules/mol ≈ 6.29 x \(10^2^4\) molecules

Therefore, approximately 2.22 x \(10^2^5\) molecules of nitrogen and 6.29 x \(10^2^4\) molecules of oxygen are present in the ISS.

Learn more about International Space Station (ISS)

brainly.com/question/31806317

#SPJ11

The amount of matter in an object is its
OA. Volum
OB. mass
Oc. density
OD. charge

Answers

The correct answer is A volume

this process involves the removal of metal oxide layers from metal surfaces to prepare them for coating. if 1.225 moles of fe2o3 and 222.54 g of hcl react, how many grams of fecl3 will be produced?

Answers

Approximately 397.201 grams of FeCl₃ will be produced. To determine the grams of FeCl₃ produced, we need to determine the limiting reactant between Fe₂O₃ and HCl.

First, let's calculate the number of moles of FeCl₃ that can be produced from 222.54 g of HCl. We need to convert the mass of HCl to moles using its molar mass:

Molar mass of HCl = 1.00784 g/mol (H) + 35.453 g/mol (Cl) = 36.46084 g/mol

Moles of HCl = 222.54 g / 36.46084 g/mol ≈ 6.1027 mol.

Next, we need to calculate the number of moles of FeCl₃ that can be produced from 1.225 moles of Fe₂O₃. From the balanced chemical equation, we know that the stoichiometric ratio between Fe₂O₃ and FeCl₃ is 1:2:

Moles of FeCl₃ = 1.225 mol Fe₂O₃ × (2 mol FeCl₃ / 1 mol Fe₂O₃) = 2.45 mol FeCl₃.

Since we have fewer moles of FeCl₃ produced (2.45 mol) compared to the moles of FeCl₃ that can be produced from HCl (6.1027 mol), Fe₂O₃ is the limiting reactant.

Molar mass of FeCl₃ = 55.845 g/mol (Fe) + 3 × 35.453 g/mol (Cl) = 162.204 g/mol

Mass of FeCl₃ = 2.45 mol × 162.204 g/mol ≈ 397.201 g

Therefore, approximately 397.201 grams of FeCl₃ will be produced.

Learn more about limiting reagents here:

https://brainly.com/question/31171741

#SPJ11

ASAP:
The gases in a can of compressed air are at a temperature of 274.9 K and a pressure of 227.2 kPa. If the gases in the can reach a pressure of 845.3 kPa, the can will explode. What temperature (in K) would the can need to be heated up to for it to explode?

Answers

Answer:

845.4

Explanation:

Calculate the average atomic mass of chromium, given the following percent abundances and isotope masses: 4.350 % 49.946 amu; 83.790% 51.941 amu; 9.500% 52.941 amu and 2.360% 53.939 amu

Answers

Asnwer: average atomic mass of chromium is 52amu

Calculations:

49.946amu: 4.350%= 0.0435

51.941amu: 83.790%= 0.8379

52.941amu: 9.500%= 0.095

53.939amu: 2.360%= 0.0236

Average atomic mass of chromium = 0.0435(49.946) + 0.8379(51.941) + 0.095(52.941) + 0.0236(53.939)

= 51.9963703amu

= 52 amu

Circle the significant figures in the following 55.0

Answers

Answer and Explanation

There are 2 significant figures.

Circle the significant figures in the following 55.0

Classify NH3 as a strongbase or a weak base.Strong BaseWeak Base

Answers

ANSWER

EXPLANATION

Ammonia (NH3) is a base that does not contain hydroxyl ion but dissolved in water to produce ammonium ion and hydroxyl ion.

Recall, that pH scale is one of the tool used in determining a strong base and a weak base

The pH of ammonia is 11 and this make ammonia (NH3) to fall under the category of weak base

Therefore, ammonia is a weak base

What is the necessary voltage to power the electrolysis of molten sodium chloride?

Answers

4V  is the necessary voltage to power the electrolysis of molten sodium chloride.

To create sodium metal and chlorine gas, molten (liquid) sodium chloride can be electrolyzed. A Down's cell is the name of the electrolytic cell utilised in the procedure. The liquid sodium ions in a Down's cell are converted to liquid sodium metal at the cathode. Liquid chlorine ions are oxidised to chlorine gas at the anode. Below is an illustration of the reactions and cell potentials:

oxidation: \(2Cl^{-} (l)\) → \(Cl_{2} (g)\) + \(2e^{-}\)                                  E°= -1.36V

reduction: \(Na^{+} (l) + e^{-}\) → \(Na (l)\)                                    E°= -2.71V

overall : \(2Na^{+} (l) + 2Cl^{-} (l)\) → \(2Na(l) +Cl_{2} (g)\)              E°\(_{cell}\) = -4.07V

For this electrolysis to take place, the battery needs to supply more than 4 volts. The only means to obtain pure sodium metal is by this reaction, which also serves as a significant source of chlorine gas generation. Swimming pools and other surfaces are frequently cleaned and disinfected with chlorine gas.

Learn more about sodium chloride here;

https://brainly.com/question/9811771

#SPJ4

How much energy is required to heat 40.7 g of water (H_2O) from -10 degree C to 70 degree C? Where: c_ice = 2.06 J/g degree C c_water = 4.18 J/g degree C Delta H_fus = 334 J/g

Answers

Energy required to heat 40.7g of water from -10 degree C to 70 degree C is 26341.04J.

Specific heat of ice = 2.06 J g-1 degree C-1

Specific heat of water = 4.18 J g-1 degree C-1

Energy required to convert ice from -10 degree C to 0 degree C,

Q1 = m . cice . DT = 40.7 x 2.06 x [ 0 – (-10)] = 40.7 x 2.06 x 10

Q1 = 838.42J

Energy required to convert ice into water at 0 degree C,

Q2 = m . DHfus  = 40.7 x 334 = 13593.8J

Energy required to heat water from 0 degree C to 70 degree C,

Q3 = m . cwater . DT = 40.7 x 4.18 x [70 – 0] = 40.7 x 4.18 x 70

Q3 = 11908.82J

Total energy required = Q1 + Q2 + Q3 = 26341.04J

To learn more about specific heat, click here: brainly.com/question/21041726

#SPJ4

. what did you observe when potassium iodate was heated in the bunsen burner flame in the presence of the embers? what is the likely identity of the species present at the end of the reaction in part ii, step 2a?

Answers

When potassium iodate is heated in the Bunsen burner flame in the presence of embers, several observations can be made. Initially, the potassium iodate may turn yellowish due to the release of iodine. As the reaction proceeds, the yellow color intensifies, indicating the presence of iodine vapors.

At the end of the reaction in part II, step 2a, the likely identity of the species present is iodine (I2). This is because the heating of potassium iodate (KIO3) in the presence of embers causes the decomposition of the compound, leading to the release of iodine. The equation for this reaction can be represented as:

2KIO3 → 2KCl + 3O2 + I2

Thus, the yellow color and the release of purple or violet fumes indicate the presence of iodine at the end of the reaction.

To know more about potassium iodate visit:-

https://brainly.com/question/32229417

#SPJ11

what color does neon make in fireworks

Answers

Answer:

specific colors of light pure neon produces glowing orange or red signs

Explanation:

Explanation:

You might wonder what neon signs like these have to do with fireworks. Neon lights produce their color by having gases in the tubes excited by electrical energy. Once the gas atoms or molecules are excited, they release that energy as very specific colors of light. Pure neon produces glowing orange or red signs.

I hope it's helpful!

Select all the correct answers. Which acids have hydro- as part of their name? a. H2SO3 b. HBr c. HClO2 d. HF
e. HNO3

Answers

Answer:

b and d

Explanation:

b. Hydrobromide

d. Hydrofluoric acid

which explains how the nervous system is typically involved in keeping the body in Homeostasis?​

which explains how the nervous system is typically involved in keeping the body in Homeostasis?

Answers

its c because of the thing on the....

Answer:

c because this is the one hundred all the time

Explanation:

which explains how the nervous system is typically involved in keeping the body in Homeostasis?

Substances known as fuels have energy stored as:
chemical energy
mechanical energy
electrical energy
kinetic energy

Answers

Answer:

Chemical energy

Explanation:

The energy stored in the bonds of atoms and molecules, is chemical energy .

Stay safe stay healthy and blessed.

Have a great day !

Thank you

Answer: Chemical energy. :]

Explanation:

Rita correctly answered 9 questions out of 10 on a test. What fraction of the test questions did Rita answer incorrectly? A. 9/10, B. 9/100, C. 1/10, D. 1/100Patrick chose A as the correct answer how did he get that answer

Answers

In the test we have a 10/10 fraction of questions, which could also mean 100%, if Rita answered 9 questions correctly, we have a fraction of 9/10, which is 90%, therefore she answered 1 question incorrectly, the fraction will be 1/10, which represents 10% of the test. The option will be C 1/10

ca(oh)2+(nh4)2so4=caso4+nh3+h20 Balance the reaction

Answers

Answer:

The balanced equation is Ca(OH)2 + (NH4)2SO4 → CaSO4 + 2NH3 + 2H2O

Explanation:

The balanced chemical equation for the reaction between calcium hydroxide (Ca(OH)2) and ammonium sulfate ((NH4)2SO4) is:

Ca(OH)2 + (NH4)2SO4 → CaSO4 + 2NH3 + 2H2O

In this reaction, calcium hydroxide reacts with ammonium sulfate to produce calcium sulfate, ammonia, and water.

Let's go through the process of balancing the equation:First, let's balance the calcium (Ca) atoms. There is one Ca atom on the left side and one Ca atom on the right side, so it is already balanced.Next, let's balance the sulfur (S) atoms. There is one S atom on the left side and one S atom on the right side, so it is also balanced.

Now, let's balance the hydrogen (H) atoms. There are two H atoms in each calcium hydroxide molecule, so we have 2H atoms on the left side. To balance this, we need to have 4H atoms on the right side. We can achieve this by adding a coefficient of 2 in front of H2O:

Ca(OH)2 + (NH4)2SO4 → CaSO4 + 2NH3 + 2H2O

Now, let's balance the oxygen (O) atoms. There are 2O atoms in each calcium hydroxide molecule, so we have 4O atoms on the left side. On the right side, there are 4O atoms from CaSO4 and 2O atoms from H2O, giving us a total of 6O atoms. To balance this, we need to add a coefficient of 3 in front of CaSO4:

Ca(OH)2 + (NH4)2SO4 → 3CaSO4 + 2NH3 + 2H2O

Now, let's check the nitrogen (N) atoms. There are two N atoms on the left side, and two N atoms on the right side, so they are balanced.Finally, let's check the charge balance. On the left side, we have two ammonium ions ((NH4)+), which gives a total charge of +2. On the right side, we have three calcium ions (Ca2+), which also gives a total charge of +2. So, the charges are balanced.

The balanced equation is:

Ca(OH)2 + (NH4)2SO4 → 3CaSO4 + 2NH3 + 2H2O

Learn more about balanced equation here, https://brainly.com/question/26694427

#SPJ11

a mortar mixture of portland cement, sand, and water, but no hydrated lime, would probably produce a mortar with _____

Answers

A mortar mixture of Portland cement, sand, and water, but no hydrated lime, would probably produce a mortar with lower workability and less durability.
Mortar is a mixture of cement, sand, and water that is used to bind bricks or stones together in construction. Hydrated lime is often added to the mixture to improve its workability and durability. Without the addition of hydrated lime, the mortar would have lower workability, meaning it would be harder to spread and work with. Additionally, it would have less durability, meaning it would not hold up as well over time and could potentially crack or crumble more easily. Therefore, it is important to include hydrated lime in the mortar mixture in order to produce a strong, long-lasting mortar.

You can learn more about mortar at: brainly.com/question/28273588

#SPJ11

How does the concentration of reactants affect the rate
of Chemical reaction? explain in short​

Answers

Higher concentration of reactants equals faster rate of reaction. Reactions occur when particles collide effectively, and by increasing the concentration of reactants, you increase the number of effective collisions, thereby making the reaction occur faster.

Answer:

The increase in the concentration of reactants increases the frequency of effective collisions.

Explanation:

The concentration of reactants determines the rate of reaction by providing the number of reactants available to yield an effective collision. There is a direct relationship between the concentration of reactants and rate of reaction.

Highlight the examples of radiation in the passage
below.
A chemist working in the laboratory is
investigating the thermal energy of H2O in a
solid, liquid, and gas state. First, she places
ice in a pan on a burner and heats it. She
records the temperature at which the solid ice
melts. Next she takes the liquid water and
heats it in a microwave. The liquid begins to
bubble and evaporate into a gas. She records
the temperature at which the liquid water
turned into a gas.

Answers

Answer:

Heating of the liquid water in a microwave.

Explanation:

Radiation is a form of heat transfer process that does not require a material medium rather it travels through space or vacuum in the form of electromagnetic waves or radiation. Heat transfer by radiation occurs in the form of microwaves, infrared radiation, visible light, or another form of electromagnetic radiation is emitted or absorbed.  Some common examples of heat transfer by radiation is the warming of the Earth by the Sun, the warmth one experiences while sitting by the campfire, or the heating up of foods in a microwave.

Black bodies or surfaces are good absorbers as well as emitters of radiation. On the other shiny or white surfaces are poor radiators of heat.

From the above discussion on radiation, it can be seen that when the chemist takes the liquid and heats it in a microwave, the heat absorbed by the liquid to change to gaseous state is transferred through radiation.

Other Questions
1. What is dainaging the Taj Mahal?a global warmingb. flooding from the River Yamunac. acid rain d. the sum's ultraviolet rays. 2. The Taj Mahal is made ofa semiprecious jewels.b. granite.c sandstone.d. marble.3. The Taj Mahal tooka about 10 years to build.b. more than 20 years to buildc. 30 years to build d 50 years to build4. Shah Jahan and Mumtaz Mahal were Muslims True or False? Explain.______________________________________________________5. Why are no images of Shah Jahan and Mumtaz Mahal included in the Taj Mahal?__________________________________________________________________________________________6. Would you like to visit the Taj Mahal? Why or why not?__________________________________________________________________________________________ A researcher examines whether students choice of enrolling in a summer Math class are influenced by students reading an article on the growth mindset. Half the students read the article and half did not.A. What is the independent variable? B. What type or category of independent variable is used? C. What is the dependent variable? D. How many levels are there for the independent variable? E. What is the scale of measurement for the dependent variable? In a population with two alleles, B and b, the allele frequency of b is 0.4. What would be the frequency of the heterozygotes if the population is in Hardy-Weinberg Equilibrium? a. 0.16 b. 0.24 c. 0.6 d. 0.48 e. 0.56 Which of the following is the sum of the series below? 3+9/2! + 27/3! + 81/4!+.... a.e^3 -2b.e^3 -1c.e^3d.e^3 + 1e.e^3 +2 Find f(3.5) if f(x) = (4x - 2)/10 Which of the following is true about a story's narrator? The narrator controls what information the reader receives about the plot, characters, setting, and conflict.The narrator is always the author and can tell you what all of the characters are thinking or feeling at any time.The narrator is always one of the characters in the story who knows everything about what the others are thinking and feeling.The narrator reveals only the information the protagonist is aware of, and the story is limited by those experiences. Data Breach at Equifax1) How does Equifax's business model work? Who is the customer and what is the product?2) Was Equifax lax or unlucky to be cyber-breached in this way?3) Where would you assign accountability for the breach the technology (security) team, senior management, CEO, the Board of Directors?4) How would you characterize Equifax's response in the wake of the breach?5) In your view, how should Equifax have prepared for the breach and the subsequent response? Use a graphing calculator to solve What are the new diminsions of a 4x6 photo enlarged 2:3 The equation, y = -3/2x + 15 represents the relationship between the amount of water left in the tub (in liters) y, and how much time has passed (in minutes) x. since Khloe starting draining the bath tub. What is the meaning of the value of 15 in this equation? After making a downpayment of $3,500 for a new car, Murphy paid $550 per month for 3 years with interest charged at 7.25% per year compounded monthly on the unpaid balance. What was the original cost of the car What's the meaning of dependent clause? : "Must post an original comment and respond to another post. You will not see other posts until you post your first comment" The UA Little Rock Office of Health Services provides hoalth and welloets services. The Health Services it committed to upholdiag core values is all initiatives, proceises abd senicei effered. Iwo of the core values ate 1. Confidentiality 2. Accestibility. Processing Site will you recomesend for the Office of Heilth Services so that it can uphold the core values of confidentiality and accessibility; and why ? - Must post an original comment and respond to another post. You will not see other posts until you post your first comment * which principle ensures auditing processes are managed by someone other than the employees whose activities are being audited? What entropy change is associated with the reversible phase change from 1.0kg of ice to water at 0 C? Help please with a cherry on top Of these sandwiches have lettuce on them A circle has a radius of 4 m. Find the length s of the arc intercepted by a central angle of 3pi/4 radians. Do not round any intermediate computations, and round your answer to the nearest tenth. Determine whether the triangle are similar by AA, SSS, SAS or not similar. If the triangles are similar, write a valid similarity statement.The options for the similarity statement are, PRT, PTR, RPT, RTP, TPR, TRP or NOT SIMILAR atp cannot be synthesized from adp and p due to a mutation in atp synthase. True or False