What type of sugar derivative has the aldehyde group (-CHO) of an aldose replaced by a carboxylic acid group (-COOH)

Answers

Answer 1

Answer:

Aldonic acids

Explanation:

Aldonic acids are a group of sugar acids which are derived from the oxidation of the aldehyde group (-CHO) of an aldose to a carboxylic acid group (-COOH).

The aldehyde group of monosaccharides is easily oxidized to the carboxylic acid group by relatively mild oxidizing agents such as copper (ii) ions and the products are called aldonic acids. This oxidation of monosaccharides such as glucose and other reducing sugars is the basis for the test for reducing sugars using the Fehling's reagent, whereby blue copper (ii) ions in solution are reduced to red copper (i) oxide which precipitate out of solution. The most common oxidizing agent used in preparation of aldonic acids is bromine. For example, oxidation of D-glucose by bromine water at C1 yields D-gluconic acid.

Aldonic acids do not usually exist in hemiacetal ring forms but are generally found in their lactone form which are cyclic structures formed by an ester linkage between the carboxylic group and one of the hydroxyl groups of the same molecule.


Related Questions

Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in the reaction below. How many molecules of HCl would have to be present to form 34.52 g of MgCl₂?
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

Answers

Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:

Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

The molar mass of MgCl₂ is 95.21 g/mol.

First, we need to calculate the number of moles of MgCl₂ formed:

Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂

Moles of MgCl₂ = 34.52 g / 95.21 g/mol

Moles of MgCl₂ = 0.363 mol

According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:

Moles of HCl = 2 * Moles of MgCl₂

Moles of HCl = 2 * 0.363 mol

Moles of HCl = 0.726 mol

To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.

Number of molecules of HCl = Moles of HCl * Avogadro's number

Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol

Number of molecules of HCl = 4.37 x 10^23 molecules

Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

For more such questions on molecules

https://brainly.com/question/1351818

#SPJ8

The electronic configuration of Na is_________.

Answers

The answer:
[Ne] 3s¹

Which of the following is NOT a natural resource? Check all that apply.

1. Air
2. Water
3. Plastic
4. Sunlight
5. Cotton
6. Glass
7. Coal
8. Copper

Answers

While being made from natural resources, electricity does not constitute a natural resource because it goes through several procedures to produce it.

What are the seven categories of natural resources?

Oil, coke, nat gas, metals, stone, or sand are examples of natural resources. Other natural resources include water, soil, sunlight, air, and so on. Natural resources have value because they enable life and provide for human needs.

A natural resource is land?

Financially referred to it as land and raw materials, land resources (also known as natural resources) are found naturally within ecosystems that are mostly unaltered by civilization. A natural resource's biodiversity levels across different habitats are frequently used to describe it.

To know more about several visit:

https://brainly.com/question/13758372

#SPJ1

What is the mass of 2.9 moles of calcium? Show all work!

Answers

Answer:

the mass of 2.9 moles of calcium is 116 g

Explanation:

The computation of the mass of 2.9 moles of calcium is shown below

As we know that

Mole = mass ÷  molar mass

where,

Moles be 2.9

And, we know that the molar mass of calcium be 40g/mol

Now put the values to the above formula

2.9 = Mass ÷ 40

So, the mass would be

= 40 × 2.9

=   116 g

Hence, the mass of 2.9 moles of calcium is 116 g

A 10.57 g sample of an unknown metal was heated to 100.00 ºC in boiling water and then transferred to a 104.0 g water bath at 22.50ºC. The temperature of the water bath rose to a maximum of 24.15ºC. What is the specific heat of the metal in cal/gºC ?

Answers

According to the problem the specific heat of the metal is 0.0329 cal/g°C.

What is specific heat?

Specific heat is the amount of heat energy required to raise the temperature of a unit mass of a substance by one degree. It is usually expressed in units of joules per kilogram-kelvin (J/kg-K). It is an important physical property of a substance that affects the rate of heat transfer.

The specific heat of a metal can be calculated using the equation, q = mcΔT,
where q is the amount of heat energy,
m is the mass of the metal sample,
c is the specific heat, and
ΔT is the change in temperature. In this problem, q = 10.57 g × c × (24.15ºC - 22.50ºC) = 2.85 g × c.
The amount of heat energy required to raise the temperature of the water bath can be calculated using the equation q = mcΔT,
where q is the amount of heat energy, m is the mass of the water bath,
c is the specific heat of water (4.184 J/g°C), and
ΔT is the change in temperature. In this problem, q = 104.0 g × 4.184 J/g°C × (24.15ºC - 22.50ºC) = 86.67 J.
The specific heat of the metal can be calculated by dividing the amount of heat energy required to raise the temperature of the metal sample by the amount of heat energy required to raise the temperature of the water bath. This gives us c = 2.85 g × c / 86.67 J = 0.0329 cal/g°C.
Therefore, the specific heat of the metal is 0.0329 cal/g°C.

To learn more about specific heat
https://brainly.com/question/27862577
#SPJ1

what is S3F4 chemical name

Answers

Sulfur fluoride 93440-84-7.

Pewter is a solidified solution of tin and lead or tin and zinc. In both cases, tin is the main component. Which metal would you classify as the solute in each type of pewter?

Answers

Low quality pewter is tin, lead and a small amount of copper. In higher quality pewter, antimony or bismuth is used instead of lead. Pewter alloyed with antimony and bismuth can be polished to a bright, tarnish free finish. The alloying metals lower the melting temperature of tin, making it possible to cast molten alloy into detailed shapes.

What kind of bond would two nonmetals typically make?
A. A metallic bond
B. An ionic bond
C. A covalent bond
O D. An ionic solid
It’s covalent

Answers

Answer: C . A covalent bond

Covalent Bond since it only deals with 2 non metals

How does the motion of particles compare between different phrases of matter?

Answers

Answer: gas vibrate and move freely at high speeds.

Explanation: liquid vibrate, move about, and slide past each other. solid vibrate (jiggle) but generally do not move from place to place.

An early arrangement of the then known elements was proposed by a British scientist John Newlands, which he called the Law of Octaves. Like other scientists at the time, Newlands arranged the elements in order of increasing atomic mass and noted that every eighth element had similar physical/chemical properties. In the modern Periodic Table, which of the following represents the last pair of elements for which Newlands' Law of Octaves would hold true?​

Answers

In the modern Periodic Table, the last pair of elements for which Newlands' Law of Octaves would hold true is Calcium (Ca) and Titanium (Ti).

What is the charge on an ion that has 19 protons, 22 neutrons, 18 electrons?

Answers

Prolly the charge is 78 you’re so very welcome

Silicon has three naturally occurring isotopes (Si-28, Si-29, and Si-30). The atomic mass and natural abundance of Si-28 are 27.9769 amu and 92.2 %, respectively. The atomic mass and natural abundance of Si-29 are 28.9765 amu and 4.67 %, respectively. Find the natural abundance of Si-30. Express your answer numerically using two significant figures.

Answers

Answer:

3.1%

Explanation:

100% - 92.2% - 4.67% = 3.1% (2 s.f.)

In terms of energy, when atoms chemically bond to form a stable compound:_____.
A. Energy is released.
B. Energy can either be released or consumed depending upon the bond formed.
C. Energy is transferred from one atom to another.
D. Energy is consumed.

Answers

Answer:

  A. Energy is released

Explanation:

Energy is only released when chemical bonds are formed.

This chart shows global energy usage for the year 2005. Solar, 0.5% Hydroelectric, 3% Wind, 0.3% Biomass Geothermal, 0.2% Nuclear Oil 379 Natural gas 23% Need an extra pair of e Get writing feedback fri real tutor Submit a review Coal Use the chart to answer the following questions. (8 points) A. What total percent of energy came from fuels that emitted greenhouse gases?

Answers

Approximately 60.9% of the total energy in 2005 came from fuels that emitted greenhouse gases. This signifies a significant contribution to global greenhouse gas emissions and highlights the importance of transitioning to cleaner and more sustainable energy sources to mitigate climate change impacts.

To determine the total percent of energy that came from fuels emitting greenhouse gases, we need to consider the energy sources listed in the chart that are known to produce greenhouse gas emissions. In this case, those would be oil, natural gas, and coal.

From the chart, we see that the percentages for these three energy sources are:

Oil: 37.9%

Natural gas: 23%

Coal: Not specified

Although the percentage for coal is not mentioned in the given information, it is a known fact that coal combustion releases greenhouse gases, including carbon dioxide (CO2). Therefore, we can assume that coal is among the fuels emitting greenhouse gases.

Adding up the percentages for oil and natural gas, we have:

37.9% (oil) + 23% (natural gas) = 60.9%

Therefore, approximately 60.9% of the total energy in 2005 came from fuels that emitted greenhouse gases. This signifies a significant contribution to global greenhouse gas emissions and highlights the importance of transitioning to cleaner and more sustainable energy sources to mitigate climate change impacts.

For more question on energy

https://brainly.com/question/30745996

#SPJ11

Brainbreak task:
Write a tweet as if you were Dmitri Ivanovich Mendeleev making his discovery

Answers

Mendeleev sketched out the table he had in mind. Mendeleev created the so-called Periodic Law while assembling these atomic data cards.

What is periodic law?

Periodic law is defined as a rule that the elements fall into recurrent groupings when enumerated in order of their atomic numbers, causing elements with similar qualities to appear frequently. "The physical and chemical properties of the elements are periodic functions of their atomic numbers," is how the current Periodic law is best summarized.

Mendeleev found that when all the known chemical elements were arranged in order of increasing atomic weight, the resulting table revealed a periodicity, or repeated pattern, of characteristics within groupings of elements.

Thus, Mendeleev sketched out the table he had in mind. Mendeleev created the so-called Periodic Law while assembling these atomic data cards.

To learn more about periodic law, refer to the link below:

https://brainly.com/question/1258483

#SPJ1

Which simple machine is best used to split apart an object

A. A screw

B. A lever

C. A wedge

D. A pulley

Answers

Answer:

its A screw :))) your welcome

A screw, hope that helps.;)

What amount of energy is required to change
20.0 g of an unknown substance from -15.0 °C
to 7.0 °C? (More information on the picture!!)

What amount of energy is required to change20.0 g of an unknown substance from -15.0 Cto 7.0 C? (More

Answers

The amount of energy that is required to change 20.0 g of an unknown substance from -15.0 °C to 7.0 °C is q = +49.65 kJ.

What is energy?

Energy is the ability to do tasks. It can exist in various forms, including potential, kinetic, thermal, electrical, chemical, and nuclear.

At -15°c, it will be solid, to increase the amount of heat to raise

temp from -15°C to 40°C.

(20.0) (3.3J/g°c) x 15°C) = 330 J.

At -10°C, it is in which phase transformation takes place from sold to wound.

ΔHfue = 0.945 J/gx 20g = 18.93.

After that, it will be in want and it will be in liquid form 40°C.

To 7°C, then.

922 m Cgas 47

=(20g) (1455/g°c) (17)

493005.

Total Energy = q1 + ΔHfus  + q2

47 = 7.0°C - 10°C) = 14°C -

2 330J18.95 + 49300J

q = 49648.9 3. 9

q = +49.65 KJ

Therefore, the amount of energy is q = +49.65 KJ.

To learn more about energy, refer to the link:

https://brainly.com/question/3805749

#SPJ1

Who always receives the H+

Answers

Answer:

In an acid-base reaction, the base always receives the H+.

Explanation:

What cell structure is best represented by the image?
A.
a non-permeable cell wall
B.
a selectively permeable membrane
C.
a waterproof nuclear envelope
D.
a permeable exoskeleton

Answers

Answer:where is the image

Explanation:

Answer:

B.

a selectively permeable membrane

Explanation:

A field produced by a magnetic object that exerts a force on other magnetic materials or moving electrical charges is called alan a Magnetic field b Electric field Electrostatic field d All of the above​

Answers

Answer: magnetic field

A field produced by a magnetic object that exerts a force on other magnetic materials or moving electrical charges is called a Magnetic field.

What is a magnetic field?

The magnetic subject is the region around a magnet in which the effect of magnetism is felt. We use the magnetic area as a device to describe how the magnetic force is shipped inside the area around and inside something magnetic in nature.

Why magnetic area is important?

The magnetic area is extremely critical to maintaining lifestyles in the world. without it, we'd be exposed to excessive amounts of radiation from the solar, and our environment would be unfastened to leak into space.

Learn more about the magnetic fields here: https://brainly.com/question/7802337

#SPJ2

explain how the shape of the root hair cell is adapted to help it do its job ​

Answers

Root hair cells are adapted for taking up more water and mineral ions. The way the are able to perform this is by having a bigger surface area to increase how fast the water and minerals absorb. Plus they contain a lot of mitochondria, which release the energy from glucose during respiration in order to provide the energy that is needed for active transport.

1. A football player throws a football 30 meters/second2 using 600 Newtons of force What
was the mass of the football?

Answers

Answer:

20 kg

Explanation:

The mass of the football can be found by using the formula

\(m = \frac{f}{a} \\ \)

f is the force

a is the acceleration

From the question we have

\(m = \frac{600}{30} = \frac{60}{3} \\ \)

We have the final answer as

20 kg

Hope this helps you

6. A box measures 11.25 inches in length, 8.1 inches in width and 6.85 inches in height. What is the
volume of the box?

Answers

Answer:

I'd say 624.2^3 inches.

Explanation:

what divided by 700000 equals 4

Answers

I think it’s 280000

Which bone is located between the incus and the inner ear?

cochlea

stapes

incus

malleus

Answers

Answer: The answer is incus

Sodium-25 was to be used in an experiment, but it took 3.0 minutes to get the sodium from the reactor to the laboratory. If 8.0 mg of sodium-25 was removed from the reactor, how many mg of sodium-25 were placed in the reaction vessel 3.0 minutes later if the half life of sodium-25 is 60 seconds.

Answers

Sodium-25 after 3 minutes : 1.0625 mg

Further explanation

General formulas used in decay:  

\(\large{\boxed{\bold{N_t=N_0(\dfrac{1}{2})^{t/t\frac{1}{2} }}}\)

T = duration of decay  

t 1/2 = half-life  

N₀ = the number of initial radioactive atoms  

Nt = the number of radioactive atoms left after decaying during T time  

No=8 mg

t1/2=60 s

T=3 min=180 s

\(\tt Nt=No\dfrac{1}{2}^{T/t1/2}\\\\Nt=8.5\dfrac{1}{2}^{180/60}\\\\Nt=8.5(\dfrac{1}{2})^3\\\\Nt=1.0625~mg\)

It takes 4 pounds of steel to make a small robot. You have 48 ounces. Do you have enough? If not what do you need?

Answers

No, 48 ounces are not enough. For making a small robot we need 64 ounces which is equal to 4 pounds.

What is pound and ounces?

Pound is a unit for measuring weight. 16 ounces makes one pound.

Ounce is also a unit for measuring weight. 16 ounces is equal to 1 pound

So, for making one small robot we need 4 pounds.

1 pound = 16 ounces

4 pounds = 64 ounces

But, we have 48 ounces

We need more = 64 - 48 = 16 ounces or 1 pound

No, 48 ounces are not enough. For making a small robot we need 64 ounces which is equal to 4 pounds.

To know more about pounds, check out:

https://brainly.com/question/22599208

#SPJ1

A manufacturer advertises that a particular brand of lotion is “pH balanced” and that it has a pH equal to 6.25. What can you infer about the lotion based on the information in the ad?

Answers

We can infer about the given information of lotion is that pH is slightly acidic in nature.

What is pH?

pH of any solution gives idea about the acidity or basicity of that solution, and it will be calculated as:

pH = -log[H⁺]

pH value in the range of 0 to 6.9 shows acidity, 7 shows the neutral nature and from 7.1 to 14 shows basicity. Given pH value of lotion i.e. 6.25 states that lotion is slightly acidic in nature.

Hence pH value of lotion informs that lotion is slightly acidic.

To know more about pH, visit the below link:

https://brainly.com/question/172153

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

A gas expands and does PV work on its surroundings equal to 322 J. At the same time, it absorbs 132 J of heat from the surroundings. Calculate the change in energy of the gas. Note: PV work means work done by a changing volume against constant pressure. Enter your answer in scientific notation.

Answers

From the calculations, the change in energy is - 190 J.

What is the first law of thermodynamics?

From the first law of thermodynamics, the energy is neither created nor destroyed but is transformed from one form to another.

From the law;

U = q + w

U = internal energy

q = heat

w = work

Since work is done on the surroundings and the gas absorbs heat then;

U = 132 J - 322 J

U = - 190 J

Learn more about thermodynamics:https://brainly.com/question/1368306

#SPJ1

Other Questions
preferred dividends are usually considered a fixed charge, which makes preferred stock resemble debt. a. true b.false How many molecules of sugar C6H1206 are in a mole? Which of the following represents the strongest correlation? a. +.80 b. - 45 c. +45 ed.-92 a data item to include on a qualitative review checklist of newborn inpatient health records that need not be included on adult records would be There are three main parts to a division problem: the dividend, the divisor, and the quotient. The dividend is the number that will be divided. The divisor is the number of people that the number is being divided among. The quotient is the answer. Which of the following would decrease your wealth (net worth)?-you write a check to pay down your credit card debt .-you write a check to buy some stock-you sell some government bonds and put the money in your checking account-the value of your house has declined by 10% The question is on the screenshot as always! A 2.0 L flask contains nitrogen and oxygen gases at 25C. The total pressure is 0.91 atm and contains 0.050 mol of nitrogen. Calculate the partial pressure of oxygen and moles of oxygen present what functions are performed through the up/down buttons on 2022 versas available advanced drive-assist display? How do you reduce fractions on a calculator? decrease in caudate glutamatergic concentrations in pediatric obsessive compulsive disroder patients takign paroxetine Carbon-14 has a half life of 5730. If a sample contained 70 mg originally, how much is left after 17190 years How does the graph of g(x) = 2^x - 1 compare to the graph of parent function f(x) = 2^x how does fast food affect the american diet? I need answers pretty quickly What is the slope of the function y = -3/4x + 5 ______ is a naturally occurring metal found in the environment as well as manufactured in products. The major source of this metal has historically been from fuels in on-road motor vehicles such as cars and trucks, and industrial sources. trina was born in 1962 and lived a secure early childhood. in her teens, trina's family was uprooted after her father lost his job and her parents divorced. she attributes her current determination toward building a decent savings and balancing her career and personal life to the uncertainty she faced in her early years. trina's outlook is typical of a person in which generational group? Which of the following statements concerning differences between continuous review (Q systems) and periodic review (P systems) inventory systems is FALSE?Multiple ChoiceP systems require a perpetual inventory count, while Q systems require a periodic inventory counting system.In periodic review systems, orders are placed after an elapsed period, P, has passed, for a variable quantity of units.In continuous review systems, orders are placed for a fixed quantity of goods after a variable length of time has passed.Higher than normal demand during the order cycle leads to a shorter time between orders for Q systems, while in P systems it leads to larger order sizes. 3. What was the total distance traveled from Chicago to New York City?12 hours780 meters12 seconds780 miles