What measurement scale is used in the following example? The distance in miles to the closest grocery store



A. Ordinal

B. Ratio

C. Nominal

D. Interval

Answers

Answer 1

The measurement scale used in the given example is Interval.

An interval scale is a scale where the difference between two values is meaningful, but there is no true zero. On an interval scale, zero represents an arbitrary point, rather than a true zero. The distance in miles to the nearest grocery store is an example of an interval scale. A grocery store that is 5 miles away is twice as far as one that is 2.5 miles away, but it is not true that a grocery store that is 0 miles away means that there is no distance to travel. In an interval scale, the most common measures of central tendency are mean, median, and mode. A quantitative measuring scale with order, meaningful and equal differences between the two variables, and arbitrary zero presence is known as an interval scale. It takes measurements at equal intervals of variables that are found along a common scale. The methods utilised to determine how far apart the variables are from one another are quite trustworthy.

After the nominal scale and the ordinal scale, the interval scale is the third level of measurement. You can distinguish between interval measurements if you comprehend the preceding two stages. When variables lack a natural ordering or order, a nominal scale is utilised. However, typical survey examples include gender, locality, political party, pets, and so on. You can include numbered or unnumbered variables.

Know more about interval  here:

https://brainly.com/question/32501638

#SPJ11


Related Questions

Please Help I don't understand at all !!!!!!! I'll give 50 brainly points

Students collected data and created an equation to model the spread of a winter cold among the students, teachers, and other staff. They decided this was best represented by the exponential function C(d) = 1*3d where d is the time in days since the cold began to spread.

How many people initially had the cold? _______ people

How many people would have the cold after 2 days? ______ people

Answers

Answer:

0 People initially had the cold.

6 People will have it after 2 days.

Step-by-step explanation:

To find out how many people had it initially, plug 0 in for x (implying 0 days later.)

C= 1*3(0)

C= 1*0

C=0

Nobody had the cold initially.

To find out how many people had it after 2 days, plug 2 in for x. (implying 2 days later.)

C= 1*3(2)

C= 1*6

C=6

Therefore 6 people had the cold after 2 days.

I hope this helps!

An arithmetic sequence has this recursive formula: What is the
explicit formula?

An arithmetic sequence has this recursive formula: What is theexplicit formula?

Answers

Answer:

the correct answer is -32+43

Step-by-step explanation:

I just know

(2011 aime i). [8] for some integer m, the polynomial x 3 −2011x m has the three integer roots a, b, and c. find |a| |b| |c|.

Answers

The absolute values of the three integer roots of the given polynomial are |a| = 0, |b| = 2011, and |c| = 2011.

The given polynomial is x³ - 2011xᵐ.

We are asked to find the absolute values of the three integer roots of this polynomial, denoted as a, b, and c.

To find the roots, we can set the polynomial equal to zero and solve for x:

x³ - 2011xᵐ = 0

Factoring out an x gives us:

x(x² - 2011xᵐ⁻¹) = 0

From this equation, we can see that one of the roots is x = 0.

Now let's focus on the second factor, x² - 2011xᵐ⁻¹ = 0.

This quadratic equation has two roots, which we can find using the quadratic formula:

x = (-b ± √(b² - 4ac))/(2a)

For this equation, a = 1, b = -2011, and c = 0. Substituting these values into the quadratic formula, we get:

x = (-(-2011) ± √((-2011)² - 4(1)(0)))/(2(1))
x = (2011 ± √(4044121))/(2)

Simplifying further, we have:

x = (2011 ± √(2011²))/(2)
x = (2011 ± 2011)/(2)

This gives us two possible values for x:

x = (2011 + 2011)/(2) = 2011
x = (2011 - 2011)/(2) = 0

Now we have three potential roots: x = 0, x = 2011, and x = 2011.

To find the absolute values of these roots, we take the absolute value of each:

|0| = 0
|2011| = 2011
|2011| = 2011

Therefore, the absolute values of the three integer roots of the given polynomial are |a| = 0, |b| = 2011, and |c| = 2011.

To know more about polynomial visit:

https://brainly.com/question/11536910

#SPJ11

Bentley is deciding between two truck rental companies. Company A charges an initial fee of $50 for the rental plus $2 per mile driven. Company B charges an initial fee of $10 for the rental plus $3 per mile driven. Let AA represent the amount Company A would charge if Bentley drives xx miles, and let BB represent the amount Company B would charge if Bentley drives xx miles. Graph each function and determine the interval of miles driven, x,x, for which Company A is cheaper than Company B.


Company A is cheaper than Company B when x ___ _ ___

Answers

Answer:

after 41 miles A is cheaper than B

Step-by-step explanation:

not sure if this is what the question is asking for

Please help me answer this math question !

Please help me answer this math question !

Answers

Answer:

y=-3x+6

Step-by-step explanation:

Which angle is a vertical angle with

Which angle is a vertical angle with

Answers

the angle that is a vertical angle is ii believe DFB !

If a heptagon has an area of 105 in2, what is the measure of one side ?

Answers

Answer:

5.38 inches

Step-by-step explanation:

The formula for Area of an Heptagon

= A=7/4a²cot(180°/7)

Area = 105in²

Side a = ?

The formula for Side a

= √4A ×tan (180°/7)/7

= √4 × 105 × tan (180°/7) /7

= 5.37536 inches

Approximately = 5.38 inches.

What is the answer to this question?
91
X51

Answers

Answer:

4,641

Step-by-step explanation:

Answer: it would be 4641

Step-by-step explanation:

Because when you multiply 91 and 51 that’s the answer you get

Which equation represents the line that passes through the points (2,4)and (1,-3)

Answers

Answer:

y=7x-10

Step-by-step explanation:

m=(-3-4)/(1-2)

m=-7/-1

m=7

y-y1=m(x-x1)

y-4=7(x-2)

y=7x-14+4

y=7x-10

Silvia has 20 tomato plants and 30 bean plants. She wants to put the plants in rows so that each row has the same number of tomato plants and the same number of bean plants. What is the greatest number of rows Silvia can plant?

Answers

The greatest number of rows Silvia can plant as per given number of plants and condition is equal to 10.

As given in the question,

Silvia is going to plant 20 tomato plants and 30 bean plants.

Total tomato plants = 20

Total bean plants = 30

If Silvia would like to plant, the plants in rows where each row has the same number of tomato plants and each row has the same number of bean plants.

Then, the greatest number of rows Silvia can plant is equal to greatest common factor of 20 and 30.

20 = 2×2×5

30 = 2×3×5

Greatest common factor of 20 and 30 = 2×5 = 10

Therefore, the greatest number of rows Silvia can plant as per given number of plants and condition is equal to 10.

Learn more about greatest number here

brainly.com/question/23233405

#SPJ1

Solve the following system of equations.Express your answer as an ordered pair in the format (a,b),with no spaces between the number or symbols 3x+4y=16 -4x-3y=-19

Solve the following system of equations.Express your answer as an ordered pair in the format (a,b),with

Answers

Answer:

(4,1)

Step-by-step explanation:

3x + 4y = 16

-4x - 3y = -19

4( 3x + 4y = 16)

3( -4x - 3y = -19)

Distribute

12x + 16y = 64

-12x - 9y = -57

Now subtract both equations

7y = 7

/7 on both sides

y = 1

Substitute y = 1 in one of the equations.

3x + 4y = 16

3x + 4(1) = 16

-4 on both sides

3x = 12

/3 on both sides

x = 4

Answer:

x = 4

y = 1

what is 4 3/7 as a improper fraction

Answers

Answer:

4 3/7 as an improper fraction is 31/7

Answer:

31/7

Step-by-step explanation:

4 3/7

4 x 7 = 28

28 + 3 = 31

31/7

a student applies for ten different scholarships to various universities. seven of the scholarships pay for books. four scholarships include a meal ticket. two of the scholarships exclude meals and books. how many scholarships pay for both books and meals? use a venn diagram to illustrate and help solve this problem

Answers

The number of scholarships that pay for both books and meals is 1.

To solve this problem, we need to use the concept of set intersection. Let B be the set of scholarships that pay for books, and M be the set of scholarships that include a meal ticket. We want to find the number of scholarships that pay for both books and meals, which is the size of the set intersection B ∩ M.

From the problem statement, we know that:

|B| = 7 (seven scholarships pay for books)

|M| = 4 (four scholarships include a meal ticket)

We can use the inclusion-exclusion principle to find |B ∩ M|:

|B ∩ M| = |B| + |M| - |B U M|

We need to find the size of the union of the sets B and M, which includes all scholarships that pay for books, all scholarships that include a meal ticket, and possibly some scholarships that pay for both. From the problem statement, we know that there are two scholarships that exclude both meals and books, so we can subtract that from the union:

|B U M| = |B| + |M| - |B ∩ M| + 2

Substituting the known values, we get:

|B ∩ M| = |B| + |M| - |B U M| + 2

|B ∩ M| = 7 + 4 - (7 + 4 - |B ∩ M| + 2) + 2

|B ∩ M| = 1 + |B ∩ M|

Solving for |B ∩ M|, we get

|B ∩ M| = 1

Learn more about inclusion-exclusion principle here

brainly.com/question/27975057

#SPJ4

The given question is incomplete, the complete question is:

A student applies for ten different scholarships to various universities. seven of the scholarships pay for books. four scholarships include a meal ticket. two of the scholarships exclude meals and books. how many scholarships pay for both books and meals?

A theme park company is opening a marine-inspired park in your city. they are in the process of designing the theatre where a killer whale show will take place. the following design is already under construction and will house the whales that perform in the show:

the main tank has a radius of 70 feet. what is the volume of the quarter-sphered sized tank? round your answer to the nearest whole number. you must explain your answer using words, and you must show all work and calculations to receive credit.

Answers

The volume of the quarter-sphered sized tank is approximately 490,490 cubic feet.

To find the volume of the quarter-sphered sized tank, we need to first calculate the volume of a sphere and then divide it by 4.

The formula for the volume of a sphere is V = (4/3) * π *r3, where V represents volume and r represents the radius.

Given that the radius of the main tank is 70 feet, we can substitute this value into the formula.

V = (4/3) * π * 703
V = (4/3) * π * 343,000

Now we can calculate the volume.

V = (4/3) * 3.14 * 343,000
V ≈ 1.43 * 343,000
V ≈ 490,490

Since we want the answer rounded to the nearest whole number, the volume of the quarter-sphered sized tank is approximately 490,490 cubic feet.

To know more about volume visit:

https://brainly.com/question/28058531

#SPJ11

Jasmine extracted 5.6 pounds of honey from a beehive. She divided the honey evenly into 4 jars. How much honey was in each jar

Answers

There were 1.4 pounds of honey in each jar.

Since unitary method is a method for solving a problem by the first value of a single unit and then finding the value by multiplying the single value.

Given that Jasmine extracted 5.6 pounds of honey from a beehive. She divided the honey evenly into 4 jars.

Thus, divided 5.6/4

In each jar there would be; 1.4 pounds.

Now multiplying 1.4 by 4

1.4/4 =  5.6.

Learn more about the unitary method, please visit the link given below;

https://brainly.com/question/23423168

#SPJ1

You are given two offers for a monthly wage. Option A is to be paid one cent on the first day of the month, with your wages doubling each day (2 cents on day 2, 4 cents on day 3, 8 cents on day 4, etc.) for the rest of this 30 day month. Option B is to be paid $1 on the first day of the month, with your wages increasing $100 each day ($101 on day 2, $201 on day 3, $301 on day 4, etc.). Which option will give you more money by the end of the month? Make sure to support your answer.

Answers

Answer:

Option B.

Step-by-step explanation:

If you begin with one dollar a day there will get you more by the end of the month because on day 2 your on 201 already which is more than you get in that month with one cent.

The first option (A) will give you more money than option (B).

What are the geometrical progression series and arithmetic progression series?

A geometric progression is a sequence in which any element after the first is obtained by multiplying the previous element by a constant which is called a common ratio denoted by r.

The difference between every two successive terms in a sequence is the same this is known as an arithmetic progression (AP).

Given that

Case A). Doubling each day

1 + 2+ 4 + 8 + 16 .... it is form a GP series with common ratio (r) 4/2 = 2

Number of terms (n)

Sum =  30( 230 - 1)/(2 - 1) = $2147483464.

Case B). Adding $100 each day

1 + (101 + 201 + 301 ....) it is form a ap series with common difference d = 201 - 101 = 100.

Number of terms = 29

Sum = 1 + 29/2 + [ 2 (101) + 28(100)] = $43530

Hence it is clear that case (A) will give you more money.

For more information about the geometrical progression

brainly.com/question/4853032

#SPJ5

factorise fully p^3 + p^2

factorise fully p^3 + p^2

Answers

Answer:

p3+p2=p2(p+1)

Step-by-step explanation:

p3+p2p3=p2+1=p2pp3+p2=p2p+p21=p2(p+1)

Used:

anam=an+mdistributive property: a(b+c)=ab+ac




3. Let T : R² → P2(R) be the function defined by T(a, b) = a + bx +(a+b)x²2, (a, b) ≤ R². (a) Find the matrix M(T; B, C) where B is the standard basis for R² and C = {1,x, x²} is the standard

Answers

(a) To find the matrix representation of the linear transformation T: R² -> P2(R) with respect to the standard bases B and C, we compute the images of the basis vectors of B under T and express them as linear combinations of the vectors in C.

The resulting coefficients form the columns of the matrix M(T; B, C).

The matrix representation of the linear transformation T: R² -> P2(R) with respect to the standard bases B and C.

The steps involved in obtaining the matrix representation. The standard basis for R² is given by B = {(1, 0), (0, 1)}. We apply the linear transformation T to each basis vector of B and express the results in terms of the vectors in the standard basis for P2(R), which is C = {1, x, x²}.

Applying T to (1, 0), we have T(1, 0) = 1 + 0x + (1+0)x²/2 = 1 + 0x + x²/2. Thus, the coefficients of the linear combination of C are 1, 0, and 1/2.

Similarly, applying T to (0, 1), we have T(0, 1) = 0 + 1x + (0+1)x²/2 = x + x²/2. This gives the coefficients of the linear combination of C as 0, 1, and 1/2.

Therefore, the matrix M(T; B, C) is given by:

M(T; B, C) = [1 0

0 1

1/2 1/2]

The matrix has three columns corresponding to the coefficients of 1, x, and x² in the image of each basis vector of B under T.

To learn more about coefficients click here:

brainly.com/question/1594145

#SPJ11

Julio says, "If you subtract 17 from my number and multiply the difference by -3, the result is -9." What is Julio's number?

Answers

Answer:

23

Step-by-step explanation:

Taking an algebraic approach

let the number be n, then (n - 17) is 17 subtracted from the number, and -2(n - 17) = - 12 ( divide both sides by - 2 )n - 17 = 6 ( add 17 to both sides ) which is n=23

The hanger diagram models the equation 2b = 4. Use the diagram to find the
value of b. Show your reasoning.

Answers

The value of b is 2.

Since the hanger diagram models the equation 2b = 4, we can see that the bar representing 2b has a length of 4 units.

To find the value of b, we need to divide both sides of the equation by 2. This gives us:

2b/2 = 4/2

b = 2

Therefore, the value of b is 2.

Learn more about Equation here:

https://brainly.com/question/29657983

#SPJ1

Simplify.

3/4−4x+1/2x−1/2+1/2x

Enter your answer in the box.

Answers

Answer:

3(1−10x)43(1-10x)4

Step-by-step explanation:

34−4x+12x−212x34-4x+12x-212x

Simplify each term.

Combine 1212 and xx.

34−4x+x2−212x34-4x+x2-212x

Multiply the numerator by the reciprocal of the denominator.

34−4x+x2−(2(2x))34-4x+x2-(2(2x))

Multiply 22 by 22.

34−4x+x2−(4x)34-4x+x2-(4x)

Multiply 44 by −1-1.

34−4x+x2−4x34-4x+x2-4x

Find the common denominator.

Write −4x-4x as a fraction with denominator 11.

34+−4x1+x2−4x34+-4x1+x2-4x

Multiply −4x1-4x1 by 4444.

34+−4x1⋅44+x2−4x34+-4x1⋅44+x2-4x

Multiply −4x1-4x1 and 4444.

34+

Answer:

-3x + ¼

Step-by-step explanation:

Follow Me Please ...

A sample of scores has mean of M 26, median of 28, and a mode of 29 What is the most Iikely shape for the sample distribution? a. Symmetrical b. positively skewed c. negatively skewed d. cannot be determined from the information given

Answers

The most likely mean for the sample distribution is option c. negatively skewed.

Based on the given information, we know that the mean (M) is less than both the median and the mode. This suggests that the distribution is skewed to the left (negatively skewed), with a long tail on the left side of the distribution.

The mean of a sample distribution is the average value of all the observations or measurements in the sample. It is calculated by adding up all the values in the sample and dividing the sum by the total number of observations in the sample.

To learn more about Mean :

https://brainly.com/question/29748875

#SPJ4

James has a 6-ft board that is 24 in. wide. He wants to cut it into five pieces to make a small bookshelf with two shelves. The front and back will not be covered. What should the dimensions of the bookshelf be to maximize the volume and use all of the 6 ft board?

James has a 6-ft board that is 24 in. wide. He wants to cut it into five pieces to make a small bookshelf

Answers

Answer:

width=x, length = y

(in ft)

3x + 2y = 6y>x

y = 1.5 , x= 1

1ft = 12 in 1.5ft = 18in

Let's say you rolled a dice twice, and you got at least a 6. What is the probability that the sum of both rolls is at least 9

Answers

The probability that the sum of both rolls is at least 9 is 2/36.

Probability is the chance that a given event will occur.  the ratio of the number of outcomes in an exhaustive set of equally likely outcomes that produce a given event to the total number of possible outcomes.

Given:

Total sample spaces: 36.

Number on one dice: 6

For sum of both rolls to be 9 , the only possible way is (6,3)(3,6)

Using probability formula,

Thus The probability that the sum of both rolls is at least 9 is 2/36.

To Learn more about Probability visit:

https://brainly.com/question/4313883

#SPJ4

Solve the system and enter the smallest x-coordinate first

Solve the system and enter the smallest x-coordinate first

Answers

Answer:
(2,-3)(6,5)
Step-by-step explanation:
We can use substitution to get the equation: x^2-6x+5 = 2x-7
Solve:
x^2-6x+5 = 2x-7
x^2 = 8x-12
x^2-8x+12 = 0 (we now have a polynomial)
(x-6)(x-2) = 0 (set each equation to equal 0 and solve)
x-6 = 0 --> x=6
x-2 = 0 --> x=2
To get the Y coordinates:
y=2(2)-7 --> y = -3
y = 2(6)-7 --> y = 5

Check work:
5 = 6^2-6(6)+5 --> 5 = 36-36 +5 --> 5=5
-3 = 2^2-6(2)+5 --> -3 = 4-12+5 --> -3=-3

What does Asa congruent triangle mean?.

Answers

ASA congruent triangle stands for Angle-Side-Angle.

According to the question,

We have the following information:

ASA congruent triangle

We know that ASA is a property to prove that two triangles are congruent in the same way the properties are used to prove that two triangles are similar.

ASA stands Angle-Side-Angle which means that two triangles can be congruent if the two angles and one side of one triangle is equivalent to the corresponding two angles and side of the other triangle.

There are other properties to prove two triangles are congruent. For example, there is SSS and SAS.

Hence, ASA congruent triangle stands for Angle-Side-Angle.

To know more about congruent triangle here

https://brainly.com/question/22062407

#SPJ4

Correlation is a measure of the extent to which two factors Group of answer choices vary together. are random samples. influence each other. are dependent variables.

Answers

Correlation is a measure of the extent to which two factors vary together. Correlation denotes the relationship between two variables. Correlation analysis determines the strength and direction of the linear relationship between two variables. Correlation can be positive, negative, or neutral.

Positive correlation denotes that the variables move together in the same direction, whereas negative correlation denotes that the variables move in opposite directions. Neutral correlation denotes that there is no relationship between the variables. Correlation is a technique that is used in statistics to identify the strength of the relationship between two variables. Correlation can be used to identify the strength of the linear relationship between two variables. Correlation measures the degree to which two variables vary together, in other words, it measures how much the variables are associated with one another. Correlation is used to identify the relationship between two variables. If there is a strong correlation between two variables, it indicates that there is a strong relationship between the variables. Correlation analysis helps in determining the strength and direction of the relationship between the variables. The correlation coefficient is used to measure the strength of the relationship. The correlation coefficient ranges from -1 to +1. The correlation coefficient of +1 indicates a perfect positive correlation, and the correlation coefficient of -1 indicates a perfect negative correlation. The correlation coefficient of 0 indicates that there is no correlation between the variables.

Correlation is a measure of the extent to which two factors vary together. Correlation analysis determines the strength and direction of the linear relationship between two variables. Correlation can be positive, negative, or neutral. Correlation is used to identify the relationship between two variables. The correlation coefficient is used to measure the strength of the relationship between the variables. The correlation coefficient ranges from -1 to +1. The correlation coefficient of +1 indicates a perfect positive correlation, and the correlation coefficient of -1 indicates a perfect negative correlation.

To know more about correlation coefficient visit:

brainly.com/question/29704223

#SPJ11

select the δh values associated with the dissolution of lithium chloride that are exothermic

Answers

The ΔH values associated with the dissolution of lithium chloride that are exothermic involve the release of heat energy. When a substance dissolves in a solvent, it can either release heat (exothermic) or absorb heat (endothermic).

Here are the steps to determine if the dissolution of lithium chloride is exothermic:

1. Look for the chemical equation that represents the dissolution of lithium chloride. In this case, it would be:

LiCl(s) → Li+(aq) + Cl-(aq)

2. Examine the enthalpy change (ΔH) associated with this chemical equation. If the ΔH value is negative, it indicates an exothermic process, meaning that heat is released during the dissolution. If the ΔH value is positive, it indicates an endothermic process, meaning that heat is absorbed during the dissolution.

So, to identify the exothermic ΔH values associated with the dissolution of lithium chloride, you need to find experiments or reliable sources that provide the enthalpy change values for this reaction.

To know more about lithium chloride here:

brainly.com/question/14582271

#SPJ11

During a weekend, the manager of a mall gave away gift cards to every 80th person who visited the mall.
• On Saturday, 1,310 people visited the mall.
• On Sunday, 1,714 people visited the mall.
How many people received a gift card?

answer fast and explain pls

Answers

Answer:

37 people received a gift card over the weekend.

Step-by-step explanation:

To solve this problem, we need to find the total number of visitors who received a gift card on Saturday and Sunday separately and then add them.

For Saturday, we need to divide the total number of visitors by 80 to find how many received a gift card:

1,310 ÷ 80 = 16.375

We can't have a fraction of a person receiving a gift card, so we round down to 16. This means 16 people received a gift card on Saturday.

For Sunday, we do the same calculation:

1,714 ÷ 80 = 21.425

Again, we round down to 21. This means 21 people received a gift card on Sunday.

To find the total number of people who received a gift card, we add the number of people who received a gift card on Saturday and Sunday:

16 + 21 = 37

Therefore, a total of 37 people received a gift card over the weekend.

Answer: 404 gift cards to every person or either 202

Step-by-step explanation: because subtracting all the number you will get 404 then you have divided by 2 to get 202

What is
33 x 45 x 87 -100 ???

Answers

Answer:

129095

Step-by-step explanation:

Answer:

129,095

Step-by-step explanation:

33 x 45 x 87 -100 = 129,095

I hope this helps!

Other Questions
Help! What is the answer. Please, help ASAP. after the watergate scandal, reporters redefined their roles and became group of answer choices chummy insiders. skeptics. professionals. paid informants. Why do you think slavery mainly existed in the Southern Colonies and not in the New England Colonies? Think about how geography affected their labor system. Find all solutions of the following equations. (a) 5 cos(2.c + 3) = sin(2x + 3) (b) 20 + 90 sin (3(t 2)) = 1004 (c) cos(3.x 7) = 5 (d) 8 cos(5.c) = 3 _________ are a collection of string values inherited by each process from its parent that can affect the way a running process behaves. What represents a restriction on decision variable values for alinear programming problem?Group of answer choicesConstraintsSurplusesExtreme PointsOptimal Points PART 3You are in the 0-3 year room as a Trainee educator along with 3 other educators, Ashley, Daniel and Lauren. Ashley is reading a story with a group of children and asks if you can make a bottle for Lucy as she is getting ready to have her morning sleep. While you are doing this Daniel is changing a nappy and Lauren is at the door talking with another educator about their weekend with her back to the room. A parent comes into the room to drop off their child who appears to be upset. You can see a child climbing up onto a shelf and another child is waking up from their morning sleep and begins to cry. Who could you ask to assist you during this time? Determine if the sequence below is arithmetic or geometric and determine the common difference / ratio in simplest form.12,9,6,... For an OFF-center ganglion cell, which stimulus on the cell's receptive field would cause the highest rate of action potential firing? (In the figure, black fill indicates darkness, and white fill indicates light in the receptive field.)Select one:1. a2. b3. c4. d5. Both a and d would cause the same level of activation show all work.Using the balanced chemical equation, use dimensional analysis to complete each problem. Show all work 4. Reaction 1: 4 HCl (g) + O(g) 2 Cl (g) + 2 HO (g) a. How many moles of water vapor can When does the automatic 60-day extension period for qualified taxpayers impacted by federally declared disasters begin?. A restaurant customer left $1.40 as a tip. The tax was 6% and the tip was 20% of the after tax cost.Which information is not needed to compute the bill after tax and tip? What was the total bill? What are the 5 parts of the brain and their functions? 2y=3x+7 x=y-2 find the common factors What does Myo O mean? Which of the following systems of equations has many solutions?1.2x + 3y = 6y= 2x + 22.8x - 4y= 12y=2x-3.3y= 4x + 3y= 4x - 34.2x + y = 4-2x - y = 4 who helped establish Plymouth Colony and was one of the authors of the Mayflower Compact a web page is transmitted securely when the protocol part of the url is Which statement best explains why a moral dilemma often creates conflict?There are always two characters who want completely different things to happen.There are no good reasons for choosing the solutions that will resolve the dilemma.A character always has only one option to adequately resolve the dilemma.A character has to make a choice that will likely have some undesirable consequences. Classical Mediterranean Societies Study Guide II1. Who was the first great Greek philosopher and what did he wantk. What ultimately happened to him and why?3. Who was one of his students?4. What did Plato write about?5. What did Plato start and where did he start it?6. What did Aristotle develop?7. What did Aristotle classify and who did he teach?8. Who was Alexander the Great?9. What did Alexander the Great promote?10. What did Alexander the Great assimilate?11. How did Julius Caesar come to power?12. What lifelong role was Julius Caesar given?13. What did Julius Caesar do while in power?14. Who came to power after Julius Caesar's death?15. What were the two things that Augustus Caesar did while in power?