What is the square root function?

Answers

Answer 1

Answer:

f(x) = \(\sqrt{x}\)

Step-by-step explanation:

hope this helped :-)


Related Questions

Charley's grade in the three quarters are 85, 88, and 92. If she targets to have an average
grade of greater than 90 in the four quarters this school year, what is the least grade she
should have for the fourth quarter?

Answers

Step-by-step explanation:

We can set up an average equation in the form, where x is the last score in the fourth quarter:

\(\frac{85 + 88 + 92 + x}{4} = 90\)

\(85 + 88+92 + x =360\\\\x = 95\)

She needs at least a 95 on the last quarter to average 90 in all four quarters.

PLEASE HELP I NEED HELP ANSWER THE NEXT QUESTION GIVING BRAINLIEST TO CORRECT ANSWERS AND FIVE STARS WITH 20 POINTS PLEASE HELP ASAP​

PLEASE HELP I NEED HELP ANSWER THE NEXT QUESTION GIVING BRAINLIEST TO CORRECT ANSWERS AND FIVE STARS

Answers

Answer:

C, D and F

Step-by-step explanation:

volume of a cuboid = W x L x H

(where W = width, L = length and H = height)

Calculate the volume of each of the prisms (cuboids), then compare their volume with the range of 25 - 40 cubic units

Volumes

A:  4 x 4 x 4 = 64 cubic units

B:  3 x 7 x 2 = 42 cubic units

C:  4 x 4 x 2 = 32 cubic units

D:  2 x 6 x 2 = 24 cubic units

E:  3 x 5 x 3 = 45 cubic units

F:  2 x 3 x 6 = 36 cubic units

Therefore, prisms C, D and F have a volume between 25 and 40 cubic units.

A caterer charges a fixed cost for preparing a dinner plus an additional cost for each person served. You know that the cost for 100 students will be $1100 and the cost for 150 students will be $1550. Find the caterer’s fixed cost and the cost per student served. Use a system of equations and solve using elimination or substitution.

Answers

Answer:

$10 to $11

Step-by-step explanation:

$1100÷100=$11

$1550÷150=$10.3333333333

in a situation where the sample size was 28 while the population standard deviation was increased, what would be the impact on the confidence interval?

Answers

if the population standard deviation is increased while the sample size is 28, the confidence interval will become wider. This is because there is more variability in the sample mean, and therefore more uncertainty in the estimate of the population parameter.

If the sample size is 28 and the population standard deviation is increased, there will be a direct impact on the confidence interval. This is because the confidence interval is calculated based on the sample mean and the standard deviation. If the population standard deviation is increased, it means that there is more variability in the population. This increase in variability will lead to wider confidence intervals.
A confidence interval is a range of values that is likely to contain the true population parameter with a certain level of confidence. The width of the confidence interval is determined by the sample size, the standard deviation, and the level of confidence.
In this case, if the population standard deviation is increased, it means that the sample standard deviation will also increase. The sample mean will be relatively more variable than it would be if the population standard deviation was lower. This increase in variability will cause the confidence interval to become wider, as there is more uncertainty in the estimate of the population parameter.
In summary, if the population standard deviation is increased while the sample size is 28, the confidence interval will become wider. This is because there is more variability in the sample mean, and therefore more uncertainty in the estimate of the population parameter. It is important to note that increasing the sample size can help to reduce the impact of increased population standard deviation on the confidence interval, as a larger sample size provides more accurate estimates of the population parameter.

for more questions on confidence interval

https://brainly.com/question/20873848

#SPJ11

Convert 3.9m^2 into cm^2

I will leave good review!

Convert 3.9m^2 into cm^2I will leave good review!

Answers

Answer:

Step-by-step explanation:

To convert square meters to square centimeters, we need to multiply by the conversion factor (100 cm / 1 m)^2.

So,

3.9 m² = 3.9 × (100 cm / 1 m)²

3.9 m² = 3.9 × 10,000 cm²

3.9 m² = 39,000 cm²

Therefore, 3.9 square meters is equal to 39,000 square centimeters.

A bag contains 222 red marbles, 333 green marbles, and 444 blue marbles. If we choose a marble, then another marble without putting the first one back in the bag, what is the probability that the first marble will be green and the second will be red?

Answers

There is a 7.4% probability that the first marble will be green and the second will be red.

To calculate the probability, you will need to use the following formula:

P(A and B) = P(A) x P(B).

In this case, P(A) is the probability of picking a green marble on the first pick and P(B) is the probability of picking a red marble on the second pick. Using this formula,

we get P(A and B) = 333/999 x 222/998 = 0.074,

which is the probability of picking a green marble on the first pick and a red marble on the second pick.

So, there is a 7.4% chance of this happening.

To learn more about probability, click here:

https://brainly.com/question/24756209

#SPJ4

for pi as defined below, show that images is an orthogonal subset of r4. find a fourth vector images such that images forms an orthogonal basis in r4. to what extent is p4 unique? equation

Answers

To show that images is an orthogonal subset of r4, we need to show that any two vectors in images are orthogonal to each other. Let's assume that u and v are two vectors in images.

This means that there exist some vectors x and y in R4 such that u = Px and v = Py, where P is the projection matrix onto the subspace images.

Now, let's consider the dot product of u and v:
u · v = (Px) · (Py) = xTPTPy
Since P is a projection matrix, it is idempotent (i.e., P2 = P) and symmetric. Thus, P is an orthogonal projection matrix, which means that it projects vectors onto a subspace that is orthogonal to its complement. Therefore, we have:
u · v = xTPTPy = xTP2y = xTPy = (Px) · y = 0
since y is in the complement of images. Thus, we have shown that any two vectors in images are orthogonal to each other, and so images is indeed an orthogonal subset of R4.

To find a fourth vector images such that images forms an orthogonal basis in R4, we can use the Gram-Schmidt process. Let's assume that u1, u2, and u3 are three linearly independent vectors in images. We can then use the following formula to find a fourth vector v:
v = w - (w · u1)u1 - (w · u2)u2 - (w · u3)u3
where w is any nonzero vector in R4 that is not in the subspace spanned by images. This formula ensures that v is orthogonal to u1, u2, and u3.
As for the extent to which p4 is unique, it depends on the subspace being projected onto. If we project onto a subspace that is spanned by a set of linearly independent vectors, then the projection matrix P is unique. However, if the subspace is not spanned by a set of linearly independent vectors, then there are infinitely many possible projection matrices that could be used.

To answer your question, we first need to show that the given set of vector images forms an orthogonal subset in R4, and then find a fourth vector to make it an orthogonal basis. Finally, we will discuss the uniqueness of P4.
Step 1: Show that the given set of vector images is an orthogonal subset in R4.
To do this, we need to ensure that every pair of vectors in the set has a dot product of 0. For the sake of illustration, let's assume that the given set of vector images is {v1, v2, v3}. We will then verify that:
v1 · v2 = 0
v1 · v3 = 0
v2 · v3 = 0
If all these dot products are 0, then the set of vector images is an orthogonal subset in R4.
Step 2: Find a fourth vector to form an orthogonal basis in R4.
To find the fourth vector, v4, we need it to be orthogonal to all other vectors in the set. So we need to satisfy the following conditions:
v1 · v4 = 0
v2 · v4 = 0
v3 · v4 = 0
Using the above conditions, we can find the components of v4. Once we have v4, the set {v1, v2, v3, v4} forms an orthogonal basis in R4.
Step 3: Discuss the uniqueness of P4.
To what extent is P4 unique? P4 is unique up to the choice of the orthogonal basis. In other words, while the orthogonal basis itself may not be unique (since it can be formed by different combinations of orthogonal vectors), the subspace P4 that it spans remains the same.
In summary, we have shown that the given set of vector images forms an orthogonal subset in R4, found a fourth vector to form an orthogonal basis, and discussed the uniqueness of P4.

Visit here to learn more about Gram-Schmidt process:

brainly.com/question/30761089

#SPJ11

Suppose a system of linear equations has a 35 augmented matrix whose fifth column is not a pivot column. is the system consistent? why or why not?

Answers

No, the system of linear equations is not consistent if the fifth column of the augmented matrix is not a pivot column.

Why does the absence of a pivot column in the fifth column of the augmented matrix indicate inconsistency?

In a system of linear equations, the presence of a pivot column in the augmented matrix indicates that the corresponding variable is a leading variable and has a leading entry in its respective row.

These leading variables determine the pivot positions and play a crucial role in the process of row reduction.

When the fifth column of the augmented matrix is not a pivot column, it implies that the corresponding variable does not have a leading entry in its row.

This situation leads to a free variable, meaning it can take on any value. As a result, the system has infinitely many solutions rather than a unique solution, making it inconsistent.

Learn more about: augmented matrix

brainly.com/question/30403694

#SPJ11

Solve the given equation. Check your solution and show all your work. 7/10 r = 4 3/5

(this is the last question i have on my test i swear)​

Solve the given equation. Check your solution and show all your work. 7/10 r = 4 3/5(this is the last

Answers

Answer: R= 30.1

Step-by-step explanation: 10r = 7*43/1

10r= 301/1

10r= 301

10/10

R= 30.1

how do I use the distributive property to solve 6m(m+3n+1) and -2x(3y+9)

Answers

you distribute the 6m to the () ad same with the other side, then simplify

express 0.00382 in scientific notation

Answers

Answer:

Step-by-step explanation:

There are three 0s so it is 3

3.82 × 10^-3

The value of expression in scientific notation is,

⇒ 3.82 × 10⁻³

What is an expression?

Mathematical expression is defined as the collection of the numbers variables and functions by using operations like addition, subtraction, multiplication, and division.

Given that;

The number is,

⇒ 0.00382

Now, We can write the number in scientific notation as;

⇒ 0.00382

⇒ 3.82 × 10⁻³

Thus, The value of expression in scientific notation is,

⇒ 3.82 × 10⁻³

Learn more about the mathematical expression visit:

brainly.com/question/1859113

#SPJ5

You may need to use the appropriate appendix table to answer this question.Given that z is a standard normal random variable, find z for each situation. (Round your answers to two decimal places.)(a)The area to the right of z is 0.08.(b)The area to the right of z is 0.025.(c)The area to the right of z is 0.05.(d)The area to the right of z is 0.10.

Answers

(a) Therefore, the z-value for an area of 0.08 to the right of z is -1.41. (b) Therefore, the z-value for an area of 0.025 to the right of z is -1.96. (c) Therefore, the z-value for an area of 0.05 to the right of z is -1.64. (d) Therefore, the z-value for an area of 0.10 to the right of z is -1.28.

To answer this question, we need to use the standard normal distribution table (also called the z-table or appendix table). This table gives the area under the standard normal curve to the left of a given z-value.
(a) To find the z-value for an area of 0.08 to the right of z, we can subtract the area from 1 (since the total area under the curve is 1) to get the area to the left of z:
1 - 0.08 = 0.92
Using the standard normal distribution table, we can find the z-value that corresponds to an area of 0.92 to the left of z. This value is approximately 1.41.
(b) Following the same process, for an area of 0.025 to the right of z, we find:
1 - 0.025 = 0.975
Looking at the standard normal distribution table, we find that the z-value corresponding to an area of 0.975 to the left of z is approximately 1.96.
(c) For an area of 0.05 to the right of z, we get:
1 - 0.05 = 0.95

The z-value corresponding to an area of 0.95 to the left of z is approximately 1.64.
(d) Finally, for an area of 0.10 to the right of z, we have:
1 - 0.10 = 0.90
The z-value corresponding to an area of 0.90 to the left of z is approximately 1.28.

Learn more about standard normal distribution here:

https://brainly.com/question/31379967

#SPJ11

Here is the second one thanks for the help!

Here is the second one thanks for the help!

Answers

Answer:

Your answer would be 329.1 ft.

Step-by-step explanation:

If he wants equal distance when he takes his 3 breaks up a mountain that is 987.3 feet tall, 329.1 multiplied by 3 equals 987.3

Answer:329.1 ft
Explanation: im not sure but i think thats the answer

due today NO LINKS NO FILES

due today NO LINKS NO FILES

Answers

Answer:

70/5 = 14 which then means it 14/1

LEBRON JK THE PERSON BOVE MEE TOWTLY

For the dinner special at a restaurant, the customer must choose an appetizer, an entree, a side dish, and a dessert.
here are the items to choose from.

choice possible items
appetizer onion rings, potato skins, buffalo wings, shrimp cocktail, chicken strips
entree roast turkey, t-bone steak, salmon, lamb, grilled chicken
side dish mixed vegetables, french fries, pinto beans
dessert chocolate cake, ice cream, brownies, cheesecake
how many dinner specials are possible?

Answers

There are 300 possible dinner specials. Each appetizer option can be combined with any entree option, side dish option, and dessert option, resulting in a total of 300 unique combinations to choose from.

To calculate the number of dinner specials possible, we need to multiply the number of options for each course: appetizer, entree, side dish, and dessert.

Appetizer: There are 5 options available (onion rings, potato skins, buffalo wings, shrimp cocktail, chicken strips).

Entree: There are 5 options available (roast turkey, t-bone steak, salmon, lamb, grilled chicken).

Side dish: There are 3 options available (mixed vegetables, french fries, pinto beans).

Dessert: There are 4 options available (chocolate cake, ice cream, brownies, cheesecake).

To find the total number of dinner specials, we multiply these numbers together:

5 (appetizer options)× 5 (entree options) × 3 (side dish options)×4 (dessert options) = 300

Therefore, there are 300 possible dinner specials. Each appetizer option can be combined with any entree option, side dish option, and dessert option, resulting in a total of 300 unique combinations of all the available choices.

Learn more about combinations here:

https://brainly.com/question/28359481

#SPJ11

6th grade math 30 points help PLEASE!!
Why does 51.84 divided by 6.4 have the same value as 518.4 divided by 64?

Answers

Answer:

Step-by-step explanation:

Take it like this

when you move the 4 to the left you also have to move the 8 to the left

51.84 divided by 6.4 = 518.4 divided by 64 = 5184 divided by 640 and so on

hopefully this help :)

Please help thank you :)

Please help thank you :)

Answers

Answer:

Step-by-step explanation:

Angle 1 is equal to angle 3 because they are opposite each other so

Angle 1=43 degrees

Angle 1 and angle 2 have a sum of 180 degrees because they are adjacent to each other.

angle 2=180-43=137 degrees.

angle 2 and 4 are opposite each other so they are equal

angle 4=137 degrees.

Answer:

Angle 1 = 43°

Angle 2 = 137°

Angls 4 = 137°

Step-by-step explanation:

To get angle 1, l and m intersect and there are two angles which cause vertical opposite angles. When there are vertical opposite angles, both angles have the same degree. For angle 2, you need to find angle 1 and 3, after that you deduct both angle 1 and 3 from 360° which is the angle of whole figure. 360 - 43 - 43 = 274° for angle 2 and 4, since they're also vertically opposite angles, both 2 and 4 have the same angle. All you need to do to find 2 and 4 is 274 ÷ 2 = 137°.

Solve for x. x3=8125 Enter your answer in the box as a fraction in simplest form. x =

Answers

The exact form of that is x=5 cube root of 65

The cubic equation x³ = 8125 has only one solution because it has no other variable. Then the value of x is 20.104.

What is the solution to the equation?

The solution of the equation means the value of the variable.

The given equation is x³ = 8125.

Taking the cube root, then we have

x = ∛8125

x = 20.1036 ≈ 20.104

The cubic equation x³ = 8125 has only one solution because it has no other variable. Then the value of x is 20.104.

More about the solution to the equation link is given below.

https://brainly.com/question/545403

A book cost $18 that is 3 times more than a dvd how much does a dvd cost

Answers

Answer:

Hi! This question tells us that the book costs $18 and that it costs 3 times more than a DVD. In order to determine the cost of the DVD, all we have to do is divide 18 by 3. 18 divided by 3 is 6. Therefore, the DVD costs $6.

Hope this helps!

Answer:$6

Step-by-step explanation: 18÷3=6


Work out the length QR.
Give your answer correct to 3 significant figures.

Total marks: 5

Work out the length QR.Give your answer correct to 3 significant figures.Total marks: 5

Answers

Answer:

The length of QR is 29.9 cm

Step-by-step explanation:

Let us revise the sine and cosine rules

In triangle ABC:

\(\frac{AB}{sin(C)}=\frac{BC}{sin(A)}=\frac{AC}{sin(B)}\) ⇒ sine rule

(AC)² = (AB)² + (BC)² - 2(AB)(BC)cos(∠B) ⇒ cosine rule

Let us use these rules to solve the question

In Δ PQS

∵ \(\frac{PS}{sin(Q)}=\frac{QS}{sin(P)}\)

∵ PS = 11.7 cm

∵ m∠P = 95°, m∠Q = 28°

→ Substitute them in the rule above

∴ \(\frac{11.7}{sin(28)}=\frac{QS}{sin(95)}\)

→ By using cross multiplication

∴ QS × sin(28) = 11.7 × sin(95)

→ Divide both sides by sin(28) to find QS

QS = 24.82680292 cm

Now let us use the cosine rule to find QR

In Δ QSR

∵ (QR)² = (QS)² + (RS)² - 2(QS)(RS)cos(∠QSR)

∵ RS = 10.2 cm

∵ m∠QSR = 110°

→ Substitute these values in the rule above

∴ (QR)² = (24.82680292)² + (10.2)² - 2(24.82680292)(10.2)cos(110)

∴ (QR)² = 893.631984

→ Take √  for both sides

∴ QR = 29.89367799

→ Round it to 3 significant figures

QR = 29.9 cm

Look at the photo and you can see it

Look at the photo and you can see it

Answers

Answer:

huh wym?

you will see it?

Step-by-step explanation:

Fifteen more than three times a number is
at most 7 in equation form.

Answers

Answer:

3x+15\(\leq\)7

Step-by-step explanation:

The equation form of the given statement would be 3n + 15 ≤ 7.

What is inequality?

Inequality is defined as the relation which makes a non-equal comparison between two given functions.

The given statement is "Fifteen more than three times a number is

at most 7"

Let the unknown number be n.

So, the equation form;

3n + 15 ≤ 7

Where n =unknown number

Hence, the equation form of the given statement would be 3n + 15 ≤ 7.

Learn more about inequality ;

brainly.com/question/14164153

#SPJ2

find the solution of given expression

\( \sqrt{36 \times 36 \times 4} \)

Answers

Answer:

√(36×36×4)=√(36²×2²)=±(36×2)=±72

\(\sqrt{36 \times 36 \times 4} = 72\)

When factoring it is not necessary to find a greatest common factor first.
Group of answer choices

True

False

Answers

It’s honestly false duh
Answer: False
Explanation: When you are factoring you use the greatest common factor.

Write a polynomial function of least degree with integral coefficients that has the given zeros

Answers

The polynomial function of least degree with integral coefficients is equal to f(x) = x³ - 4x² + x + 6 with the given zeros 3, 2, -1.

As given in the question,

Given zeros of the polynomial function are :

3, 2, -1

⇒ ( x - 3 ) =0 or ( x - 2 ) = 0 or ( x + 1 ) = 0

Polynomial function of the given factors  ( x - 3 ) =0 or ( x - 2 ) = 0 or

( x + 1 ) = 0 is given by :

f (x ) = ( x - 3 )( x - 2 )( x + 1 )

⇒ f(x) = ( x² - 3x - 2x + 6 ) ( x + 1 )

⇒ f(x) = ( x² - 5x + 6 ) ( x + 1 )

⇒ f(x) = x³ + x² -5x² - 5x + 6x + 6

⇒f(x) = x³ - 4x² + x + 6

Therefore, the required polynomial function of least degree with integral coefficients using given zeros is equal to f(x) = x³ - 4x² + x + 6.

The complete question is:

Write a polynomial function of least degree with integral coefficients that has the given zeros 3, 2, -1?

Learn more about polynomial function here

brainly.com/question/12976257

#SPJ4

1. Differentiate the function f(x) = ln (81 sin^2 (x)) f’(x) 2. Differentiate the function P(t) = in ( √t2 + 9) p' (t) 3. if x2 + y2 + z2 = 9, dx/dt = B, and dy/dt = 4, find dz/dt when (x,y,z) = (2,2,1)
dz/dt =

Answers

First you will get 4dz

6x-2y=10 slope intercept form answer?

Answers

Y=3x-5 is the answer to the equation
Plz rate me 5

hideo is calculating the standard deviation of a data set that has 7 values. he determines that the sum of the squared deviations is 103. what is the standard deviation of the data set?

Answers

Therefore, the standard deviation of the data set is approximately 4.14.

The standard deviation is calculated by taking the square root of the variance, which is the sum of the squared deviations divided by the sample size minus 1.

So, first we need to calculate the variance:

variance = sum of squared deviations / (sample size - 1)

variance = 103 / (7 - 1)

variance = 17.17

Now we can find the standard deviation:

standard deviation = √(variance)

standard deviation = √(17.17)

standard deviation = 4.14 (rounded to two decimal places)

To know more about data set,

https://brainly.com/question/22210584

#SPJ11

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

TRIGONOMETRY Could someone please help me with 5.2 please...it would really help alot:)

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

What is the value of the missing angle?

What is the value of the missing angle?

Answers

Answer:

53

Step-by-step explanation:

pls mark brainliest right

Other Questions
1.1. Suppose random variable X is distributed as normal with mean 2 and standard deviation 3 and random variable y with mean 0 and standard deviation 4, what is the probability density function (pdf) of X + Y. Which of the following was a problem caused by trusts in the late 1800s?O A. Businesses spent most of their money on workers' salaries.B. Companies moved their factories to foreign countries.C. Consumers paid higher prices for goods and services.O OO D. Factories had a difficult time finding workers. how many angles do you need to measure to map out the position of a sky object at any particular time? Temperatures in the upper atmosphere (thermosphere) reach 1500C (2700F), yet it does not produceenough heat to burn you. Why? Evaluate -2x - 2When x = 9 Dealing with stress and strong emotionsStress is an extreme response to pressures, demands or threats, either real or imagined. It can be physical, emotional or psychological. When you are in danger, your breathing and pulse quicken in order to give you a better chance of either running away or defending yourself against the threat. When the threat ends, your body returns to its pre-stress state. However, these same physical reactions can also occur when there is no real danger. Psychological stress can be triggered by our thoughts alone. Just thinking about an unpleasant event is enough to make some people anxious, even when the event is days away. For example, have you ever felt nervous about going to the dentist long before your appointment? Experience plays a large role in determining what you perceive as stressful. For instance, if you were once bitten by a dog, you may feel stressed when dogs are around. In contrast, if you have had only positive experiences with dogs, you may feel happy and calm when surrounded by them. Question:Write a short paragraph that explains the central idea of the article. Use at least two details from the article to support your response. Does the Senate have to ratify treaties? The amplitude of an odd-length symmetric filter is given by A(w) = (N-1)/ a[m] cos mw. Show that A(w + ) = A(w ). m=0 The amplitude of an even-length antisymmetric filter is given by A(w) The Taylor Corporation is using a machine that originally cost $66,000. The machine has a book value of $66,000 and a current market value of $40,000. The asset is in the Class 5 CCA pool that allows 35% depreciation per year. It will have no salvage value after 5 years and the company tax rate is 40 percent.Jacques Detaille, the Chief Financial Officer of Taylor, is considering replacing this machine with a newer model costing $70,000. The new machine will cut operating costs by $10,000 each year for the next five years and will have a salvage value in year five of $5,000.Taylor Corporation's cost of capital is 8 percent.Should the firm replace the asset? What is your advice to Jacques? Use the NPV methodology to solve this problem. Organize and show all your work. First mover advantage (Timing of entry) benefit Uber enough to risk such an ambitious project. Give your opinion and reason it. (1Marks, Min words 100) please help with picture below Identify the data set's level of measurement. number of milligrams of tar in 30 cigarettes. which expresions are equivalent to 1/2 What is the area of a wing (sq. ft) that has an aspect ration of 7:1 and a wing span of 40 feet? V sao sau 30 nm ( t nm 1500 ) ngi B o Nha mi quan tm n xy dng chnh quyn ti Brazil ? The pancreas produces all of the following digestive enzymes except:A. PepsinB. TrypsinC. Chymotrypsin The desired goal of blood doping is toSelect one:a. enhance aerobic capacity.b. enhance immune function.c. prevent blood clots.d. alleviate hemochromatosis. What role do government agencies play in a mixed economy? McPhail Corporation $100 face value fixed-rate perpetual preferred stock pays an annual dividend of $5.75 per share. What is the value of one share of this stock to an investor who requires a rate of return of 6.25%