what is the solution 2/3x + 5 = 1

Answers

Answer 1

Answer:

x = -6

Step-by-step explanation:

subtract 5 from both sides

2/3 x = -4

multiply by 3

2x = -12

divide by 2

x= -6

Answer 2

Answer:

2=x

Step-by-step explanation:

2/3x+5=1

2/3 is also like division so lets do it this way:

2÷3x+5=1

           -5    -5

______________________-

2÷3x=-4

·3x     ·3x

__________________-

2=-4·3x

+4   +4

______________-

6=3x

÷ 3    ÷3

_______________

2=x

Hope this helps


Related Questions

You ran into Pedro's for a quick lunch and spent
$12. You left an 18% tip. How much was your total?

Answers

Answer:

The total answer is $14.16 because the tip would be $2.16 so add it with 12 and you get $14.16.

Find the area of a circle with a diameter of 8 inches. Use 3.14 for π.

Answers

Answer:

50.24 square inches

Step-by-step explanation:

Use the formula A=πr2

Find the radius, r, by dividing the diameter by 2.

8/2 = 4

Now plug the numbers into the formula.

A= 3.14(42)

A=3.14(16)A=50.24

(8÷2)×(8÷2)×(22÷7) = 50.29 square inches

Consecutive even integer word problem help please!!​​

Consecutive even integer word problem help please!!

Answers

Answer:

Width: 16 in.,  Length:  18 in.

Step-by-step explanation:

Consecute even/odd problems seem a bit weird at first.

You choose a variable to represent the first integer, say  n .  Assume it's even (no symbolic way to tell!).  If  n  is even, then the next consecutive integer is  n + 2.  You add two because you want to skip one integer.

Width:  n

Length:  n + 2

Area is length multiplied by width, so

n(n+2)=224n2+2n=224n2+2n224=0(n+14)(n16)=0n+14=0 or n16=0n=14 or n=16

The negative solution makes no sense, so use n = 16

Width: 16

Length: 18

use function notation (with the appropriate functions above) to represent the area of a regular pentagon whose perimeter is 140 cm.

Answers

However, we need to substitute a with s since that is the value we have calculated. Therefore, we get A(s)=(1/4)(5+sqrt(5))s2. This is the function notation that represents the area of a regular pentagon whose perimeter is 140 cm.

Let's consider that s be the length of a side of the regular pentagon.

The perimeter of the regular pentagon will be 5s. Therefore, we have the equation:5s = 140s = 28 cm

Also,

we have the formula for the area of a regular pentagon as:

$A=14(5+5)a2$,

where a is the length of a side of the pentagon.

In order to represent the area of a regular pentagon whose perimeter is 140 cm, we need to substitute a with s, which we have already calculated.

Therefore, we have:A(s)=$14(5+5)s2$

Now, we have successfully used function notation (with the appropriate functions above) to represent the area of a regular pentagon whose perimeter is 140 cm.

The area of a regular pentagon can be represented using function notation (with the appropriate functions above). The first step is to calculate the length of a side of the regular pentagon by dividing the perimeter by 5, since there are 5 sides in a pentagon.

In this case, we are given that the perimeter is 140 cm, so we get 5s = 140, which simplifies to s = 28 cm. We can now use the formula for the area of a regular pentagon, which isA=(1/4)(5+sqrt(5))a2, where a is the length of a side of the pentagon.

However, we need to substitute a with s since that is the value we have calculated. Therefore, we getA(s)=(1/4)(5+sqrt(5))s2. This is the function notation that represents the area of a regular pentagon whose perimeter is 140 cm.

To know more about notation visit:

https://brainly.com/question/29132451

#SPJ11

and D are noncoplanar. △ABC,△ABC,△ACD, and △ABD are equilateral. X and Y are midpoints of AC¯¯¯¯¯¯¯¯ and and AD.Z is a point on AB¯¯¯¯¯¯¯¯. What kind of triangle is △XYZ? Explain.

Answers

ΔXYZ will also be an equilateral triangle.

What is equilateral triangle?

An equilateral triangle in geometry is a triangle with equal-length sides on all three sides. In the well-known Euclidean space, an equilateral triangle also is equiangular, meaning that each of its three internal angles is 60 degrees and congruent with the others. It's also referred to it as a regular triangle because it is a regular polygon.

As X,Y,Z are the midpoints of sides of equilateral triangle so when we will join the X,Y,Z we will find that distances XY=YZ=XZ are three are equal because this is proved by similarity of triangles which in itself is a detailed and vast topic

Hence XYZ will also be an equilateral triangle

To learn more about equilateral Triangles click the below link:

https://brainly.com/question/15294703

#SPJ4

Write the coordinates of the vertices after a translation 7 units down.
-
10
-
8
-
6
-
4
-
2
2
4
6
8
10
-
10
-
8
-
6
-
4
-
2
2
4
6
8
10
x
y
Q
R
S

Write the coordinates of the vertices after a translation 7 units down.-10-8-6-4-2246810-10-8-6-4-2246810xyQRS

Answers

Answer:

R'(-4,-3), Q'(-4,-4), S'(6,-4)

Step-by-step explanation:

Translating 7 units down means subtracting 7 from each y coordinate.

Algebra 1 Final Exam 2020
A repair bill for your car is $850. The parts cost $325, and the labor cost is $55 per hour. What is the context of the slope?

Answers

stop cheating it’s not good i’m telling your teacher

Liz and Becca went out to eat in a restaurant. They ate 152 ounces of food combined. Liz ate seven more ounces that 4 times the amount Becca ate. How many ounces of food did Becca eat?

Answers

The ounces of food eaten by Becca is 29 ounces.

This is a question of linear equation in one variable.

Given that:-

Total amount of food eaten by Liz and Becca = 152 ounces

Also, Liz ate seven more ounces that 4 times the amount Becca ate.

We have to find the ounces of food eaten by Becca.

Let the ounces of food eaten by Becca be x.

Hence, we can write,

Food eaten by Liz = (4x + 7) ounces

Total food eaten = 152 ounces = x + (4x + 7) = 5x + 7

Hence,

152 = 5x + 7

5x = 152 - 7

5x = 145

x = 145/5 = 29 ounces.

To learn more about linear equation in one variable, here:-

https://brainly.com/question/17139602

#SPJ1

The floor of a storage unit is 15 feet long and 8 feet wide. What is the distance between two opposite corners of the floor?

Answers

The distance between two opposite corners of the given floor is 17 feet.

What is Pythagoras's theorem?

Pythagoras's theorem states that in a right-angled triangle, the square of one side is equal to the sum of the squares of the other two sides.

Given that the floor of a storage unit is 15 feet long and 8 feet wide.

Let x would be the distance between two opposite corners of the floor

As per the figure, We have a right triangle with legs 15 and 8 and with hypotenuse x.

According to Pythagoras's theorem,

x² = 15² + 8²

x² = 225 + 64

x² = 289

x = √289

x = 17

Thus, the distance is 17 feet between two opposite corners.

Learn more about Pythagoras's theorem here:

brainly.com/question/343682

#SPJ9

The floor of a storage unit is 15 feet long and 8 feet wide. What is the distance between two opposite

I need answers quick. ASAP.​

I need answers quick. ASAP.

Answers

Answer:

integer ; 1

Step-by-step explanation:

1) find two point of the line

A (4,0) ; B (0, -4)

2) use this formula

slope = (y2-y1)/(x2-x1)

(-4-0)/(0-4)

-4/-4 = 1

Riverboat Adventures pays $310,000 plus $15,000 in closing costs to purchase real estate. The real estate consists of land appraised at $35,000, a building appraised at $105,000, and land improvements appraised at $210,000. Compute the cost that should be allocated to the land.

Answers

To determine the cost allocated to the land, we need to calculate the proportionate cost of the land in relation to the total appraised value of the real estate. Therefore, the cost allocated to the land is $32,500.

The total cost paid for the real estate is $310,000 plus $15,000 in closing costs, totaling $325,000. To allocate the cost to the land, we need to calculate the proportion of the land's appraised value to the total appraised value of the real estate.

The total appraised value of the real estate is the sum of the appraised values of the land, building, and land improvements, which amounts to $35,000 + $105,000 + $210,000 = $350,000.

To calculate the cost allocated to the land, we divide the appraised value of the land by the total appraised value of the real estate and multiply it by the total cost paid:

Cost allocated to land = (Appraised value of land / Total appraised value) * Total cost

= ($35,000 / $350,000) * $325,000

= 0.1 * $325,000

= $32,500

Therefore, the cost allocated to the land is $32,500. This allocation is based on the relative appraised value of the land compared to the total appraised value of the real estate.

Learn more about multiply here:

https://brainly.com/question/23536361

#SPJ11

how do you know if a system of two linear equations has one solution, multiple solutions or no solutions?

Answers

A system of linear equations has one solution when the graphs intersect at a point.

A system of linear equations has no solution when the graphs are parallel.

A system of linear equations has infinite solutions when the graphs are on the exact same line.

The graphs attached below show the linear equations that have one solution, multiple solutions, and no solutions.

A linear equation in two variables of the form axe + by + c = 0, where a, b, c R, a 0, and b 0. By comparing the coefficients of the equations while taking the system of linear equations into consideration, we may determine how many solutions there are. Additionally, we can use a graphical way to determine whether the equation system has a single solution or an infinite number of solutions.

To know more about linear equations visit: brainly.com/question/11897796

#SPJ4

how do you know if a system of two linear equations has one solution, multiple solutions or no solutions?
how do you know if a system of two linear equations has one solution, multiple solutions or no solutions?
how do you know if a system of two linear equations has one solution, multiple solutions or no solutions?

Find the solutions of the quadratic equation 3x2 + 9x + 17 = 0.

Find the solutions of the quadratic equation 3x2 + 9x + 17 = 0.

Answers

Answer: C

Step-by-step explanation: Just did khan academy

Angle 6 is 60°.
What is the
measure of 42?
m42 = [?]°
Answer in degrees.
1/2 = [?]°
8/7
4/3
5/6=60°

Angle 6 is 60.What is themeasure of 42?m42 = [?]Answer in degrees.1/2 = [?]8/74/35/6=60

Answers

Step-by-step explanation:

the intersection angles between a line and 2 parallel lines are the same for each parallel line (otherwise they would not be parallel).

and the intersection angles on one side of a line are the same as in the other side - just left-right mirrored.

so,

angle 2 = angle 4 = angle 6 = angle 8 = 60°

Find T,N, and k for the space curve r(t)=-7ti-(7a cosh(t/a))j, a>0.

Answers

The tangential vector, normal vector, and binormal vector are given by:

T = -7i - (7a sinh(t/a))j

N = [-7i - (7a sinh(t/a))j]/sqrt[(-7)^2 + (7a sinh(t/a))^2]

B = (-7 / √49 + 49a² sinh²(t/a)) i + (7a sinh(t/a) / √49 + 49a² sinh²(t/a)) j.

Given the space curve r(t) = -7ti - (7a cosh(t/a))j, a > 0.

Tangential vector T can be determined using the following formula:T = r'(t)

Where r'(t) is the derivative of r(t) with respect to t.Thus, we need to differentiate r(t) with respect to t.

Here's the differentiation:r(t) = -7ti - (7a cosh(t/a))j

The derivative of the first component is -7 and the derivative of the second component is -7a sinh(t/a).

Hence, the tangential vector T is given by:T = r'(t) = -7i - (7a sinh(t/a))j

The magnitude of the tangential vector is given by:|T| = sqrt[(-7)^2 + (7a sinh(t/a))^2]

The normal vector N can be found by the formula:N = T/|T|

That is: N = [-7i - (7a sinh(t/a))j]/sqrt[(-7)^2 + (7a sinh(t/a))^2]

Finally, the binormal vector is given by the cross product of T and N. B = T x N = i j k - 7 0 - 7a sinh(t/a) / √49 + 49a² sinh²(t/a) i - 7 0 - 7 / √49 + 49a² sinh²(t/a) j 0 0 0 k

B = (-7 / √49 + 49a² sinh²(t/a)) i + (7a sinh(t/a) / √49 + 49a² sinh²(t/a)) j

Therefore, tangential vector, normal vector, and binormal vector are given by:

T = -7i - (7a sinh(t/a))j

N = [-7i - (7a sinh(t/a))j]/sqrt[(-7)^2 + (7a sinh(t/a))^2]

B = (-7 / √49 + 49a² sinh²(t/a)) i + (7a sinh(t/a) / √49 + 49a² sinh²(t/a)) j.

To learn more about tangential vector, normal vector, and binormal vector visit: brainly.com/question/30895285

#SPJ11

can some one help me with this trigonometry problem?
CotA + cot(60+A)-cot(60-A)=3cot3A
how can i prove this ?

Answers

Step-by-step explanation:

Hope it will help you ❤❤

can some one help me with this trigonometry problem? CotA + cot(60+A)-cot(60-A)=3cot3Ahow can i prove
can some one help me with this trigonometry problem? CotA + cot(60+A)-cot(60-A)=3cot3Ahow can i prove

7(m – 6) m = 8 Evaluate this expression for the given value(s) of the variable(s).

Answers

Answer:

14

Step-by-step explanation:

7(8-6)

So, PEMDAS

7(2)= 14

14 is the answer.

Suggest regular languages L1​ and L2​ over {0,1} such that 1. L1​⊈L2​, 2. L2​L1​, and 3. (L1​∪L2​)∗=L1∗​∪L2∗​ (b) Prove or disprove whether condition 3 above holds for any regular languages, L1​ and L2​.

Answers

a). We have proved all the given conditions.

b). It is true that condition 3 holds for all regular languages L1 and L2.

(a) Regular languages L1 and L2 can be suggested as follows:

Let L1=0(n+1)|n0

and

L2=1(n+1)|n0

We have to prove three conditions:1. L1 ⊈ L2:

The given languages L1 and L2 both are regular but L1 does not contain any string that starts with 1.

Therefore, L1 and L2 are distinct.2. L2  L1:

The given languages L1 and L2 both are regular but L2 does not contain any string that starts with 0.

Therefore, L2 and L1 are distinct.3. (L1 ∪ L2)* = L1* ∪ L2*:

For proving this condition, we need to prove two things:

First, we need to prove that (L1 ∪ L2)* ⊆ L1* ∪ L2*.

It is clear that every string in L1* or L2* belongs to (L1 ∪ L2)*.

Thus, we have L1* ⊆ (L1 ∪ L2)* and L2* ⊆ (L1 ∪ L2)*.

Therefore, L1* ∪ L2* ⊆ (L1 ∪ L2)*.

Second, we need to prove that L1* ∪ L2* ⊆ (L1 ∪ L2)*.

Every string that belongs to L1* or L2* also belongs to (L1 ∪ L2)*.

Thus, we have L1* ∪ L2* ⊆ (L1 ∪ L2)*.

Therefore, (L1 ∪ L2)* = L1* ∪ L2*.

Therefore, we have proved all the given conditions.

(b)It is true that condition 3 holds for all regular languages L1 and L2.

This can be proved by using the fact that the union of regular languages is also a regular language and the Kleene star of a regular language is also a regular language.

To know more about string, visit:

https://brainly.com/question/30099412

#SPJ11

5. -2 = p - 1
Help me pleaseee

Answers

Assuming you are trying to find the value of p:

You would add 1 to each side to make the p alone

-2 =p - 1
+1 +1

-1 = p


To check, you can put p in the original equation

-2 = -1 - 1

-2 = -2 which means this is correct


Hope this helps! If you can, please give brainlist! :)

Sam has the lead role in the school play. He still has to memorize 1/2 of his lines. Suppose Sam memorizes 1/3 of his lines today. What fractions of his lines will he have left to memorize?

Answers

Answer: 1/6

Step-by-step explanation:

Since Sam has to memorize 1/2 of his lines and he memorizes 1/3 of his lines today, the fractions of his lines that he has left to memorize will be gotten by subtracting 1/3 from 1/2. This will be:

= 1/2 - 1/3

= 3/6 - 2/6

= 1/6

Therefore, he has 1/6 of his lines left to memorize.

Answer:

1/6

Step-by-step explanation:

The fractions of his lines will he have left to memorize is calculated as:

Number of lines he has to memorize - Number of line he memorized today

Number of lines he has to memorize = 1/2

Number of line he memorized today = 1/3

Hence,

= 1/2 - 1/3

Lowest Common Denominator = 6

= 3 - 2/6

= 1/6

If the universal set contains natural numbers that are at most 25, and A is the set of multiples of 3 that are less than 20, define each set.
U=.
A =
A'=

Answers

The defined sets are as follows:

U = {1, 2, 3, 4, 5, 6, 7, 8, 9, 10....25}

A = {3, 6, 9, 12, 15, 18}

A' = {1, 2, 4, 5, 7, 8, 10, 11, 13, 14, 16, 17, 19, 20, 21, 22, 23, 24, 25}

How to represent sets?

The universal set contains natural numbers that are at most 25. Natural numbers are counting numbers.

Therefore,

universal set = U = {1, 2, 3, 4, 5, 6, 7, 8, 9, 10....25}

A is the set of multiples of 3 that are less than 20. Therefore,

A = {3, 6, 9, 12, 15, 18}

A'(A prime) is the number that is not in the A set but is present in the universal set.

Therefore,

A' = {1, 2, 4, 5, 7, 8, 10, 11, 13, 14, 16, 17, 19, 20, 21, 22, 23, 24, 25}

learn more on sets here: https://brainly.com/question/27529130

#SPJ1

There are four candidates for homecoming queen and three for king. How many different king-queen combinatons are there

Answers

There will be 12 combination of  different king-queen.

When grouping objects or figuring out how many subgroups can be created from a given collection of objects, combinations are employed. We also employ permutations to calculate the number of possible combinations of unrelated things.

To determine the number of different king-queen combinations, we need to multiply the number of candidates for king by the number of candidates for queen. In this case, there are four candidates for homecoming queen and three candidates for king.

There are 4 candidates for queen and 3 candidates for king, so:

4 x 3 = 12

Therefore, the total number of different king-queen combinations is 4 multiplied by 3, which equals 12. So, there are 12 different king-queen combinations.

Learn more about combination at https://brainly.com/question/8755914

#SPJ11

If p and q vary inversely and p is 5 when q is 4, determine q when p is equal to 10.

Answers

If p and q vary inversely and p is 5 when q is 4, the value of q when p is equal to 10 is 2.

What is an inverse variation?

An inverse variation can be defined as a type of proportionality which shows the relationship that exist between two (2) distinct variables, wherein, as the value of one variable increases, the value of the other variable decreases and vice-versa.

Mathematically, an inverse variation can be modeled or represented by this expression:

p ∝ 1/q

p = k/q

Where:

p and q are the variables.k represents the constant of proportionality.

Next, we would determine the constant of proportionality (k) by substituting the value of the given variable as follows:

k = pq

k = 5(4)

k = 20

Now, we can determine the value of q:

q = k/p

q = 20/10

q = 2.

Read more on inverse here: https://brainly.com/question/28008647

#SPJ1

Write an equation of the line with a slope of 2/3
and y -intercept of -8

Answers

Answer: y=  2/3 + -8

Step-by-step explanation: Put into slope intercept form

The  equation of the line with a slope of 2/3  and y -intercept of -8 is y = 2/3 x -

8

The slope intercept equation is represented as follows:

y = mx + b

where

m = slope

b = y-intercept

Therefore,

The equation of the line has a slope(m) of 2 / 3 and y-intercept of  -8.

The equation can be represented as follows:

y = 2/3 x - 8

learn more: https://brainly.com/question/19319525?referrer=searchResults

pls help me!! will give brainliest

pls help me!! will give brainliest

Answers

Answer: (0,0)

If AB is translated right 5 units and down two then both points are translated by that amount.

A currently is (-5, 2)

x=-5 and y=2

Since youre going right by five your x value will increase by 5 so the point will instead be at x=0

Since youre going down by two your y value will decrease by 2 so the point will instead be at y=0

x=0 and y=0

(0,0)

Answer: its 0,0

Step-by-step explanation:

An item is regularly priced at $95. It is on sale for 85% off the regular price.

Answers

Answer:

14.25

Step-by-step explanation:

95*0.85=80.75

95-80.75=14.25

Answer:

The sale took $14.25 off the original price, so the item is currently $80.75 with the sale.

HOW DO I DO IT?! pls help this is homework and i need help and i have a test fiaday this week!

HOW DO I DO IT?! pls help this is homework and i need help and i have a test fiaday this week!

Answers

The wages earned by the worker after assembling 300 parts is $90.

What is equation?

The equals sign indicates that two expressions in a formula, also known as an equation, are equal.

Given:

The no of parts assembled by the worker, n = 250,

The wage he gets, r = $75

The wage earned to assemble one part = 75 / 250 = $0.3

So, the wage earned by worker by assembling 300 parts = 0.3 × 300 = $90

Therefore, the wage earned by the worker after assembling 300 parts is $90.

To know more about equation:

https://brainly.com/question/12788590

#SPJ1

find dy/dx. x = t sin(t), y = t2 + 8t

Answers

find dy/dx

x= t sin(t); (Given in the question)

y= t²+8t; (Given in the question)

then, x= t sin(t)

dx/dt = sin t + t cos t ;

y= t²+8t

dy/dt = 2t + 8;

then, dy/dx = dy/dt x dx/dt

dy/dx = (2t+8)/(sin t + t cos t)

dy/dx = 2(t+4)/(sin t + t cos t)

Learn more about derivative at:

brainly.com/question/23847661

#SPJ4

Graph The Curve. x = cos(t) + ln(tan(t/2)), y = sin(t), π/4 ≤ t ≤ 3π/4

Answers

To graph the curve x = cos(t) + ln(tan(t/2)) and y = sin(t) with the domain π/4 ≤ t ≤ 3π/4, follow these steps: 1. Create a table of values for t within the given domain, such as t = π/4, π/2, and 3π/4. 2. Calculate the corresponding x and y values for each t value using the given equations. 3. Plot the (x, y) coordinates on a Cartesian plane.

To graph the curve, we first need to understand what each term means.
- x = cos(t) + ln(tan(t/2)): This is the equation for the x-coordinate of the curve. It's a combination of the cosine function (cos(t)) and the natural logarithm of the tangent function (ln(tan(t/2))).
- y = sin(t): This is the equation for the y-coordinate of the curve. It's simply the sine function (sin(t)).
Now, let's look at the range of values for t: π/4 ≤ t ≤ 3π/4. This means that t starts at π/4 (45 degrees) and ends at 3π/4 (135 degrees), and it increases in increments of pi/4 (90 degrees).
To graph the curve, we can start by plugging in some values of t to find corresponding (x,y) pairs. Here are a few:
- When t = π/4: x = cos(π/4) + ln(tan(π/8)) ≈ 0.532, y = sin(π/4) ≈ 0.707. So one point on the curve is (0.532, 0.707).
- When t = π/2: x = cos(π/2) + ln(tan(π/4)) = 0 + ln(1) = 0, y = sin(π/2) = 1. Another point on the curve is (0, 1).
- When t = 3π/4: x = cos(3π/4) + ln(tan(3π/8)) ≈ -0.532, y = sin(3π/4) ≈ -0.707. A third point on the curve is (-0.532, -0.707).
We can continue to plug in values of t and plot the corresponding points to create the graph. However, because the equation for x involves the natural logarithm of the tangent function, the curve may not be easy to visualize or sketch by hand.
In general, the curve will have a "wavy" shape due to the combination of the sine and cosine functions. The natural logarithm of the tangent function will also introduce some asymmetry to the curve. To get a more precise sense of the curve's shape, we can use a graphing calculator or software to plot the points and connect them with a smooth curve.

To know more about logarithm visit:

https://brainly.com/question/30085872

#SPJ11

Which value is equivalent to
4

Answers

Answer:

Look it out for me

Step-by-step explanation:

2 6 8 10 12 14 16 18 20
Other Questions
Solve this quickly please!! 1 Producerswhy this is true?consumers.generally found at the beginningof a food chain. Which statement best explains(1) Producers are usually smaller in size thn(2) Producers do not rely on other organisms(3) There are always more consumers thanproducers in food chains(4) Consumers are always more complex organismsthan producers.for food. Why did a court decide John Brown had committed treason ? 1. To remember abdominal muscles, explain what TIRE stand for the phrase spare TIRE The real interest rate r is given by r = i - m where i nominal interest rate and r the rate of inflation.Suppose the economy-wide demand for money is given by My = P(0.6Y - 40000i) where P is theprice level, Y is real GDP and i nominal interest rate.If inflation is r = 6% = 0.06 and what level does the nominal interest rate need to be inorder for the real interest rate to be r = 1.25% = 0.0125?What value should the Reserve Bank set the nominal money supply Ms if the price level is P =5, real GDP is Y = 60,000 and it wants the real interest rate to be be r = 1.25% = 0.0125? kayla enlarged the size of a rectangle to a height of 8 in. what is the new width if it was originally 2 in tall and 3 in wide? One loop of a trna molecule includes the ______, which is complementary to an mrna codon, and the other end of the trna molecule carries an ______ corresponding to that mrna codon. Whose reflection has been seen in the mirror of the lobby of hollywoods roosevelt hotel?. 3. What were the two main forms of government during the history of Ancient China? a. Democracy and Dictatorship b. The Feudal System and Civil Service employees c. Socialism and Communism d. Theocracy and Republic e. Communism aid Democracy Dr. Peabody recorded an $82 telephone bill that he will pay within thirty days. Which of the following statements is correct?A. Telephone expense is debited $82; accounts payable is credited $82.B. Telephone expense is debited $82; cash is credited $82.C. Telephone expense is debited $82; accounts payable is debited $82.D. Telephone expense is credited $82; accounts payable is debited $82. What is the land like in the south and southwest of Asia? tundrarain forestforestdesert A researcher believes that about 72%of the seeds planted with the aid of a new chemical fertilizer will germinate. He chooses a random sample of 165 seeds and plants them with the aid of the fertilizer. Assuming his belief to be true, approximate the probability that at most 117of the 165 seeds will germinate. Use the normal approximation to the binomial with a correction for continuity Find the area. Round to the nearest hundredth if necessary quizlet cancer antigen-binding domains/sites of an antibody molecule are made up of heavy and light chains How many people were killed by the rat islands earthquake. Recording the adopted budget; determining property tax rate following are (a) a condensed summary of a recent general fund budget adopted by the village of croton-on-hudson, new york, and (b) the total assessed value of taxable properties in the village. estimated revenues and other sources real property taxes $15,491,173 non-property taxes and other 9,621,203 total estimated revenues 25,112,376 appropriated previously accumulated fund balance 573,750 total estimated revenues and other sources $25,686,126 appropriations police department $4,313,439 all other departments and other 11,973,293 employee benefits 6,123,763 transfer to debt service fund 3,275,631 total appropriations $25,686,126 assessed value of taxable real property $60,230,497 required: prepare the journal entry to record the budget and compute the property tax rate per $1,000 of taxable assessed value. What is the equation in slope intercept form of the line that passes through the points (-6,5) and (2,1) enter any fractions like a/b or -a/b. Do not use spaces in your answer the nurse cares for a client with an abnormal cortisol level. the nurse recalls which information about cortisol? cortisol metabolizes free fatty acids. Graphically variable costs over all levels of production would be a ___ linestraight horizontalstraight verticalupward sloping straight linenone of above 17. Which of the following is an inherent strength of advertising? a. advertising provides immediate feedback b. advertising can deliver complex information c. advertising can create messages quickly d. advertising is an efficient means for reaching large numbers of people-the mass market e. advertising is often the most credible source of information for consumers 18. Which promotional mix alternative has the advantage of allowing the seller to see and/or hear the potential buyer's reaction to the message? a. advertising b. personal selling c. public relations d. sales promotion e. publicity