Answer:
what dog
Explanation:
you did not show a dog
How are atoms of sodium and chlorine similar and different from one another?
Answer:
similar as they both have valency of 1
different as sodium is metal while chlorine is non metal
Scientists find a new mid-ocean ridge forming along an underwater
mountain range. What can scientists assume based on this finding?
Ridge
O a. The plates are converging in this area.
O b. Crust is being pushed back down to the mantle here.
O c. New ocean floors have stopped being produced at the ridge.
Od. The crust near the ridge is newer than the crust farther from the ridge.
*
The new mid-ocean ridge shows that the crust near the ridge is newer than the crust farther from the ridge. Therefore, option (d) is correct.
What is a mid-ocean ridge?A mid-ocean ridge can be described as a seafloor mountain system formed by plate tectonics. It has a depth of about 2,600m and rises about 2,000 m above the deepest part of an ocean basin. Seafloor spreading occurs along a divergent plate boundary.
The rate of seafloor spreading calculates the morphology of the crest and its width in an ocean basin. The production of new seafloor results from the mantle in response to plate separation.
Mid-ocean ridges can be linked by plate tectonic boundaries and the trace of the ridges across the ocean floor appears to be the seam of a baseball. The mid-ocean ridge system can be defined as the longest mountain range on Earth, reaching about 65,000 km.
Learn more about Mid-ocean ridges, here:
https://brainly.com/question/11504396
#SPJ1
The volume of a gas is 200 mL at 330.0 kPa what will the volume be when the pressure is reduced to 45.0 kPa assuming the temperature remains constant
Answer
V2 = 1466.7 mL
Explanation
Given:
Volume 1 = 200 mL
Pressure 1 = 330.0 kPa
Pressure 2 = 45.0 kPa
Required: Volume 2
Solution:
To solve this problem we will use Boyles law
P1V1 = P2V2
V2 = P1V1/P2
V2 = (330.0 kPa x 200 mL)/45.0 kPa
V2 = 1466.7 mL
What is the osmotic pressure of a solution of FeCl3(aq) in which 69.5 g of FeCl3(s) (molar mass = 162.20 g mol-1) are dissolved in a solution with a total volume of 2.35 L at 35.0 °C?
The osmotic pressure of the solution is 25.48atm
Data;
Mass = 69.5gMolar mass = 162.20g/molVolume = 2.35LTemperature = 35.0^oCOsmotic PressureThe osmotic pressure of the solution is calculated as
\(\pi = iMRT\)
i = Vant Hoff FactorM = molarityR = gas constantT = TemperatureThe Vant hoff factor of the factor = 4
Let's calculate the molarity of the solution;
\(M = \frac{number of moles}{volume}\)
Number of moles = mass / molar mass
\(n = \frac{mass}{molar mass} \\\)
substitute the values into the formula and solve for it
\(n = \frac{69.5}{162.20} \\n = 0.428 moles\)
The molarity of the solution is calculated as
\(M = \frac{number of moles}{volume} \\M = \frac{0.428}{2.35} = 0.182 mol/L\)
The osmotic pressure of the solution is calculated as
\(\pi = iMRT\\\pi = 4 * 0.182 * 35\\\pi = 25.48 atm\)
The osmotic pressure of the solution is 25.48atm
Learn more on osmotic pressure here;
https://brainly.com/question/8195553
30 example of redox reaction
It has been hypothesized that a chemical known as BW prevents colds. To test this hypothesis, 20,000 volunteers were divided into four groups. Each volunteer took a white pill every morning for one year. The contents of the pill taken by the members of each group are shown in the chart below. What is the independent variable in this experiment? *
1. % Developing Colds
2. Number of Volunteers
3. Grams of sugar
4. Grams of BW
Grams of BW
i think thats irtu9rgirg
Independent variable in an investigation is the variable is does not depends on any other variable and on which we can have the control. Hence, the grams of BW is the independent variable here.
What is independent variables?In an experiment the parameters which changes by control or depending on other changes are called variables. There are two kinds variables namely dependant and independent variables.
The dependant variables are those variable which depends upon other variables and whose changes are studying with respect to certain parameters.
Independent variables does not depends on other variable and can be controlled by the researcher. Here, we are studying the % of developing cold with respect to the amounts of BW. The changing variable is BW amount on which the percentage of cold depends.
Therefore, the independent variable is grams of BW and dependant variable is % development of cold.
To find more on independent variables, refer here:
https://brainly.com/question/29430246
#SPJ5
The irreversible isomerization A
B was carried out in a batch reactor and the following concentration time data were obtained:
Time vs Concentration data in a Batch reactor
t 0 3 5 8 10 12 15 7.5
mol/h 4 2.89 2.25 1.45 1.0 0.65 0.25 0.07
Determine the reaction order,
, and the specific reaction a rate constant, k, using any method of your choice.
The reaction order and specific reaction rate constant can be determined by performing the kinetics experiment on irreversible polymerization A. Kinetic experiments can be used to investigate the rate and mechanism of chemical reactions. Chemical kinetics is the study of chemical reactions' speed and pathway.
The term "kinetics" refers to the study of reaction rates, which are determined by measuring the concentration of reactants and products as a function of time.Kinetics experiments can be used to determine the reaction rate and order of reaction. A chemical reaction's rate is defined as the change in the concentration of a reactant or product per unit time. The order of a reaction refers to the number of molecules that must react to produce a product. The order of reaction can be determined by measuring the initial rate of the reaction as a function of concentration.Methods for determining the reaction rate order include the initial rate method, the half-life method, and the integrated rate method. The initial rate method determines the reaction order by measuring the initial rate of the reaction at different reactant concentrations. The half-life method determines the reaction order by measuring the time it takes for the reactant concentration to decrease by half.The integrated rate method determines the reaction order by measuring the concentration of the reactant or product at different times.The specific rate constant can be determined by using the Arrhenius equation, which relates the rate constant to the activation energy, temperature, and frequency factor. The frequency factor can be determined by measuring the rate constant at different temperatures.For such more question on polymerization
https://brainly.com/question/1602388
#SPJ8
Which of the following correctly describes a mixture?
A mixture can be defined as a physical blend of two or more substances that are not chemically combined.
They retain their own properties and can be separated by physical means like filtration, distillation, evaporation, or magnetism. The various types of mixtures include homogeneous mixtures, heterogeneous mixtures, and colloids.Homogeneous mixtures, also known as solutions, are uniform mixtures where the composition is the same throughout. They are not visibly different and consist of a solute (the substance being dissolved) and a solvent (the substance doing the dissolving). For example, salt water is a homogeneous mixture because the salt is dissolved uniformly throughout the water.Heterogeneous mixtures are non-uniform mixtures that consist of two or more phases, each with its own distinct properties. They can be seen with the eye, and the different components can be separated using physical means. An example of a heterogeneous mixture is oil and water. They can be mixed together, but they will eventually separate.Colloids are mixtures where the particle size is intermediate between that of a solution and a suspension. The particles are small enough to not be visible to the eye, but they are large enough to scatter light. Milk is an example of a colloid because it appears homogeneous but is actually made up of small particles of fat and protein dispersed throughout the liquid.In conclusion, a mixture is a physical blend of two or more substances that are not chemically combined. They can be separated by physical means and consist of homogeneous mixtures, heterogeneous mixtures, and colloids.
for such more questions on substances
https://brainly.com/question/29108029
#SPJ8
Take a look at your rubbing alcohol at home. What is its main composition?
Answer:
It is a mixture of denatured alcohol, water, and agents added to make the alcohol unpalatable to drink.
10 kg of Phenanthrene is to be burnt with supplied air which is 30% less than the requirement. Find the
exit gas stream average molecular weight and the leftover Phenanthrene amount in the reactor.
The exit gas stream average molecular weight is 28.97 g/mol, and there will be 3.0 kg of leftover Phenanthrene in the reactor.
The balanced combustion equation for Phenanthrene is:
C₁₄H₁₀ + 21O₂ → 14CO₂ + 5H₂O
From the equation, we can see that 21 moles of oxygen are needed to combust 1 mole of Phenanthrene. Thus, to burn 10 kg of Phenanthrene, we need:
10,000 g / 178.24 g/mol = 56.05 moles of Phenanthreneand
21 * 56.05 = 1177.05 moles of O₂However, the supplied air is 30% less than the requirement, which means only 70% of the required O₂ will be supplied. Therefore, the actual amount of O₂ supplied will be:
1177.05 * 0.7 = 823.94 moles of O₂Assuming the air is mostly nitrogen, we can calculate the exit gas stream average molecular weight using the following formula:
Mw = (0.79 * 28.01) + (0.21 * 32) = 28.97 g/molwhere 0.79 and 0.21 are the mole fractions of nitrogen and oxygen in air, respectively, and 28.01 and 32 are the molecular weights of nitrogen and oxygen, respectively.
Finally, we can calculate the amount of leftover Phenanthrene in the reactor:
Amount of Phenanthrene consumed = 56.05 moles x 178.24 g/mol = 9999.72 gLeftover Phenanthrene = 10,000 g - 9999.72 g = 0.28 gHowever, this amount is negligible due to the large scale of the reaction. Therefore, we can round it off to:
Leftover Phenanthrene = 3.0 kg
To learn more about average molecular weight, here
https://brainly.com/question/31476705
#SPJ1
the term rhizospher is given by
Answer:
the interface between soil and plant root
Please helpppp!!!!!! It's 6th-grade thermal energy science.
Answer:
b?
Explanation:
The answer is C: Radiant energy from the sun travels through the glass, is absorbed by the black pot, and reflected by the aluminum foil.
What is the number of C atoms in 0.247 mol of C.
The number of C atoms in 0.247 mol of C is 1.48 X 10²³ .
The number of C atoms in 1 mol of C is 6.02 X 10²³, which is also called Avogadro’s number .
so, The number of C atoms in 0.247 mol of C is _
0.247x6.02x10²³= 1.48 X 10²³.
learn more about Avogadro’s number here-
https://brainly.com/question/1513182
#SPJ9
Using the following reaction, determine the theoretical yield of Acetylsalicylic acid if given 2.31 grams of salicylic acid? (reminder, salicylic acid is the limiting reagent)
The theoretical yield of Acetylsalicylic acid is found out to be: 3.01 grams.
What is limiting reagent?The limiting reagent is a substance that prevents a chemical reaction from occurring completely.
When a limiting reagent is used in a chemical reaction, the atoms, molecules, or ions of the other reactant that it (the limiting reagent) reacts with will either stay free or unreacted.
What is acid?Popular compounds called acids and bases interact with one another to create salt and water. The Latin word "acere," which meaning "sour," is where the term "acid" originates.
According to the problem, we have 2.31 grams of salicylic acid. We need to determine the theoretical yield of acetylsalicylic acid.
The molar mass of salicylic acid is 138.12 g/mol. Therefore, the number of moles of salicylic acid we have is:
n = mass / molar mass
n = 2.31 g / 138.12 g/mol
n = 0.0167 mol
According to the balanced equation, 1 mole of salicylic acid reacts with 1 mole of acetic anhydride to produce 1 mole of acetylsalicylic acid. Therefore, the number of moles of acetylsalicylic acid produced is also 0.0167 mol.
The molar mass of acetylsalicylic acid is 180.16 g/mol. Therefore, the theoretical yield of acetylsalicylic acid is:
mass = n x molar mass
mass = 0.0167 mol x 180.16 g/mol
mass = 3.01 g
Therefore, the theoretical yield of acetylsalicylic acid is 3.01 grams.
To know more about reagent visit:
https://brainly.com/question/31228572
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Helpppp me pleaseeee now I’ve been struggling so bad w this
Answer:
I don't know what the passage says, but I feel like the most logical conclusion is D or the last one.
Explanation:
Answer:
D! Hope this helps! Figured id help with all of ur questions!
Explanation:
Im a wiz at science! ;)
What does the presence of a polar covalent bond show about the electronegativity of its two atoms
Answer:
The electronegative of two atoms are not equal.
Explanation:
what is ammonium nitrate
Answer:
Ammonium nitrate is a chemical compound with the chemical formula NH₄NO₃. It is a white crystalline solid consisting of ions of ammonium and nitrate.
Gaseous ammonia chemically reacts with oxygen O2 gas to produce nitrogen monoxide gas and water vapor. Calculate the moles of water produced by the reaction of of oxygen. Be sure your answer has a unit symbol, if necessary, and round it to the correct number of significant digits.
The moles of water produced by the reaction of of oxygen is 12 moles \(H_2O\).
The balanced chemical equation for the reaction is:
\(4NH_3(g)+5O_2(g)\) →\(4 NO(g) + 6 H_2O(g)\)
This equation shows that for every 5 moles of\(O_2\) that react, 6 moles of H2O are produced. Therefore, we can use stoichiometry to calculate the moles of water produced by the reaction of a certain amount of\(O_2\) .
Hence Gaseous ammonia chemically reacts with oxygen \(O_2\) gas to produce nitrogen monoxide gas and water vapor
Let's assume that we have 10 moles of \(O_2\). According to the balanced equation, this amount of \(O_2\) will produce:
(6 moles \(H_2O\) / 5 moles \(O_2\)) x 10 moles \(O_2\) = 12 moles \(H_2O\)
Therefore, 10 moles of \(O_2\) will produce 12 moles of\(H_2O\). The answer is 12 moles \(H_2O\).
Know more about moles here:
https://brainly.com/question/29367909
#SPJ11
Co-60 is used medically for radiation therapy as implants and as an external source of radiation exposure. The half-life of
Co-60 is 5, 272 years. How much of a 2.000 mg sample will remain after 21, 088 years? You must show your work to receive
credit.
. Show the equation needed
b. Show a picture of you solving for the unknown.
c. Show the final answer
Co-60 is used medically for radiation therapy as implants and as an external source of radiation exposure the half-life of Co-60 is 5, 272 years 2.000 mg sample will remain after 21, 088 years is 0.0625 gm left
Radiation therapy is the cancer treatment that uses high doses of radiation to kill cancer cell and shrink tumor
Here given data is Co-60 is 5, 272 years and we have to find the number of half lives in 21, 088 years = ?
21, 088/5, 272 = 4 half lives
(1/2)⁵ = 1/32 nd of the original will be left
1/32×2.000mg = 0.0625 gm left
Know more about half life
https://brainly.com/question/9963723
#SPJ1
A gas company in Massachusetts charges $1.30 for 17.0ft³ of natural gas. Convert this rate to dollars
per liter of gas.
Answer:
See below
Explanation:
Conversion factor : 1 ft^3 = 28 .317 liters
$ 1.30 /( 17 ft^3 * 28.317 liters/ft^3) = $.0027 per liter
Name the following lonic Compounds using the lonic naming rules. Remember, place the metal's name
first, followed by the non-metal element, replacing the ending with "-ide"
1.Caci,
2.LIBr
I
3. Bes
4. LIF
5. K Se
6. Sr,P2
7. Baci
8. Feo
9. Fe,
10. CUN
11. Cun,
Please help meeee
How many particles are present in0.24moles of carbon?
Answer:
1.45 x 10²³ particles
Explanation:
Given parameters:
Number of moles of carbon = 0.24moles
Unknown:
Number of particles = ?
Solution:
A mole of a substance contains the Avogadro's number of particles.
The Avogadro's number of particles is 6.02 x 10²³
So;
0.24 moles of carbon will contain 0.24 x 6.02 x 10²³ = 1.45 x 10²³ particles
Consider the reaction of solid aluminum iodide and potassium metal to form solid potassium iodide and aluminum metal.
Write the balanced chemical equation for the reaction.
The balanced chemical equation is AlI₃(s) + 3 K(s) → 3 KI(s) + Al(s). The number of moles of aluminium will be 2.437moles.
What is chemical equation ?Chemical equations are symbols and chemical formulas that depict a chemical reaction symbolically.The reactive species and end product are described by the chemical equation. The mole ratio or molecular ratio of the constituent components or compounds in the reaction is revealed by the coefficient of the reacting species and the products that are produced.Reactants are the substance(s) in a chemical equation to the left of the arrow. A component that is present at the outset of a chemical reaction is known as a reactant. Products are the substance(s) to the right of the arrow. A substance that remains after a chemical reaction is complete is known as a product.To learn more about chemical equation refer :
https://brainly.com/question/26227625
#SPJ1
What is the mass of sulphate ions 96.06 in 25.0ml of a 0.125 solution
Answer:
12.34
Explanation:
because this is how we do this
which describes bedrock?
a. consist of a solid rock
b.lies directly above the soil layer
c, does not contain weathered rock
d. forms from decomposed material
What needs to be done to fight climate change?
1. Eliminate Food Waste
Food waste in the US occurs mostly in stores and at home—either because it spoils on the store shelf or before we can eat it. According to an NRDC study, Americans throw away up to 40 percent of the food they buy. We can combat food waste by shopping for what you need, eating leftovers, composting scraps, and donating excess to food banks. You can find a local food bank at FeedingAmerica.org. Project Drawdown estimates that curbing food waste could avoid a whopping 70.5 gigatons of CO2—that’s a bigger impact than restoring 435 million acres of tropical forest.
2. Eat Plant-Based
Transitioning to a vegetarian diet can cut your carbon footprint in half, and going vegan, even lower. Even shifting from high to low meat consumption can shrink your footprint by a third, according to a University of Oxford study. If half of the world’s population reduced meat consumption and avoided the associated deforestation caused by agriculture, we could reduce carbon emissions by 66 gigatons.
3. Use Clean Energy
Renewable energy is fundamental to powering the world as we move away from fossil fuels. Modeled after World War II “war bonds,” Clean Energy Victory Bonds—a bill introduced to Congress by Sen. Udall (D-NM), Reps. Lofgren (D-CA), and Reps. Matsui (D-CA)—would offer Treasury bonds as low as $25 to finance the government’s clean energy programs. Ask your representatives to support this bill to make Clean Energy Victory Bonds a reality. Additionally, you can purchase renewable energy from installers such as Blue Pacific Solar and RGS Energy, as well as plug into renewable utilities with Clean Choice Energy and Arcadia Power, which don’t require you to install any new hardware in your home to get sun- and wind-power.
4. Participate in the Democratic Process
Climate change has implications on local, national, and global levels. While the average person isn’t responsible for governing a nation, we are responsible for deciding who does. Vote for a climate activist, support comprehensive climate policies, and use your citizen voice to contact legislators when you disagree. The results of upcoming elections will determine how Americans and their elected leaders grapple with catastrophic climate change.
5. Divest
The largest source of greenhouse gas emissions come from fossil fuels. Divesting means taking your money out of institutions that fund fossil fuel expansion, which could eventually dry up funding to those projects. So far, the fossil fuel divestment movement has removed $9.94 trillion dollars from fossil fuel companies because of institutional divestments and $5.2 billion thanks to 58,000 individual divestments. You can build a fossil-free portfolio with our nationwide network of socially-responsible investing financial advisors which you can find on GreenPages.org and by encouraging your faith organization or alma mater to divest.
6. Improve Insulation
One of the most cost-effective and accessible tactics to combating the climate crisis is better insulation. Older homes can lose up to 35 percent of heat through their walls. Modern insulation reduces the energy needed to heat a home, therefore reducing emissions and saving you money. If even half of existing buildings installed thicker insulation, 8.3 gigatons of emissions could be avoided—that’s more than overhauling efficiency for the entire international shipping industry.
8. Rethink Transportation
Overhauling the world’s transportation systems, both commercial and personal, would save as much CO2 as one billion acres of regenerative agriculture. Commercial trucks alone account for six percent of the world’s emissions—more than the collective emissions of airplanes around the globe. While individuals can’t revolutionize the shipping, flight, and automobile industries overnight, we can demand they change by voting with our dollars for public transit, using electric or hybrid vehicles, and reducing our total trips taken.
9. Recycle
Acquiring virgin resources—from logging trees to mining minerals—exploits more resources than recycling existing materials. For example, recycled aluminum products use 95 percent less energy than creating new ones. About 50 percent of recycled materials come from households; if that number were to increase to 65 percent, at-home recycling could prevent 2.8 gigatons of carbon emissions. However, recycling wrong can slow the system and create more waste, so be sure to rinse out your recyclables and stay up to date on local regulations to make sure what you recycle isn’t causing contamination.
Consider the structure of chloride ion. Draw the conjugate acid for chloride ion. Remember to include charges and non-bonding electrons where necessary. Select Draw Rings More Erase H CI C17
The chloride ion (Cl-) has a single negative charge and a full octet of electrons in its outermost shell. It has a tetrahedral shape, with three equatorial lone pairs and one axial bond to a hydrogen or other positively charged ion.
The conjugate acid of chloride ion is HCl (hydrogen chloride), which is formed when the chloride ion accepts a proton (H+) from an acid. The resulting molecule has a positive charge and a linear shape, with a single bond between the hydrogen and chlorine atoms.
The conjugate acid of chloride ion, HCl, is a strong acid that readily donates a proton (H+) to a base to form the chloride ion. In water, HCl dissociates completely to form H+ and Cl- ions. The hydrogen ion (H+) has a positive charge and no electrons, while the chloride ion (Cl-) retains its original tetrahedral shape and three lone pairs of electrons.
Learn more about electrons here :
https://brainly.com/question/1255220
#SPJ4
Which of the following do all food chains in an ecosystem depend on?
A.
consumers
B.
competition
C.
decomposers
D.
producers
What if you measured 15cc of liquid elemental mercury, how much would that weigh in pounds
Answer:
0.447 pounds
Explanation:
The density of Mercury in grams/mL is 13.55 - I multiplied that by the volume and got approximately 203.25 grams, I then turned it into Kilograms and multiplied by 2.2 lbs / kg.