What is the molality of 6 grams of salt in 10 grams of solution?

Answers

Answer 1

Answer:

maalat ang salt

Explanation:


Related Questions

How many moles are in 59.6 grams of BaSO4​

Answers

Answer:

0.2553669915026199 BaSO4

Explanation:

hi, give brainliest?

Based on a Kc value of 0.250 and the given data table, what are the equilibrium concentrations of XY, X, and Y , respectively?

Answers

From the solution that we have in the question;

The concentration of X and Y is 0.28 MThe concentration of XY is  0.32 MWhat is the equilibrium constant?

The equilibrium constant, denoted as K, is a value that quantitatively represents the ratio of the concentrations of products to reactants at equilibrium in a chemical reaction.

It is a fundamental concept in chemical equilibrium.

The value of the equilibrium constant provides valuable information about the position of equilibrium and the relative concentrations of species involved in a chemical reaction.

Kc = [X] [Y]/[XY]

0.25=(0.1+x)2/(0.5x)

0.25(0.5x)=(0.1+x)2

0.1250.25x=0.01+0.2x+x2x2+0.45x0.115=0

x = 0.18 M

The equilibrium amount of X and Y=  0.28 M and the equilibrium concentration of XY = 0.32 M

Learn more about equilibrium constant:

https://brainly.com/question/29253884

#SPJ1

Based on the answer to the question that we have;

A 0.28 M concentration of X and Y exists at equilibriumXY's concentration at equilibrium is 0.32 M.

The equilibrium constant

The ratio of the product to reactant concentrations in a chemical reaction at equilibrium is represented quantitatively by the equilibrium constant, abbreviated as K.

It is a cornerstone of the theory of chemical equilibrium.

A chemical reaction's equilibrium position and the relative concentrations of the species involved can both be learned from the equilibrium constant's value.

Kc = [X][Y]/[XY]

0.25=(0.1+x)2/(0.5x)0.25(0.5x)=(0.1+x)20.1250.25x=0.01+0.2x+x2=0.18M

The equilibrium concentration of;

XY =0.5 - 0.18

=0.32 M

Then the equilibrium amount of

X and Y is

0.1 + 0.18= 0.28 M.

Learn more about equilibrium:brainly.com/question/29253884

#SPJ1

Based on a Kc value of 0.250 and the given data table, what are the equilibrium concentrations of XY,

61. Given the following information:

Ag2 CrO4(s)=2Agt (aq) + CrO4²- (aq)
Ag+ (aq) + e- Ag(s)
find the standard reduction potential at 25°C for the half-reaction
Ksp = 1 × 10-12
E = +0.799 V
Ag2 CrO4(s) + 2e¯ 2Ag(s) + CrO4²- (aq)​

Answers

Q = Ksp = 1 × 10^(-12).

Substituting the values into the Nernst equation, we have:

0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))

Now, solving for E°:

E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))

The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.

To find the standard reduction potential at 25°C for the half-reaction Ag2CrO4(s) + 2e¯ → 2Ag(s) + CrO4²-(aq), we can use the Nernst equation, which relates the standard reduction potential (E°) to the equilibrium constant (K) and the reaction quotient (Q).

The Nernst equation is given as follows:

E = E° - (RT/nF) * ln(Q)

Given information:

Ksp = 1 × 10^(-12)

E = +0.799 V (standard reduction potential of Ag+ to Ag)

Since the reaction involves the dissolution of Ag2CrO4(s), the reaction quotient Q can be expressed as [Ag+]²/[CrO4²-].

Since the stoichiometry of the reaction is 2:1 for Ag2CrO4 to Ag+, we can say that [Ag+]² = Ksp.

Therefore, Q = Ksp = 1 × 10^(-12).

Substituting the values into the Nernst equation, we have:

0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))

Now, solving for E°:

E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))

The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.

Please note that without specific values for temperature (T) and the ideal gas constant (R), the exact standard reduction potential at 25°C cannot be determined.

For more question on temperature

https://brainly.com/question/4735135

#SPJ8

when molecules colide is the explosion instant or is there a delay if so why is there a delay

Answers

When molecules collide, there is generally a delay before an explosion occurs, if an explosion occurs at all. This is because an explosion requires a chemical reaction to take place, which involves the breaking of chemical bonds and the formation of new bonds. These reactions require a certain amount of energy, which is called the activation energy.

The collision of molecules can provide energy to the system, but it is not always enough to overcome the activation energy needed for a chemical reaction to occur. If the energy of the collision is less than the activation energy, no reaction will occur and there will be no explosion. If the energy of the collision is equal to or greater than the activation energy, a chemical reaction may occur and an explosion may result.

The time delay between the collision of molecules and an explosion occurring depends on the nature of the molecules and the conditions under which the collision occurs. Some chemical reactions are very fast and can occur almost instantly, while others may take longer to reach the activation energy and proceed to completion.

It's worth noting that not all collisions between molecules result in an explosion. In many cases, the collision may simply transfer energy from one molecule to another without leading to a chemical reaction.

When gaseous hydrogen sulfide and carbon dioxide interact, water vapor and carbon disulfide CS₂ (g) are formed.
Write the thermochemical equation for this reaction by calculating its thermal effect.

Answers

The thermochemical equation for this reaction by calculating its thermal effect is H₂S +CO₂ = CS₂ + water vapor.

What is a thermochemical reaction?

Thermochemical equations are balanced chemical equations that contain all reactants and products' physical states as well as the energy change. The reaction is endothermic when energy is a reactant, but exothermic when energy is a product.

A thermochemical equation is a stoichiometric chemical equation with a balanced enthalpy change, H. A thermochemical equation in variable form would look like this: A + BC.

Therefore, the thermochemical reaction is H₂S +CO₂ = CS₂ + water vapor.

To learn more about thermochemical reactions, refer to the link:

https://brainly.com/question/2874342

#SPJ1

When energy is converted from one form to another in a chemical or physical change, which of the following also changes by a measureable amount?a. The total mass in the system b. The force of gravity c. The total energy d. None of the above

Answers

The correct answer is d. None of the above, as the total mass and force of gravity do not change, while the total energy does change during energy conversions.

When energy is converted from one form to another in a chemical or physical change, the total mass in the system does not change. According to the law of conservation of mass, mass is neither created nor destroyed during a chemical or physical process. Therefore, the total mass in the system remains constant. Similarly, the force of gravity does not change during energy conversion. Gravity is a fundamental force that acts on objects with mass and is independent of the energy transformations occurring in the system. The force of gravity is determined by the masses of the objects involved and their distance from each other, but it is not influenced by energy conversions. The total energy in the system does change during energy conversions. Energy can be transferred or transformed from one form to another, but the total energy within a closed system is conserved according to the law of conservation of energy. The amount and type of energy may vary, but the total energy content remains constant. Therefore, the correct answer is d. None of the above, as the total mass and force of gravity do not change, while the total energy does change during energy conversions.

for more questions on energy
https://brainly.com/question/29339318
#SPJ8

Using the Cell Size and Scale Interactive, tell me which of the following is correct. They are in order of size, left to right, from smallest to largest:

tRNA > influenza virus > E. coli bacterium
Hepatitis virus > hemoglobin > phospholipid
Ribosome > amoeba proteus > carbon atom

Answers

Using the cell size and scale Interactive, the correct order of size, left to right, from smallest to largest is tRNA > influenza virus > E. coli bacterium Hepatitis virus > hemoglobin > phospholipid. The correct option is a.

What is t-RNA?

t-RNA is transfer RNA. It helps in transferring information from RNA to DNA or DNA to RNA.

t-RNA is present in viruses, so it will be smaller than the virus because they are present inside the virus. Phospholipids are chains of lipids. They are macromolecules.

Therefore, the correct option is a. tRNA > influenza virus > E. coli bacterium Hepatitis virus > hemoglobin > phospholipid.

To learn more about Cell Size and Scale Interactive, refer to the link:

https://brainly.com/question/917170

#SPJ1

Consider the following compound: Hg3(PO4)2What is the percent composition by mass for each element?

Answers

Answer

H = 76.10%

P = 7.82%

O = 16.16%

Procedure

Considering the compound Hg₃(PO₄)₂

To calculate the percent composition by mass of each element first you need to calculate the total mass of the compound using the molecular weights.

Data from the periodic table

Hg= 200.59 g/mole

P = 30.97 g/mole

O =15.99 g/mole

Molecular weight per type of atom in one molecule

Hg= 200.59 g x 3 = 601.77 g

P = 30.97 g x 2 = 61.94 g

O =15.99 g x 8 = 127.92 g

Total mass = 601.77 + 61.94 + 127.92 = 791.63

Percent masses

Hg=601.77791.63 ×100%=76.01%P=61.94791.63 ×100%=7.82%O=127.92791.63 ×100%=16.16%

h

For the reaction C + 2H2 - CH4
how many grams of carbon are required to produce 10.7 moles of methane, CH4?

Use the following molar masses:
hydrogen: 1
carbon: 12

Answers

Taking into account the reaction stoichiometry, 128.4 grams of C are required to produce 10.7 moles of methane.

Reaction stoichiometry

In first place, the balanced reaction is:

C + 2 H₂ → CH₄

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

C: 1 moleH₂: 2 molesCH₄: 1 mole

The molar mass of the compounds is:

C: 12 g/moleH₂: 2 g/moleCH₄: 16 g/mole

Then, by reaction stoichiometry, the following mass quantities of each compound participate in the reaction:

C: 1 mole ×12 g/mole= 12 gramsH₂: 2 moles ×2 g/mole= 4 gramsCH₄: 1 mole ×16 g/mole= 16 grams

Mass of C required

The following rule of three can be applied: If by reaction stoichiometry 1 mole of CH₄ is produced by 12 grams of C, 10.7 moles of CH₄ are produced by how much mass of C?

mass of C= (10.7 moles of CH₄×12 grams of C)÷1 mole of CH₄

mass of C= 128.4 grams

Finally, 128.4 grams of C are required.

Learn more about the reaction stoichiometry:

brainly.com/question/24741074

#SPJ1

Not sure if my answers are even correct. i am so confused

Not sure if my answers are even correct. i am so confused

Answers

Answer:

#3 is the percentage for sodium i believe and 4 is right

Explanation:

2Al + 3CuCl2 = 2AlCl3 + 3Cu (copper (ii) chloride + aluminum = aluminum chloride + copper) Examine your balanced equation. So if you had 0.26 moles of Aluminum foil, then how many exact moles of copper (II) chloride would be needed for stoichiometry

Answers

Answer: .39 Moles would be needed.

Explanation: The mole-to-mole ratio of Copper (ll) chloride to Al is 3/2. We can tell by looking at the coefficients of the reactants. Al has a coefficient of 2 and CuCl2 has a coefficient of 3. The ratio of CuCl2 to Al is 3:2 or 3/2. We multiply this ratio by the number of moles of Al which .26 to find how much we need of CuCl2. Now figure out how many moles of AlCl3 you would produce from .26 moles of Al.

A soft drink contains 33g of sugar in 349g of H2O. What is the concentration of sugar in the soft drink in mass percent?

.

Answers

A soft drink contains 33g of sugar in 349g of H2O. 14.3%  is the concentration of sugar in the soft drink in mass percent.

One approach to indicate the concentration of any dissolved component in a solution is by mass percentage. Mass percentage is the ratio of the total weight of a compound in a solution to the overall mass of the solution, expressed in percentages.

In order to express the mass percent of a solution, the grammes of solute are divided by the grammes of solution, and the result is multiplied by 100. As long as you use a comparable number for both the component and solute mass.

Mass percent = (mass of solute/mass of solute+ mass of solvent)×100

                      = ( 33/ 33+ 349)×100

                       =14.3%

To know more about concentration, here:

https://brainly.com/question/10725862

#SPJ1

the number of particles in a mole if substance

A.avografo number

b.molar volume

c.molar mass

d.molar ratio

Answers

its avagadro number
represented by Na
6.02*10^23

During a UV-Visible spectroscopy experiment, a student notes a wavelength peak measurement at 280 nm. What region of the electromagnetic spectrum was this peak observed?

Answers

If during a spectroscopy experiment a student notes a wavelength peak measurement at 280 nm, then the region of the electromagnetic spectrum observed is the UV region.

What is the electromagnetic spectrum?

The electromagnetic spectrum refers to all types of wavelengths that radiation can emit as light, which involves both visible light and also ultraviolet (UV) radiation.

In conclusion, if during a spectroscopy experiment a student notes a wavelength peak measurement at 280 nm, the region of the electromagnetic spectrum observed is the UV region.

Learn more about the electromagnetic spectrum here:

https://brainly.com/question/23423065

#SPJ1

C6H12O6 + 602 → 6CO2 + 6H₂O
The most efficient ratio is
1 C6H12O6 6 02.
Which set of reactants will be the most
efficient (least wasteful of materials) for
the reaction?
A. 1.0 mol C6H12O6 and 3.0 mol O₂
B. 1.5 mol C6H₁2O6 and 3.0 mol O₂
C. 3.0 mol C6H₁2O6 and 6.0 mol O₂
D. 0.5 mol C6H₁2O6 and 3.0 mol O₂

Answers

Answer:

D

Explanation:

The ratio of C6H12O6 (which will be referred to as "the carb") to oxygen is 1 to 6, so if we find an answer which has the same ratio, it should be chosen. A is 1:3
B is even worse with a ratio of the carb to oxygen of 1:2
C is the same as B, 1:2
D has a ratio of the carb to oxygen of 1:6, which is what we are looking for.

PLEASE ANSWER QUICKLY!!!!

2KI (aq) + Cl₂(g) → 2KCl(aq) + 1₂(g)
What volume of 12 gas forms when
21 L Cl2 react at STP?
[?] L 12

PLEASE ANSWER QUICKLY!!!!2KI (aq) + Cl(g) 2KCl(aq) + 1(g)What volume of 12 gas forms when21 L Cl2 react

Answers

The volume of 12 gas forms when 21 L Cl2 react at STP is 21 L.

To determine the volume of 12 gas (I assume you mean I2 gas) formed when 21 L of Cl2 reacts at STP (standard temperature and pressure), we need to use the ideal gas law equation.

The ideal gas law equation is given by:

PV = nRT

Where:

P = pressure

V = volume

n = number of moles

R = ideal gas constant

T = temperature

At STP, the pressure is 1 atm, and the temperature is 273.15 K.

From the balanced equation, we can see that the molar ratio between Cl2 and I2 is 1:1. So, if 21 L of Cl2 reacts, it will produce an equal volume of I2 gas.

Given that the volume of Cl2 is 21 L, we can assume the volume of I2 gas formed will also be 21 L.

Therefore, the volume of I2 gas formed is 21 L.

For more such questions on volume

https://brainly.com/question/1749900

#SPJ8

2. What happens to the pH when you add more H+ ions to a solution that has no buffers?

Answers

It will go over the amount it needs to.

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

Number of molecules in 4HCI

Answers

Answer:

4 Molecules

Explanation:

Because the coefficient is 4.

Help please....it is due today...​

Help please....it is due today...

Answers

Solid, liquid, and gas in that order

i need help asap <3

i need help asap &lt;3

Answers

Answer:

...........................

Rocks melt at what temperature range? a. 50 to 100 degrees Celsius b. 130 to 200 degrees Celsius c. 220 to 500 degrees Celsius d. 600 to 1,300 degrees Celsius

Answers

600 and 1,300 degrees Celsius

In pretty sure

what challenges do the three industries have in making better batteries

Answers

Answer:

1. Materials: One of the biggest challenges in making better batteries is finding the right materials that can store more energy and last longer. The materials need to be efficient in terms of energy density, cost, and environmental impact.

2. Manufacturing: The production of batteries is a complex and expensive process that requires specialized knowledge and equipment. Scaling up production can be a challenge, and the cost of manufacturing high-quality batteries is still relatively high.

3. Safety: The safety of batteries is a major concern. The risk of fire or explosion is always present, particularly with lithium-ion batteries. Improvements in battery safety are needed to reduce the risk of accidents and increase confidence in battery technology.

4. Environmental impact: The production and disposal of batteries can have a significant environmental impact. The mining of metals and other materials used in batteries can have negative environmental consequences, and the disposal of used batteries can lead to pollution.

5. Performance: The performance of batteries can be affected by temperature, humidity, and other environmental factors. Improving battery performance in extreme conditions and increasing their durability is a priority for the industry.

Is vinegar a lactic acid?

Answers

Answer-No, vinegar is not a lactic acid.

When iron(lII) oxide is heated with whom the products are iron metal and carbon monoxide. Balance the equation in standard form and determine the sum of the coefficients

When iron(lII) oxide is heated with whom the products are iron metal and carbon monoxide. Balance the

Answers

Answer:

Explanation:

We have iron (iii) oxide been heated in furnaces (where carbon monoxide is the prevalent carbon oxide) to produce carbon dioxide and solid iron

We can write the reaction scheme as follows:

Fe2O3 + 3CO 2Fe+3CO2

The above is the balanced chemical reaction

Now, we want to sum up the coefficients (these are the numbers before each of the chemical entities in the reaction. For example iron is an entity on its own here)

By doing this, we have 1 +3 + 2 + 3 = 9

The sum of the coefficients is 9

How many grams of Br are in 25 g CaBr2

Answers

The Br are in 25 g CaBr2 will be approximately 203.87 g of Br.

What is molar mass?

The molar mass of an element's atoms is calculated by multiplying the element's comparative atomic mass by the molar mass constant.

In the given scenario, we need to find the grams of Br in CaBr2.

We know that,

molar mass of Br = 79.904 g/mol

molar mass of CaBr2 = 199.886 g/mol

CaBr2 = 2 Br + Ca

So, by the given data,

199.886 g = 2 x 79.904 g

255 g = X ( i.e., mass of Br )

X = 255 x 2 x 79.904 / 199.886

X = 203.87 g of Br

Thus, the amount of Br is 203.87gm.

For more details regarding molar mass, visit:

https://brainly.com/question/12127540

#SPJ1

A type of cognitive bias where people typically view the world as having justice, which results in good people being rewarded and bad people being punished, is known as __________.
A.
just-world phenomenon
B.
in-group bias
C.
social equalities
D.
social inequalities

Answers

Answer: a

Explanation: correct on ed

Answer:

A.

just-world phenomenon

Explanation:

A type of cognitive bias where people typically view the world as having justice, which results in good

7. What are the coefficients that will balance the skeleton equation below?
N₂ + H₂ → NH3
a.1,1,2
b.3,1,3,1
c.1,1,1,3
d.1,3,3,1


When the equation Fe + Cl₂ → FeCl, is balanced, what is the coefficient

Answers

Answer:

N₂ + 3H₂ → 2NH3

4Fe + 2Cl₂ → 4FeCl

Explanation:

This equations are now balanced

pls rate as brainliest

Which has more calories: table sugar or aspartame?

Answers

Hello there!

Aspartame has 4 kilocalories of energy per gram and table sugar has 3.9 kilocalories. They are pretty much same but aspartame is 200 times sweeter than sucrose so probably would be aspartame that has more calories.

What type of heat transfer drives plate tectonics?

Answers

Answer:

Convection, or the flow of mantle material transporting heat, drives plate tectonics.

Explanation:

Have a nice day !!! :)

Other Questions
tcp has a nominal 20 byte header for all pdus. some protocols have a separate type of pdu that carry no data for sending acknowledgments and flow control. imagine that a new version of tcp utilized these seperate acknowledgment and flow control pdus. how many bytes could be removed from the existing tcp header for the standard tcp pdu? Which was a Sumerian religious practice?The people of Sumer were polytheistic.The gods existed to serve the people of Sumer.The gods were seen as unimportant in daily life.Merchants attended church weekly to please the gods. Which statement best describes one effect the Great Depression had on Black Americans? A. Black workers were paid a higher wage than other workers. B. White people demanded Black workers be fired so they could get jobs. C. White employers were more likely to hire Black workers. D. Black workers were forced to leave the country. How does migration result in cultural diffusion? Identify the type of logical fallacy used in the following sentence:Everyone is going to see the new Avengers movie because it's the most popular movie out right now.A. hasty generalizationB. circular reasoning C. Red herring D. non sequitur A marble rolled down an inclined ramp with an acceleration of 0.500 m/s for 7.00 seconds will travel meters from the point where it was released, A.12.3 B.24.5 C.1.80 D.None of the above he shouted to give himself the necessary push away from this last house window, and the fascinating seance going on in there. is what type of figurative language What are the 12 common themes?. The realization that your mother has the same appearance and does not shrink as you watch her walk away from you (even though she appears to get smaller) means that you understand ______ constancy. a 45 yearr old male patient is supected to have meningitis. the patient is scheduled for a lumbar puncture in the am which action should the nurse to prevent complications after test what is the percent yield when a reaction vessel that initially contains 61.5 kg ch4 and excess steam yields 13.0 kg h2 State legislatures define offenses and set punishments for their states and authorize local governing bodies to enact ____________ defining minor offenses and setting penalties.Ordinancesimpliedstare decisis Find the slope of all four lines. Rise over run. Please help. Which of the following best explains why the Aztecs were so warlike? who are the primary stakeholders in this problem? harold mills, vice president of human resources as the most senior human resources officer at the hospital, he makes sure hiring, firing, and disciplinary decisions are made fairly. dr. emerson rogers, chief of staff he is responsible for everything that goes on in the organization and often liable for ethical mistakes. christine reeve, privacy officer her job is to ensure that systems and protocols protect confidential patient information. Which sentence contains a list that is punctuated correctly? A My favorite foods include tamales- chicken and beef chimichangas. B One day, I hope to own a car, a house, and a boat. C The farm we visited grew vegetables, fresh herbs, and flowers. D For the camping trip, we packed a water bottle a nylon tent, and a fishing pole. 8thgrade 9^2 plus 3^2 a nurse is planning care for a client who is receiving continuous enteral tube feedings through an open system, which of the interventions should the nurse include in the plan of care? FILL IN THE BLANK. Escherichia coli and Streptococcus faecalis are two types of ______ that make up part of the municipal water pollution produced by humans. Which of the following technologies uses variable-length packets, adds labels to packets as they enter the WAN cloud, and uses the labels to switch packets and prioritize traffic?A. ISDNB. ATMC. MPLSD. Frame relayE. SONET