Base is a proton acceptor, whereas acid is a proton giver.
Strong acid and strong base depend upon ionization.
Acid is a hydrogen ion donor and base is a hydrogen ion acceptor.When an acid is dissolved in water, all of its molecules disintegrate, making the acid powerful. When an acid is dissolved in water, only a small number of its molecules disintegrate, making the acid weak.A strong acid is an acid in which all of the acid is dissolved in water, its molecules disintegrate.A weak acid is an acid in which only a few molecules break apart when the acid is dissolved in water.Mineral acids are inorganic compounds consisting of different chemical element combinations, whereas organic acids are organic molecules mostly composed of carbon and hydrogen atoms. This is the main difference between mineral acids and organic acids.Mineral acids are inorganic compounds consisting of different chemical element combinations, The acid for which pH is close to 7 is a neutral acid.To learn more about acids visit:
https://brainly.com/question/11543614
#SPJ9
What is sound? it is a form of energy produced by ____________.
A. conduction C. convection
B. radiation D. vibration
Answer:
D
Explanation:
sound is produced when the matter vibrates
Answer:
D
Explanation:
the sound that is made is basically energy. This energy we call it vibration
Identify all of the ions that are
formed when H3PO4 ionizes in water
Answer:
H3PO4 + H2O (Phosphoric acid + Water)
Explanation:hope its help
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Calculate the standard entropy of reaction at 298 K for the reaction Hg(liq) + Cl2(g) → HgCl2(s) The standard molar entropies of the species at that temperature are: Sºm (Hg,liq) = 76.02 J / (K mol) ; Sºm (Cl2,g) = 223.07 J / (K mol) ; Sºm (HgCl2,s) = 146.0 J / (K mol)
Answer:
−153.1 J / (K mol)
Explanation:
Calculate the standard entropy of reaction at 298 K for the reaction Hg(liq) + Cl2(g) → HgCl2(s) The standard molar entropies of the species at that temperature are: Sºm (Hg,liq) = 76.02 J / (K mol) ; Sºm (Cl2,g) = 223.07 J / (K mol) ; Sºm (HgCl2,s) = 146.0 J / (K mol)
Hg(liq) + Cl2(g) → HgCl2(s)
Given that;
The standard molar entropies of the species at that temperature are:
Sºm (Hg,liq) = 76.02 J / (K mol) ;
Sºm (Cl2,g) = 223.07 J / (K mol) ;
Sºm (HgCl2,s) = 146.0 J / (K mol)
The standard molar entropies of reaction = Sºm[products] - Sºm [ reactants]
= 146.0 J / (K mol) – [76.02 J / (K mol) +223.07 J / (K mol) ]
= -153.09 J / (K mol)
= or -153.1 J / (K mol)
Hence the answer is −153.1 J / (K mol)
If 22.5 L of nitrogen at 90 Kpa are compressed to 40 Kpa at a constant temperature. What is the new volume?
Answer:
51 L
Explanation:
Step 1: Given data
Initial volume of nitrogen (V₁): 22.5 LInitial pressure of nitrogen (P₁): 90 kPaFinal volume of nitrogen (V₂): ?Final pressure of nitrogen (P₂): 40 kPaStep 2: Calculate the final volume of nitrogen
The volume of a gas is inversely proportional to the pressure. If we consider nitrogen as an ideal gas at a constant temperature, we can find the final volume using Boyle's law.
P₁ × V₁ = P₂ × V₂
V₂ = P₁ × V₁ / P₂
V₂ = 90 kPa × 22.5 L / 40 kPa
V₂ = 51 L
Use Hess’s Law to calculate the enthalpy change for the reaction.
C2H4(g) + H2(g) → C2H6(g) ∆Hrxn = ?
Given:
C2H4(g) + 3O2(g) → 2CO2(g) + 2H2O(l) ∆Hrxn 1 = -1410.9kJ
2C2H6(g) + 7O2(g) → 4CO2(g) + 6H2O(l) ∆Hrxn 2 = -3119.4kJ
2H2(g) + O2(g) → 2H2O(l) ∆Hrxn 3 = -571.6kJ
Answer:
∆Hrxn 1 + ∆Hrxn 3 - ∆Hrxn 2 = ?
-1410.9kJ - 571.6kJ + 3119.4kJ = ?
-2801.1kJ
Which statement about pure substances and molecules is correct?
O All pure substances are molecules.
O All molecules are pure substances.
o Molecules cannot be pure substances.
O Pure substances cannot be molecules.
A molecule must be a pure substance hence the correct answer is " All molecules are pure substances."
A pure substance is one which contains only one element or compound. A molecule is the smallest unit of a compound that can exist independently.
When we refer to a molecule of a compound, we are referring to that pure substance that contains only the element(s) that compose the compound.
Hence; All molecules are pure substances.
Learn more: https://brainly.com/question/19922822
Thermal energy is added to four identical samples of water.  what increases in each sample A. Mass B. density C. Kinetic energy
Answer:
Kinetic energy
Explanation:
Di ako sure kung Tama
An empty graduated cylinder weighs 25.489 g. When the cylinder contains 45.3 mL of an
unknown liquid,
it weighs 57.847 g. What is the mass of the unknown liquid? Show your work.
Answer:
In the given question, the mass of empty slender is given 25 points 489 Grand. The mass of Slender plus unknown liquid is given 57 points 847 g. The volume of a non liquid is given 45 three ml. We have to find the density of a non liquid. Firstly we will find the mass of unknown liquid. As the mass of unknown liquid is equal to the mass of cylinder plus unknown liquid minus the mask of empty cylinders. So the mass of a non liquid is equal to seven points 847 g -25 points 489 g. The mass of a non liquid will be 32 points 358 g. The formula to calculate the density of a non liquid is equal to the mass of a non liquid divided by the volume of a non liquid. So we will put the values as the mass of a non liquid is 32.358 g, Divided by the volume, which is given 45.3 ML. When we solve this Comes out to be 0.71 g, but I am in. So the Final answer is the density of a non liquid is equal to 0.71 g.
the characteristic property of an acid is due to the presence of what ions
hi how do i do this question? thanks in advance!
The pH of the solution made by dissolving 135 g of sulphuryl chloride in water to make 1 dm^3 of solution will be acidic.
To calculate the pH of the solution made by dissolving 135 g of sulphuryl chloride (SOCl2) in water to make 1 dm^3 of solution, we need to consider the hydrolysis reaction of sulphuryl chloride with water:
SOCl2 + 2H2O → H2SO4 + 2HCl
In this reaction, sulphuryl chloride reacts with water to form sulphuric acid (H2SO4) and hydrochloric acid (HCl).
First, we need to determine the number of moles of sulphuryl chloride in the solution. To do this, we divide the given mass of sulphuryl chloride by its molar mass:
Molar mass of SOCl2 = 32.5 g/mol + 2 × 35.5 g/mol = 118.5 g/mol
Number of moles of SOCl2 = Mass / Molar mass = 135 g / 118.5 g/mol = 1.14 mol
Since we are dissolving 1.14 mol of sulphuryl chloride in 1 dm^3 of solution, the concentration of sulphuryl chloride is 1.14 M.
Now, we can consider the hydrolysis reaction. The hydrolysis of sulphuryl chloride produces hydrochloric acid, which is a strong acid. When a strong acid is completely dissociated in water, it results in a solution with a low pH. Therefore, the pH of the solution will be acidic.
For more such questions on pH visit:
https://brainly.com/question/12609985
#SPJ8
what are animals live in land
Answer:
all animals live on land
Explanation:
Classify the substances as atomic elements, molecular elements, molecular compounds, or ionic compounds.
Answer:
compounds ok I think I can't anderstand good
As the distance between the moon and Earth increases the moon's orbital speed...
1. decreases
2. increases
3. stays the same
The increase in distance between moon and earth, the orbital speed of moon increases. As the gravitational force from earth at closer distances, the speed of orbiting decreases for moon.
What is orbital speed?Moon revolves around the earth through a fixed circular path called orbit. Moon also rotates on its own axis like earth do. The distance between moon an earth varies with revolution time.
Earth attracts every objects on or near its surface into its center of mass by gravitational force. The force exerted depends on the mass of object and distance from the ground.
As the distance from earth increases, the gravitational force experienced by moon from earth reduces and thereby, it is getting some freeness to orbits. Thus, orbital speed increase.
Find more on gravitational force:
https://brainly.com/question/24783651
#SPJ2
How does heat differ from temperature?
O Temperature is the measure of heat.
O Temperature and heat are the same thing.
O Temperature measures thermal energy, and heat is the flow of thermal eneroy
O Temperature measures the loss of energy, and heat measures the gain of eneray.
Answer: Temperature measures thermal energy, and heat is the flow of thermal energy
Explanation:
Heat describes the transfer of thermal energy between molecules within a system. Heat measures how energy moves or flows. It is measured in Joules.
Temperature measures the hotmess or coldness of a body or how much thermal energy it contains . Temperature describes the average kinetic energy of molecules within a material or system. It is measured in Celsius (°C), Kelvin(K), or Fahrenheit (°F).
Thus the correct option is Temperature measures thermal energy, and heat is the flow of thermal energy
Answer:
its c
Explanation:
edg 2021
A 25 ml solution of 0.5 M NaOH is titrated until neutralized into a 50 ml sample of HCl?
The concentration of the acid is \(0.25 M\).
Titration is a laboratory technique used to determine the concentration of a substance in a solution by reacting it with a standardized solution of known concentration.
The titration formula can be given by,
(Volume of the Base) \(\times\) (Normality of the Base) = (Volume of the Acid) \(\times\) (Normality of the Acid)
\(\Rightarrow V_1N_1=V_2N_2\)
Given, the volume of the base (\(NaOH\)), \(V_1 =25 ml\).
The concentration of the base (\(NaOH\)), \(M_1=0.5 M\).
The equivalence of the base (\(NaOH\)) is \(1\).
Hence, the normality of the base (\(NaOH\)), \(N_1=\frac{0.5}{1}N=0.5N\).
Given, the volume of the acid (\(HCl\)), \(V_2 =50 ml\).
Let us assume that the normality of the acid (\(HCl\)) \(N_2\).
Substitute the values in the given formula of titration.
\((25\times0.5)=(50 \times N_2)\\\Rightarrow 12.5=50N_2\\\Rightarrow N_2=\frac{12.5}{50} N\\\Rightarrow N_2=0.25 N\)
Hence, the normality of the acid (\(HCl\)), \(N_2=0.25 N\).
The equivalence of the acid (\(HCl\)) is \(1\).
Therefore, the concentration of the acid, \(M_1=\frac{0.25}{1}=0.25 M\).
Learn more about titration here: brainly.com/question/186765
A solution is made by dissolving 38.81 grams of nickel (II) sulfate, NiSO4, in enough water to make 0.467
liters of solution. Calculate the molarity of this solution.
The molarity of the NiSO₄ solution made by dissolving 38.81 grams of nickel (ii) sulfate, NiSO₄, in enough water to make 0.467 liters of solution is 0.535 M
How do i determine the molarity of the solution?First, we shall obtain the mole of 38.81 grams of nickel (ii) sulfate, NiSO₄. Details below:
Mass of NiSO₄ = 38.81 grams Molar mass of NiSO₄ = 154.75 g/molMole of NiSO₄ = ?Mole of NiSO₄ = mass / molar mass
= 38.81 / 154.75
= 0.25 mole
Now, we shall determine the molarity of the solution. Details below:
Mole of NiSO₄ = 0.25 moleVolume of solution = 10.467 LMolarity of solution = ?Molarity of solution = mole / volume
= 0.25 / 0.467
= 0.535 M
Thus, the molarity of the solution is 0.535 M
Learn more about molarity:
https://brainly.com/question/16073358
#SPJ1
This is my question
Answer:
\( \\ \)
refer the three attached images for the respective answers.
hope helpful ~
10. Help, question is in picture below!
The set of reactions that best represents the diagram of a precipitation reaction is given below:
Li₂SO₄ (aq) + AgNO₃ (aq) ---->
The net ionic equation is given below:
SO₄²⁺ (aq) + 2 Ag⁺ (aq) ----> Ag₂SO₄ (s) (a precipitate)
What are precipitation reactions?Precipitation reactions are reactions in which two soluble solutions when they are mixed result in the formation of an insoluble precipitate.
Precipitation reactions rea usually double replacement reactions.
Double replacement reactions also known as double displacement reactions are reactions in which an exchange of radicals occurs between two metallic cations resulting in the formation of an insoluble compound that forms the precipitate observed.
Considering the given reactions and the products obtained:
NH₄Br (aq) + Pb(C₂H₃O₂)₂ (aq) ---> forms no precipitate
KNO₃ (aq) + CuCl₂(aq) ----> forms no precipitate
Li₂SO₄ (aq) + 2 AgNO₃ (aq) ----> 2 LiNO₃ (aq) + Ag₂SO₄ (s) (forms a precipitate)
NaClO₄ (aq) + CaCl₂ (aq) ----> forms no precipitate
Learn more about double replacement reactions at: https://brainly.com/question/23918356
#SPJ1
Calculate the morality of a 35.4% (by mass) aqueous solution of phosphoric acid (H3PO4). Molar mass of H3PO4 is 98.00g/mol
Answer:
no idea with the answer pls check with otherr
Perform the following conversion: 6.1 × 103 K (the surface temperature of the Sun) to °F and °C. Pay attention to the number of significant figures in this problem. (Enter your answers in scientific notation.)
Answer:
\(\°C=5.8x10^3\°C\)
\(\°F=1.1x10^4\°F\)
Explanation:
Hello,
In this case, for the calculation of the temperature in degree Celsius we subtract 273.15 to the given temperature in kelvins:
\(\°C=6100-273.15\\\\\°C=5.8x10^3\°C\)
Next, by applying the following equation we compute it in degree Fahrenheit:
\(\°F=(5.8x10^{3}*9/5) + 32\\\\\°F=1.1x10^4\°F\)
Clearly, since the initial unit has two significant figures the computed units also show two significant figures.
Regards.
Which atom has the greatest ionization energy?
C
N
O
F
Answer:
helium
The ionization energy decreases from top to bottom in groups, and increases from left to right across a period. Thus, helium has the largest first ionization energy, while francium has one of the lowest.
Khpo4 is mono basic salt but when I write potassium phosphate mono basic then I get kh2po4
It is a salt formed from the potassium cation (K+) and the phosphate anion (H2PO4-). This salt is considered monobasic because it contains one replaceable hydrogen ion (H+).
KH2PO4 is actually potassium dihydrogen phosphate, not potassium phosphate monobasic. Potassium phosphate monobasic, or monopotassium phosphate, is correctly represented by the chemical formula KH2PO4. It is a salt formed from the potassium cation (K+) and the phosphate anion (H2PO4-). This salt is considered monobasic because it contains one replaceable hydrogen ion (H+).
On the other hand, potassium dihydrogen phosphate, or K2HPO4, is a different compound. It is formed from the potassium cation (K+) and the hydrogen phosphate anion (HPO4^2-). This compound is considered dibasic because it contains two replaceable hydrogen ions (H+).
Therefore, KH2PO4 is correctly identified as potassium phosphate monobasic, while K2HPO4 is potassium dihydrogen phosphate.
For more question on cation
https://brainly.com/question/14309645
#SPJ8
for a solution containing similar concentrations of hcn and nacn, . multiple choice if a small amount of acid is added, the hcn will neutralize it if a small amount of base is added, the ph would decrease very little if a small amount of acid is added, the ph would decrease very little if a small amount of base is added, the nacn will neutralize it if a small amount of acid is added, there would no change in ph
The pH would decrease very little if a small amount of acid is added.
What is pH value?The pH scale determines how acidic or basic water is. The range is 0 to 14, with 7 representing neutrality. Acidity is indicated by pH values below 7, whereas baseness is shown by pH values above 7. In reality, pH is a measurement of the proportion of free hydrogen and hydroxyl ions in water.
How does pH formula work?You need to know the hydronium ion concentration in moles per litre to determine the pH of an aqueous solution (molarity). The equation pH = - log [H3O+] is then used to determine the pH. Example: In a 0.0025 M HCl solution, determine the pH. Strong and entirely ionised in water, HCl is an acid.
Learn more about pH here:
brainly.com/question/15289741
#SPJ1
what molecule is not a compound
Which of these changes would likely occur if the Earth's rotation on its axis
increased in speed? TEKS 8.7(A)
A The length of the seasons would be shorter.
B The length of the seasons would be longer.
C The length of a day would be shorter.
D The length of a day would be longer.
Answer: its c
Explanation:
N2 + H2 -> NH3
How many moles of H2 gas are used to make 36.5 grams of NH3?
Explanation:
First, you need to balance the equation:
N2 + 3 H2 ====> 2 NH3
so three moles of H2 result in 2 moles of NH3
ratio of 3:2
How many moles of NH3 is 36.5 gm ??
Using periodic table NH3 mole weight = 14.007 + 3*1.008 =17.031 g/mole
36.5 g / 17.031 g/mole = 2.14 moles of NH3
Using the ratios above 3/2 = x / 2.14 shows x = 3.21 moles of H2 needed
Which of the following describes the location and energy of all the valence electrons
of electrically-neutral sulfur (S)?
3p4
3s23p4
Зрб
3523pó
Answer:
1s22s22p63s23p4
Explanation:
Sulfur is located in the p block and has 6 valence electrons (the 2 exponent on the 3s and the 4 exponent on the 3p add up to 6)
The location and energy of all the valence electrons of electrically-neutral sulfur ( S ) is 3s₂3p₄.
What is sulfur ?
Chemical element sulfur has the letter S and atomic number 16. It is multivalent, nonmetallic, and plentiful. Sulfur atoms normally combine to create cyclic octatomic molecules, which have the chemical formula S8. At room temperature, elemental sulfur is a crystalline solid that is brilliant yellow.
In addition to being a fungicide and an ingredient in black gunpowder, sulfur is used to vulcanize black rubber. However, the majority of sulfur is utilized in the creation of sulfuric acid, which is arguably the most significant chemical produced by western civilisations.
Sulfur can be found naturally and in metal sulfide ores. Natively, it may be found close to hot springs and volcanoes.
Thus, option B is correct.
To learn more about sulfur, follow the link;
https://brainly.com/question/16829809
#SPJ5
Photoelectric effect will occur only if frequency of light striking an electron in a metal is above a certain threshold frequenci
The statement is correct. The photoelectric effect refers to the phenomenon where electrons are ejected from the surface of a material when it is exposed to light. The frequency of light striking an electron in a metal must be above the threshold frequency in order for the photoelectric effect to occur.
The statement is correct. The photoelectric effect refers to the phenomenon where electrons are ejected from the surface of a material when it is exposed to light. However, for the photoelectric effect to occur, the frequency of the incident light must be above a certain threshold frequency.
The threshold frequency is the minimum frequency of light required to dislodge electrons from the material. Below this threshold frequency, regardless of the intensity or duration of the light, no electrons will be emitted.
This behavior can be explained by the particle-like nature of light, where light is composed of discrete packets of energy called photons. The energy of a photon is directly proportional to its frequency. Only photons with energy greater than or equal to the binding energy of the electrons in the material can dislodge them.
Therefore, the frequency of light striking an electron in a metal must be above the threshold frequency in order for the photoelectric effect to occur.
For more question on photoelectric
https://brainly.com/question/1458544
#SPJ8
Consider a 0.238 M aqueous solution of sodium hydroxide, NaOH.
How many grams of NaOH are dissolved in 23.46 mL?
Answer:
0.2237 grams of NaOH
Explanation:
To calculate the grams of NaOH dissolved in 23.46 mL of a 0.238 M solution of NaOH, we can use the formula:
mass = molarity x volume x molar mass
where mass is the mass of NaOH dissolved in grams, molarity is the concentration of NaOH in moles per liter, volume is the volume of the solution in liters, and molar mass is the molar mass of NaOH in grams per mole.
First, we need to convert the volume of the solution from milliliters to liters:
volume = 23.46 mL / 1000 mL/L
volume = 0.02346 L
The molar mass of NaOH is 40.00 g/mol.
Now we can plug in the values and solve for mass:
mass = 0.238 M x 0.02346 L x 40.00 g/mol
mass = 0.2237 g
Therefore, there are 0.2237 grams of NaOH dissolved in 23.46 mL of a 0.238 M solution of NaOH.