What is the definition of a Bronsted-Lowry bade

What Is The Definition Of A Bronsted-Lowry Bade

Answers

Answer 1
It’s either B or D because it is a proton

Related Questions

A sample of an unknown compound is vaporized at 160 c . The gas produced has a volume of 2330 ml at a pressure of 1.00 atm ,and it weighs 2.10 g
Round answer to 3 significants digits

A sample of an unknown compound is vaporized at 160 c . The gas produced has a volume of 2330 ml at a

Answers

The molar mass is 3230.8 g/mol

How to determine the value

First, we need to know that the formula for the general gas law  is represented as;

PV = nRT

such that the parameters are;

P is the pressureV is the volumen is the number of molesR is the gas constantT is the temperature

Substitute the values

1 × 2.33 = n × 8.314 × 433.15

Multiply the values, we get;

n = 2.33/ 8.314 × 433.15

Divide the values

n = 6.5 × 10⁻⁴ moles

But, number of moles = mass/molar mass

Molar mass = 2.10/ 6.5 × 10⁻⁴

Molar mass = 3230.8 g/mol

Learn about ideal gas law at: https://brainly.com/question/25290815

#SPJ1

Inter conversion of glucose and fructose occurs with an eqilibrium constant of 1.0. glicose isomerase catalyzes this reaction. The final concentration of fructose at equilibrim from 40 mM glucose is .

Answers

Inter-conversion of glucose and fructose occurs with an equilibrium constant of 1.0. Glucose isomerase catalyzes this reaction. The final concentration of fructose at equilibrium from 40mM glucose is a. 40 mM.

How to find the  final concentration of fructose?

Using this formula to find the  final concentration of fructose

Final concentration of fructose  =Equilibrium from glucose/ Equilibrium constant

Where:

Equilibrium constant = 1.0

Equilibrium from glucose = 40 mM

Let plug in the formula

Final concentration of fructose  = 40mM / 1.0

Final concentration of fructose  =  40mM

Therefore we can conclude that the correct option is A.

Learn more about Final concentration of fructose here:https://brainly.com/question/14041283

#SPJ1

The complete question is:

Inter-conversion of glucose and fructose occurs with an equilibrium constant of 1.0. Glucose isomerase catalyzes this reaction. The final concentration of fructose at equilibrium from 40mM glucose is

a. 40 mM

b. 20 mM

c. 10 mM

d. 0 mM​

in a covalent bond, the electrons are _____

Answers

Explanation:

In a covalent bond the electrons are simultaneously attracted by the two atomic nuclei.

In a covalent bond the electrons are; simultaneously attracted by the two atomic nuclei.

What is Covalent bonding?

Covalent bonding can be defined as the sharing of electrons between two atoms.

The Polar covalent bonds share electrons unequally, while nonpolar covalent bonds share electrons equally.

We know that

Polar covalent bond is defined as a chemical bond in which electrons are shared unequally or unevenly between two atoms.

Non-polar covalent bond is defined as a chemical bond in which electrons are shared evenly or equally between two atoms.

Therefore, In a covalent bond the electrons are; simultaneously attracted by the two atomic nuclei.

To learn more about the bonding, please visit here;

https://brainly.com/question/25150590

#SPJ2

What is the liquid substance use in the laboratory for dissolving dry mortar on floor flies

Answers

The liquid substance used in the laboratory for dissolving dry mortar on floor flies is hydrochloric acid.

What is hydrochloric acid?

Hydrochloric acid is a strong acid that can dissolve many materials, including dry mortar.

Hydrochloric acid also known as muriatic acid or sulfuric acid, are commonly used to dissolve hardened mortar or concrete residues.

To use hydrochloric acid to dissolve dry mortar, you will need to mix the acid with water in a ratio of 1 part acd to 10 parts water.

You should then apply the mixture to the dry mortar using a brush or spray botle.

Find more exercises on Hydrochloric acid;

https://brainly.com/question/24784580

#SPJ1

PLEASE HELP!!!!! WILL GIVE BRAINLIEST!!!!

PLEASE HELP!!!!! WILL GIVE BRAINLIEST!!!!

Answers

The answer should be A

VisibleVisible wave length visible wavelength of light that are emitted by Adams can be used to get Nate explosive devices remotely

The percent composition of a given element in a compound is the number of _______ in one mole of that compound.

Answers

The percent composition of a given element in a compound is the number of molar mass in one mole of that compound.

What is meant the percent composition of a compound?

The percentage of each element in a compound measured by mass is known as the composition. A compound's chemical formula can also be used to estimate its % makeup. To start, the formula's subscripts are employed to determine how much of each element there is in a mole of the compound.

How can you determine an element's percentage makeup in a compound?

Percentage Composition. Find the molar mass in grams per mole of each component in the compound. Find the compound's total molecular weight. Divide the total molecular mass by the molar mass of the component. Your new number will range from 0 to 1. To obtain the percent composition, multiply it by 100%.

To know more about Percentage Composition, visit:

brainly.com/question/14876861

#SPJ1

Which amphibian organ has a high blood supply and many folds to increase surface area?
a. heart
b. stomach
c. lungs
d. brain

Answers

Answer:

lungs

Explanation:

I think the answer is the lungs because they allow for increased surface area.

name this structure ​

Answers

Answer:

where is the structure the picture

Explanation:

???

2C₂H6 (g) + 702 (g) → 4CO2 (g) + 6H₂O(g)

PLEASE HELP!!!
If 10.0 liters of ethane gas are used, how many liters of oxygen gas will be
needed for the above reaction at STP?
A. 35.0 liters
B.2.85 liters
C.70.0 liters
D.1.4 liters

2CH6 (g) + 702 (g) 4CO2 (g) + 6HO(g)PLEASE HELP!!! If 10.0 liters of ethane gas are used, how many liters

Answers

The answer is c that’s the ang

Give TWO reasons, in terms of shielding, why potassium is the
most reactive of the three elements.​

Answers

Answer:

Hi..? All three elements are in group 1 thus they have 1 valence electron which is easy to lose due to shielding.As Pottasium is larger than the rest,Pottasium's valence electron is at a greater distance from the attractive nucleus and is so removed more easily than Sodium's and Lithium's valence electrons.As it is removed more easily it requires less energy and can be said to be more reactive

Anyone can help me out?

Anyone can help me out?
Anyone can help me out?

Answers

Answer:

Your answer will be C

Explanation:

hope this helps


A solution is prepared by dissolving 0.131 g of a substance in 25.4 g of water. The molality of the solution is determined by freezing point
depression to be 0.056 m. What are the moles of the substance?

Answers

The mole of the substance, given the data from the question is 0.0014 mole

What is molality?

This is simply defined as the mole of solute per kilogram of water. Mathematically, it is expressed as

Molality = mole / mass (Kg) of water

How to determine the mole of the substanceMass of water = 25.4 g = 25.4 / 1000 = 0.0254 KgMolality = 0.056 mMole of substance =?

Mole = molality × mass of water

Mole of substance = 0.056 × 0.0254

Mole of substance = 0.0014 mole

Thus, the mole of the substance is 0.0014 mole

Learn more about Molality:

https://brainly.com/question/4251997

#SPJ1

How many moles of N2 will be produced if 3.5 moles of Oz react?

Answers

Answer:

2.3 mol of N2

Explanation:

mol N2 = 3.5 mol O2 x. 2 mol N2  

3 mol O2. = 2.3 mol N2.

how many s orbitals are there for silver?

Answers

5 electron orbits

I hope this helps

4.All materials are made of atoms and molecules that are always ___.
The energy of atoms and molecules due to their motion is _____.

5._____ is the energy carried by an electric current.

LESSON OUTLINE
continued
FORMS OF ENERGY

Answers

All materials are made of atoms and molecules that are always identical. The energy of atoms and molecules due to their motion is thermal energy. Electrical energy is the energy carried by an electric current

What is energy?

Energy is the quantity that denotes the ability to do work and is measured in a Joules.

The energy which arises due to motion of atoms or molecules in a body is known as thermal energy. It is a measure of kinetic energy of the particles. It increases with increase in temperature.

Electrical energy is a type of kinetic energy caused by moving electric charges. The amount of energy depends on the speed of the charges.

Learn more about energy at: https://brainly.com/question/1932868

#SPJ1

Can somebody give me an example of scientific literacy?

Answers

Answer:

Here is

Explanation:

Can somebody give me an example of scientific literacy?

1. How many atoms are in 2.15 moles of water?

*2. How many atoms of copper are in 12.0 grams?

*3. How many moles of NH3 contain 1.75 x 10^24 molecules of?

4. Determine the number of molecules in 16.75 g of H2O ?

5. Find the formula for a hydrate with 48.8% MgSO4 & 51.2% H2O

6. What is the % by mass of C in Pb(C2H3O2)2?

(Questions with stars just don't make sense to me.)

Answers

1. Two water molecules contain 4 hydrogen atoms and 2 oxygen atoms. A mole of water molecules contains 2 moles of hydrogen atoms and 1 mole of oxygen atoms.

2. 12.00 g C-12 = 1 mol C-12 atoms = 6.022 × 1023 atoms • The number of particles in 1 mole is called Avogadro's Number (6.0221421 x 1023). Calculate the number of atoms in 2.45 mol of copper.

That’s all I know I think

1.29×10²⁴ atoms are in 2.15 moles of water. Atom is also the smallest piece of substance with chemical element-like characteristics.

What is atom?

The smallest unit of matter that may be divided without producing electrically charged particles is the atom. It is also the smallest piece of substance with chemical element-like characteristics. As a result, the atom serves as the fundamental unit of chemistry.

Space makes up the majority of an atom. The rest is made up of a cloud of electrons that are negatively charged surrounding a nucleus that is positively charged made up of protons and neutrons. The behaviour of the electron in an atom can be compared to that of particles surrounding the nucleus.

number of atoms = number of moles ×6.022×10²³

                               = 2.15×6.022×10²³

                                = 1.29×10²⁴

Therefore, 1.29×10²⁴ atoms are in 2.15 moles of water.

To know more about atom, here:

https://brainly.com/question/29712157

#SPJ3

An equilibrium mixture of N2, 02, and NO gases at 1500 K is determined to consist of
6.4 x101-3 mol/1 oF N2, 1.7 x 101-3 mol/ of 02 , and 1.1 × 10 ^-5 mol/1 of NO. What is the equilibrium constant for the system at this temperature?

Answers

The equilibrium constant for the system at this temperature is\(1.17 × 10^-31 mol^2/L^2\).

For the chemical equation:

N2(g) + O2(g) ⇌ 2NO(g)

The equilibrium mixture at a temperature of 1500 K is determined to contain 6.4 × 10^-3 mol/L of N2,\(1.7 × 10^-3\)mol/L of O2 and 1.1 × 10^-5 mol/L of NO.  First, we need to calculate the concentration of N2 and O2 required to produce

1.1 × 10^-5 mol/L of NO:

2NO(g) = N2(g) + O2(g)

Given that there are 1.1 × 10^-5 mol/L of NO, the number of moles of N2 and O2 are equal since the stoichiometric ratio is 1:1. Therefore:

\(1.1 × 10^-5 mol/L\) = [N2][O2]Kc = \(([NO]^2)/([N2][O2])Kc\)= \((1.1 × 10^-5 mol/L)^2/(6.4 × 10^-3 mol/L)(1.7 × 10^-3 mol/L)Kc\) =

1.17 × 10^-31 mol^2/L^2.

for such more questions on  equilibrium

https://brainly.com/question/5081082

#SPJ8

Keisha finds instructions for a demonstration on gas laws.

1. Place a small marshmallow in a large plastic syringe.
2. Cap the syringe tightly.
3. Pull the plunger back to double the volume of gas in the syringe.


Which best describes the purpose and outcome of the demonstration?

This is a demonstration of Charles’s law. As the volume increases, the temperature decreases, and the marshmallow will freeze.
This is a demonstration of Charles’s law. As the volume increases, the temperature increases, and the marshmallow will melt.
This is a demonstration of Boyle’s law. As the volume increases, the pressure decreases, and the marshmallow will grow larger.
This is a demonstration of Boyle’s law. As the volume increases, the pressure increases, and the marshmallow will shrink.

Answers

Following best describes the purpose and outcome of demonstration: This is demonstration of Boyle's law. As volume increases, the pressure decreases and marshmallow will grow larger.

What are gas laws?

Gas laws are set of fundamental principles that describe the behavior of gases under different conditions of temperature, pressure, and volume.

These laws include Boyle's law, Charles's law, Gay-Lussac's law, and the combined gas law. These laws help to predict the behavior of gases in different situations and can be used to determine properties such as temperature, pressure, volume, and the number of moles of gas present.

Boyle's Law explains that volume of gas increases as the pressure decreases.

To know more about gas laws, refer

https://brainly.com/question/25290815

#SPJ1

How many grams of Aluminum Sulfate do you have if you have 2.837x10^26 atoms of Sulfur?
Apparently, the right answer is 5.373x10^4, but I do not know how to get there, please help.

Answers

The mass of Aluminum Sulfate is 5.373 grams if you have \(2.837*10^{26\) atoms of Sulfur .

The molecular formula of Aluminum Sulfate is \(Al_2(SO_4)_3.\) In one molecule of aluminum sulfate, there are 3 sulfur atoms. To calculate the mass of aluminum sulfate, follow the steps below:

Step 1: Calculate the molar mass of aluminum sulfate using the periodic table.Al = 27.0 g/molS = 32.1 g/molO = 16.0 g/mol

(2 × Al) + (3 × S) + (12 × O) = molar mass of \(Al_2(SO_4)_3.\) = 342.2 g/mol

Step 2: Find the number of moles of sulfur in the given number of atoms of sulfur.2\(2.837*10^{26\) atoms of sulfur × 1 mol S/\(6.022 * 10^{23\)atoms S = 0.0470 mol S

Step 3: Use the molar ratio of sulfur to aluminum sulfate to calculate the number of moles of aluminum sulfate.1 mol \(Al_2(SO_4)_3.\) / 3 mol S = 0.333 mol\(Al_2(SO_4)_3.\) per mol S0.0470 mol S × 0.333 mol \(Al_2(SO_4)_3.\)/mol S = 0.0157 mol \(Al_2(SO_4)_3.\)

Step 4: Calculate the mass of aluminum sulfate.0.0157 mol \(Al_2(SO_4)_3.\) × 342.2 g/mol\(Al_2(SO_4)_3.\)= 5.373 g\(Al_2(SO_4)_3.\)

Therefore, the mass of Aluminum Sulfate is 5.373 grams if you have \(2.837*10^{26\) atoms of Sulfur.

Know more about  aluminum sulfate   here:

https://brainly.com/question/28299913

#SPJ8

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Mg + HCl -> MgCl2 + H2
When the equation is balanced what should the coefficient for magnesium chloride be

Mg + HCl -> MgCl2 + H2When the equation is balanced what should the coefficient for magnesium chloride

Answers

Explanation:

hope it helps you

have a good day please mark me as brain list ☺️ sorry for picture

Mg + HCl -> MgCl2 + H2When the equation is balanced what should the coefficient for magnesium chloride

Pls solve these 2 questions I will mark you as the brainliest


Which of the following is a way to conserve resources?

leave lights on
go one more trips
plan longer trips
take shorter showers

Answers

Taking shorter showers is a way to conserve resources.

Oxides of sulfur are important in atmospheric pollution, arising particularly from burning coal. Use the thermodynamic data at 25 C given in the appendix to answer the following questions. a. In air, the oxidation of SO2 can occur: 1 2O2(g) SO2(g) S SO3(g). Calculate rG 298

Answers

Answer:

-70.87 kJ

Explanation:

Let's consider the following balanced equation.

1/2 O₂(g) + SO₂(g) ⇄ SO₃(g)

We can calculate the standard Gibbs free energy of reaction (ΔG°r) from the standard Gibbs free energies of formation (ΔG°f) using the following expression.

ΔG°r = 1 mol × ΔG°f(SO₃(g)) - 1/2 mol × ΔG°f(O₂(g) - 1 mol × ΔG°f(SO₂(g))

ΔG°r = 1 mol × (-371.06 kJ/mol) - 1/2 mol × 0 kJ/mol - 1 mol × (-300.194 kJ/mol)

ΔG°r = -70.87 kJ

Describe Describe how a metal and a nonmetal can combine by forming an ionic bond.

Answers

lonic bonds are formed through the exchange of valence electrons between atoms, typically a metal and a nonmetal. The loss or gain of valence electrons allows ions to obey the octet rule and become more stable. Therefore, ions combine in ways that neutralize their charges.

A 15.0 mL portion of a 0.400 M solution of acetic acid is to be titrated with a standarized 0.250 M solution of KOH. What is the expected volume of the KOH solution needed to reach the phenolphthalein end point?

Answers

b.9.38 ml.The volume of KOH required to neutralize the acetic acid is:9.38ml

The equation for the reaction between acetic acid (CH3COOH) and potassium hydroxide (KOH) is:

CH3COOH + KOH → CH3COO- + K+ + H2O

The titration of acetic acid with potassium hydroxide can be used to determine the concentration of the acetic acid solution. The volume of KOH required to neutralize the acetic acid can be calculated using the equation:

Volume (KOH) =\(\frac{ (Molarity of acetic acid) * (Volume of acetic acid) }{(Molarity of KOH)}\)

In this problem, the volume of KOH required to neutralize the acetic acid is:

Volume (KOH)

\(\frac{(0.400 M) * (15.0 mL) }{ (0.250 M)}\\= 9.38 mL\)

Therefore,It takes 9.38 ml of KOH to neutralise 1 g of acetic acid.

learn more about acetic acid Refer:brainly.com/question/15202177

#SPJ1

Complete question:A 15.0 mL portion of a 0.400 M solution of acetic acid is to be titrated with a standarized 0.250 M solution of KOH. What is the expected volume of the KOH solution needed to reach the phenolphthalein end point?

a.22.50 ml

b.9.38 ml

c.6.00 ml

d.3.75 ml

e.24.00 ml

dry ice is solid carbon dioxide. represent carbon dioxide in the following three ways, symbolic, particulate. and macroscopic

Answers

In symbol form, ice is depicted as CO2, in particle form, as molecules of CO2 packed closely together, and in macroscopical form, as a white, crystalline substance that sublimates from a solid to a gas.

How is dry ice defined as solid carbon dioxide?

Because the gas when it solidifies resembles ice, ice ice is actually just carbon dioxide that has been solidified. Unlike regular ice, it instantly transforms into CO2 gas instead of melting into a liquid.

Why is dry ice a good illustration of sublimation?

Solid carbon dioxide is sometimes referred to as "dry ice." That's because when something warms up and changes state, it doesn't just dissolve into a liquid. Instead, it skips the liquid step and transforms right into a gas.

To know more about molecules visit:-

https://brainly.com/question/19556990

#SPJ9

what are some habits of the woodhouse's toads​

Answers

Answer:

Behavior

Explanation:

Near human habitaciones these toads may congregate underneath outsider lights to feed one the insects the attract.

15. What volume of water must be added to 300 mL of 0.75 M HCl to dilute the solution to
0.25 M?

Answers

Known :

V1 = 300 mL

M1 = 0.75 M

M2 = 0.25 M

Solution :

M1 • V1 = M2 • V2

(0.75 M) • (300 mL) = (0.25 M) V2

V2 = 900 mL

Water add to this solution is :

∆V = V2 - V1

∆V = 900 - 300

∆V = 600 mL

The answer is 600 ml of water needs to be added to change the concentration to 0.25 M.

What is Dilution ?

A dilution is when you have a solution of a certain concentration and you add more solvent to decrease the concentration.

If you are adding more solvent, the volume of the whole solution is going to increase as the concentration of the solution decreases.

You can solve for the concentration or volume of the concentrated or dilute solution using the equation:

M₁V₁ = M₂V₂,

where M₁ is the concentration in molarity (moles/Liters) of the concentrated solution,

V₁ is the volume of the concentrated solution,

M₂ is the concentration in molarity of the dilute solution (after more solvent has been added), and

V₂ is the volume of the dilute solution.

It is given that

V₁ = 300 ml

V₂ = ?

M₁= 0.75 M

M₂ = 0.25 M

Substituting the values in the equation

0.75 * 300 = 0.25 * V₂

V₂= 900 ml

So 900 - 300 , 600 ml of water needs to be added to change the concentration to 0.25 M.

To know more about dilution

https://brainly.com/question/21323871

#SPJ2

What is paper made of?

Answers

Paper used as a writing material is made of pulp (wood).

What is paper?

Paper is a sheet material used for writing on or printing on (or as a non-waterproof container), usually made by draining cellulose fibres from a suspension in water.

Paper is made from cellulose found in trees, which are the main source of cellulose fibre (or woodpulp). Besides woodpulp, paper can be made from other materials such as cotton, flax, esparto, straw, hemp, manilla and jute.

Wood pulp is usually a softwood, used for pulping to make paper.

Learn more about pulp at: https://brainly.com/question/23590026

#SPJ1

Other Questions
A 12-kg sled is moving at a speed of 3.0 m/s. At which of the following speeds will the sled have twice as much kinetic energy? 4. The net of a square pyramid is shownbelow What is the surface area of thepyramid?8 cm8 cmA 100 cmB 138 cmC 172 cm?D 192 cm? Some General Motors flex fuel vehicles do not use a fuel sensor to measure the percentage of ethanol in the fuel. These vehicles use ________ as a base fuel to calculate the percentage using oxygen sensor readings. which of these are common features of a corporate bond? select all that apply. multiple select question. semi-annual interest payments currently issued as bearer bonds face value of $1,000 publicly traded debt security What is 268,955 rounded to the nearest hundred thousand? One gallon of paint covers about 450 square feet. How many square feet will 1.5 gallons of paint cover? What is the constant of proportionality that relates y, the total cost in dollars, to x, the number of boxes purchased? One regiment marched off to battle wearing ___________,the traditional army wear for Scottish regiments, because it was all they had. Oneoutlandish uniform was copied from the French; it consisted of baggy redbreeches, purple blouses, and red fezzes (hats). PLEASE HELP MEEEE!! Analyze the map below and answer the question that follows. Image courtesy of NASA The country labeled with the number 1 on the map above is __________, and it has a population of _____ million people. A. Russia . . . 139 B. France . . . 65 C. Spain . . . 47 D. Poland . . . 38 Please select the best answer from the choices provided Ben and alina worked together in a small group tosolve one of the most difficult problems when theyfinished they asked their teacher for feedback. MrsMeyer told them that there answer was Correct;however they needed to show their work. Before theycould continue Alinas pencil needed to be sharpened soben lent one of his pencils to her. Mathametics is oneof Bens most challenging classes but he expects to passbecause he works well with his partnerEditing What is the degree of the polynomial below?7x+6x2 + 4x + 2O A. 3O B. 5O c. OO D. 1 What is 1/2 of 2/8? Please help ASAP can somebody help me with this Infants do best with: A variety of caregivers A primary caregiver Infants do not thrive in childcare A large group setting Two caregivers The sum of three lengths of a fence ranges from 45 to 60 inches. Two side lengths are 9 and 18 inches. If the length of the third side is x inches, write and solve a compound inequality to show the possible lengths of the third side. 9 x 18 18 x 33 36 x 42 45 x 60 Normally when scientists and philosophers says that some behavior is human nature they mean that --Hint see Kupperman, Theories of Human Nature. - everybody should act like that. - everyone always acts that way. - almost anybody would act that way in the same situation - nobody really acts like that a recent consumer reports study analyzed toasters and found that the average performance rating for all toasters tested was 70 with an average price of $33. krups is a brand of toaster that sells for $32 and received an overall performance rating of 84. what is krup's relative performance against other toasters tested? Suppose we did a regression analysis that resulted in the following regression model: yhat = 10.4+1.8x. Further suppose that the actual value of y when x=14 is 25. What would the value of the residual be at that point? 44.22 divided by (-6.7) --------is the study of how muscles work. Q|C Two capacitors, C = 18.0F and C = 36.0F , are connected in series, and a 12.0-V battery is connected across the two capacitors. Find (e) Will this equality always be true, or does it depend on the number of capacitors and their capacitances?