What is one way the concept of stability is seen in chemistry?

Answers

Answer 1

Stability can be seen in chemistry through thermodynamics or kinetic stability.

There are two possible meanings of stability when it refers to coordination compounds (metal complexes): kinetic stability or thermodynamic stability.

The change in energy when reactants become products or G for the reaction is referred to as thermodynamic stability. Reactivity, or generally ligand substitution, is referred to as kinetic stability. In some situations, substitution happens relatively quickly, while in others, it happens quite slowly. Complexes of the first type are known as labile, whereas those of the second type are known as inert. These two forms of stability can sometimes be parallel to one another, but they are frequently not.The energetics and associated equilibrium constant for the reaction of an aquated metal ion with another ligand is frequently referred to as the reaction's "thermodynamic stability" (other than water). The stability constant () is equal to the instability constant reciprocated.

Learn more about thermodynamic stability here:

https://brainly.com/question/28431165

#SPJ9


Related Questions

How many liters of N2 gas are in 2.4 moles at STP?

Answers

Answer:

any gas takes up 22.4L per mole so 2.4*22.4=53.76

Explanation:

In 2.4 moles at STP, 53.79 litres of N2 gas are present.

What are moles?

Moles are defined as the amount of substance of a system that contain the same number of entities as the number of atoms in 12g of carbon 12.

What is STP?

STP is defined as the standard temperature and pressure. At STP, as system has s temperature of zero degree centigrade or 273 Kelvin and the pressure is 1 atm.

PV= nRT

P= 1 atm

V= ?

n= 2.4 moles

R= 0.0821 L atm /K/mol

1 x V = 2.4 x 0.0821 x 273

V = 53.79 litres


Hence, 53.79 litres of N2 gas is present in 2.4 moles at STP.

To learn more about moles and STP here

https://brainly.com/question/9945437

#SPJ2

Determine the mass in grams of CO₂ that is produced by the complete reaction of 0.08142 moles of C₅H₁₂ (pentane) according to the following combustion reaction:

C₅H₁₂(l) + 8 O₂(g) → 5 CO₂(g) + 6 H₂O(g)

Answers

Answer: 17.91 grams of CO2 will be produced

Explanation:

The balanced chemical equation for the combustion of pentane is:

C5H12(l) + 8 O2(g) → 5 CO2(g) + 6 H2O(g)

From the equation, we can see that for every 1 mole of C5H12 that reacts, 5 moles of CO2 are produced. Therefore, to determine the mass of CO2 produced, we need to first calculate the number of moles of CO2 produced by 0.08142 moles of C5H12:

0.08142 moles C5H12 x (5 moles CO2 / 1 mole C5H12) = 0.4071 moles CO2

Now we can use the molar mass of CO2 (44.01 g/mol) to calculate the mass of CO2 produced:

0.4071 moles CO2 x 44.01 g/mol = 17.91 g CO2

Therefore, the mass of CO2 produced by the complete combustion of 0.08142 moles of pentane is 17.91 g.

Answer: 17.912 gm

Explanation: C5H12 + 8O2 ------- 5CO2 +6H2O

IF ONE MOLE OF C5H12 produces 5 moles of CO2 then 0.08142 produces x mole

then x = 5 X 0.08142

X = 0.4071

NO. OF MOLES = given mass/ molecular mass of CO2

0.4071= mass/44

Mass= 0.4071 X 44

mass = 17.912

therefore mass of CO2 produced is 17.912

The density of Na2Co3 solution at 20Celsius is 1.019g/mL. The mass fraction w(Na2CO3) is 0.02 (2%). What's the concentration of the solution?

Answers

1. we are given :

• that the mass fraction of Na2CO3 = 2%

meaning 2 grams of Na2Co3 was dissolved in 98g of water .

∴ total mass of solution = 100g

• Density = 1.019g/mL.

,

• Molar mass Na2CO3=105,9888 g/mol

2. Calculate volume

Density = mass /volume

∴Volume = mass/density = 100g /1.019g/mL.

= 90.66mL.

3.Calculate moles of the solution

n = mass Na2CO3/MolMass Na2Co3

= 2 g /105.9888g/mol

∴moles of Na2CO3 =0.019moles Na2CO3

4. Calculate the Molarity (concentration)of the solution

Molarity =( n/v) * 1000

= (0.019mol/(90.66/1000) L

= (0.019/90.66)*1000 ( multiply by 1000: 90.66/1000=0.09066)

=0.21M

This means that the concentration of the solution is 0.21M

A student carries out the precipitation reaction shown below, starting with 0.030 moles of calcium nitrate. The final mass of the precipitate is 2.9 g. Answer the questions below to determine the percent yield. 3Ca(NO3)2(aq) + 2Na3PO4(aq) → Ca3(PO4)2(s) + 6NaNO3(aq) 1. a. Which product is the precipitate? b. How many moles of the precipitate would one expect to be produced from 0.030 moles of calcium nitrate? c. How many grams of solid do you expect to be produced? d. What is the percent yield?

Answers

Answer:

a. Ca₃(PO₄)₂.

b. 0.010 moles of Ca₃(PO₄)₂ can we expect to be produced

c. 3.1g of Ca₃(PO₄)₂

d. Percent yield = 93.5%

Explanation:

a. Based on the reaction:

3Ca(NO₃)₂(aq) + 2Na₃PO₄(aq) → Ca₃(PO₄)₂(s) + 6NaNO₃(aq)

3 moles of calcium nitrate reacts with 2 moles of sodium phosphate producieng 1 mole of calcium phosphate.

As you can see, Ca₃(PO₄)₂ is a solid product -(s)-, that means when the reaction occurs the precipitate produced is the solid,

Ca₃(PO₄)₂

b. As 3 moles of calcium nitrate produce 1 mole of calcium phosphate and there are 0.030 moles of calcium nitrate

0.030 moles Ca(NO₃)₂ × (1 mol Ca₃(PO₄)₂ / 3 moles Ca(NO₃)₂) =

0.010 moles of Ca₃(PO₄)₂ can we expect to be produced

c. As molar mass of Ca₃(PO₄)₂ is 310.18g/mol, the mass of 0.010 moles (The expected mass) is;

0.010 moles Ca₃(PO₄)₂ × (310.18g / mol) =

3.1g of Ca₃(PO₄)₂

d. The percent yield is defined as 100 times the ratio between the obtained yield (That is 2.9g of precipitate, Ca₃(PO₄)₂) and the expected yield, 3.1g of Ca₃(PO₄)₂:

2.9g3.1g100

Percent yield = 93.5%

(a) The product in solid state would be the precipitate. Hence, the precipitate would be Ca3(PO4)2

(b) From the balanced equation of the reaction: 3 moles of Ca(NO3)2 is required for 1 mole of Ca3(PO4)2

If there are just 0.030 moles of Ca(NO3)2, then"

3 moles = 1

0.030 moles =    1 x 0.030/3

                         = 0.01 moles of Ca3(PO4)2

In other words, 0.01 moles of the precipitate would be expected to be produced from 0.030 moles of calcium nitrate.

(c) 0.01 moles solid (Ca3(PO4)2) is expected. Mass of Ca3(PO4)2 expected:

      mass   = mole x molar mass

molar mass of Ca3(PO4)2 = 310.18 g/mol

mass of Ca3(PO4)2 expected to be produced = 0.01 x 310.18

                                                                       = 3.1018 g

Hence, 3.1018g of solid is expected to be produced.

(d) Percentage yield = actual yield/theoretical yield x 100

                          = 2.9/3.1018 x 100

                               = 93.5%

More on precipitation reaction can be found here:  https://brainly.com/question/24158764

3.7x10^7 and 3.30x10^8 written in scientific notation

Answers

Answer:

1) 37100000

2) 330000000

Explanation:

1) 3.7 x 10^7 = 37100000

2) 3.30 x 10^8 = 330000000

(Hope this helps can I pls have brainlist (crown)☺️)

Hypothesize! Compare the Solid state of Water to the solid state of Neon. How do
these two configurations differ? Why do you think this is?

Answers

The arrangement of hydrogen bonds during freezing is what causes water to have a lower density when it solidifies: the water molecules are pushed together.

Why is density important?

The density of a place refers to the quantity of things—which may include people, animals, animals, or objects—there are in it. Multiply the number of items even by area's measurement to determine density. A country's population density is calculated by dividing its total population by its area, expressed in square kilometers or miles.

What is a density unit?

However, kg/m3 is used as the standard SI unit for density. As seen below (t/m3-metric ton per cubic meter), density can be expressed in units of liters or metric tons. It stands for grams per milliliter. kilograms per liter, or kg/L.

To know more about density visit:

https://brainly.com/question/29775886

#SPJ1

Please help!

Hydrochloric acid is a strong acid whereas acetic acid is a weak acid.
i. How would the pH of a 0.01M acetic acid compare to pH value for 0.01M HCl?
(Explain in your own words without calculating)

ii. Calculate the pH of a 0.01 M acetic acid.

Please help!Hydrochloric acid is a strong acid whereas acetic acid is a weak acid.i. How would the pH

Answers

Because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. 2.88 is the  pH of a 0.01 M acetic acid.

What is acid?

Any hydrogen that comprises a material capable of giving a proton (a hydrogen ion) to another chemical is defined as acid. A base is indeed a molecule or ion that can receive a hydronium ion from just an acid.

1)Because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. The pH value of stronger acid is lower.

2)CH3COOH + H2O  ⇄ CH3COO⁻+  H3O⁺

 0.01             0               0

 -x              +x                +x

 0.01-x           +x        +x

Ka=[ CH3COO⁻][H3O⁺]/[CH3COOH]

1.8×10⁻⁵ = [x][x ]/[  0.01-x ]

x=1.34×10⁻³

pH = -log[H⁺]

     =  -log[1.34×10⁻³]

     =2.88

Therefore, because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. 2.88 is the   pH of a 0.01 M acetic acid.

To learn more about acid, here:

https://brainly.com/question/29775793

#SPJ9

how many moles of pbcl2 are produced when 16 alcl3 are consumed

Answers

Using dimensional analysis and the mole ratios from the balanced equation, we can calculate moles of PbCl2 formed from 14 moles of AlCl3.

Identify each term as a description of an electron geometry or a molecular geometry. Trigonal pyramidal for N F 3 Choose... Tetrahedral for N F 3 Choose... Arrangement of bonding and non-bonding electron domains Choose... Arrangement of only the atoms in a molecule Choose...

Answers

Answer:

electron geometry

Tetrahedral for N F 3

Arrangement of bonding and non-bonding electron domains

molecular geometry

Trigonal pyramidal for N F 3

Arrangement of only the atoms in a molecule

Explanation:

According to valence shell electron pair repulsion theory, the shape of a molecule is determined by the number of electron pairs on the valence shell of the central atom in the molecule.

The electron pair geometry refers to the arrangement of bonding and non-bonding electron domains. For NF3, the electron geometry is tetrahedral.

The molecular geometry refers to the arrangement of only the atoms in a molecule. For NF3, the molecular geometry is trigonal pyramidal.

NF₃ has different geometry as per the arrangements of electrons. Tetrahedral and Trigonal bipryamidal are the two geometries.

According to valence shell electron pair repulsion theory:

The shape of a molecule is determined by the number of electron pairs on the valence shell of the central atom in the molecule.

Electron geometry

Tetrahedral for NF₃

Arrangement of bonding and non-bonding electron domains

Molecular geometry

Trigonal pyramidal for NF₃

Arrangement of only the atoms in a molecule

Find  more information about Electron geometry here:

brainly.com/question/25629871

A galvanic cell consists of a Mg electrode in a 1 M Mg(NO3)2 solution and another metal electrode X in a 1 M X(NO3)2 solution.

The galvanic cell has an E°cell value of 1.61 V. Which of the following elements fits the identity of X. (Use table table 18.1)



Select one:

a.
Pb


b.
Zn


c.
Ni


d.
Fe


e.
Mn

Answers

Answer:

To determine the identity of metal X, we need to compare the standard reduction potentials of the possible metals with the standard reduction potential of the Mg half-reaction.

From Table 18.1, we can find the standard reduction potentials for each of the metals listed:

Pb: -0.13 V

Zn: -0.76 V

Ni: -0.25 V

Fe: -0.44 V

Mn: -1.18 V

The reduction half-reaction for the Mg electrode is:

Mg2+ + 2e- → Mg E° = -2.37 V

The overall reaction for the galvanic cell is:

Mg(s) + X2+(aq) → Mg2+(aq) + X(s)

The standard cell potential is given by:

E°cell = E°(cathode) - E°(anode)

where the cathode is the reduction half-reaction and the anode is the oxidation half-reaction.

Substituting the given values, we get:

1.61 V = E°(X2+/X) - (-2.37 V)

Simplifying, we get:

E°(X2+/X) = 1.61 V + 2.37 V = 3.98 V

Comparing E°(X2+/X) with the standard reduction potentials in Table 18.1, we see that only zinc (Zn) has a reduction potential that is more negative than 3.98 V. Therefore, the metal X is zinc (Zn).

Therefore, the answer is (b) Zn.

Small bodies from which the planets formed are called _____.

Answers

Answer:

The small bodies from which the planets formed are called planetesimals.

Can somebody please help me

Can somebody please help me

Answers

Answer:

a

Explanation:

because this could be down to coincidences whereas the others could be explained with scientific experiments

Answer:

A

Explanation:

Must be testable - A is not

How many molecules are contained in 55.0g of co2??

Answers

Answer: 7.52*10^23 molecules.

Explanation: This is a classic Stoichiometry problem.

In one mole of any substance, there are 6.02*10^23 molecules. This number is called Avogadro's number. We are given 55 grams of Co2 so to convert that to moles, we divided by the molar mass of Co2. We find the molar mass by adding the molar masses of the elements that make up the compound.

There is one molecule of Carbon and two molecules of Oxygen in one molecule of Co2. From the periodic table, the molar mass of Carbon is 12.01 and 16.00 for Oxygen. 1(12.01)+2(16.00) gives us the molar mass. We then divided 55 grams by that mass to find the number of moles. We then multiply the number of moles by Avogadro's number (6.02*10^23) to find the total number of molecules.

You can use this method for solving any problem that asks you to find the number of atoms or molecules of some number of grams of a substance.

How many atoms of Chlorine would there be in 6.8 mol of Cl?

Answers

Answer:

241.08039999999588

Explanation:

In the following reaction, 8.24 mol of P4 mix with 24.2 mol of O₂.
P4 (s) + 5 O2 (g) → 2 P₂O5 (s)
a. Find the limiting reagent. Explain.
b. How many moles of P2O5 (s) will be produced?
C. How many grams of P₂O5 (s) will be produced?

Answers

The limiting reagent is O₂ because there is only 24.2 mol of O₂ available for the reaction, and 8.24 mol of P4 is needed to react with all of the O₂.

What is reaction?

Reaction is a response to a stimulus or event. It is an action or behavior that is often automatic and instinctive. Reactions can be emotional, biological, chemical, or physical. Examples of reactions include fear, laughing, crying, or sweating. Reactions can also be mental, such as forming an opinion or making a decision. Depending on the context, a reaction can be positive or negative. A reaction can be short lived, or it can cause a longer lasting impact. Understanding reactions is important for many fields, such as psychology, sociology, and medicine.

a. The limiting reagent is O₂ because there is only 24.2 mol of O₂ available for the reaction, and 8.24 mol of P4 is needed to react with all of the O₂.
b. 12.1 mol of P2O5 (s) will be produced.
c. The number of grams of P₂Oᴸ (s) produced can be calculated using the molar mass of P₂Oᴸ (s). 12.1 mol of P2O5 (s) has a mass of 283.9 g.

To learn more about reaction
https://brainly.com/question/24795637
#SPJ1

What is the change in boiling point atb in Celsius of a 0.852m solution of C6H14 in benzene?

Kb(benzene)= 2.65 degrees Celsius/m

Answers

The change in boiling point of C6H14 in benzene is 2.257 degree Celsius.

What is boiling point?

The boiling point is the temperature at which vapor pressure of the liquid is equal to the atmospheric pressure or the temperature at which the liquid phase turns into vapor state.  The boiling point of pure water at sea level is 100 degree Celsius.

The change in boiling point can be calculated as,

ΔTb = Kb x m

where ΔTb is change in boiling point, Kb is Ebullioscopic constant and m is molality of the solute.

ΔTb = (2.65 degree Celsius / m) x 0.852m = 2.257 degree Celsius.

Therefore, the change in the boiling point of 0.852m solution of C6H14 in benzene is 2.257 degree Celsius.

To know more about boiling point click on the given link https://brainly.com/question/24675373

#SPJ1

Answer:

The correct answer for ACELLUS is 2.25

Explanation:

Which energy transformation occurs in an endothermic reaction

Answers

Answer:

heat energy

Explanation:

Chemical reactions often involve changes in energy due to the breaking and formation of bonds. Reactions in which energy is released are exothermic reactions, while those that take in heat energy are endothermic.

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

chemistry
Which of the following is a characteristic of solid silver?
O A. High electrical conductivity
O B. Brittleness
C. Low melting point
O D. Good insulator
SUBM

Answers

Answer:

A. High electrical conductivity

Explanation:

solid silver isn't brittle, it has a high melting point, and its not a good insulator.

How many atoms are in 3.2 moles of S (sulfur)?

Answers

Answer:

1.92704e24 atoms

Explanation:

Using Avogadro's number, you can set up a stoichiometric equation to find the number of atoms.

How many atoms are in 3.2 moles of S (sulfur)?

There are 1.926 × 10²⁴ atoms in 3.2 moles of sulfur (S).

How to calculate number of atoms?

The number of atoms in a substance can be calculated by multiplying the number of moles by Avogadro's number.

Avogadro's number is the number of atoms present in 12 grams of isotopically pure carbon-12, being 6.02214076 × 10²³.

According to this question, there are 3.2 moles of sulfur. The number of atoms can be calculated as follows:

no of atoms = 6.02 × 10²³ × 3.2

no of atoms = 19.26 × 10²³

no of atoms = 1.926 × 10²⁴

Therefore, 1.926 × 10²⁴ atoms are in 3.2 moles of sulfur.

Learn more about number of atoms at: https://brainly.com/question/8834373

#SPJ1

Define exothermic and endothermic. What are the mathematical signs of the internal energy and enthalpy when a process is exothermic?

Answers

Exothermic refers to chemical interactions that aerobic respiration. Combustion reactions release higher energy. Endothermic refers to atoms and molecules that either use or absorb reactive power.

What is an exothermic explanation?

A chemical process known as an endothermic releases energy as heat or light. It is an endothermic reaction's opposite. Chemical equation expressed as reactants + products + energy. An reaction mechanism is one in which electricity is given off as light or warmth.

Exothermic example: What is it?

A response is deemed to be exothermic if it produces heat while also undergoing a net decrease in basic enthalpy change. Samples include those type of combustion, iron rust, including water froze. Exothermic processes are those that discharge heat and energy into the surroundings.

To know more about exothermic visit:

https://brainly.com/question/13243759

#SPJ1

Find the molar mass of CaCO3
+ show work please

Answers

Answer:

100.0869 g/mol

Explanation:

Add the molar masses of calcium (40.078 g/mol), carbon (12.0107 g/mol), and three oxygen atoms at 15.9994 g/mol each.

40.078 g/mol + 12.0107 g/mol + (3)(15.9994 g/mol) = 100.0869 g/mol

C6H6 + Cl2 - --> C6H5Cl + HClIf I start with 15.7 grams of C6H6 , how many grams of C6HClare produced?O 22.8 grams0 23.0 gramsO 22.0 gramsO 50.0 grams1

C6H6 + Cl2 - --> C6H5Cl + HClIf I start with 15.7 grams of C6H6 , how many grams of C6HClare produced?O

Answers

The equation presented to us is balanced since we have the same number of atoms of each element on each side of the reaction. So we can continue with the calculations.

To determine the amount of product that we can obtain we must see the stoichiometry of the reaction. We will follow the following steps:

1. We find the moles of C6H6 contained in 15.7g by dividing the mass by the molar mass of C6H6 (78.11g/mol).

2. We find the moles of C6H5Cl that are produced using the ratio C6H5Cl to C6H6 which is equal to 1/1. This is because the coefficients that accompany these molecules are 1 for both.

3. We find the grams of C6H5Cl by multiplying the moles by the molar mass of C6H5Cl(112.56g/mol).

Let's proceed to do the calculations.

1. Moles of C6H6:

molC6H6=GivengC6H6×1molC6H6MolarMass,gC6H6molC6H6=15.7gC6H6×1molC6H678.11gC6H6=0.2molC6H6

2. Moles of C6H5Cl

molC6H5Cl=GivenmolC6H6×1molC6H5Cl1molC6H6molC6H5Cl=0.2molC6H6×1molC6H5Cl1molC6H6=0.2molC6H5Cl

3. grams of C6H5Cl

gC6H5Cl=GivenmolC6H5Cl×MolarMass,gC6H5Cl1molC6H5ClgC6H5Cl=0.2molC6H5Cl×112.56gC6H5Cl1molC6H5Cl=22.8gC6H5Cl

If we start with 15.7 of C6H6 we will obtain 22.8g C6H5Cl. The answer will be the first option: 22.8g

Rank these least polar=1 to most polar=11 and why the most polar is the most polar

Rank these least polar=1 to most polar=11 and why the most polar is the most polar

Answers

To rank these least polar=1 to most polar=11, we need to understand what polarity is. The term "polarity" refers to the distribution of electrical charge in a molecule.

A molecule is polar if its electron cloud is distributed unevenly and has poles, resulting in the molecule having a positive and a negative end. A molecule is nonpolar if its electron cloud is distributed uniformly, resulting in the molecule having no charge poles.

The ranking of the given compounds from least polar to most polar is as follows:

Least polar: 7 (nonpolar)

4 (nonpolar)

9 (nonpolar)

1 (nonpolar)

8 (polar)

2 (polar)

6 (polar)

5 (polar)

10 (polar)

3 (most polar)

Most polar: 3 (most polar)

The reasoning behind this ranking is that the difference in electronegativity between the two atoms that make up the molecule determines polarity.

The greater the difference in electronegativity between two atoms, the more polar the bond between them is. As a result, we can classify the compounds as nonpolar and polar. We rank these compounds based on their polarity, with the least polar being nonpolar and the most polar being polar.

For more questions on polarity, click on:

https://brainly.com/question/17118815

#SPJ8

How do molecules work?

Answers

A molecule is essentially created by a collection of atoms linked by a network of bonds.

what is biotic?check all that apply​

Answers

where are the answers that apply .. hopes this help :)

Answer: biotic is Living things in their ecological relations.

Explanation:

Determine the only possible 2 ion for which the following two conditions are both satisfied: The net ionic charge is one-tenth the nuclear charge. The number of neutrons is four more than the number of electrons. Express your answer as an ion and as an isotope separated by a comma.

Answers

Explanation:

The answer is the Calcium ion. It satisfies the conditions of the question.

Condition 1

The net ionic charge is one-tenth the nuclear charge.

In the Calcium ion,  Ca²⁺. The nuclear charge in this ion is 20. The net ionic charge is 2.

2 / 20 = 1 / 10. So the net ionic charge is indeed one tenth of the nuclear charge.

Condition 2

The number of neutrons is four more than the number of electrons.

Mass Number of Ca²⁺ = 44

Atomic Number = 20

Neutrons =  Mass Number - Atomic Number = 44 -20 = 24

Number of electrons = 20 - 2 = 18

Since Number of Neutrons = 22, Number of electrons = 18. This condition also holds.

As an ion and as an isotope = Ca²⁺, Ca - 42

What is the freezing point, in Celsius, of a sucrose-water solution containing 2.23g sucrose per 100g water. The molal freezing point depression constant for water is 1.86oC/m.

Answers

The freezing point of the solution is - 0.12 oC.

We know that;

ΔT = K m i

ΔT = Freezing point depression

K = Freezing constant

m = molality

i = Van't Hoff factor

Number of moles of sucrose= 2.23g/342 g/mol = 0.0065 moles

Mass of solvent in Kg = 0.1 Kg

Molality of the solution = 0.0065 moles/ 0.1 Kg = 0.065 m

Now;

ΔT = 1.86 oC/m × 0.065 m × 1

ΔT = 0.12 oC

Freezing point of pure water = 0 oC

Freezing point of solution =  0 oC -  0.12 oC = - 0.12 oC

Learn more: https://brainly.com/question/2292439

The combustion of octane, C8H18, proceeds according to the reaction shown.

2C8H18(l)+25O2(g)⟶16CO2(g)+18H2O(l)

If 354 mol of octane combusts, what volume of carbon dioxide is produced at 15.0 ∘C
and 0.995 atm?

Answers

The concept ideal gas equation is used here to determine the volume of the carbondioxide. Combustion reactions are generally highly exothermic reactions. The volume of CO₂ is

A combustion is a chemical reaction in which a fuel undergoes oxidation as a result of the reaction with an oxidizing agent which causes the release of energy in the form of heat.

15.0 °C = 288 K

The ideal gas equation is:

PV = nRT

V = nRT / P

V = 354 × 0.0821 × 288 / 0.995 = 8412.3 L

To know more about combustion, visit;

https://brainly.com/question/14335621

#SPJ1

compared to sodium, sulfur is more-
A. conductive
B. shiny
C. dull
D. malleable ​

Answers

A is the answer to that question
Other Questions
in the short run, perfectly (or purely) competitive firms will maximize their profit by producing which of the choices? select all that apply.any quantity where marginal revenue > marginal cost. the quantity where marginal revenue = marginal cost. the largest quantity possible, not considering costs or revenues. a small quantity to drive up the price. the quantity where price equals marginal cost. none of the above are correct. During its first year, there were 138 volunteers at a community outreach program. Over the next 2 years, there were 156 volunteers and 175 volunteers, respectively. What is the percent of increase in volunteers from Year 1 to Year 2 and from Year 1 to Year 3? Round to the nearest tenth percent if necessary. What letter note is this? which of the following is the advantage of having a clean and good quality of air and water supply a. it will motivate them more to learn b. it encourage them to play and move freely c. it keeps the children free from illnesses and disease d. it makes them feel at home to be able to learn effectively In two sentences or less, please descirbe anything that you know about teaching. Finish the sentence: The television evangelist faced ignominy when the public Manganese is composed of two stable isotopes: Mn-54 and Mn-57. Use the periodic tableand predict which of these isotopes is more abundant. Explain your prediction.Why is the mass in amu of a carbon atom reported as 12.011 in the periodic table of theelements? Reagan's tax initiatives, outlined in this excerpt, most directly resulted in which of the following trends?A growing middle class and service industry to support them Why must a phlebotomist be very careful during the collection of sputum samples for a tuberculosis test? moderate endurance exercise can boost a person's function, whereas excessive training can depress it. True/False If the adoption of a new product will reduce the sales of an existing product, then the projected sales should:_______. a) reflect only the sales of the new product b) include only the reduction amount. c) equal the incremental increase in total sales. d) be adjusted upward by the reduction amount. Upton Sinclair's The Jungle convinced Congress to establish a cabinet position for a secretary of the interior. pass legislation barring slavery from any new territories west of the Mississippi River. create the Agricultural Adjustment Administration . pass the Pure Food and Drug Act. cut funding for the war in Vietnam . to start your evaluation of this web page, take a moment to determine its authority. remember to ask yourself the following questions: is it clear who is responsible for this information? (hint: this can be an individual, a group of people, or an organization.) What's the answer for 1 and 2 in most cases, involuntary turnover should not occur based on one employee offense. an effective discipline program should have a system in place that includes documentation and progressive measures of discipline (called the progressive discipline system) to teach employees what is expected. additionally, many organizations use alternative dispute resolution (adr), employee assistance programs (eap), and possibly outplacement counseling as part of this process. this activity is important because establishing a formal discipline process, called progressive discipline, allows the organization to have a systematic way to handle employee problem behaviors fairly. the primary purpose is to teach employees what is expected of them and create the opportunity in which the employee tries to do what is expected. progressive discipline identifies and communicates unacceptable behaviors and responds to repeated offenses with a series of graduated steps such as spoken and written warnings, temporary suspensions, and termination. the consequences become more serious if the employee repeats the offense. examples that could be addressed include tardiness, absenteeism, performance issues, and cyberslacking. other organizations use impartial outsiders to solve problems using alternative dispute resolution. adr has four stages: open-door policy, peer review, mediation, and arbitration. discipline issues that do not deal with interpersonal or performance elements may be resolved through an employee assistance program (eap). these programs provide professional treatment for various problems, such as drug and alcohol abuse. lastly, if after a series of offenses, the employee is terminated, they may be provided with outplacement services that will help them build skills to manage the transition to find new employment. the goal of this activity is to match the appropriate type of discipline and associated phase of the process the employee is experiencing based on the situation. What are academic and emotional benefits of music? 25 points!!!What is the scale factor from left to right?2024203036 what is the graph of 2x + 3y > - 3? PLZ HELP!!!!!! _SOMEONE HELP ME WITH - an advice speech for parents from teens!!!! Sergio is eleven. His voice is deeper than it used to be, and his muscles are bigger. These changes illustrate which of the following puberty-related terms?Gonadotropin-releasing hormonesecondary sex characteristicsprecocious pubertyprimary sex characteristics