what is generally true about the compressibility of solids?​

Answer:is a trace metal of severe toxicity. Its health concerns via consumption of contaminated vegetables have often been overlooked or underestimated

Explanation: Read it carefully and it explains

Taking into account the definition of Avogadro's Number, 3.704×10²³ atoms are in a sample of 0.615 mol Ne.

Avogadro's number indicates the amount of elementary entities (molecules, atoms, ions or other similar particles) that a mole of any substance contains. It applies to molecular and atomic substances.

Its value is 6.023×10²³ particles per mole.

You can apply the following rule of three: If 1 mole of Ne contains 6.023×10²³ atoms, 0.615 mole of Ne contains how many atoms?

amount of atoms= (0.615 moles ×6.023×10²³ atoms)÷ 1 mole

amount of atoms= 3.704×10²³ atoms

Finally, 3.704×10²³ atoms of Ne are present.

Learn more about Avogadro's Number:

brainly.com/question/11907018

#SPJ1

Answer:

1

False. if they all moved together at any time then it would be a million things withinthe human species all at once at a high rate

Answer:

Explanation:

1=i

4=d

5=m

6=c

8=o

9=j

10=a

13=b

14=h

15=l

Theses are the ones i knew

If the density of ocean water at a depth of 10,000 m is 1.071 g/ml and if 25.0 g of water at that depth contains an additional 190 mg of KCl,  the molarity of KCl will be 0.109M.

Given data:

Depth= 10000m

Density= 1.071 g/ml

M (water)= 25g

M (KCl) = 190mg

Volume can be determined by using the formula:

Volume= Mass/Density

= 25/1.071 = 23.34ml

It is known that:

No of moles= Mass/ Molar Mass

Molar Mass of KCl= 74.5 g/mol

Now, put the value of mass and molar mass in above formula:

n =  0.190/74.5

  = 0.002550 moles

Molarity of KCl= no of moles/volume(L)

= 0.002550/23.34* 10⁻³

= 0.109 M

Therefore, the molarity of KCl will be 0.109 M.

To know more about Molarity

https://brainly.com/question/20814260

#SPJ1

Answer:

yay well done good job keep going

An endothermic reaction feels cold to the touch because the reaction absorbs heat from its surroundings. When you touch the vessel in which the reaction occurs, you, as part of the surroundings, transfer heat to the system, which makes you feel cold.

The heat absorbed by the reaction does not increase its temperature but rather becomes potential energy stored in chemical bonds. In an endothermic reaction, energy is required to break the existing bonds in the reactants, and this energy is absorbed from the surroundings. As a result, the surroundings lose heat, leading to a decrease in temperature. When you touch the vessel, heat is transferred from your body to the system, further contributing to the cooling effect. However, this heat does not raise the temperature of the reaction itself but instead becomes potential energy, stored in the newly formed bonds of the products. Therefore, the sensation of coldness when touching an endothermic reaction vessel is due to the heat transfer from your body, which is utilized to fuel the energy requirements of the reaction, rather than directly increasing the reaction's temperature.

For more such questions on  endothermic reactions

https://brainly.com/question/1160007

#SPJ8

Answer:

The number of moles of O atom in \((7.9\times10^{-1})\) mol of \(CO_{2}\) = 1.6

Explanation:

1 molecule of \(CO_{2}\) contains 2 atoms of O

So, \((6.023\times 10^{23})\) molecules of  \(CO_{2}\) contains \((2\times6.023\times10^{23})\) atoms of O.

We know that 1 mol of an atom/molecule/ion represents \(6.023\times10^{23}\) numbers of atoms/molecules/ions respectively.

So, \((6.023\times 10^{23})\) molecules of  \(CO_{2}\) is equal to 1 mol of \(CO_{2}\).

\((2\times6.023\times10^{23})\) atoms of O is equal to 2 moles of O atom.

Hence, 1 mol of \(CO_{2}\) contains 2 moles of O atom.

Therefore, \((7.9\times10^{-1})\) mol of \(CO_{2}\) contains \((2\times7.9\times10^{-1})\) moles of O atom or 1.6 moles of O atom.

The shorthand electron configuration of a potassium ion (k ) is

[Ar] 4s1.

The shorthand electron configuration of a potassium ion (K+) is [Ar] 4s1. This means that the electron configuration is based on the electron configuration of Argon (Ar), which is a noble gas immediately preceding potassium in the periodic table. The electron configuration of Argon is [Ar] 3d10 4s2. To form a potassium ion, one electron is removed from the 4s orbital, leaving [Ar] 4s1. This is the shorthand electron configuration of a potassium ion.

To know more about electronic configuration please refer:

https://brainly.com/question/29757010

#SPJ4

The power output of the circuit is the product of the voltage and current passing through the circuit. Hence the power of the speaker carrying a current of 6.4 A when connected to 120 V is 768 W.

Power is the rate of work done. Its unit is Watt. Power of a device is directly proportional to the current, voltage as well as to the resistance.

The expression relating the power, current and resistance is:

P = I² R

According to Ohm's law, V = I R

Thus, P = I V.

Given that, voltage V = 120 V

current I  = 6.4 A.

Thus power  P = 120 V × 6.4 A = 768 W.

Therefore, the power of the speaker carrying a current of 6.4 A when it is connected to 120 V source is 768 Watt.

To find more on power, refer here:

https://brainly.com/question/9338858

#SPJ1

Answer:

2 are number of coloum o

Answer:

protons

Explanation:

The number of protons in the nucleus determines which element an atom is, while the number of electrons surrounding the nucleus determines which kind of reactions the atom will undergo.

True. Do not use oil-based products such as Vaseline and body lotions because they destroy latex. Latex is a natural rubber, and when it comes into contact with oil-based products, it reacts chemically.

This reaction causes latex to degrade and lose its elasticity, making it prone to breakage. Therefore, it is important to avoid oil-based products when using latex products, such as condoms, gloves, and other medical supplies. Instead, use water-based products that are safe to use with latex. Water-based products are gentle on the skin and do not react chemically with latex, making them ideal for use with latex products.

learn more about chemically

https://brainly.com/question/12145141

#SPJ11

The correct statement regarding the delta of the option presented in Exhibit 3 is: "Delta is -0.4024 for the first step and is different for the second step." Option B is Correct.

This indicates that the delta value changes over time and is not constant for both steps. Hess' law states that when the primary reaction is conducted at the same temperature, all intermediate reactions that can be divided into the main reaction have standard enthalpies that add up to the same value.

The enthalpy change for a reaction is independent of the number of possible ways a product might be created if the starting and finishing conditions are the same. A reaction's negative enthalpy change denotes an exothermic process, whereas a reaction's positive enthalpy change denotes an endothermic activity.

Because the energy required for each stage of the process is the same, a reaction that occurs in just one step will have the same enthalpy as a reaction that occurs in several phases. The enthalpy of a reaction does not rely on the reaction route, according to Hess's law.

Learn more about Hess' law here

https://brainly.com/question/29889549

#SPJ11

Which of the following is true regarding the delta of the option presented in exhibit 3?

A. delta is -0.7357 for the first step and it changes over time.

B. delta is -0.4024 for the first step and is different for the second step

C. delta may be 1.00 in the second step delta will be the same for both steps

Yes, it is possible to make an aqueous solution of strontium hydroxide that gives a pOH of 10.54 because of thr Sr ions in the solution.

First, we can use the relationship between pH and pOH,

pH + pOH = 14

Since we want a pOH of 10.54, we can solve for the pH,

pH = 14 - pOH

pH = 14 - 10.54

pH = 3.46

Next, we can use the ionization constant expression for strontium hydroxide,

Sr(OH)₂(s) → Sr²⁺(aq) + 2OH⁻(aq)

Kw = [H⁺][OH⁻] = 1.0 x 10⁻¹⁴

Hence, the concentration will be given as,

[OH⁻] = 2[Sr²⁺]

Substituting this expression into the Kw expression, we get,

Kw = [H⁺][OH⁻] = [H⁺] (2[Sr²⁺])

1.0 x 10⁻¹⁴ = [H⁺] (2x)

where x is the molar concentration of strontium ions.

Solving for x, we get,

x = 1.0 x 10⁻¹⁴ / 2

x = 5.0 x 10⁻¹⁵

Therefore, the molar concentration of strontium ions in solution is 5.0 x 10⁻¹⁵ M.

To know more about pOH value, visit,

https://brainly.com/question/22664380

#SPJ1

Answer:

A

Explanation:

The amount of work is a strong factor that changes production.

Reflecting telescopes are preferred for scientific research because they are better suited for gathering large amounts of light and producing high-quality images. However, refracting telescopes are still popular for amateur astronomers and for viewing objects on Earth.

Reflecting telescopes are different from refracting telescopes because reflecting telescopes use mirrors, whereas refracting telescopes use lenses. The reflecting telescope was invented in 1668 by Sir Isaac Newton, and it has since become one of the most popular types of telescopes.
Reflecting telescopes use a mirror to gather and focus light, while refracting telescopes use a lens to do the same thing. Reflecting telescopes can be made much larger than refracting telescopes because it is easier to make large mirrors than it is to make large lenses. The mirror in a reflecting telescope is placed at the back of the telescope, and it gathers and reflects light back to a secondary mirror, which then reflects the light to the eyepiece. The eyepiece is where the observer looks through the telescope.In contrast, the lens in a refracting telescope is placed at the front of the telescope, and it gathers and bends light as it passes through. The lens focuses the light onto an eyepiece at the back of the telescope. Refracting telescopes are generally smaller than reflecting telescopes because of the difficulty of making large lenses.
Another difference between reflecting and refracting telescopes is the way they are constructed. Reflecting telescopes have a simple tube that houses the mirrors and eyepiece, while refracting telescopes have a more complex design with a long tube that contains the lens and eyepiece.

for such more questions on telescopes

https://brainly.com/question/28359353

#SPJ8

There would be Chemical reaction in the bottle.(NH4)2CO3 + H2O = 2NH4OH + CO2.There is ammonium carbonate present, as evidenced by the formation of white crystals inside the bottle.

Learn more about ammonium carbamate refer to :

https://brainly.com/question/14816590

#SPJ4

The heat evolved or absorbed in an open system, where reactants and products are constantly in contact with their environment and there is constant pressure, is equivalent to the change in enthalpy.

Under conditions of constant pressure, the change in enthalpy of the reacting species equals the amount of heat evolved or absorbed in a chemical reaction. This is referred to as the reaction's enthalpy change (H). A thermodynamic property called enthalpy (H) denotes a system's overall heat capacity. The difference between the enthalpy of the products and the reactants determines the change in enthalpy of a reaction. The heat evolved or absorbed in an open system, where reactants and products are constantly in contact with the environment and there is constant pressure, is equivalent to the change in enthalpy (H), because the heat is being exchanged with the environment. The name of this law is Hess's Law.

To know more about heat, here:

https://brainly.com/question/13860901

#SPJ4

Without more information about the synthesis process and the specific substances used, it's difficult to say exactly what the solid or oil that was not soluble in hexanes might be. However, there are a few possibilities to consider.

One possibility is that the solid or oil is an impurity that was introduced during the synthesis process. For example, it could be a side product or a reactant that did not fully react with the adipoyl chloride. In this case, the substance may not be soluble in hexanes because it has different chemical properties than the desired product.

Another possibility is that the substance is a byproduct of the reaction between the adipoyl chloride and another substance, such as a solvent or a catalyst. In this case, the substance may not be soluble in hexanes because it has a different chemical structure than the desired product and is not compatible with hexanes.

Alternatively, it's possible that the solid or oil is a form of the adipoyl chloride itself. For example, if the adipoyl chloride was not fully purified or if it was synthesized using impure starting materials, it could contain other compounds that are not soluble in hexanes.

Overall, without more information about the synthesis process and the specific substances used, it's difficult to determine the exact nature of the solid or oil that was not soluble in hexanes. Further analysis, such as chromatography or spectroscopy, may be necessary to identify the substance and determine its origin.

Answer:

hydroxide is the one because it is the one HAHAH

Answer:

hydroxide, OB

Explanation:

hydroxide,OB

Answer:

motion of molecules because we gonna see which one is in a solid state and what's so ever

Detergent, ethanol, and salt can all play important roles in extraction processes, depending on the specific type of biomolecule being extracted and the purification needs.

Detergent, ethanol, and salt can all play important roles in different types of extraction processes. Here's an overview of how each of them can be used:

Detergent: Detergents are often used to extract proteins or other biomolecules from biological samples. Detergents are able to solubilize membrane-bound proteins by disrupting the lipid bilayer of the cell membrane. This allows the proteins to be extracted into a solution. Detergents can also help to break apart protein complexes, making it easier to isolate individual proteins.

Ethanol: Ethanol is commonly used as a solvent in extractions because it can dissolve a wide range of organic compounds, including lipids and proteins. Ethanol can also be used to precipitate DNA or RNA from a solution. When added to a solution of DNA or RNA, ethanol causes the nucleic acids to clump together and form a visible precipitate, which can then be collected and further purified.

Salt: Salt is often used in DNA and RNA extractions to help remove proteins and other impurities from the sample. When salt is added to a solution, it can cause proteins to denature and precipitate out of the solution. The salt can then be removed along with the precipitated proteins. In addition, salt can help to bind DNA or RNA to a solid support, such as a column or a membrane, making it easier to isolate the nucleic acid from other components of the sample.

In summary, detergent, ethanol, and salt can all play important roles in extraction processes, depending on the specific type of biomolecule being extracted and the purification needs. Detergents are useful for solubilizing proteins, ethanol can dissolve a wide range of organic compounds, and salt can help to remove impurities and bind DNA or RNA to a solid support.

To know more about ethanol please refer: https://brainly.com/question/25002448

#SPJ4

0.114 mol of \(H_2SO_4\) need to react with all of this KOH

Balance Equation:

\(2 KOH ( aq ) + H 2 SO 4 ( aq ) \rightarrow K_2 SO_4 ( aq ) + 2 H_2 O ( l ) .\)

from the Equation we know that 2 mol of KOH react with 1 mole of sulphuritic acid.

so

moles of h2so4 = Moles of KOH/ 2

=0.228/2 = 0.114 moles

0.114 mol of \(H_2SO_4\) need to react.

To learn more about  neutralization reaction refer,

https://brainly.com/question/15255706

#SPJ4

To deposit 10.5 g of copper onto the surface of an electrode from a solution of cu2, 0.3297 faradays is needed.

Given the mass of copper (m) = 10.5g

It is known that the molar mass of copper (M) = 63.5g

To deposit copper onto the surface of an electrode from a solution of cu2

Cu -> Cu2+ + 2e-

One mole of Cu2+ in the electrolysis requires the passage of two moles of electrons, according to the stoichiometry of this equation.

Here 2e- are released from the solution such that

1Cu release faradays of = 2/M = 2/63.5 = 0.0314

Then 10.5g of copper release faradays = 10.5 x 2/63.5 = 0.3297

To learn more about copper click here https://brainly.com/question/13677872

#SPJ4

Answer:

21.92 gm

Explanation:

A 1.5 M  solution would have 1.5 * 58.44 = 87.66 gm per liter

   you only need 1/4 of this (250 ml)    =  21.92 gm

Answer:

Microwave or Radio waves

Explanation:

Sodium(Na) is the limiting reagent.

The reactant that is totally consumed during a reaction, or the limiting reagent, decides when the process comes to an end. The precise quantity of reactant required to react with another element may be estimated from the reaction stoichiometry.

How do you identify a limiting reagent?

The limiting reactant is the one that is consumed first and sets a limit on the quantity of product(s) that can be produced. Calculate how many moles of each reactant are present and contrast this ratio with the mole ratio of the reactants in the balanced chemical equation to get the limiting reactant.

Start by writing the balanced chemical equation that describes this reaction

\(2Na_{(s)} + Cl_{2 (g)} -- > 2NaCl_{(s)}\)

Notice that the reaction consumes 2 moles of sodium metal for every 1 mole of chlorine gas that takes part in the reaction and produces 2 moles of sodium chloride.

now we can see that we have 3 moles of sodium and 3 moles of chlorine, according to question. so, we can say that sodium is the limiting reagent in the given situation.

to learn more about Limiting Reagent go to - https://brainly.com/question/14222359

#SPJ4

The balanced equation for this reaction is:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

Learn more about the condensation reaction:

brainly.com/question/6256866

#SPJ11

The rate constant of a first-order reaction that takes 555 seconds for the reactant concentration to drop to half of its initial value is 1.2 x 10^-3 sec^-1.

A first-order reaction refers to a chemical reaction in which the rate of reaction is proportional to the concentration of the reactant. In other words, doubling the reactant concentration doubles the reaction rate.

The time taken that is taken for original population of radioactive atoms to decay to half of initial value is called the half-life. The half-life of a first-order reaction is a constant that is related to the rate constant (k) for the reaction given by: t1/2 = 0.693/k. Radioactive decay reactions are first-order reactions.

According to the provided information, t1/2 = 555 seconds

Hence,

555 = 0.693/k

k = 0.693/555 = 0.0012486 = 1.2 x 10^-3 sec^-1

Learn more about First-order reaction:

brainly.com/question/518682

#SPJ4