What element is represented by the following electron configuration?

What Element Is Represented By The Following Electron Configuration?

Answers

Answer 1

Answer:

Cobalt

Explanation:

From the question given above, the following data were obtained:

Electronic configuration of element => 1s² 2s²2p⁶ 3s²3p⁶ 4s²3d⁷

Name of the Element =?

Next, we shall determine the number of electrons in the atom of the element. This can be obtained as follow:

Number of electron = 2 + 2 + 6 + 2 + 6 + 2 + 7

Number of electron = 27

Next, we shall determine the number protons in the atom of the element. This can be obtained as follow:

For a ground state element,

Number of Proton = number of Electron

Number of electrons = 27

Number of proton = Number of electron = 27

Number of protons = 27

Therefore, the number of protons in the atom of the element is 27

Next, we shall determine the atomic number of the element. This can be obtained as follow:

The atomic number of an element is simply the number of protons in the atom of the element. Mathematically,

Atomic number = proton number

Number of proton = 27

Finally, we shall determine the name of the element as follow:

Comparing the atomic number of the element (i.e 27) with those in the periodic table, the element is Cobalt since no two elements have the same atomic number.


Related Questions

Given a concentration of a solution, determine the amount of solute. Percent volume to volume is the ratio of the volume of solute to the volume of the entire solution. A beer that is 2.50% (vlv) alcohol has mL of ethanol per glass (250.0 mL) of beer: mL 2 3 5 8 +/- X100

Answers

A beer that is 2.50% (vlv) alcohol has 6.25 mL of ethanol per glass (250.0 mL) of beer.

"Percent volume to volume" (vlv) is a way to express the concentration of a solution. It is defined as the volume of solute divided by the volume of the entire solution, multiplied by 100%.

In this case, we are given that a beer is 2.50% (vlv) alcohol. This means that the volume of ethanol in the beer is 2.50% of the total volume of the beer.

To calculate the amount of ethanol in a 250.0 mL glass of beer, we can use the following formula:

Volume of ethanol in mL = Percent vlv x Volume of solution in mL / 100

Plugging in the given values, we get:

Volume of ethanol in mL = 2.50 x 250.0 / 100 = 6.25 mL

Therefore, a beer that is 2.50% (vlv) alcohol has 6.25 mL of ethanol per glass (250.0 mL) of beer.

Learn more about volume here:

https://brainly.com/question/1578538

#SPJ4

4. How many grams is 3 moles of H₂O?

Answers

Answer:

1.67

Explanation:

Mass÷mr=moles

3÷18=1.67

The diagram shows the process of the water cycle on Earth. Heat from the Sun causes water to evaporate: the liquid water turns into water vapor. The water vapor eventually cools in the atmosphere and becomes clouds. These clouds eventually precipitate. Explain how this diagram relates to what you observed in the biome.

The diagram shows the process of the water cycle on Earth. Heat from the Sun causes water to evaporate:

Answers

The diagram below shows the different aspects of the water cycle, such as how water is observed by plants and how it is carried around by the atmosphere.

The diagram relates to a cactus biome.

Cactuses are still plants,

We have several characteristics that make cactus a plant:

1. Photosynthesis

Unlike other plants that photosynthesize with their leaves, cacti do so with their stems. At night, they take in carbon dioxide, which is then used during the day.  

2. The stem succulent

A cactus is classified as a succulent. In other terms, a succulent is a plant that has thick juicy stems or leaves that store water. A cactus stores its water in stems, and some species are adapted to arid areas.  

3. Special skin surface

One attribute that makes cacti not lose a lot of water is the fact that they have waxy surfaces that prevent evaporation. Some species also have ribbed surfaces that prevent splitting even when the plant expands during desert rainstorms.

4. Cactus spines

Cacti have spines that protect them from being eaten by animals. The spines also act as insulation during the dry seasons.

How do cactuses survive in the desert?

A cactus is able to survive in the desert due to the following features:

It has long roots that go deep inside the soil for absorbing water.

Its leaves are in the form of spines to prevent water loss through transpiration.

Its stem is covered with a thick waxy layer to retain water.

This shows how cactuses can survive without water and this relates to what the diagram shows however, the diagram shows that rain takes a part in the water cycle, whereas for cactuses, they don't need much water due to their extreme adaptivity.

But there are some similarities too, for example cactuses are still plants so they still photosynthesise and give us oxygen and whatnot.

Forgive me if this is wrong, I tried my best <3 Have a great day

(Forgive me if this is too long just use the important part)

Water cycle balance the water content in all spheres of earth through a repetitive cyclic process. It can be observed from the biome that, the water evaporated from water  resources are precipitating out as rain.

What is water cycle ?

Water cycle is a geological process by which the water content in hydrosphere, atmosphere and biosphere is balanced through a repetitive cyclic process.

The heat radiated from sun causes the water resources to warm up by convection currents. The water evaporates out to atmosphere and rises above.

The warm water then cools down by condensation and precipitates out as rain to the earth surface and water bodies. This process is taking place cyclically to maintain the water content in all spheres of earth.

Find more on water cycle :

https://brainly.com/question/1151425

#SPJ3

Please please help help me please help me

Please please help help me please help me

Answers

Answer:

the noble gas configuration for sodium is 3s^1

Explanation:

Give one example of a question that science could test. Then, explain in your own words why it is an example of a scientific question. Please!

Answers

Answer:

Questions are an essential part of science. ... They state the final question in a way that can be answered by investigation or experiment. A good scientific question is: “What effect does the pH of water have on radish seed germination?” Good scientific questions are defined, measurable, and controllable.

If a less concentrated initial solution of sodium bicarbonate was used in beaker C, would that solution require more or less bicarbonate to neutralize the acid? Why?

Answers

If a less concentrated initial solution of sodium bicarbonate was used in beaker C, it would require more bicarbonate to neutralize the acid.

What is concentrated?

Concentrated means something that has been increased in strength or power by reducing its volume. It can refer to a solution that has a higher concentration of solutes than the original solution, a sound that is louder or stronger, or a force that is more powerful or intense. Concentrated can also refer to a person’s focus or attention on one particular thing, when their thoughts and energy are directed to a single point.

This is because the concentration of sodium bicarbonate determines how much of the acid can be neutralized by the solution. If the initial solution is less concentrated, then it will take more of the bicarbonate to neutralize the same amount of acid.

To learn more about concentrated
https://brainly.com/question/30558048
#SPJ1

If 9.8 g of sulfuric acid dissolved in excess quantity moles of hydrogen ion of water, it will yield (H+) and A. 0.1, 0.2 B. 0.1, 0.3 C. 0.2, 0.4 D. 0.2,0.1 mole of sulphate ions (SO4-2)​

Answers

If 9.8 g of sulfuric acid is dissolved in excess quantity moles of hydrogen ion is 0.1, 0.2. The correct option is A.

What are moles?

The mole is a SI unit of measurement that is used to calculate the quantity of any substance.

Molar mass H₂SO₄ = 98 g/mol

9.8 g H₂SO₄ = 0.1 mol

H₂SO₄ produces 2 H+ ions

Therefore, [H+] = 0.2 M

Number of H+ ions = 0.2 x 6.022 x 10²³ = 1.20 x 10²³ H+ ions

H₂SO₄ dissociates in 2 steps

The first dissociation is complete because H₂SO₄ acts as a strong acid here

H₂SO₄ → H+ + HSO₄-

Thus, the 0.1 mol H₂SO₄ will produce 0.1 mol H+ and the moles of sulfate ion is 0.2. The correct option is A.

To learn more about moles, refer to the link:

https://brainly.com/question/14295820

#SPJ1

take it before its gone​

Answers

Hello my friend thank you

What are the possible values of 1 and m for
n=4 ?​

Answers

Answer:

If n = 4, then the possible values of 1 and m depend on the equation or expression being used. Without more information, it is impossible to determine what the possible values of 1 and m might be. Can you please provide more context or information about the problem you are trying to solve?

subject: science

what is radiation?​

Answers

Answer:

Definition: - Radiation is the emission or transmission of energy in the form of waves or particles through space or through a material medium.

Example: A burning candle emits radiation in the form of heat and light.

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

please help asap!

3. A double replacement reaction occurs between two solutions of lead (II) nitrate and potassium bromide. Write a
balanced equation for this reaction-identifying the product that will precipitate, and the product that will remain in
solution.
a) Write the balanced equation for this double replacement reaction.
b) If this reaction starts with 32.5 g lead (II) nitrate and 38.75 g potassium bromide, how many grams of the
precipitate will be produced? Remember to use the limiting reactant to calculate the amount of precipitate
formed.
c) How many grams of the excess reactant will remain?

please help asap!3. A double replacement reaction occurs between two solutions of lead (II) nitrate and

Answers

Answer:

Explanation:

a) The balanced equation for the double replacement reaction between lead (II) nitrate and potassium bromide is:

Pb(NO₃)₂(aq) + 2KBr(aq) → PbBr₂(s) + 2KNO₃(aq)

In this reaction, lead (II) bromide (PbBr₂) will precipitate, while potassium nitrate (KNO₃) will remain in solution.

b) To determine the amount of precipitate produced, we need to first determine the limiting reactant. We can do this by calculating the number of moles of each reactant and comparing it to the stoichiometry of the balanced equation.

The molar mass of lead (II) nitrate is 331.21 g/mol and the molar mass of potassium bromide is 119.00 g/mol.

The number of moles of lead (II) nitrate is 32.5 g / 331.21 g/mol = 0.0981 mol The number of moles of potassium bromide is 38.75 g / 119.00 g/mol = 0.3256 mol

According to the balanced equation, one mole of lead (II) nitrate reacts with two moles of potassium bromide to produce one mole of lead (II) bromide. This means that if all the lead (II) nitrate were to react, it would require 0.0981 mol * 2 = 0.1962 mol of potassium bromide.

Since we have more than enough potassium bromide (0.3256 mol > 0.1962 mol), lead (II) nitrate is the limiting reactant.

The number of moles of lead (II) bromide produced will be equal to the number of moles of lead (II) nitrate consumed, which is 0.0981 mol.

The molar mass of lead (II) bromide is 367.01 g/mol, so the mass of lead (II) bromide produced will be 0.0981 mol * 367.01 g/mol = 36.0 g.

c) To determine the amount of excess reactant remaining, we need to subtract the amount consumed from the initial amount.

The number of moles of potassium bromide consumed is half the number of moles of lead (II) nitrate consumed, which is 0.0981 mol / 2 = 0.04905 mol.

The mass of potassium bromide consumed is 0.04905 mol * 119.00 g/mol = 5.84 g.

The mass of potassium bromide remaining is 38.75 g - 5.84 g = 32.91 g.

What will weigh more when a chemical change is complete

Answers

when a chemical change is complete the reactant before the chemical reaction and the product after the chemical reactant will weigh same.

According to the law of mass of conservation : the mass in the chemical reaction is neither be created nor be destroyed. This means the the total mass of the reactant before the chemical reaction and the mass of the product after the reaction is same. we can say that atoms in the reactant side is equal to the atoms in the product side.

Thus, when a chemical change is complete the reactant before the chemical reaction and the product after the chemical reactant will weigh same.

To learn more about law of conservation of mass here

https://brainly.com/question/19185557

#SPJ1

Class 8 chemistry : metals and non metals describe the process of formation of coal in the nature

Answers

Explanation:

Coal is formed when dead plantand animals matter decays into peat and is converted into coal by the heat and pressure of deep burial over millions of years.

The transfer of thermal energy from a warmer object to a cooler object is called

A heat
B temperature
C kinetic energy
D radiation

Answers

Answer:

c

Explanation:

somehow i didnt have to look this up to help u lol i learned this is 6th grade

4. Which formula represents the binary molecular compound dinitrogen tetroxide?
O N₂0
ON₂04
O NO4
O N₂02

Answers

N₂0₄ is the formula represents the binary molecular compound dinitrogen tetroxide. Therefore, option B is correct.

What is the binary molecular compound ?

Binary molecular compounds are made up of exactly two nonmetal elements. HF, NO2, and P2O5 are a few examples. It is extremely simple to name binary molecular compounds. The first element is given its element name, followed by ide; the second element is given its root (hydr, bor, carb, ox, fluor, etc.).

In N₂0₄ molecule there are two nitrogen atoms at the suffix so, it is binary and in oxygen atom its suffix is 4 so, it is tetroxide. Therefore, N₂0₄ is the formula represents the binary molecular compound dinitrogen tetroxide.

Thus, option B is correct.

To learn more about the binary molecular compound, follow the link;

https://brainly.com/question/7960132

#SPJ1

Which component of the steam sterilizer is the coolest?

Answers

Answer:

Thermostatic valve

Explanation:

"Is located in the drain line; the drain and the area surrounding it are the coolest areas in the sterilizer. A sensor in the chamber drain measures steam temperature and automatically controls the flow of air and condensate from the sterilizing chamber."

Hope this helps

Partner A: Writer.
Partner B: Calculato
1. How many moles of bromine are in 2.8 L at 1.38 atm and 327 K?

Answers

The number of moles of the gas can be determined using ideal gas equation. The number of moles of Br gas in 2.8 L at 1.38 atm and 327 K is 0.144 moles.

What is ideal gas equation ?

Ideal gas law states the relation between temperature, pressure and volume with the number of moles of a gas as written below:

PV = nRT

where, R is the universal gas constant equal to 0.082 L atm/K mol

Given that, T = 327 K

P = 1.38 atm

V = 2.8 L.

Then, n = PV/RT

Number of moles of Br gas, n = (1.38 atm ×2.8 L)/(327 K × 0.082 L atm/K mol ) = 0.144 moles.

Therefore, the number of moles of Br gas in in 2.8 L at 1.38 atm and 327 K is 0.144 moles.

Find more on ideal gas law:

https://brainly.com/question/13821925

#SPJ1

(c) 45 g C,H, react with 45 g Cl₂ according to the equation:
Cl₂ + C6H6 C6H5Cl + HCI. What is the limiting reactant? What mass of HCI will be produced?
-

Answers

In the given reaction, the limiting reactant is C₆H₆ (benzene).

To determine the limiting reactant as well as calculate the mass of HCl produced, compare the moles of each reactant.

The number of moles for each reactant:

Molar mass of Cl₂ = 35.5 g/mol + 35.5 g/mol = 71 g/mol

Moles of Cl₂ = mass of Cl₂ / molar mass of Cl₂

                     = 45 g / 71 g/mol

                     = 0.634 moles of Cl₂

Molar mass of C₆H₆ (benzene) = 12 g/mol + 6(1 g/mol) = 78 g/mol

Moles of C₆H₆ = mass of C₆H₆ / molar mass of C₆H₆

                        = 45 g / 78 g/mol = 0.577 moles of C₆H₆

Determine the stoichiometry between Cl₂ and HCl:

Cl₂ + C₆H₆ → C₆H₅Cl + HCl

Here, we can see that 1 mole of Cl₂ produces 1 mole of HCl.

Thus, the limiting reactant is C₆H₆ (benzene).

Calculate the mass of HCl produced:

Molar mass of HCl = 1 g/mol + 35.5 g/mol = 36.5 g/mol

Moles of HCl produced = moles of C₆H₆ = 0.577 moles

Mass of HCl produced = moles of HCl produced × molar mass of HCl

Mass of HCl produced = 0.577 moles × 36.5 g/mol

                                     ≈ 21.04 g

Therefore, approximately 21.04 grams of HCl will be produced.

For more details regarding limiting reactant, visit:

https://brainly.com/question/10090573

#SPJ1

How is an athlete's body different from a healthy body? Discuss what you learned in class today.

Answers

Answer:

Lower Heart Rate

Athletes' heart rates tend to be lower than heart rates of non-athletes. A low resting heart rate is generally a sign of good cardiovascular fitness and efficiency. A well-trained athlete may have a normal resting heart rate of only 40 beats per minute, compared with the average heart rate that ranges from 60 to 100 beats a minute.

Lower Disease Risk

Athletic types may have better overall health and be less apt to develop certain diseases. Regular exercise boosts your immune system and lowers the risk of serious health conditions such as cancer and heart disease. Physical activity can also reduce the risk of type 2 diabetes and osteoporosis while helping to manage cholesterol levels and blood pressure. You gain about two hours of additional life expectancy for each hour of regular exercise, according to the American Heart Association.

Psychological Effects

Athletes may have better mental clarity and focus than non-athletes. Exercise increases the flow of oxygen, which has a direct impact on brain function, explains the American Heart Association. Exercise can help improve your memory and reduce negative feelings, such as anger, tension, anxiety and depression.

A comprehensive study of the academic performance of North Carolina high school student-athletes in North Carolina over a three-year period attests to the positive psychological effects of athletic capabilities. Researchers discovered obvious differences between athletes and non-athletes. The study of nearly 127,000 high school students found dropout rates were lower and grade point averages were higher in students who participated in sports. The study was led by Dr. Roger Whitley in collaboration with the North Carolina High School Athletic Association.

Motivated by Excellence

Athletes, especially competitive athletes, have high ambitions. It's a trait that allows them to persevere through setbacks and failures and to come out the other side stronger. Athletes are highly motivated individuals who set their sights on a prize and are single-minded in their pursuit of excellence. They are propelled by passion to become the best they can be and the benefits of that inner drive are a higher level of self-esteem and confidence.

Explanation:

30 example of redox reaction

Answers

Sure! Here are 30 examples of redox reactions:
1. Combustion of gasoline in a car engine
2. Rusting of iron
3. Photosynthesis in plants
4. Respiration in animals
5. Corrosion of metals
6. Bleaching of hair with hydrogen peroxide
7. Formation of ozone in the atmosphere
8. Electroplating of metals
9. Burning of wood
10. Reaction between bleach and ammonia
11. Reaction between copper and nitric acid
12. Reaction between iron and hydrochloric acid
13. Reaction between zinc and sulfuric acid
14. Reaction between magnesium and hydrochloric acid
15. Reaction between aluminum and hydrochloric acid
16. Reaction between sodium and water
17. Reaction between potassium and water
18. Reaction between lithium and water
19. Reaction between calcium and water
20. Reaction between barium and water
21. Reaction between copper and silver nitrate
22. Reaction between lead and silver nitrate
23. Reaction between zinc and copper sulfate
24. Reaction between iron and copper sulfate
25. Reaction between magnesium and copper sulfate
26. Reaction between aluminum and copper sulfate
27. Reaction between sodium and chlorine
28. Reaction between magnesium and chlorine
29. Reaction between aluminum and chlorine
30. Reaction between zinc and hydrochloric acid.

How much MnO2(s) should be added to excess HCl(aq) to obtain 195 mL Cl2(g) at 25 °C and 715 Torr g

Answers

THIS IS THE COMPLETE QUESTION

Chlorine can be prepared in the laboratory by the reaction of manganese dioxide with hydrochloric acid, HCl(aq), as described by the chemical equation.

How much MnO2(s) should be added to excess HCl(aq) to obtain 185 mL of Cl2(g) at 25 °C and 715 Torr?

Answer:

0.62901mol of MnO2(s) should be added

Explanation:

Given:

P = 715/760 = 0.94078atm

v=195ml=0.195l

n = ? moles have to find

R = 0.0821 L atm/K/mole

T = 25 + 273 = 298 K

Then we will make use of below formula

PV = nRT

Insert the values

0.94078*0.195=n 0.0821*298

24.466n=0.1740443

n=0.174/24.466

n=0.007235 nb of moles of cl2

as 1 mole of Cl2 were obtained from 1 mole of MnO2

so 0.007235 of chlorine must have come from

0.007235 moles of MnO2

1 mole of MnO2 = 86.94 g/mole

so 0.007235 moles of MnO2== 86.94* 0.007235

=0.62901

What was the gas that form in this chemical reaction

Answers

What chemical reaction??? Very vague

Scoring Scheme: 3-3-2-1 Part II. You considered the properties of two acid-base indicators, phenolphthalein and methyl orange. Many indicators are weak acids in water and establish the equilibrium: HIn(aq)(Color 1) H2O(l) H3O (aq) In-(aq)(Color 2). Indicators change color depending on whether they are in a protonated (HIn) or unprotonated (In-) form. What is the equilibrium expression for the phenolphthalein indicator in water and what colors are the protonated and unprotonated forms of the indicator

Answers

Answer:

Explanation:

Phenolphthalein is a protonated indicator and methyl orange is a basic indicator having hydroxyl ionisable part .

Phenolphthalein can be represented by the following formula

HPh  which ionizes in water as follows

       HPh        + H₂O      ⇄    H₃O⁺      +        Ph⁻

( colourless  )                    ( pink  )

In acidic solution it is in the form of protonated Hph form which is colourless

In basic medium , it ionises to give H₃O⁺ and unprotonated  Ph⁻ whose colour is pink .

Hydrogen peroxide decomposes to water and oxygen at constant pressure by the following reaction:

2 H2O2(l) → 2 H2O(l) + O2(g) ΔH = -196 kJ

Calculate the value of q (kJ) in this exothermic reaction when 5.00 g of hydrogen peroxide decomposes at constant pressure.

Answers

The value of q (kJ) in the exothermic reaction when 5.00 g of hydrogen peroxide decomposes at constant pressure is 14.40kJ.

What is an exothermic reaction?

Exothermic reaction is the reaction in which the standard enthalpy change of the reaction is negative that is there is release of heat energy.

The q (kJ) in the exothermic reaction can be calculated as,

2 H2O2(l) ------> 2 H2O(l) + O2(g)         ΔH = -196 kJ

So, 196kJ of heat (q) will be released for every 2 moles of hydrogen peroxide. To calculate the heat released for 5.00 g of hydrogen peroxide,

Number of moles of hydrogen peroxide = 5.00g / 34.016 g/mol

n = 0.147

q = -196 x 0.147 / 2 = 14.40kJ.

Therefore, 14.40kJ of heat is released by 5.00 g of hydroxide peroxide when it decomposes in the exothermic reaction.

To learn more about exothermic reactions click on the given link https://brainly.com/question/2924714

#SPJ9

The absorption of 350 calories changes the temperature of a sample of water from 35°C to 62°C. What is the mass of the water?

Answers

The mass of water used is 50.0-g  and the precise warmness of water (C) is 1.0 cal/g °C. those values will give you the warmth gained in calories. Q = m × C × ∆T = 50.0 g × 1.zero cal/g°C × 5.three °C = 265 cal.

answer °C = 265 cal.

Measurement of heat is finished in energy. One calorie is the quantity of energy required to raise one gram of water one diploma Celsius. To degree heat, you divide the alternate temperature of a sample of water by way of the mass of the water.

Mass is constantly regular for a body. One way to calculate mass is Mass = quantity × density. Weight is the measure of the gravitational force performing on a mass. The SI unit of mass is "kilogram".

Learn more about mass here

https://brainly.com/question/19385703

#SPJ9

Two asteroids are 75,000 m apart one has a mass of 8 x 10^7 N what is the mass of the other asteroid

Answers

The mass of the asteroid is C. 1.2 x 1012 Kg

To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:

F = (G * m1 * m2) / r2

where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.

Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x 107 kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):

1.14 N = (6.67430 × 1011 N m2/Kg2 * 8 x 107 kg * m2) / (75000m)2

Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x 1012 kg. Therefore, Option C is correct.

The question was incomplete. find the full content below:

Two asteroids are 75000 m apart one has a mass of 8 x 107 kg if the force of gravity between them is 1.14 what is the mass of the asteroid

A. 3.4 x 1011 kg

B. 8.3 x 1012 kg

C. 1.2 x 1012 kg

D. 1.2 x 1010 kg

Know more about gravitational force here:
https://brainly.com/question/72250

#SPJ8

describe the dual nature of electrons (give an example)

Answers

Answer:

In 1924, the French physicist, Louis de Broglie suggested that if light has electron, behaves both as a material particle and as a wave. According to this theory, small particles like electrons when in motion possess wave properties.

Explanation:

examples

This can be derived as follows according to Planck’s equation, E = hv = hc /λ ∴ v=c/λ(energy of the photon (on the basis of Einstein’s mass energy relationship) E = mc2    

( If Bohr’s theory is associated with de-Broglie’s equation then wave length of an electron can be determined in bohr’s orbit and relate it with circumference and multiply with a whole number 2πr = nλ or λ = (2πr/2π) From de-Broglie equation, λ = (h/mv).  

WOULD YOU CONSIDER WATER AND OZONE TO BE MOLECULES ?

Answers

Answer:

yes

Explanation:

Water contains molecular bonds and because it is  made from more than one element and they are oxygen and hydrogen.

ozone would be considered a molecule because it has three oxygen atoms formed together and is 21% of the gases found on earth

Which of these 2 elements will react similarly? *
Be, CI
Na, K
O Na, Mg
Na, CI

Answers

Answer:

Na, K

Explanation:

From the given choices, the two elements that will react similarly are Na and K.

This is because, Na and K are in the same group on the periodic table.

Na and K are both called Alkali metals and they have just one electron in their outermost shell.

The number of electrons in the outermost of an atom determines their chemical properties.

Since Na and K are in the same group, they chemically combine with other atoms in similar fashion.

Other Questions
what happens to the mean of the data set {2 4 5 6 8 2 5 6} if the number 7 is added to the data set? a) the mean decreases by 1 b) the mean increases by 2 c) the mean increases by 0.25d) the mean increases by 0.75 will there be a 4th war when and why who will be fighting??????? the weight of an object on the moon is 0.167 of its weight on earth how much wuold a 180 pound astrounaut weigh on the moon "twice as old as y decreased by 10 sketch the graph of f(x)=1/x Please help!! ; Evaluate the expression.6 3A. -2B. -3C. 3D. 2 A(n) __________ should be used when you are communicating unexpected negative news, when you anticipate that you audience will be resistant to your message, or when you need to provide an explanation before your main point makes sense. Sergio and Miguel read 6 books. Write an equal comparison to say that one reads as many books as the other, in Spanish. Use their proper names. Clinical/critical thinking which smaller body cavity would be opened to perform a total knee joint replacement? Salt-tolerant plants include cordgrasses and mangroves. True or False True False c) consider binary the following classification problem with Y = K k {1, 2} At a data point > P (Y=1|x = x) =0.4. Let x be the nearest neighbour of x and P (Y = 1 | x = x) = P >0. what are the values of P Such that the 1- neighbour error at is at least O.S ? a company is configuring iam for its new aws account. there are Consider a 30-year S200,000 5/1 ARM having a 2.6% margin and based on the CMT index. Assume that is carries a payment cap of 8% and the monthly payments for the 6th year are $1448 77 at an annual interest rate of 8.1%. Also assume that the CMT index is 8.3% at the beginning of the 7th year and all interest rates are compounded monthly (a) Calculate the unpaid balance of the loan at the beginning of the 7th year (b) Calculate the monthly payment for the 7th year without using the payment cap (c) Calculate the monthly payment for the 7th year using the payment cap (d) How much interest is due for the 73rd month? (e) Determine the unpaid balance at the end of the 73rd month ? how abraham contributed to old testament story how do honeybees serve their keepers? Using the formula ln(p1/p2)=(delta H/R)(1/T2-1/T1)The normal boiling point of benzene is 80.1C, and the heat of vaporization is AHvap 30.7 kJ/mol. What is the boiling point of benzene in "C on the top of Mt. Everest where P 260 mmHg? A nurse pushes a 152 kg gurney. What is the normal force acting on the bed?Type your answer... Please help on this question for vapor pressure all the prime numbers greater than 2 are all 37 is a prime number there for 37 years old is sole trader or partnership better?