what are the products for the following equation?

ZnBr2 + F2 -> ​

Answers

Answer 1

Answer:

The products to ZnBr2 + F2 -> Znf + Br2

When we balance this equation we get the following:

2ZnBr2 + F2 -> 2Znf + 2Br2

Hope this helps !!!


Related Questions

Consider a solution initially containing 0. 50 mol ammonia (nh3) and 0. 30 mol of ammonium ion (nh4 ). What is the ph after addition of 0. 20 mol of hcl to this solution? (nh4 , ka = 5. 6 × 10–10 )?

Answers

The pH value after addition of 0.20 mol of HCl to this solution is found to be 9.03.

We can use the Henderson-Hasselbalch equation to calculate the pH of the solution after the addition of HCl,

pH = pKa + log([NH₃]/[NH₄⁺])

Initially, the concentration of NH₃ is 0.50 mol and the concentration of NH₄⁺ is 0.30 mol. After adding 0.20 mol of HCl, the concentration of NH₄⁺ increases by 0.20 mol, while the concentration of NH₃ decreases by the same amount. Therefore, the new concentrations are,

[NH₃] = 0.50 - 0.20 = 0.30 mol

[NH₄⁺] = 0.30 + 0.20 = 0.50 mol

The dissociation constant, Ka, for NH₄⁺ is 5.6 × 10⁻¹⁰.

The pKa for this system is determined from the expression,

Ka = [NH₃][H₃O⁺] / [NH₄⁺]

pKa = - log Ka

Using the given Ka value, we can calculate the pKa,

pKa = -log (5.6 × 10⁻¹⁰) = 9.25

Now, we can substitute the values for [NH₃], [NH₄⁺], and pKa into the Henderson-Hasselbalch equation,

pH = 9.25 + log(0.30/0.50)

Simplifying,

pH = 9.25 - 0.22

Therefore, the pH of the solution after the addition of HCl is approximately 9.03.

To know more about Henderson-Hasselbalch equation, visit,

https://brainly.com/question/13423434

#SPJ4

how many moles are in 564 grams of Cooper

Answers

The term mole concept is used here to determine the moles of copper. It is the convenient method for expressing the amount of the substance. The number of moles of copper in 564 grams is  8.87 moles.

One mole of a substance is defined as that quantity of it which contains as many entities as there are atoms exactly in 12 g of carbon - 12. The formula used to calculate the number of moles is:

Number of moles = Given mass / Molar mass

Molar mass of copper = 63.55 g / mol

Number of moles = 564 / 63.55 = 8.87 moles

To know more about mole concept, visit;

https://brainly.com/question/19730733

#SPJ1

Choose the correct name for each acid. Click here
to access the common polyatomic ion sheet.
HNO2:
DONE
HI:
DONE
H3PO4 :
DONE

Answers

The correct name of HNO₂, HI and of H₃PO₄ is nitrous acid, hydroiodic acid and phosphoric acid respectively.

What are acids?

Acids are those substances in which carboxylic acid (-COOH) is present and pH value of acids falls in the range of 0 to 6.9.

Name of the HNO₂ compound is nitrous acid, of HI is hydroiodic acid and of H₃PO₄ is phosphoric acid.

Hence name of the HNO₂, HI and of H₃PO₄ is nitrous acid, hydroiodic acid and phosphoric acid respectively.

To know more about acids, visit the below link:

https://brainly.com/question/24375075

#SPJ2

Answer: HNO2 nitrours acid

              HI Hydroiodic acid

               H3PO4 phosphoric acid

Explanation: edu


Which iron pot has the least thermal energy?
A. A5 kg pot at 130°C
B. A 2 kg pot at 120°C
C. A 5kg pot at 25°C
D. A 2 kg pot at 25°C

Answers

Answer: D. A 2 kg pot at 25C.

Explanation:

calculate the pka for the weak acid from the ka values given in the lab manual

Answers

To calculate the pKa for a weak acid from the Ka values given in the lab manual, use the formula pKa = -log(Ka).

The Ka value represents the acid dissociation constant, which is a measure of the strength of an acid. The pKa value, on the other hand, is the negative logarithm of the Ka value and is used to compare the relative strengths of acids. The lower the pKa value, the stronger the acid.

To calculate the pKa value from the Ka value, take the negative logarithm of the Ka value using a calculator or log table. For example, if the Ka value is 1.8 x 10⁻⁵, the pKa value would be:

pKa = -log(1.8 x 10⁻⁵) = 4.74

The Ka value represents the acid dissociation constant, which is a measure of the strength of an acid. In aqueous solution, a weak acid partially dissociates into its conjugate base and hydrogen ions. The Ka value represents the equilibrium constant for this dissociation reaction and can be expressed as follows:

HA (aq) + H₂O (l) ⇌ A⁻ (aq) + H₃O⁺ (aq)

where HA represents the weak acid, A- represents the conjugate base, and H3O+ represents the hydrogen ion. The Ka value is equal to the product of the concentrations of the products (A- and H3O+) divided by the concentration of the reactant (HA) at equilibrium. In other words:

Ka = [A⁻][H₃O⁺] / [HA]

The pKa value, on the other hand, is the negative logarithm of the Ka value and is used to compare the relative strengths of acids. The lower the pKa value, the stronger the acid. A pKa value of less than 0 indicates a strong acid, while a pKa value of greater than 14 indicates a very weak acid.

To calculate the pKa value from the Ka value, take the negative logarithm of the Ka value using a calculator or log table. For example, if the Ka value is 1.8 x 10⁻⁵, the pKa value would be:

pKa = -log(1.8 x 10⁻⁵) = 4.74

Therefore, the pKa value for the weak acid can be calculated from the Ka values given in the lab manual using the formula pKa = -log(Ka). This calculation can help determine the strength of the acid and its ability to donate protons in solution. It is important to note that the pKa value may vary depending on the solvent used and the temperature at which the measurement is made.

To know more about pKa, visit:

https://brainly.com/question/30655117

#SPJ11

A wave has a length of 380 nm. Find its frequency in Hz.

Answers

Answer:

The shortest wavelength of visible light is 380 nm. Its frequency is 7.89x1014Hz. That will be visible light’s highest frequency.

Explanation:

Is there a difference between normal, dry, and oil shampoo?

Please put the URL (the info you got from)

Answers

The main difference between normal, dry, and oil shampoo is that normal shampoo has half amount of oil, dry shampoo has no oil content and oil shampoo has a large amount of oil.

Is dry shampoo better than regular shampoo?

Experts say dry shampoo is great once but it shouldn't be a full-time replacement for washing your hair with water. Dry shampoo can be considered to be a hair freshener as compared to a hair cleaner. It does nothing to clean your scalp, which collects dirt.

Dry shampoo is not shampoo at all. The spray absorbs the oil content in your hair, making it less distinguishable. It doesn't remove oil and dirt the same way which is removed by shampoo and water.

So we can conclude that normal, dry, and oil shampoo has a different amount of oil content.

Learn more about shampoo here: https://brainly.com/question/21837237

#SPJ1

#7) How many waves are in this picture?

#7) How many waves are in this picture?

Answers

Answer:

4

Explanation:

Answer:

B.

Explanation:

I don't know much about this subject, but it seems that a wave is when the line is above the line in the middle.

Solutions that are very concentrated have greater freezing point depression Group of answer choices true or false

Answers

Answer:

Explanation:

False. The greater the concentration, the lower the freezing point.

Organic compounds form the basis of?

Answers

Answer:

1. carbon

Explanation:

carbon atoms bound to one another and other atoms by covalent bonds and found in the cells of living organisms. Hydrogen, oxygen and nitrogen are typical elements which, in addition to carbon, make up organic compounds.

the answer is carbon

What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?

Answers

The balanced equation for this reaction is:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).

Learn more about the condensation reaction:

brainly.com/question/6256866

#SPJ11

What mass of HCl would need to be added to a 250. mL solution containing 0.500 M NaC2H3O2 and 0.500 M HC2H3O2, to make the pH = 4.25? Ka of HC2H3O2 is 1.77 x 10-5.

Answers

We need to add 10.42 g of HCl to the solution to adjust the pH to 4.25.

To calculate the amount of HCl needed to adjust the pH to 4.25, we can use the Henderson-Hasselbalch equation:

pH = pKa + log([A-]/[HA])

where pH is the desired pH, pKa is the dissociation constant of HC₂H₃O₂ (1.77 x 10⁻⁵), [A-] is the concentration of the acetate ion (NaC₂H₃O₂), and [HA] is the concentration of the acid (HC₂H₃O₂).

Rearranging the equation, we get:

log([A-]/[HA]) = pH - pKa

Taking the antilog of both sides:

[A-]/[HA] = 10^(pH - pKa)

Substituting the values given in the problem:

[A-]/[HA] = 10^(4.25 - 1.77) = 133.52

We know that the initial concentrations of the acetate ion and the acid are both 0.500 M. Let x be the amount of HCl (in moles) that needs to be added to the solution. Then, the concentration of the acetate ion will remain the same, while the concentration of the acid will be reduced by x/0.250 (the new volume of the solution after adding the HCl).

Using the [A-]/[HA] ratio, we can write:

133.52 = [NaC₂H₃O₂] / ([HC₂H₃O₂] - x/0.250)

Solving for [NaC₂H₃O₂]:

[NaC₂H₃O₂] = 133.52 * ([HC₂H₃O₂] - x/0.250)

We also know that the total moles of the acid after adding the HCl must be equal to the total moles of the acid before adding the HCl plus the moles of HCl added:

0.500 mol/L * 0.250 L + x = (0.500 mol/L + 0.5x/L) * (0.250 L + 0.250 L)

Simplifying this equation:

0.125 + x = 0.375 + 0.125x

0.875x = 0.25

x = 0.2857 mol

Finally, we can calculate the mass of HCl needed:

mass = molar mass * moles = 36.46 g/mol * 0.2857 mol = 10.42 g

Therefore, we need to add 10.42 g of HCl to the solution to adjust the pH to 4.25.

Learn more about Henderson-Hasselbalch equation:

https://brainly.com/question/13423434

#SPJ4

In plants, algae, and some bacteria, energy is produced by the:

A. nucleus
B. chloroplast
C. vacuole
D. mitochondria

Answers

Answer: D?  

Explanation: The mitochondrion (plural mitochondria) is a membrane-bound organelle found in the cytoplasm of eukaryotic cells. It is the power house of the cell; it is responsible for cellular respiration and production of (most) ATP in the cell.

Why do solids expand on heating?

Answers

Explanation:

The molecules of solids are shrinked in there normal state . but as a heat energy is produced , the molecules starts curating fast and fast as temperature goes up . since they vibrate , they hit and collide each other breaking the bondings this increases the surface of area of the solid , and molecules consumes that space and they expand .

Chlorine can bond with fluorine to form ClF. Chlorine can also bond with lithium to form LiCl. Which compound will have a greater partial charge?Question 2 options:A) Both compounds will have the same partial charge.B) ClFC) LiClD) Neither compound will have partial charge.

Answers

In this question, we have two compounds, ClF and LiCl. The first molecule is a covalent compound, since we will not have donation of electrons but instead the sharing of electrons, but in this case, the difference of the electronegativity will cause this molecule to have Polar covalent bond, which will cause partial charges to occur. LiCl is a molecule in which we have a greater difference in electronegativity, which makes this molecule be an ionic molecule, and not covalent. Since ionic compounds have real charges, the only possible answer will be ClF, since they have partial charges. Letter B

Based on the balanced equation : 2 K + Cl2 → 2 KCl If you start with 4 K, how many KCl can you make?

Answers

The law of conservation of  mass is obeyed by a balanced chemical equation. The number of moles of KCl produced from 4K is 4KCl.

What is a balanced chemical equation?

An equation in which the amount of the reactants and products on both sides of the reaction are equal is defined as the balanced chemical equation. In a balanced equation the number of atoms of each element is same on both sides.

According to the law of conservation of mass, mass can neither be created nor be destroyed. All the balanced chemical equation satisfies this law.

Here when 4K is used the amount of KCl produced is given as:

4K + 2Cl₂ → 4KCl

Here there are 4 'K' atoms and 4 'Cl' atoms. Hence the number of the respective atoms are equal on both sides of the equation.

To know more about balanced equation, visit;

https://brainly.com/question/29769009

#SPJ1

How does Lori make the solution?

How does Lori make the solution?

Answers

Answer:

I would say the top one but im not confident in the answer

Calculate the overall energy change for the complete combustion of one mole of methane in oxygen

Calculate the overall energy change for the complete combustion of one mole of methane in oxygen

Answers

The overall combustion energy for the reaction is -110 kJ/mol.

What is the enthalpy of reaction?

The enthalpy of reaction, denoted as ΔH, is a measure of the heat energy exchanged or released during a chemical reaction at constant pressure. It represents the change in the internal energy of the system and is commonly referred to as the heat of reaction.

We know that the overall energy is given by;

[(2(805) + 2(464)] - [4(413) + 2(498)]

(1610 + 928) - (1652 + 996)

2538 - 2648

= -110 kJ/mol

Learn more about enthalpy:https://brainly.com/question/32882904

#SPJ1

Baking soda is a critical component of chemical spill kits. Why would a chemist need baking soda to help clean up spills?.

Answers

Baking soda or sodium bicarbonate are typically suggested by chemistry lab protocols to neutralize acid spills. Even today, to clean up the occasional tiny acid leak, the majority of working laboratories use a solution of baking soda and water.

Why is baking soda so useful?

Carbon dioxide is produced chemically when baking soda is combined with liquid, acid, and heat. Soft and fluffy baked items like cookies, pancakes, and cakes are made possible by these microscopic CO2 gas bubbles. Baking soda decreases gluten while raising pH levels.

Baking soda or sodium bicarbonate are typically suggested by chemistry lab protocols to neutralize acid spills. Even today, to clean up the occasional tiny acid leak, the majority of working laboratories use a solution of baking soda and water.

Many waters are corrosive, soft, and acidic with a pH below 6.5. So, during water treatment, sodium compounds like sodium bicarbonate are added to raise the water's pH level.

To learn more about baking soda refer to:

https://brainly.com/question/28624529

#SPJ1

question 3 a reaction equation, shown below, consumes 5.0 g of a and 6.0 g of b. how many total grams of c and d should be obtained? 1 a 3 b → 2 c 4 d

Answers

By law of conservation of mass The total grams of c and d obtained is equal tp 11 gm

When two or more molecules or compounds interact, one or more new substances are created. These chemical reactions adhere to a set of rules known as the laws of chemical combination. One of the laws of chemical combination is the law of conservation of mass

This law states that the total mass of the reactants equals the total mass of the result in any physical or chemical change (s).

That implies that mass is unaffected by the reaction both before and after it.

Thus, the mass of all reactants equals the mass of all products, and the mass of A and B equals the mass of C and D.

The mass of C and D is (5g + 6g) = 11g

To learn more about mass:

https://brainly.com/question/19694949

#SPJ4

what process takes place in stars

Answers

Answer:

Explanation:

Stars are powered by nuclear fusion in their cores, mostly converting hydrogen into helium. The production of new elements via nuclear reactions is called nucleosynthesis. A star's mass determines what other type of nucleosynthesis occurs in its core (or during explosive changes in its life cycle).

Stars are powered by nuclear fusion in their cores, mostly converting hydrogen into helium. The production of new elements via nuclear reactions is called nucleosynthesis. A star's mass determines what other type of nucleosynthesis occurs in its core (or during explosive changes in its life cycle).

Calculate the density; D= mass/ volume
1)
A student measures the mass of an
8 cm3 block of brown sugar to be 12.9 g.
What is the density of the brown sugar?
2) A chef fills a 50 mL container with 43.5 g of
cooking oil. What is the density of the oil?

Answers

Answer:

density of sugar = 1.6 g/cm³

density of oil = 0.87 g/mL

Explanation:

1)

Given data:

Mass of object = 12.9 g

Volume of object = 8 cm³

Density of brown sugar = ?

Solution:

Formula:

d = m/v

d = density of object

m = mass of object

v = volume of object

Now we will put the values in formula.

d = 12.9 g/ 8 cm³

d = 1.6 g/cm³

2)

Given data:

Mass of oil  =  43.5 g

Volume of container = 50 mL

Density of oil = ?

Solution:

Formula:

d = m/v

d = density of oil

m = mass of oil

v = volume of oil

Now we will put the values in formula.

d = 43.5 g/ 50 mL

d = 0.87 g/mL

What is the ph at the equivalence point in the titration of a 25.6 ml sample of a 0.397 m aqueous hydrofluoric acid solution with a 0.406 m aqueous potassium hydroxide solution?

Answers

In the titration of a 25.6 ml sample of a 0.397 m aqueous hydrofluoric acid solution with a 0.406 m aqueous potassium hydroxide solution, the pH at the equivalence point is 8.21.

Given volume of sample (V) = 25.6ml = 0.0256L

Concentration of  aqueous hydrofluoric acid solution (M1) = 0.397M

Concentration of  aqueous potassium hydroxide solution (M2) = 0.406M

The concentration of fluoride ions will determine the pH at the equivalency point. During the titration, the reaction is

HF + KOH --> H2O + KF.

Since it is the conjugate base of a weak acid, the F- will have an impact on the pH of the solution rather than the K+ in solution.

F- + H2O <--> HF + OH- is the reaction at the equivalence point, and the fluoride ion's molarity is 0.0256 x 0.397 = 0.010 moles of HF = moles of KOH at the equivalence point = 0.010/0.406 = 0.0246L of KOH

At the equivalence point, the F-'s molarity will be equal to =  0.010/(0.0256+0.0246) = 0.199M

Additionally, the Kb for F- is required, and its values are as follows:

Kw/Ka = 1.0 x 10-14 / (6.6 x 10-4) = 1.5 x 10-11

pOH = -log (1.8 x 10-6) = 5.79

pH = 14-5.79 = 8.21

To learn more about pH click here    https://brainly.com/question/15289741

#SPJ4

What are pros and cons of hydrogen fuel cells?

Answers

Answer:

Pros: No vehicle emissions other than water vapor. Fuel economy equivalent to about twice that of gasoline vehicles. Hydrogen is abundant, and can be made from renewable energy. Cons: This space-age technology is expensive.

Answer:

The pros of hydrogen fuel cells are that they are very efficient, producing very little waste. They are also very stable, which makes them safe to use.

The cons of hydrogen fuel cells are that they can be expensive to produce and maintain, and they require a lot of energy to power them, meaning that they often aren't as efficient as they could be.

Despite these pros and cons, hydrogen fuel cells are still a very promising technology. With more research, attention, and development, they could be a powerful force in the fight against carbon emissions and global warming.


Ethanol has a heat capacity of 2.46 Jig 'c. If 50 g of ethanol has a temperature of 30°C and a piece of hot Copper is added to the ethanol causing the
temperature to increase to 70°C. What is the amount of heat absorbed by the ethanol?

Answers

Explanation:

there it is fella tried on ma own consciousness

Ethanol has a heat capacity of 2.46 Jig 'c. If 50 g of ethanol has a temperature of 30C and a piece of

Based on its location on the periodic table, what group does Strontium belong to?

Answers

Answer:

alkaline earth metals

Explanation:

Answer:

Group 2

Explanation:

Strontium (Sr), chemical element, one of the alkaline-earth metals of Group 2 (IIa) of the periodic table.

Hope this helps

The greater the mass of the object, the greater its weight force will be.
True or false.

Answers

Answer:

True

Explanation:

The greater the mass of the object, the greater its weight force will be.

True :)))))))))))))))))))

A student has a sample of the mineral rock salt. Rock salt contains sodium chloride or 'salt',sand,and grit [small pebbles]. Describe how the student could get a sample of pure sodium chloride from the rock salt.

Answers

In order to obtain pure sodium chloride from rock, the separation techniques employed are as follows:

dissolve the rock salt in waterfilter the mixture to remove the grit or small pebblesevaporate the water in the filtrate to obtain pure sodium chloride.

What are separation techniques?

Separation techniques are the techniques or methods used for separating mixtures or substances in two different states of matter, such as liquid and solid.

Using techniques like evaporation, distillation, filtration, and chromatography, which employ variations in the components of a mixture's physical qualities to separate them, mixtures can be physically separated.

Separation techniques are useful in obtaining pure substances from impure substances. For example, filtration and evaporation can be used to obtain pure sodium chloride from rock salt.

Learn more about separation techniques at: https://brainly.com/question/24645716

#SPJ1

if, instead of using a mixture of fluorene and fluorenone in the column, you had run a column with florenone and fluorenol, which compound would elute first? explain why

Answers

If a column was run with florenone and fluorenol instead of fluorene and fluorenone, fluorenol would elute first.

The elution order in a chromatographic column is determined by the polarity and affinity of the compounds for the stationary phase. In this case, florenone and fluorenol are the compounds of interest.

Fluorenol, which is the alcohol form of fluorene, contains a hydroxyl group (-OH) attached to the aromatic ring. This hydroxyl group increases the polarity of the molecule compared to florenone, which lacks the hydroxyl group. The presence of the hydroxyl group makes fluorenol more polar and more likely to interact with the stationary phase.

In a typical chromatographic column, the more polar compounds tend to have stronger interactions with the stationary phase, resulting in slower elution times. Therefore, fluorenol, being the more polar compound, would have a stronger interaction with the stationary phase and elute later compared to florenone.

The difference in elution order between fluorenol and florenone can also be attributed to the increased hydrogen bonding potential of fluorenol due to the presence of the hydroxyl group. Hydrogen bonding interactions can further enhance the affinity of fluorenol for the stationary phase, leading to delayed elution compared to florenone.

In summary, if a column was run with florenone and fluorenol instead of fluorene and fluorenone, fluorenol would elute first. The presence of the hydroxyl group in fluorenol increases its polarity, resulting in stronger interactions with the stationary phase and slower elution compared to florenone.

To know more about chromatographic column refer here:

https://brainly.com/question/32502709#

#SPJ11

What is the oxidation state of S in H₂SO4?
OA. +8
OB. +6
OC. -4
OD. -2

Answers

Answer:

B.) +6

Explanation:

To find the oxidation number of sulfur, we can assume the oxidation numbers of the other elements.

What I mean is, oxygen (O) always has an oxidation number of (-2). That being said, if there are 4 oxygen atoms, oxygen is contributing -8 overall. We also know that hydrogen generally has an oxidation number of (+1). Like before, if there are 2 hydrogens, it must be contributing +2.

If the overall molecule is neutral, we have to get these charges to balance out.

In essence, -8 + 2 + ? = 0?

If you combine the charges from oxygen and hydrogen, you are left with -6. Therefore, to make the molecule neutral, sulfur must have an oxidation number of +6.

Other Questions
Encryption algorithms are grouped into two categories: ___________ - ___________ and asymmetric-key encryption methods. Why does calcium chloride have a greater affect on colligative properties verses sodiumchloride? Latasha has a swimming pool that needs to be drained. Her pool holds9,934.6 gallons of water and will need to drain completely in 8.4 hours.What is the change in the water level per hour for Latasha's swimmingpool? Round your answer to the nearest hundredth. Describe three big developments in e-business that will become commonplace by the year 2025. Explain why you selected each development and the impact it will have on society and on businesses. As we said, your forecasts need to be supported by the literature and the evidence. Obviously, as noted below, this will obligate you to actually be able to present such evidence in an academically respectable manner. A certain city prides itself on having sunny days. If it rains one day, there is a 95% chance that it will be sunny the next day. If it is sunny one day, there is a 28% chance that it will rain the following day. (Assume that there are only sunny or rainy days.)If today is sunny, what is the chance that it will be rain the day after tomorrow QUESTION 2 (36 marks)FreeLine Limited is a transport business with a 30 June year-end.They are in the process of finalising their 30 June 2021 financialstatements.The financial statements were pre 13x^8 Find the base When did New York become an English colony Why is the answer 2 in the subtractive equation 1+1? please help ill mark brainly Use the Laws of logarithms to rewrite the expression ln(x^10y^5z^10) in a form with no logarithm of a product, quotient orpower. excerpt from Frankenstein the creatures request 8. PART B: Which phrase from the passage supports the answer to Part A? OA I perceived, as the shape came nearer (sight db tremendous and abhorred!) that it was the wretch whomlhad created." ( Paragraph 1) B. "Begone, or let us try our strength in a fight, in which one must fall.'" ( Paragraph 7) c"The sun is yet high in the heavens; before it descends to hide itself behind your snowy precipices and illuminate another world, you will have heard my story and can decide." ( Paragraph 10) D "become the scourge of your fellow creatures and the author of your own speedy ruin." ( Paragraph 10) Will make brainliest :DTwo identical metal spheres at 8 C are put in an equal amount of water in two beakers, as shown belowHeat flows from the metal sphere to the water in Beaker A and from the water to the metal sphere in Beaker B. Which statement is correct? The temperature of the water is greater than 8 C in Beaker A. The temperature of the water is lower than 8 C in Beaker B. The temperature of the water in Beaker A will increase. The temperature of the water in Beaker B will increase. What type of injury would you suffer if your vehicle is knocked from behind, and your head restraint is not appropriately adjusted? The punnett square below shoes a cross between two pea plants. The letter Trepresents the dominant allele for tall plant height and the letter trepresents the recessiveallele for short plant height.What were the genotypes of the parents that produced these offspring? PLSSSSSSSSSSSSS HELP Welche Schlussfolgerung ber die Auswirkungen der Umweltbedingungen auf Neufrankreich untersttzt der Auszug? What is the best title for this diagram?A.Checks and balancesB.Popular Sovereignty C.Limited government D.Federlism What was the overall outcome of Operation Torch (North Africa)? Find the next three terms of each geometric sequence.8.1, -6, 36...10.3, 15, 75...12.-5, -20, -80...