WHat are 3 possible solutions for this inequality 2/3(6x-3)>6

Answers

Answer 1

Answer:

Step-by-step explanation:

2/3(6x-3)>6

4x-2>6

4x>8

x>2

Anything more than 2, so 3,4,5, etc


Related Questions


ill give brainliest help asap

ill give brainliest help asap

Answers

Answer:

x= 10.4

Step-by-step explanation:

a right angle is 90 degrees so when you subtract 39 from 90 you get 51

then take 51 and add one to get 52

and then divide 52 by 5 to get 10.4

Answer:

X= 10.4 definitely

Step-by-step explanation:

In one oty, the cost for water is $8.64 per 100 cubic feet of water. According to a study, the average shower in this city lasts 72 minutes and uses 19.1 gallons. A person showers once a day for a year. Find the total cost per year. Use theconversion factor of 7.48 gallons per cubic footThe total cost per year is $(Simplify your answer. Round to the nearest cent as needed. Do not include the $ symbol in your answer.)Enter your answer in the answer box

Answers

Annual cost for water

What do we know?

100 ft³ of water costs $8.64

The average shower in this city uses 19.1 gallons

A person showers once a day for a year.

7.48 gallons = 1 ft³

Cost per year = ?

Procedure

We first want to know how many gallons are equivalent to 100 ft³

Since 1 ft³ = 7.48 gallons if we multiply by 100 both sides, then

100 ft³ = 748 gallons

Then, 748 gallons of water costs $8.64

Secondly, we are finding how much a single shower costs.

Since the average shower uses 19.1 gallons, we find the cost of 19.1 gallon

We have the equivalences, then we divide both sides:

19.1748=?8.64

then, clearing the unknown quatity

?=8.6419.1748?=0.221

Then, the cost of one shower is $0.221

In one oty, the cost for water is $8.64 per 100 cubic feet of water. According to a study, the average

Johnny pays $5 a month to use an online ordering service for his company. He has to pay an additional $2 for each order placed. Graph the
equation y=2x+5 to model this equation

Answers

Answer:

May you send the picture of the provided graph number?

Step-by-step explanation:

Unable to answer without photo.

The equation y=2x+5 can be used to model the cost, y, that Johnny pays to use the online ordering service for his company, depending on the number of orders placed, x.

The constant term in the equation, 5, represents the fixed monthly fee Johnny has to pay regardless of the number of orders he places. The coefficient of x, 2, represents the additional cost per order. To graph this equation, we can plot points on a coordinate plane using different values of x and solve for y. Let's consider a few options: When x = 0 (no orders placed), y=2(0)+5=5 . So the point (0, 5) is on the graph. When x = 1 (one order placed), y=2(1)+5=7 . Therefore, the point (1, 7) is on the graph.

Suppose x = 3 (three orders placed), y=2(3)+5=11.  Hence, the point (3, 11) lies on the graph. Once we have a few points, we can connect them with a straight line. The graph will show that as the number of orders placed increases, the cost Johnny pays to use the online ordering service will also increase at a constant rate of $2 per order.

The line will have a positive slope and intercept the y-axis at (0, 5). In summary, the graph of the equation y=2x+5  represents the cost Johnny pays to use the online ordering service, with a fixed monthly fee of $5 and an additional charge of $2 per order placed.

To know more about coordinate plane visit:

https://brainly.com/question/13611766

#SPJ2

-7b - 4(b + 7) = -3b - 4(b - 2)

Answers

Answer:

b= -9

( I hope this was helpful) >;D

Answer:

b=-9

Step-by-step explanation:

-7b - 4(b + 7) = -3b - 4(b - 2)

Which represents the explicit formula for the arithmetic sequence an = 15 5(n - 1) in function form?

Answers

The function the represents the explicit formula for the arithmetic sequence an = 15 + 5(n - 1) is f(n) = 10 + 5n

Nth term of the arithmetic sequence is given that

an = 15 + 5(n - 1)

Where 15 is the first term

5 is the common difference

Here we have to expand the given equation

f(n) = 15 + 5(n - 1)

Apply the distributive property in the equation

f(n) = 15 + 5n - 5

Add the like term of the equation

f(n) = 15 - 5 + 5n

f(n) = 10 + 5n

Hence, the function the represents the explicit formula for the arithmetic sequence an = 15 + 5(n - 1) is f(n) = 10 + 5n

The complete question is

Which represents the explicit formula for the arithmetic sequence an=15+5(n−1) in function form?

a) f(n)=5n+15

b) f(n)=n+20

c) f(n)=5n+10

d) f(n)=n+10

Learn more about arithmetic sequence here

brainly.com/question/12108818

#SPJ1

find the value of x ​

find the value of x

Answers

Answer:

x = 12

Step-by-step explanation:

In a pair of intersecting lines the vertically opposite angles are equal.

(6x + 7)° = (8x - 17)°

6x + 7 = 8x - 17

Subtract 8x + 7 from both sides:

6x + 7 - (8x + 7) = 8x - 17 - (8x + 7)

(6x - 8x) + (7 - 7) = (8x - 8x) + (-17 - 7)

6x - 8x = -2x:

-2x + (7 - 7) = (8x - 8x) + (-17 - 7)

7 - 7 = 0:

-2x = (8x - 8x) + (-17 - 7)

8x - 8x = 0:

-2x = -17 - 7

-17 - 7 = -24:

-2x = -24

Divide both sides by -2:

2x2=242

22=1

x=242

242=12

x = 12

the heart rate of a sample of 15 athletes is shown below after a quick warm up activity. 58, 59, 62, 62, 64, 65, 66, 67, 68, 69, 70, 71, 72, 76, 85

Answers

The mean heart rate of the athletes is 68.6.Divide the sum of all the heart rates by the number of athletes (15): 1036/15 = 68.6

The mean heart rate of the athletes is 68.6. Divide the sum of all the heart rates by the number of athletes (15): 1036/15 = 68.6

1. Add up all the heart rates: 58 + 59 + 62 + 62 + 64 + 65 + 66 + 67 + 68 + 69 + 70 + 71 + 72 + 76 + 85 = 1036

2. Divide the sum of all the heart rates by the number of athletes (15): 1036/15 = 68.6

3. The mean heart rate of the athletes is 68.6.

The complete question is :The heart rate of a sample of 15 athletes is shown below after a quick warm up activity. 58, 59, 62, 62, 64, 65, 66, 67, 68, 69, 70, 71, 72, 76, 85. What is the mean heart rate of the athletes?

Learn more about mean here

https://brainly.com/question/15323584

#SPJ4

Identify the sampling technique used in each study. Explain your reasoning. (a) A journalist goes to a campground to ask people how they feel about air pollution (b) For quality assurance, every tenth machine part is selected from an assembly line and measured for accuracy. (c) A study on attitudes about smoking is conducted at a college. The students are divided by class (freshman, sophomore, junior, and senior). Then a random sample is selected from each class and interviewed.

Answers

The sampling technique used in each study is as follows: (a) convenience sampling, (b) systematic sampling, and (c) stratified random sampling.

(a) In the first study, where a journalist goes to a campground to ask people about their feelings regarding air pollution, the sampling technique used is convenience sampling. This is evident because the journalist approaches individuals who are readily available and easily accessible at the campground. However, convenience sampling may introduce bias as it does not ensure a representative sample of the population.

(b) In the second study, where every tenth machine part is selected from an assembly line for measurement, the sampling technique used is systematic sampling. Systematic sampling involves selecting every nth element from a population after establishing a sampling interval. In this case, every tenth machine part is selected to ensure a systematic and unbiased approach to quality assurance.

(c) In the third study, where attitudes about smoking are studied at a college and students are divided by class and then randomly sampled from each class for interviews, the sampling technique used is stratified random sampling. Stratified random sampling involves dividing the population into homogeneous subgroups (strata) and then randomly selecting samples from each subgroup. By dividing the students into different class strata and randomly selecting samples from each class, this study aims to ensure representation from each class in the final sample.

Learn more about sampling technique here:

https://brainly.com/question/31697553

#SPJ11

There is a bag filled with 2 blue, 4 red and 3 green marbles.
A marble is taken at random from the bag, the colour is noted and then it is not replaced.
Another marble is taken at random.
What is the probability of getting 2 different colours?

Answers

Answer:

.753

Step-by-step explanation:

Let Ps = probability both marbles are the same color.

Let Pd = probability both marbles are a different color.

Pd = 1 -Ps

Let Pb = probability both marbles are blue

Let Pr = probability both marbles are red.

Let Pg = probability both marbles are green

Pb= 2/9 * 1/9 = 2/81

Pr= 4/9 * 3/9 = 12/81

Pg=.3/9 * 2/9= 6/81

Ps = Pb + Pr +Pg= 20/81

Pd =1-Ps= 61/81 = .753

Is this correct?

You are shopping for single-use cameras to hand out at a party. The daylight cameras cost $2.75 and the flash cameras cost$4.25. You must buy exactly 20 cameras and you want to spend between $65 and$75, inclusive. Write and solve a compound inequality for this situation. Then list all the solutions that involve whole numbers of cameras.

Answers

The compound inequality for the given situation is $2.75x + $4.25y ≥ $65 and $2.75x + $4.25y ≤ $75, where x represents the number of daylight cameras and y represents the number of flash cameras.

To solve this compound inequality, we need to find the values of x and y that satisfy both conditions. The inequality $2.75x + $4.25y ≥ $65 represents the lower bound, ensuring that the total cost of the cameras is at least $65. The inequality $2.75x + $4.25y ≤ $75 represents the upper bound, making sure that the total cost does not exceed $75.

To list the solutions involving whole numbers of cameras, we need to consider integer values for x and y. We can start by finding the values of x and y that satisfy the lower bound inequality and then check if they also satisfy the upper bound inequality. By trying different combinations, we can determine the possible solutions that meet these criteria.

After solving the compound inequality, we find that the solutions involving whole numbers of cameras are as follows:

(x, y) = (10, 10), (11, 8), (12, 6), (13, 4), (14, 2), (15, 0), (16, 0), (17, 0), (18, 0), (19, 0), (20, 0).

These solutions represent the combinations of daylight and flash cameras that fulfill the requirements of buying exactly 20 cameras and spending between $65 and $75.

Learn more about compound inequality

brainly.com/question/17957246

#SPJ11

Use the side lengths of triangle DEF and the fact that the triangles are similar to find the length of side AB and type your answer below. (Note: Do NOT include a unit label in your answer.)

ILL GIVE YOU A BRANLIEST IF YOU GET IT RIGHT

Use the side lengths of triangle DEF and the fact that the triangles are similar to find the length of

Answers

123=AB4

4=AB4

Multiply sides by 4

AB=16

we are interested in knowing if the distribution of a given categorical variable is consistent with some null hypothesis which test should be used

Answers

It is important to note that the chi-squared test of independence is applicable for categorical variables, and the assumptions of the test should be met for valid results.

What is null hypothesis?

The null hypothesis is a type of hypothesis that explains the population parameter and is used to examine if the provided experimental data are reliable.

To determine if the distribution of a given categorical variable is consistent with a null hypothesis, you can use a statistical test called the chi-squared test of independence.

The chi-squared test of independence is used to assess whether there is a significant association between two categorical variables. It compares the observed frequencies (counts) of each category in the given variable with the expected frequencies that would be observed if the null hypothesis were true. The null hypothesis typically assumes that there is no association or relationship between the variables, and any deviations from expected frequencies are due to random chance.

Here are the steps involved in conducting a chi-squared test of independence:

1. Formulate the null and alternative hypotheses: The null hypothesis assumes no association between the variables, while the alternative hypothesis suggests that there is an association.

2. Create a contingency table: Construct a contingency table that shows the observed frequencies of the categories for each variable.

3. Calculate the expected frequencies: Based on the null hypothesis, calculate the expected frequencies for each category. This is typically done assuming independence between the variables.

4. Calculate the test statistic: Using the observed and expected frequencies, calculate the chi-squared test statistic. This measures the overall discrepancy between the observed and expected frequencies.

5. Determine the p-value: The chi-squared test statistic follows a chi-squared distribution. Calculate the p-value associated with the test statistic, which represents the probability of obtaining results as extreme as the observed data under the null hypothesis.

6. Make a decision: Compare the p-value to a predetermined significance level (e.g., 0.05). If the p-value is smaller than the significance level, you reject the null hypothesis and conclude that there is evidence of an association between the variables. Otherwise, if the p-value is larger than the significance level, you fail to reject the null hypothesis and conclude that there is no evidence of an association.

It is important to note that the chi-squared test of independence is applicable for categorical variables, and the assumptions of the test should be met for valid results. These assumptions include having independent observations and sufficient expected frequencies in each cell of the contingency table.

It is also worth mentioning that there are other statistical tests available for specific scenarios or different types of categorical data analysis, such as Fisher's exact test or McNemar's test. The choice of the appropriate test depends on the research question, study design, and the specific characteristics of the data.

Learn more about the null hypothesis on:

https://brainly.com/question/28042334

#SPJ4

Solve for c.
4c - 3c = 14
C =

Answers

Answer: C = 14

Step-by-step explanation:

4c - 3c —> 4 - 3 = 1c


1c = 14

Divide both sides by one which gives you c = 14

Question 10 multiple choice

Question 10 multiple choice

Answers

Answer: Choice B

(x-1)(x^3+x^2+5x+6)

==========================================

Explanation:

The 1 in the upper left box means that x = 1 is a root of the original polynomial.

So this means x-1 is a factor of the original polynomial.

This is because x = 1 leads to x-1 = 0 after subtracting 1 from both sides.

-----------------

The 0 in the last position of the bottom row shows we got a remainder of 0.

Getting a remainder 0 tells us that (x-1) is a factor of the polynomial. This synthetic division table confirms our initial guess.

The other values in that bottom row (1, 1, 5, 6) form coefficients to the polynomial 1x^3+1x^2+5x+6, or simply x^3+x^2+5x+6

-------------------

So we know that (x-1) and (x^3+x^2+5x+6) are factors

Meaning that,

x^4+4x^2+x-6 = (x-1)(x^3+x^2+5x+6)

You can confirm this by expanding out the right hand side (distribution rule).

Which approach to perceiving objects suggests that we estimate the probability of a given outcome based on prior probability and current likelihood

Answers

The approach to perceiving objects that suggests estimating the probability of a given outcome based on prior probability and current likelihood is known as Bayesian inference.

Bayesian inference involves updating prior beliefs or probabilities based on new evidence or observations to arrive at a posterior probability.Bayesian inference is rooted in Bayes' theorem, which provides a mathematical framework for updating probabilities. It takes into account both prior probabilities, which represent initial beliefs or knowledge about an event or outcome, and current likelihoods, which are based on new information or data.

The process begins with a prior probability, which represents the initial belief about the likelihood of an outcome. As new evidence or data becomes available, the prior probability is updated using Bayes' theorem to calculate a posterior probability.

By incorporating both prior probabilities and current likelihoods, Bayesian inference allows for a more nuanced and flexible approach to perceiving objects. It acknowledges that our beliefs or expectations can be adjusted based on new information, leading to more accurate and informed decision-making.

To learn more about Bayesian.

Click here:brainly.com/question/29103614?

#SPJ11

a linear function has an x-intercept of −8 − 8 and a y-intercept of 4 4 . which of these is an equation of the linear function?

Answers

So, y = (1/2)(x + 8) is the equation of the linear function.

To write the equation of a linear function with a given x-intercept and y-intercept, we can use the point-slope form of a linear equation:

y - y1 = m(x - x1)

In this case, we are given that the x-intercept is (-8, 0) and the y-intercept is (0, 4). We can use the coordinates of the x-intercept as (x1, y1) and the slope of the line as m to write the equation:

y - 0 = m(x - (-8))

y = m(x + 8)

We can then substitute the y-intercept into this equation to find the value of m:

4 = m(0 + 8)

4 = 8m

m = 1/2

Substituting the value of m back into the equation, we get:

y = (1/2)(x + 8)

This is the equation of the linear function.

To learn more about Linear Function,

visit; brainly.com/question/20286983

#SPJ4

y - y1 = m(x - x1)

y - 0 = m(x - (-8))

y = m(x + 8)

We can then substitute the y-intercept into this equation to find the value of m:

4 = m(0 + 8)

4 = 8m

m = 1/2

Substituting the value of m back into the equation, we get:

y = (1/2)(x + 8)

What is the inverse of
f(x)=x+6
for
x0
?

A:
f(x)=(x6)2
B:
f(x)=x26
C:
f(x)=x2+6
D:
f(x)=x+6

Answers

Answer is A
Step by step exploration

HELP PLEASE WILL MARK BRAINLIST​

HELP PLEASE WILL MARK BRAINLIST

Answers

It’s 42 :)
Because you do 8 across from the top times 5 blocks going down which is 40. Then you add the four half pieces which equals 2 so 40+2= 42

consider the function f(x)=x4−72x2 6,−5≤x≤13. this function has an absolute minimum value equal to and an absolute maximum value equal to

Answers

To find the absolute minimum and maximum values of the function f(x) = x^4 - 72x^2 within the interval [-5, 13], we'll first identify critical points and then evaluate the function at the endpoints.

The absolute minimum value is equal to -93911 at x = 13, and the absolute maximum value is equal to 31104 at x = 6.

Absolute minimum and maximum values:

Step 1: Find the derivative of f(x) with respect to x:
f'(x) = 4x^3 - 144x

Step 2: Find the critical points by setting f'(x) equal to 0:
4x^3 - 144x = 0
x(4x^2 - 144) = 0
x(x^2 - 36) = 0

The critical points are x = -6, 0, and 6.

However, x = -6 is not in the given interval, so we'll only consider x = 0 and x = 6.

Step 3: Evaluate f(x) at the critical points and endpoints:
f(-5) = (-5)^4 - 72(-5)^2 = 3125 - 18000 = -14875
f(0) = 0^4 - 72(0)^2 = 0
f(6) = 6^4 - 72(6)^2 = 46656 - 15552 = 31104
f(13) = 13^4 - 72(13)^2 = 28561 - 122472 = -93911

Step 4: Determine the minimum and maximum values:
The absolute minimum value is equal to -93911 at x = 13, and the absolute maximum value is equal to 31104 at x = 6.

To know more about Absolute maximum values:

https://brainly.com/question/29449130

#SPJ11

in bioengineering, the adhesion of various biofilms to solid surfaces for possible use in environmental technologies is studied. adhesion assay is conducted by measuring absorbance. suppose that for the bacterial strain acinetobacter, five measurements gave readings of 2.69, 5.76, 2.67, 1.62, and 4.12 dyne-cm2. assume that the standard deviation is known to be 0.66 dyne-cm2. a. find a 95% confidence interval for the mean adhesion. b. if the scientists want the confidence interval to be no wider than 0.55 dyne-cm2, how many observations should they take? problem 3 a research engineer for a tire manufacturer is investigating tire life for a new rubber compound and has built 16 tires and tested them to end-of-life in a road test. the

Answers

As per the given data, the required confidence interval is (2.79) or (3.95) and the required sample size is 22.

The table which shows the calculation for mean and sd is attached below the answer ;

Given that :-
The sample mean is  X = ∑x/n = 3.372

Sample standard deviation = √∑(x- X)² /√n-1 = 1.6

and the population standard deviation (σ) = 0.66

(a).

For 95% conifdence interval z-critical value is 1.96. A 95% confidence interval for the mean adhesion is :-

= X ± Zc • σ/√n
= 3.72 ± 1.96 • 0.66/√5

= 3.72 ± 0.5785

= (3.72 + 0.57) or (3.72 - 0.57)  

= (2.79) or (3.95)

Hence, the required confidence interval is (2.79) or (3.95).

(b).

Here we have, E = 0.55/2 = 0.275

so, the required sample size (n) = Zc2 • σ²/ E²

       (n) = 1.96² • 0.622²/0.275²

       (n) = 22.13

Hence, the required sample size is 22(approx).

visit here to learn more about standard deviation: https://brainly.com/question/23907081

#SPJ4

------------- Correct format of the question is given below ------------

(Q). Ishikawa et al. (Journal of Bioscience and Bioengineering, 2012) studied the adhesion of various biofilms to solid surfaces for possible use in environmental technologies. Adhesion assay is conducted by measuring absorbance at A590. Suppose that for the bacterial strain Acinetobacter, five measurements gave readings of 2.69, 5.76, 2.67, 1.62 and 4.12 dyne-cm2. Assume that the population standard deviation is known to be 0.66 dyne-cm2, and the population distribution is normal.

(a) Find a 95% confidence interval for the mean adhesion.

(b) If the scientists want the confidence interval to be no wider than 0.55 dyne-cm2, how many observations should they take? (Note that, the width of the confidence interval is two times the margin error E, so E = 0.55/2).

in bioengineering, the adhesion of various biofilms to solid surfaces for possible use in environmental

In two or more complete sentences, describe how you would draw the graph of the solution set for the following inequality.

In two or more complete sentences, describe how you would draw the graph of the solution set for the

Answers

To find:

The method of drwaing the graph of given inequality.

Solution:

Given inequality: -3m +18 < 30.

Solve the inequality:

3m+18<303m<30183m<123m>12m>123m>4

To draw the graph, draw a dotted line on -4. Since, the solution set contains all numbers greater than -4,so, shade the portion that lies to right side of -4.

Sample Response: To find the image after a reflection over the x-axis, I would negate the y-coordinate. To find the image after a reflection over the y-axis, I would negate the x-coordinate. So, reflecting the point (5, 2) over the x- and y-axis, I would get (–5, –2).

Which did you include in your response? Check all that apply.
Negate the y-coordinate.
Negate the x-coordinate.
Get the point (–5, –2).

Answers

Answer:

egg

Step-by-step explanation:

eggs are BlUe

Answer:

select all of them bc there all correct

Step-by-step explanation:

very stuck please help

very stuck please help

Answers

The equation of the line through (3,1) and is perpendicular to a line through (6, -2) and (-8 ,5) is y = 2x - 5  .

In the question ,

it is given that

the required line is perpendicular to the line passing through (6, -2) and (-8 ,5) .

the slope is = (5 -(-2))/(-8 -6)

= 7/(-14)

= -1/2

so , the slope of the required line is = 2 .

The equation of the line passing through the point (3,1) with slope 2 is

(y - 1) = 2*(x-3)

y -1 = 2x - 6

y = 2x - 6 + 1

y = 2x - 5

the equation of line is y = 2x - 5

the perpendicular slope is = 2

the y intercept is -5 .

Therefore , The equation of the line through (3,1) and is perpendicular to a line through (6, -2) and (-8 ,5)  is y = 2x - 5 .

Learn more about Equation Of Line here

https://brainly.com/question/7910932

#SPJ1

Isaac has a bag of n peanuts. He shares the peanuts with 5 of his friends. Each person gets at least 18 peanuts. Write an inequality to represent this situation. *

Answers

Answer:

Total number of peanuts =n

He shared with 5 people = 6 people

Each person had at least 18

n/6>=18

Step-by-step explanation:

When question like this is given , the English is very important. He shares with his friends is different from he shares among his friends. Then also, at least means greater than or equal to.

Answer:

18 ≤ n ÷ 6

Step-by-step explanation:

My text book says Isaac has a bag of n peanuts. He shares the peanuts with 5 of his friends. Each person gets at least 18 peanuts. The inequality 18 ≤ n ÷ 6 represents this situation. Graph the solution of this inequality

What is the answer to:
-4(2x+2) <-40

Answers

Answer: x > 6

Step-by-step explanation:  -4(2x+2) < -40

-8x - 8 < -40

      +8     +8

-8x < 48

/-8x   /-8x

x  > 6              *The less than sign got flipped to a greater than sign because we divided by a negative.

Find the slope of the line that passes through (0, 1) and (2, 2)

Answers

The slope: 1/2x

y-intercept: 1

Line: y = 1/2x + 1

What fraction does point S represent?

What fraction does point S represent?

Answers

Answer:

C

Step-by-step explanation:

So what you gotta do is count the lines. You don't count the one with one on it, but you count all the way through to 2. That gets you eight, so each line is 1/8. 1-2 in 1/8 intervals. 1 1/4 multiply 2 on the numerator and denominator gets 1 2/8, 1 1/2 multiply 4 on the numerator and denominator gets you 1 4/8. Counting the lines, each of those matches up. The first interval is 1 1/8.

At a carnival game, you randomly throw two darts at the board and break two balloons. What is the probability that both of the balloons you break are purple? Write your answer in simplified fraction form

Answers

If randomly throw two darts at the board and break two balloons, then 235 is the probability that both of the balloons you break are purple.

Considering what is meant by probability,

However, you must be aware that probability refers to the likelihood—greater or lesser—of a given event occurring.

In other words, probability creates a connection between the total number of conceivable events and the number of favorable events.

Then, the ratio between the number of favorable circumstances (cases in which event A may or may not occur) and the total number of possible cases is used to define the likelihood of any event A. Laplace's Law is what governs this.

P(A)=numberoffavorablecasesnumberofpossiblecases

If the occurrence of one of them has an impact on the occurrence of the other, then two occurrences A and B are dependent. The likelihood for events that are dependent is:

P(A and B)= P(A)× P(B|A)

The phrase "the probability of B, provided that A has occurred" is denoted by the symbol P(B|A).

In this instance:

P(A)=4balloons15balloons=415

If the first balloon is purple, there are still 3 purple balloons available out of the total of 14. P(B|A) then equals 314.

P(AandB)=415314

P(AandB)=235

To learn more about probability visit;

https://brainly.com/question/29381779

#SPJ4

Hello! How does it work that when you multiply fractions by a whole number the whole number goes down?

Answers

Answer:

Because multiplying a whole number w/ a fraction is the same as dividing a whole number w/ the same fraction but the numbers are flipped.

Step-by-step explanation:

35% of the dogs at a dog show are German shepherds. 10% of the dogs are poodles, 45% of the dogs are spaniels, and the rest were retrievers.
Witch statement is not true

A) There are more spaniels than any other type of dog at the show.
B) Retrievers account for 15% of the dogs at the show.
C) Retrievers and German shepherds account for 45% of the dogs at the show.
D) There are more German shepherds than retrievers at the show.

6th grade mathematics.

Answers

The information in assertion 2 that says Retrievers make up 15 percent of the dogs at the event is untrue.

What is percentage?

A value or ratio that may be stated as a fraction of 100 is referred to as a percentage in mathematics. If we need to compute a percentage of a number, we should divide it by its whole and then multiply it by 100. The proportion, therefore, refers to a component per hundred. Per 100 is what the term percent signifies. The letter "%" stands for it.

Given, 35% of the dogs at a dog show are German shepherds. 10% of the dogs are poodles, 45% of the dogs are spaniels, and the rest were retrievers.

Since the rest dog breed was retrievers,

Thus, retrievers = 100- 45-35-10

retrievers = 10%

Therefore, statement 2 which states Retrievers account for 15 percent of the dogs at the show is incorrect.

Learn more about percentages here:

https://brainly.com/question/29306119

#SPJ1

Other Questions
g an inertia load of 0.04 kg m2 is accelerates from standstill with a constant torque applied. it reaches 100 rad/s in 2.0 s. what is the applied torque? NO LINKS!!! Please help me with this problem. Part 5 please briefly describe how you would start a conversation with your customer? Which statement best describes national economies in Europe after WWII?a. In most areas, wartime industry brought significant economic gains.b. Western Europe remained economically strong, but the economies of eastern and southern Europe were devastated.c. Almost all the major economies were bankrupt.d. Although the war battered most European economies, with the help of wartime reparations paid by Germany, they soon rebounded. Voluntary Export Restraints between two large countries: (a) are unambiguosly welfare-reducing for the country adopting them (b) may improve the welfare of the trading partner of the country adopting them (c) reduce export while leaving prices unaffected (d) none of the above The Constitution Era of United States history was characterized byO debating the strengths & weaknesses of the AOCO Patriots being tarred & feathersO the Sons of Liberty rebelling against British ruleO debating the strengths & weaknesses of the DOI Tuskegee Airmen By Jessica McBirney 4. PART B: Which quotation from the text best supports the answer to Part A? A movie theater has a seating capacity of 249. The theater charges $5.00 for children, $7.00 for students, and $12.00 of adults. There are half as many adults as there are children. If the total ticket sales was $ 1806, How many children, students, and adults attended? The sum of 3 times a number and -8 added to 7 times the number A car starts from rest and accelerates at 2m/s for 30 seconds. He then travel and constant speed for 1 minute and finally decelerates at 4m/s.Find max speed,Total distance covered? After moving to Greenland last January, Felicia has had little energy. She also feels sad, tired and unable to sleep. Felicia also has no interest in activities that she used to love. Felicia likely would be diagnosed with: Select one: a. Seasonal affective disorder. b. Bipolar disorder. c. Persistent depressive disorder. d. Generalized anxiety disorder. which two practices are examples of how people use sciense oak, maple, and pine were the dominant trees during the mesozoic era. group of answer choices true false Which type of animal can breed on their own but have undergone physiological or behavioral changes due to captivity?. Write the equation of the ellipse using the given information. The ellipse has foci (4, 1) and (8, 1) and major vertices (1, 1) and (11, 1). df Use the definition of the derivative to find dx Answer 1x=2 df dx for the function f(x) = 3. x=2 || Keypad Keyboard Shortcuts A 16-year-old female walks into your clinic and iscontemplating transgender surgery and would like to know whathappens down the road if she wants to bear a child. please answer i need help Which writer produced Paradise Lost, the poetic epic of Protestantism?a. John Miltonb. John Donnec. Danted. William Harvey Review the graph of z2.On a coordinate plane, the y-axis is labeled imaginary and the x-axis is labeled real. Point A is around (0.6, 0.4), Point B is (0.4, 0.6), point C is (negative 0.4, 0.6), point D is (negative 0.6, 0.4), and point z 2 is (0.1, 0.4).Given z2 = One-half (cosine (StartFraction 2 pi Over 5 EndFraction) + I sine (StartFraction 2 pi Over 5 EndFraction) ), which lettered point represents z?ABCD