Video D Find the distance between the points (-2, 2) and (-7, -10). Write your answer as a whole number or a fully simplified radical expression. Do not round.​

Answers

Answer 1

The distance between the two points is 13.

We have,

The two points are (-2, 2) and (-7, -10)

Now,

Distance between two points.

= √(c - a)² + (d - b)²

Where (a, b) and (c, d) are the two points.

Now,

Distance between (-2, 2) and (-7, -10).

= = √(-7 + 2))² + (-10 - 2)²

= √(-5)² + (-12)²

= √(25 + 144)

= √169

= √13²

= 13

Thus,

The distance between the two points is 13.

Learn more about distance of a line here:

https://brainly.com/question/14645718

#SPJ1


Related Questions

By using the trapezoidal rule with 5 ordinates, approximate [sin(x²+1) dx to 4 decimal places.​

Answers

Using the trapezoidal rule with 5 ordinates, we approximate the integral [sin(x²+1) dx] over the interval [0,1] to be 0.5047 to 4 decimal places.

To approximate the integral [sin(x²+1) dx] using the trapezoidal rule with 5 ordinates, we can use the following formula:

∫[a,b]f(x)dx ≈ [(b-a)/2n][f(a) + 2f(a+h) + 2f(a+2h) + 2f(a+3h) + 2f(a+4h) + f(b)]

where n is the number of ordinates (in this case, n = 5), h = (b-a)/n is the interval width, and f(x) = sin(x²+1).

First, we need to find the interval [a,b] over which we want to integrate. Since no interval is given in the problem statement, we'll assume that we want to integrate over the interval [0,1].

Therefore, a = 0 and b = 1.

Next, we need to find h:

h = (b-a)/n = (1-0)/5 = 0.2

Now, we can apply the trapezoidal rule formula:

∫[0,1]sin(x²+1)dx ≈ [(1-0)/(2*5)][sin(0²+1) + 2sin(0.2²+1) + 2sin(0.4²+1) +             2sin(0.6²+1) + 2sin(0.8²+1) + sin(1²+1)]

≈ (1/10)[sin(1) + 2sin(0.05²+1) + 2sin(0.15²+1) + 2sin(0.35²+1) + 2sin(0.65²+1) + sin(2)]

≈ (1/10)[0.8415 + 2sin(1.0025) + 2sin(1.0225) + 2sin(1.1225) + 2sin(1.4225) + 1.5794]

≈ 0.5047

Therefore, using the trapezoidal rule with 5 ordinates, we approximate the integral [sin(x²+1) dx] over the interval [0,1] to be 0.5047 to 4 decimal places.

Learn more about Trapezoidal Rule at

brainly.com/question/30401353

#SPJ1

What is the price of a T.V. costing Rs.15000 after allowing 5% discound and adding 15% VAT.​

Answers

Answer:

If a TV costs Rs. 15,000 and a 5% discount is allowed, the price after the discount is:15000 - (5/100) * 15000 = 14250Now, if a 15% Value Added Tax (VAT) is added to this discounted price, the final price becomes:14250 + (15/100) * 14250 = 16387.50Therefore, the price of the TV after allowing a 5% discount and adding a 15% VAT is Rs. 16,387.50.

0.
DETAILS
Model the data using an exponential function f(x) = Ab".
X
0
1
2
f(x)
400
240
144
f(x) =
Need Help?
Read It

0.DETAILSModel the data using an exponential function f(x) = Ab".X012f(x)400240144f(x) =Need Help?Read

Answers

I think The answer is 250

Four scenarios of statistical studies are given below. Decide which study uses a population parameter. A) Lakeside Family Dentistry reported that 6 of the 15 patients who came in for a regular cleaning one day had at least one cavity.
B) In 2001, 78% of children diagnosed with cancer were in remission after five years, and this number is improving. As part of her senior project, Kaisa asked 84 of her classmates if they voted in the
C) last presidential election. 39 said yes. D) 15% of the attendees at a town council meeting in a rural area reported not using the internet on a daily basis

Answers

The percentage of children with cancer who enter remission after five years is the variable being measured. This proportion is typical of all the youngsters who have been given a cancer diagnosis.

What is probability?

Calculating the chance that an event will occur or a statement will be true is the subject of probability theory, a branch of mathematics. A risk is a number between 0 and 1, where 1 denotes certainty and a probability of about 0 denotes the likelihood that an event will occur. The likelihood that an event will take place is mathematically expressed as probability. Probabilities can also be expressed as percentages ranging from 0% to 100% or as integers between 0 and 1. the proportion of equally plausible possibilities that actually happen in relation to all possible outcomes when a certain event occurs.

B) In 2001, 78% of children with cancer were in remission after five years, and this percentage is rising. This analysis employs a population parameter. The percentage of children with cancer who enter remission after five years is the variable being measured. This proportion is typical of all the youngsters who have been given a cancer diagnosis.

To know more about probability visit:

https://brainly.com/question/11234923

#SPJ1

PLEASE HELP ASAP ITS TIMED

PLEASE HELP ASAP ITS TIMED

Answers

It’s c bc with powers that r fractions the top is the power while the bottom is the root (of that makes sense)

Complete this sequence of numbers such that the difference between any two adjacent numbers is the same : 3/k, _, _, 9/2k.

Answers

The completed sequence is: 3/k, 3/k, 3/k, 9/2k.To complete the sequence of numbers with a constant difference between adjacent numbers, we can calculate the common difference by subtracting the first term from the second term.

Let's denote the missing terms as A and B.

The given sequence is: 3/k, A, B, 9/2k.

The common difference can be found by subtracting 3/k from A or B. Therefore:

A - 3/k = B - A = 9/2k - B.

To simplify, we can equate the two expressions for the                     common difference:

A - 3/k = 9/2k - B.

Next, we can solve for A and B using this equation.

Adding 3/k to both sides gives:

A = 3/k + 9/2k - B.

Now, we can substitute the value of A into the equation:

3/k + 9/2k - B - 3/k = 9/2k - B.

Simplifying further, we have:

9/2k - 3/k = 9/2k - B.

Cancelling out the common terms, we find:

-3/k = -B.

Multiplying both sides by -1, we get:

3/k = B.

For more such questions on Adjacent numbers:

https://brainly.com/question/28207765

#SPJ8

Which of the following values are solutions to the inequality 9 < -10 – 4x?

Answers

Answer:

ndndndndndn

Step-by-step explanation:

svhddbxbdnnddjdnfn

A triangle has three sides 35cm 54 cm and 61 cm find its area Also find the smallest of its altitude ​

Answers

Answer:

Area of given triangle is 939.15cm² and smallest altitude is 30.8cm

Solution:

We are given three sides of a triangle, Let the sides be :

( a ) = 35 cm

( b ) = 54 cm

( c ) = 61 cm

We can find the area of the triangle with its three sides using Heron's Formula

Heron's Formula

Heron's formula was founded by hero of Alexandria, for finding the area of triangle in terms of the length of its sides. Heron's formula can be written as:

s(sa)(sb)(sc)s(sa)(sb)(sc)

where ( s ) :

s=a+b+c2

Therefore, for the given triangle first we will calculate ( s )

s=a+b+c2s=35+54+612s=1502s=75cm

Now, Area of triangle will be:

:A=s(sa)(sb)(sc):A=75(7535)(7554)(7561):A=75×40×21×14:A=5×5×3×3×2×2×7×7×2×2×5:A=5×3×2×7×25:A=420×2.23:A=939.15cm2A=939.15cm2

Also, we have to find the smallest altitude, and the smallest altitude will be on the longest side. So,

:Area=939.15:12×b×h=939.15:12×61×h=939.15:h=939.15×261:h=1818.361:h=30.79(approx)h=30.79(approx)

Answer:

Area = 939.15 cm² (2 d.p.)

Shortest Altitude = 30.79 cm (2 d.p.)

Step-by-step explanation:

Heron's Formula allows us to find the area of a triangle in terms its side lengths.

Heron's Formula

Area=s(sa)(sb)(sc)

where:

a, b and c are the side lengths of the triangles is half the perimeter

Given values:

a = 35 cmb = 54 cmc = 61 cm

Find the value of s:

s=a+b+c2=35+54+612=75cm

Substitute the values into the formula and solve for area:

Area=75(7535)(7554)(7561)=75(40)(21)(14)=882000=1764005=1764005=4205=939.15cm2(2d.p.)

The altitude of a triangle is a perpendicular line segment drawn from a vertex of the triangle to the side opposite to it.

The shortest altitude of a triangle is drawn to the longest side.

Therefore, the shortest altitude will be the height of the triangle when the longest side is the base:

Area of a Triangle=12×base×height4205=12×61×altitudeAltitude=2420561=840561=30.79cm(2d.p.)

A triangle has three sides 35cm 54 cm and 61 cm find its area Also find the smallest of its altitude

What is the phase shift for the function Y= 3.2 COS(1.5(x-4pi))

What is the phase shift for the function Y= 3.2 COS(1.5(x-4pi))

Answers

Y= 3.2 COS(1.5(x-4π))

Phase shift is the number that goes with x, (adding or substracting)

Then phase shift is -4π

Answer is : OPTION C) 4π to the right

Please solve with explanation high points

Please solve with explanation high points

Answers

Answer:

k = 0,  k = 4

Step-by-step explanation:

Given equation:

y=x2+kx+3k+4x+4

Rearrange into standard form ax2+bx+c:

y=x2+kx+4x+3k+4

y=x2+(k+4)x+(3k+4)

Therefore:

a=1,b=(k+4),c=(3k+4)

If the vertex lies in the x-axis, then the quadratic has one (repeating) root at (x, 0).  Therefore, we can use the discriminant to find the values of k.

Discriminant

b24acwhenax2+bx+c=0

when b24ac>0two real roots

when b24ac=0one real root

when b24ac<0no real roots

Therefore, set the discriminant to zero and solve for k:

(k+4)24(1)(3k+4)=0

k2+8k+1612k16=0

k24k=0

k(k4)=0

k=0,k=4

So the vertex lies in the x-axis when k = 0 or k = 4

5>x/5
Show all work in steps

Answers

Answer:

x<25

Step-by-step explanation:

To find the value of x, isolate it on one side of the equation.

5>x/5

First, you have to switch sides.

→ x/5<5

Then, you multiply by 5 from both sides.

→ 5x/5<5*5

Solve.

Multiply the numbers from left to right.

→ 5*5=25

→ x<25

Therefore, the solution is x<25, which is our answer.

I hope this helps you! Let me know if my answer is wrong or not.

Answer:

25 > x

Step-by-step explanation:

5>x5

To find the value of x, you have to multiply both sides by 5.

55>x55

25>5x5

25>x

The New Jersey Division of Fish and Wildlife keeps track of the beaver population in the Raritan River. They tagged 42 beavers and released them. A week later, they captured 54 beavers, including 14 tagged beavers. What is a good estimate of the beaver population in the Raritan River? There are approximately beavers in the Raritan River. ​

Answers

Answer:ratio is 14:54 = 42:B. Beavers = 162

Step-by-step explanation:

The ratio demonstrates how often one number is multiplied by another.

The approximate number of beavers exists 162.

What is meant by ratio?

The ratio demonstrates how often one number is multiplied by another. When the second number in the ordered pair, b, is not equal to 0, the ratio is expressed as a/b. An equation in which two ratios are made equal is known as a percentage.

The relationship or comparison between two numbers in the same unit to determine how much larger one number is than the other is known as a ratio.

The 42 beavers were tagged and released by the New Jersey Division of Fish and Wildlife, which monitors the beaver population in the Raritan River. After a week, they had captured 54 beavers, 14 of which were marked. There are 54 Beavers in all, and 14 Beavers have tags.

Let the ratio be 14 : 54.

As 42 tagged beavers were released.

simplifying the above equation, we get

14 × 3 : 54 × 3

= 42 : 162

Therefore, the approximate number of beavers exists 162.

To learn more about ratio, refer to:

brainly.com/question/27817533

#SPJ2

Determine if the following system of equations has no solutions, infinitely many
solutions or exactly one solution.
-5x + y = -2

20x-4y = 8

Answers

Answer:

Infinite solutions.

Step-by-step explanation:

The given equations are :

-5x + y = -2 .....(1)

20x-4y = 8 .....(2)

We have,

a₁ = -5, a₂ = 20, b₁ = 1, b₂ = -4, c₁ = -2 and c₂ = 8

a1a2=520=14b1b2=14=14c1c2=28=14

It means,

a1a2=b1b2=c1c2

So, the system of equations has infinite solutions.

Question 12/Multiple Choice Worth 2 points) (Theoretical Probability MC) Afait, 6-sided die is rolled 45 times. Predict how many times it will land on a number greater than 4. 0 10 0 15​

Answers

Step-by-step explanation:

Greater than 4 means  it lands 5 or 6  or  1/3 of the possible rolls

  1/3 * 45 = 15 times

How to solve this question???

How to solve this question???

Answers

The sine function for this problem is given as follows:

y = 6sin(12πx) + 4.

How to define the sine function?

The standard definition of the sine function is given as follows:

y = Asin(B(x - C)) + D.

For which the parameters are given as follows:

A: amplitude.B: the period is 2π/B.C: phase shift.D: vertical shift.

The amplitude for this problem is obtained considering the maximum and minimum values, as follows:

2A = 10 - (-2)

2A = 12

A = 6.

The function oscillates between -2 and 10, not between the amount -6 and 6 without the vertical shift, which is given as follows:

D = 4.

The period is of one-sixth units, hence:

2π/B = 1/6

B = 12π

As the graph crosses it's midline at the origin, it contains no phase shift, hence the equation is given as follows:

y = 6sin(12πx) + 4.

More can be learned about trigonometric functions at brainly.com/question/21558626

#SPJ1

find the solution set of the inequality
x4515
if the domain is the set {2,1,0,1,2}​

Answers

Step-by-step explanation:

=>x4515

=>x15+45

=>x1

=> Solution in the set {-2,-1,0,1,2} is {-2,-1,0,1}

Hope you've understood the solution.

what is 10? NEEDS ANSWER!!

what is 10? NEEDS ANSWER!!

Answers

The square root of 115 is approx 10.7, so it should be placed in the middle of 10 and 11 but closest to 11

Solve 0.4(y+3)-0.8y.

Answers

Answer:

The answer is: 1.2 + -0.4y

Answer: -0.4y + 1.2

Step-by-step explanation:

0.4(y) = 0.4y

0.4(3) = 1.2

0.4y + 1.2 - 0.8y

0.4y - 0.8y = -0.4y

-0.4y + 1.2

The cashier counts 80 bills, all with the same value. She gets a total of $800. What is the value of each bill?



help, help

Answers

Answer:

10 dollars

Step-by-step explanation:

Answer:

10!

Step-by-step explanation:

So the cashier counts 80 bills and if each bill was 10 dollars, then that would equal the total. ($800) Because 80 x 10 equals 800.

Hope this helps!. :)

to compound 50% solution in which proportion must 95% sol and 30% sol be mixed to make
500 ml

Answers

Answer:

4/9

Step-by-step explanation:

Let the amount of 95% sol = a ml and

the amount of 30% sol = b ml.

So, the total amount of the compound=a+b=500 ml

As the compound is 50% solution, so

95% of a + 30% of b= 50% of (a+b)

(95/100)a+(30/100)b=(50/100)(a+b) [from equation (i)]

95a + 30b = 50(a+b)

95(a/b)+30 = 50(a+b)/b [dividing both sides by b]

95(a/b)+30 = 50(a/b+1)

95(a/b)+30 = 50(a/b)+50

95(a/b)-50(a/b)=50-30

45(a/b)=20

a/b=20/45

a/b=4/9

Therefore, a:b=4:9

As a+b= 500 ml, so the amount of 95% sol = 50013×4=200013=153.85 ml

and the amount of 95% sol = 50013×9=450013=346.15 ml

Hence, the proportion of 95% sol and 30% sol to make a compound of 50% sol must be 4/9.

a)If three students scored 70 on a test and three other students scored 89 on the same test, find the mean, median & mode for the test scores.
b) the mean scourge on a set of 21 tests is 74. What’s the sum of all the test scores?

Answers

Answer:

a. Mean = 84.25. Median = 89. Mode = 89. b. Sum = 1554.

Step-by-step explanation:

a. Mean: add together 70, 89, 89, and 89, to get 337. Divide by 4 to get the mean, which is 84.25.

Median: The "middle" number, which is 89.

Mode: The number that occurs most often, which is 89.

b. 21 times 74 equals 1554. This is the sum of the test scores.

Hope this helps!

give the person above me Brainliest

they deserve it.                                                                 :D

Point G is the point (3, -1). Which point is 5 units from point G

Point G is the point (3, -1). Which point is 5 units from point G

Answers

We have

Point G( 3,-1)

Then

Point A is 4 units to left from Point G

Point D is 4 units up, from Point G

and

Point B is 5 units left,from Point G

Then answer is

OPTION B) Point B

Desperate Need Of Help

Desperate Need Of Help

Answers

The domain and range of the graph above in interval notation include the following:

Domain = [-6, 3]

Range = [-3, 3]

What is a domain?

In Mathematics and Geometry, a domain refers to the set of all real numbers (x-values) for which a particular function (equation) is defined.

In Mathematics and Geometry, the horizontal portion of any graph is used to represent all domain values and they are both read and written from smaller to larger numerical values, which simply means from the left of any graph to the right.

By critically observing the graph shown in the image attached above, we can reasonably and logically deduce the following domain and range:

Domain = [-6, 3] or -6 ≤ x < 3.

Range = [-3, 3] or -3 < y < 3

Read more on domain here: brainly.com/question/9765637

#SPJ1

the question is in the screenshot

the question is in the screenshot

Answers

Answer:

calculator soup will help you with this one

Step-by-step explanation:

To adopt a dog from a animal shelter, you must pay 08$ for vaccinations, 65$ to spray or neuter the dog, and 50$ for a wellness exam by a veterinarian

Answers

Answer:

ok, $65+$50+$8=123

Step-by-step explanation:

A jailer carries a large key ring. The key ring has a diameter of 4 inches. What is the key ring's radius?​

Answers

Answer:

2 inches

Step-by-step explanation:

The radius is simply the distance from the edge if you were at the center, which is equal to half the diameter. So given the diameter is 4 inches, we divide that by two, 4 inches2=2 inches and that's our radius!

Which set of side lengths can be the sides of a right triangle?
6, 8, 10

6, 8, 14

6, 6, 18

12, 25, 169

Answers

Answer:

  (a)  6, 8, 10

Step-by-step explanation:

You want to know the side lengths that form a right triangle from among the choices offered.

Triangle

First, we can eliminate all choices where the side lengths cannot form a triangle. A triangle will only be formed if the sum of the shortest two lengths exceeds the longest.

  6 + 8 > 10 . . . . true, forms a triangle

  6 + 8 > 14 . . . . false, not a triangle

  6 + 6 > 18 . . . . false, not a triangle

  12 +25 > 169 . . . . false, not a triangle

Right triangle

Already we know there is only one reasonable answer choice:

  6, 8, 10

We can check to see if these lengths form a right triangle. If they do, they will satisfy the Pythagorean relation:

  a² +b² = c²

  6² +8² = 10²

  36 + 64 = 100 . . . . true

The side lengths 6, 8, 10 can be the sides of a right triangle.

__

Additional comment

The sides 6, 8, 10, have the ratios 3:4:5. They are double the lengths of the primitive Pythagorean triple {3, 4, 5}. It can be worthwhile to remember a few such triples, as they appear often in problems involving triangles. Here are a few:

  {3, 4, 5}, {5, 12, 13}, {7, 24, 25}, {8, 15, 17}, {9, 40, 41}

The only triple that is an arithmetic sequence is 3, 4, 5. Another point worthy of note is that the sum of integer side lengths of a right triangle is always an even number.

<95141404393>

Mrs.Rodriquez has 24 students in her class.Ten of the students are boys.Jeff claims that the ratio of boys to girls in this class must be 5:12.What is Jeff’s error and how can he correct it?

Answers

Answer:

10:14

Step-by-step explanation:

Can I get some help?

Can I get some help?

Answers

Since the population grows according to an exponential growth model, then;

P₁ = 26.4.

P₂ = 58.08.

P₁₀ = 31,871.91.

An explicit formula for Pn is P(n)=12(1+1.2)n

How to determine the population after a number of year?

In Mathematics, a population that increases at a specific period of time represent an exponential growth. This ultimately implies that, a mathematical model for any population that increases by r percent per unit of time is an exponential function of this form:

P(t)=I(1+r)t

Where:

P(t ) represent the population.t represent the time or number of years.I represent the initial number of persons.r represent the exponential growth rate.

When t = 1, we have:

P(1) = 12(1 + 1.2)¹

P(1) = 12(2.2)

P(1) = 26.4.

When t = 2, we have:

P(2) = 12(1 + 1.2)²

P(2) = 12(2.2)²

P(2) = 58.08.

When t = 10, we have:

P(10) = 12(1 + 1.2)¹⁰

P(10) = 12(2.2)¹⁰

P(10) = 31,871.91.

For the explicit formula, we have:

P(n)=12(1+1.2)n

Read more on exponential functions here: brainly.com/question/28246301

#SPJ1

kira has two solutions that contain alcohol and is mixing them with each other. she uses 100 milliliters less of solution a than solution b. solutions a is 11% alcohol and solution b is 20% alcohol. the resulting mixure has 51 milliliters of pure alcohol. how many milliliters of solution b did she use

Answers

Answer:

200 ml

Step-by-step explanation:

She uses a ml of solution a.

She uses b ml of solution b.

Equation of the amount of each solution:

a = b - 100

Equation of the amount of alcohol:

0.11a + 0.2b = 51

0.11(b - 100) + 0.2b = 51

0.11b - 11 + 0.2b = 51

0.31b = 62

b = 200

Answer: 200 ml

Other Questions
providing only the minimum amount of privileges necessary to perform a job or function A guy takes 60% of 20 tets. if he took 50 tests during the year and passed 80% of the remaining tests what percent of tests id he pass during the year two charges are seperated by 1m and they exert a force of 1N on each other. If the charges are pushed to 0.25m seperation, the force on each charge will be -------------software is marketed and sold to any customer who wish to use it. generic custom prototype critical the cost of software on pc are often greater than the hardware cost true false briefly discuss why software testing cost maybe higher for generic software product that are sold to a very wide market un automvil que se desplaza en una pista recta aumenta su velocidad de 15 m/s a 45 m/s utilizando para ello unpo de 10 segundos. Consideremos que la aceleracin fue uniforme, calcula:aceleracin en dicho tiempo. turner company had the following activity in its inventory account during march 2021: date activity units cost per unit total unit costs march 1 beginning inventory 100 $4.00 $400.00 march 3 purchase 1 45 5.00 225.00 march 5 sale 1 50 9.00 450.00 march 9 purchase 2 60 5.50 330.00 march 12 sale 2 70 10.00 700.00 march 14 purchase 3 10 6.00 60.00 march 15 sale 3 30 12.00 360.00 march 30 purchase 4 35 5.05 176.75 based on this information, what is the cost of goods sold for the month ended march 31, 2021, for turner company if the company uses perpetual lifo as its inventory valuation method? Marcus dives from the surface of the ocean to a reef 18 meters below sea level. What integer represents Marcus's location relative to the surface? How far does Marcus have to go to return to the surface? What best completes the analogy player as to team as inch is to ? measure ,short ,foot,warm? If A= [ 1 -3 -3 5 ] and AB = [ 1 -7 -3 1 ], determine the first and second columns of B. Let by be column 1 of B and by be column 2 of B. consider a simple ideal rankine cycle with fixed turbine inlet temperature and condenser pressure. what is the effect of increasing the boiler pressure on pump work input? public health officials believe that 90% of children have been vaccinated against measles. a random survey of medical records at many schools across the country found that, among more than 13,000 children, only 89.4% had been vaccinated. a statistician would reject the 90% hypothesis with a p-value of 0.011. a) explain what the p-value means in this context. b) the result is statistically significant, but is it important? comment. Please help with this! Will mark best!! Based on the scatterplot what is the best prediction of the number of visitors the zoo will receive on a day with high temperature of 106 bird flies straight northeast a distance of 86.3 km for 2.7 h. With the x-axis due east and the y-axis due north, what is the displacement (in km) in unit vector notation for the bird? (Express your answer in vector form.) Fill The Blank? Sarah recently had a routine medical test conducted. Her doctor contacted her and told her that there were some irregularities and further tests were needed. While Sarah was concerned about the results, she dealt with her stress by talking to friends, spending time with her family, and staying busy. This is an example of _____ coping. what exists when a party to a contract does not understand the nature and consequences of the contract at the time it was formed? select one: a. consideration b. duress c. a principal-agent relationship d. mental incompetence let f be the function that satisfies the given differential equation. write an equation for the tangent line to the curve y Does the sample size have an effect on the standard deviation of all possible sample means? Explain your answer. Choose the correct choice below.A. The smaller the sample size, the smaller is the standard deviation of X, because x is averaging fewer values. B. The larger the sample size the larger the range of values that could take on, and therefore the larger the standard deviation of x. C. The sample size has no effect on the standard deviation of all possible sample means because x - for every sample, and so the standard deviation is just zero. D. The larger the sample size, the smaller the standard deviation of X, because the denominator of the standard deviation of x contains the square root of the sample size. Suppose the price of a box of macaroni and cheese increases from $1 to $2 each. The degree to which quantity demanded responds to this price increase depends on the Suppose the following model describes changes in Company ABCssales: ABCt = 0.078 - 0.095( ABCt-1)The current change (first difference) in the companys salesgrowth rate is 0.04.Use