Dropping an antacid tablet in a cup of water is a chemical change while boiling a cup of water for tea is just a physical change.
Physical versus chemical changePhysical changes have to do with the physical properties of substances. Such changes can be reversed.
Chemical changes, on the other hand, have to do with the chemical properties of substances and are usually irreversible when they occur.
Dropping an antacid in water with the formation of bubbles indicates that gas is evolved in the reaction. This means that a chemical reaction has occurred.
The bubble formed from boiling water is a result of increased entropy. Evaporated water can be retrieved by condensation.
More on physical and chemical changes can be found here: https://brainly.com/question/25014732
The complex ion Cu(NH3)42+ is formed in a solution made of 0.0200 M Cu(NO3)2 and 0.300 M NH3. What are the concentrations of Cu2+, NH3, and Cu(NH3)42+ at equilibrium? The formation constant*, Kf, of Cu(NH3)42+ is 1.70 × 1013.
The concentrations Cu(NH3)42+ at equilibrium is [Cu(NH3)42+] = 1.70 × 1013 * (0.0200M) * (0.300M)^4.
The concentrations of Cu2+ is [Cu(NH3)42+] + [Cu2+]
The concentrations of NH3 is 4[Cu(NH3)42+] + 4[NH3]
What is concentration equilibrium?Equilibrium concentration is described as a state when the rate of forward reaction in a chemical reaction becomes equal to the rate of backward reaction.
The equilibrium constant expression for the formation of the complex ion Cu(NH3)42+ is:
Kf = [Cu(NH3)42+] / [Cu2+] * [NH3]^4
where [Cu(NH3)42+], [Cu2+], and [NH3] are the molar concentrations at equilibrium.
The initial concentrations of Cu2+ and NH3 are 0.0200 M and 0.300 M respectively.
We have that Kf = 1.70 × 1013, we then rearrange the equation to solve for [Cu(NH3)42+]:
1.70 × 1013 = [Cu(NH3)42+] / (0.0200M) * (0.300M)^4
[Cu(NH3)42+] = 1.70 × 1013 * (0.0200M) * (0.300M)^4
Therefore at equilibrium, the concentration of Cu(NH3)42+ is [Cu(NH3)42+] = 1.70 × 1013 * (0.0200M) * (0.300M)^4
Learn more about Equilibrium concentration at: https://brainly.com/question/13414142
#SPJ1
Fill in the gaps: A chemical _______ is always shown with the reactants on the left of an arrow and the products on the right.
Answer:
equation
Explanation:
A chemical reaction can be represented using chemical equation. A chemical equation is always shown with the reactants on the left of an arrow and the products on the right.
What is chemical reaction?Chemical reaction is a process in which two or more than two molecules collide in right orientation and energy to form a new chemical compound. The mass of the overall reaction should be conserved. Mass can neither be created nor be destroyed.
There are so many types of chemical reaction reaction like combination reaction, double displacement reaction. A chemical equation is always shown with the reactants on the left of an arrow and the products on the right.
Therefore, a chemical equation is always shown with the reactants on the left of an arrow and the products on the right.
Learn more about the chemical reactions, here:
https://brainly.com/question/3461108
#SPJ2
How many atom are in 5fes2, 6c2h4o2 and 2cah2po42
Answer:
83 atoms
Explanation:
5*(1 fe + 2 S) + 6(2 C + 4H + 2O) + 2*2(1 Ca + 2 H + 1 P + 4 O) = 15 + 36 + 32 = 83 atoms
Calculate the ratio of the moles of produced to the moles of each of the reactants used. (Write two separate ratios.)
Ratio of moles of NH₃ produced to moles of N₂ used: 2 moles of NH₃ / 1 mole of N₂
Ratio of moles of NH₃ produced to moles of H₂ used: 2 moles of NH₃ / 3 moles of H₂
What is the mole ratio of the reaction?From the balanced chemical equation:
N₂ + 3 H₂ ⟶ 2 NH₃
We can determine the ratio of moles of products to the moles of each reactant.
Ratio of moles of NH₃ produced to moles of N₂ used:
From the balanced equation, we can see that 1 mole of N₂ reacts to produce 2 moles of NH₃. Therefore, the ratio is:
2 moles of NH₃ / 1 mole of N₂
Ratio of moles of NH₃ produced to moles of H₂ used:
From the balanced equation, we can see that 3 moles of H₂ react to produce 2 moles of NH₃. Therefore, the ratio is:
2 moles of NH₃ / 3 moles of H₂
Learn more about the mole ratio at https://brainly.com/question/19099163
#SPJ1
Given the equation of reaction;
N₂ + 3 H₂ ---> 2 NH₃
Calculate the ratio of the moles of produced to the moles of each of the reactants used. (Write two separate ratios.)
calculate the lattice parameter of the unit cell and radius (in nm) of a tantalum (ta) atom, given ta has a bcc structure, a theoretical density of 16.6 g/cm3 , and atomic weight of 180.9g/mol
The lattice parameter of Body centered cubic unit cell is, 0.121 nm.
The structure of tantalum (Ta), where it is a BCC structure (which means the number of atoms per unit cell n = 2 atoms/unit cell) and density = 16.6 g/cm^3, atomic weight A = 180.9 g/mol.
The volume of the unit cell is,
\(V = (\dfrac{4R}{\sqrt{3}})^3\)
The volume V is,
\(V = \dfrac{nA}{\rho N_A}\)
The volume V is,
\(V = \dfrac{2 \times 108.9}{16.6 \times 6.023 \times 10^{23}}\)
\(V = 2.17 \times 10^{-23} cm^3\)
Using the value of V and find the value of R,
\(R = \dfrac{\sqrt3}{4} \times \sqrt[3]{V}\)
\(R = \dfrac{\sqrt3}{4} \times \sqrt[3]{2.17 \times 10^{-23}}\)
R = 0.121 nm
The radius is 0.121 nm.
To know more about the Body centered cubic, here
brainly.com/question/13996938
#SPJ4
The density of 1 cm3
of water is 1g/cm3
. What is the density of 200 cm3
of pure water?
A student has 25 cubic centimeters of three liquids: blue water(density 1g/cm3
), olive oil (density 0.85 g/cm3
) and corn syrup (density 1.4 g/cm3
). She carefully pours them into a single graduated cylinder. Please predict what will happen.
Responses
Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
Olive Oil on top, water in middle, and corn syrup on bottom because syrup is most dense.
Olive Oil on top, water in middle, and corn syrup on bottom because syrup is most dense.
It is not possible to predict.
It is not possible to predict.
Skip to navigation
Responses
Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
Corn
A student has 25 cubic centimeters of three liquids: blue water(density 1g/cm3
), olive oil (density 0.85 g/cm3
) and corn syrup (density 1.4 g/cm3
). She carefully pours them into a single graduated cylinder. Please predict what will happen.
Responses
Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
Olive Oil on top, water in middle, and corn syrup on bottom because syrup is most dense.
Olive Oil on top, water in middle, and corn syrup on bottom because syrup is most dense.
It is not possible to predict.
It is not possible to predict.
Skip to navigation
A student has 25 cubic centimeters of three liquids: blue water(density 1g/cm3
), olive oil (density 0.85 g/cm3
) and corn syrup (density 1.4 g/cm3
). She carefully pours them into a single graduated cylinder. Please predict what will happen.
Responses
Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
Olive Oil on top, water in middle, and corn syrup on bottom because syrup is most dense.
Olive Oil on top, water in middle, and corn syrup on bottom because syrup is most dense.
It is not possible to predict.
It is not possible to predict.
Skip to navigation
A student has 25 cubic centimeters of three liquids: blue water(density 1g/cm3
, olive oil (density 0.85 g/cm3 and corn syrup (density 1.4 g/cm3
She carefully pours them into a single graduated cylinder. Please predict what will happen.
A Corn syrup on top, water in middle, and olive oil on bottom because oil is most dense.
B Olive Oil on top, water in middle, and corn syrup on bottom because syrup is most dense.
C It is not possible to predict.
The density of 200 cm^3 of pure water is 200 g / 200 cm^3 = 1 g/cm^3, and is the same as the density of 1 cm^3 of water.
b. A Corn syrup on top, water in middle, and olive oil on bottom because corn syrup has the highest density of 1.4 g/cm^3, followed by water with a density of 1 g/cm^3, and olive oil with a density of 0.85 g/cm^3.
So option A is correct.
What is density?Density is described as the substance's mass per unit of volume.
We were able to determine which substance will stay in its relative position using Archimedes' principle which states that the upward buoyant force that is exerted on a body immersed in a fluid, whether fully or partially, is equal to the weight of the fluid that the body displaces.
Learn more about density at: https://brainly.com/question/1354972
#SPJ1
C2H4O2 IS THE EMPIRICAL FORMULA FOR GLUCOSE?
The empirical formula of the glucose molecule is written as \(CH_{2} O\).
What is the empirical formula for glucose?Let us recall that glucose is the molecule that is response for the quick release of energy in the body. It is also the molecule that is first formed in the process of photosynthesis.
The term carbohydrate actually means a compound that is a hydrate of carbon and it is composed of glucose molecules. The empirical formula shows the relationship or the ratio of the atoms that could be found in a compound. We can see that we can obtain the ratio from the number of each of the atoms present.
Learn more about empirical formula:https://brainly.com/question/27749976
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
PLZZ HELP : Which layer extends from below the mantle
to the center of Earth? (Number 2)
Answer:
f; core
Explanation:
the only one that makes sense
Which property do all metals have?
А They are hard.
B They conduct electricity.
С They form acidic oxides.
D They react with water.
Rosina creates a demonstration showing a sound echo. How could she demonstrate this?
She throws water at a wall, and it drips down the wall,
B She throws a rubber ball at a wall, and it bounces back to her,
с
She throws an egg at a wall, and it breaks and falls to the floor,
D She throws sand at a wall, and it hits the wall and falls to the floor.
Answer:
correct option for this question is B. when he throw rubber ball at a wall and it bounce back to her
Answer: b rubber ball
Explanation:
it will bounce back not like the other things she threw
Part B
Next, you’ll test your hypothesis from part A by examining the reaction times of vinegar and baking soda in water at four different temperatures. You’ll carry out the reaction using water at room temperature (about 25°C), 40°C, 60°C, and 80°C. Make sure that you use the same amounts of vinegar and baking soda for all three three trials.
Gather all the materials, and perform these steps for each trial:
Heat at least
cup (60 milliliters) of water to the required temperature (refer to the data table). Water may be heated on a stove, on a hot plate, or in a microwave oven.
Measure and record the actual temperature of the water.
Measure 1 tablespoon (15 milliliters) of the water into the cup.
Add
teaspoon (1.5 grams) baking soda to the water, and stir until it is dissolved. The solution will be clear.
Measure 1 tablespoon (15 milliliters) of vinegar, but do not pour it into the cup yet.
Very quickly, do all of the following:
a. Pour the measured vinegar into the cup.
b. Start the stopwatch.
c. Stir or carefully swirl the substances in the cup.
The chemical reaction will produce bubbles. You’ll be able to see the bubbles and hear them pop. Watch and listen for when the reaction stops. When it looks and sounds like it has finished, stop the stopwatch.
Record the reaction time in the data table.
Discard the solution down the drain, and rinse the cup.
Repeat steps 1–9 of this procedure, doing three trials for each water temperature. Record the average temperature and reaction time for each set of the three trials. Read this math review to know how to calculate average of a data set.
The reaction time decreases as the temperature increases of the reaction mixture increases.
A sample record of results is:
Temperature (°C) Trial 1 Trial 2 Trial 3 Average25°C 11 seconds 11 seconds 11 seconds 11 seconds40°C 8 seconds 8 seconds 8 seconds 8 seconds60°C 5 seconds 5 seconds 5 seconds 5 seconds80°C 3 seconds 3 seconds 3 seconds 3 secondsWhat is the effect of an increase in temperature on reaction time?An increase in temperature leads to an increase in reaction rate or a decrease in reaction time.
The increase in temperature provides more thermal energy to the reactant molecules, which leads to an increase in the average kinetic energy of the molecules. As a result, more reactant molecules have sufficient energy to overcome the activation energy barrier and undergo successful collisions, leading to an increased reaction rate.
Learn more about reaction time at: https://brainly.com/question/26142029
#SPJ1
What happens to the amount of solution when we add food colour to it?
Answer:
We need more? What else is in the question? This is unanswerable.
Explanation:
This time, include both the coefficient and exponent. Express 0.00212 in scientific notation.
[?] * times 10^[?]
Enter the coefficient in the green box and the exponent in the yellow box.
Coefficient (green) Exponent (yellow)
_______________ _____________ Enter
Answer: 212
Explanation:
Calculate the pressure of 2.50 Liters of a gas at 25.0oC if it has a volume of 4.50 Liters at
STP.
Answer:
P_2 =0.51 atm
Explanation:
Given that:
Volume (V1) = 2.50 L
Temperature (T1) = 298 K
Volume (V2) = 4.50 L
at standard temperature and pressure;
Pressure (P1) = 1 atm
Temperature (T2) = 273 K
Pressure P2 = ??
Using combined gas law:
\(\dfrac{P_1V_1}{T_1} = \dfrac{P_2V_2}{T_2} \\ \\ \dfrac{1 *2.5}{298} = \dfrac{P_2*4.5}{273}\)
\(0.008389261745 \times 273 = 4.5P_2\)
\(P_2 =\dfrac{0.008389261745 \times 273 }{4.5}\)
\(P_2 =0.51 \ atm\)
The carbon cycle is the exchange of carbon between the lands, the oceans the atmosphere and the earth's interior
O True
O False
Answer:
True
Explanation:
Carbon is the backbone of life on Earth. Most of Earth's carbon, about 65,500 billion metric tons is stored in rocks. The rest is in the ocean, atmosphere, plants, soil, and fossil fuels. Carbon flows between each reservoir in an exchange called the carbon cycle, which has slow and fast components.
Why does it mean by methane molecule is symmetrical?
A methane molecule (CH4) is considered symmetrical because it possesses a symmetric structure and exhibits symmetry operations.
Symmetry refers to a balanced arrangement of elements that can be divided into equal parts by a plane, axis, or center. In the case of methane, it exhibits several symmetrical characteristics.
Firstly, methane has a tetrahedral molecular geometry, with the carbon atom at the center and four hydrogen atoms positioned around it. This geometry ensures that the molecule is symmetrical in terms of its spatial arrangement.
Each hydrogen atom is located at one of the vertices of the tetrahedron, forming equal angles and distances with respect to the central carbon atom. This symmetry is maintained regardless of the orientation of the molecule.
Additionally, methane possesses rotational symmetry. It can be rotated around any of the carbon-hydrogen bonds, and the molecule will retain its overall appearance.
The symmetry of methane arises from its molecular structure and the equal distribution of electron density around the central carbon atom. The four hydrogen atoms are bonded to the carbon through sigma bonds, which have a cylindrical symmetry. This balanced arrangement of the atoms contributes to the overall symmetry of the molecule.
For more such questions on methane visit:
https://brainly.com/question/25207057
#SPJ8
What mass of Fe(OH)3 will be obtained when 100. mL of 0.240 M FeCl3 is mixed with 200. mL of 0.182 M NaOH?
Answer:
648.68 mg
Explanation:
The reaction that takes place is:
FeCl₃ + 3NaOH → Fe(OH)₃ + 3NaClFirst we calculate how many moles of each reactant were added, using the given volumes and concentrations:
FeCl₃ ⇒ 100 mL * 0.240 M = 24 mmol FeCl₃NaOH ⇒ 100 mL * 0.182 M = 18.2 mmol NaOH24 mmol of FeCl₃ would react completely with (24 * 3) 72 mmol of NaOH. There are not as many NaOH mmoles, so NaOH is the limiting reactant.
Now we calculate how many moles of Fe(OH)₃ are formed, using the moles of the limiting reactant:
18.2 mmol NaOH * \(\frac{1mmolFe(OH)_3}{3mmolNaOH}\) = 6.07 mmol Fe(OH)₃Finally we convert 6.07 mmol Fe(OH)₃ to grams, using its molar mass:
6.07 mmol Fe(OH)₃ * 106.867 mg/mmol = 648.68 mgThe 129.6 g mass of Fe(OH)₃ will be obtained.
How we calculate mass or weight from moles?Weight or mass of any substance can be calculated from mole as:
n = W/M.
Given chemical reaction is:
FeCl₃ + 3NaOH → Fe(OH)₃ + 3NaCl
According to the question:
Concentration of FeCl₃ = 0.240 M
Volume of FeCl₃ = 100 mL
Concentration of NaOH = 0.182 M
Volume of NaOH = 200 mL
Moles can be calculated by using the formula M = n/V mole/L 0r M = n×1000/V g/mL,
Moles of FeCl₃ = 0.240 × 100 = 0.024 mole
Moles of NaOH = 0.182 × 200 = 3.64 mole
From the stoichiometry of the reaction, it is clear that 3 mole of NaOH i.e. 109.2 moles of NaOH reacts with 1 mole of FeCl₃ to form product. So here NaOH is the limiting agent and responsible for the formation of product. Now we calculate how many moles of Fe(OH)₃ are formed, using the moles of the limiting reactant as follow:
Moles of Fe(OH)₃ = 1/3 × ( 3.64) = 1.21 mole
Finally we convert 12.1 mole Fe(OH)₃ to grams, using its molar mass:
W = 1.21 mole × 106.87 g/mole = 129.6 g
Hence, 129.6 gram of Fe(OH)₃ will be obtained.
To know more about moles, visit the below link:
https://brainly.com/question/14464650
When fossil fuels are burned, they emit carbon dioxide into the atmosphere. After centuries of large amounts of carbon dioxide accumulating in the atmosphere, the earth's temperature increases by 1°C.
What is the connection between increasing carbon dioxide and increasing temperature?
The connection between increasing carbon dioxide and increasing temperature is: carbon dioxide absorbs heat from the sun and traps it in earth's atmosphere. Since the heat cannot escape, it causes the earth's temperature to increase which is the first option.
When carbon dioxide (CO₂) and other greenhouse gases are present in the atmosphere, they act as a natural blanket, allowing sunlight (solar radiation) to pass through and reach the Earth's surface. Some of this solar radiation is absorbed by the Earth's surface, while the rest is reflected back towards space as heat (infrared radiation). However, greenhouse gases like carbon dioxide have the property of absorbing and re-emitting infrared radiation.
Learn more about fossil fuel here
https://brainly.com/question/2029072
#SPJ1
through which filter did water went through faster?
Answer:
The filter that water went through faster is Filter paper
The Calvin cycle is considered ______ because it doesn't involve photoexcitation.
Answer:
not dependent on light, light independent
Explanation:
Calvin's Cycle is a process where plants and algae use CO2 in the air into glucose. They do not need to be dependent on light to produce glucose (in other words not involving photoexcitation, the process of production using light).
an atom x having Atomic no 27 has aneutron no 28 neutron no what is x
the answer is 94 because you times the amount of atoms by the calculator of atoms
Which of the following best defines velocity? (3 points) a It is an object's speed at a specific point in time. b It is the total distance traveled over the total time. c It is the speed of an object in a specific direction. d It is a measure of how far an object moves in a certain time.
The statement that best represents the velocity is the speed of an object in a specific direction.
What is Kinematics?Kinematics is the branch of mechanics concerned with the motion of objects without reference to the forces which cause the motion.
Given is a term used widely in kinematics. The term is velocity.
Assume that the motion is one - dimensional. Velocity is a vector quantity. This means, it has both magnitude and direction. Velocity is defined as the rate of change of displacement with respect to time. Mathematically -
v = Δx/Δt
Now, option [a] and [b] cannot be correct as they involve the measurement of speed. Option [d] gives the measurement of distance travelled. Displacement and distance for a one dimensional motion (either in forward or backward and not involving both) are same in magnitude. In this case, you can say that the speed of an object in specific direction is velocity.
Therefore, the statement that best represents the velocity is the speed of an object in a specific direction.
To solve more questions on Velocity, visit the link below-
https://brainly.com/question/13372043
#SPJ1
Calculate the heat change (ΔΗ°rxn) for the slow reaction of zinc with water
Zn(s)+2H2O(l) ---> Zn^2+ (aq) +H2(g)
ΔΗ°rxn = kJ
The heat change or enthalpy change, ΔH°rxn, for the slow reaction of zinc with water is +417.7 kJ/mol.
The heat change or enthalpy change, ΔH°rxn, for the reaction of zinc (Zn) with water (H₂O) can be calculated using the standard enthalpies of formation for each species involved in the reaction.
Balanced chemical equation for the reaction is;
Zn(s) + 2H₂O(l) → Zn²⁺(aq) + H₂(g)
The standard enthalpy change for the reaction, ΔH°rxn, can be calculated as the sum of the standard enthalpies of formation of the products minus the sum of the standard enthalpies of formation of the reactants, each multiplied by their respective stoichiometric coefficients;
ΔH°rxn = Σ(nΔH°f, products) - Σ(mΔH°f, reactants)
where n and m are the stoichiometric coefficients of the products and reactants, respectively, and ΔH°f is the standard enthalpy of formation.
Assuming standard conditions (25°C and 1 atm), the standard enthalpies of formation for Zn²⁺(aq) and H₂(g) are typically tabulated values. Let's assume their values to be ΔH°f(Zn²⁺(aq)) = -153.9 kJ/mol and ΔH°f(H₂(g)) = 0 kJ/mol, respectively.
The standard enthalpy of formation of water (H₂O) is -285.8 kJ/mol.
Put the values into the equation, we get;
ΔH°rxn = [ΔH°f(Zn²⁺(aq)) + ΔH°f(H₂(g)] - [ΔH°f(Zn(s)) + 2ΔH°f(H₂O(l))]
ΔH°rxn = [-153.9 + 0] - [0 + 2(-285.8)]
ΔH°rxn = -153.9 + 571.6
ΔH°rxn = 417.7 kJ/mol
To know more about heat change here
https://brainly.com/question/18912282
#SPJ1
Which example has particles that can be drawn closer to occupy smaller volume? a. fruit juice b. block of wood c. air inside the syringe d. ice cube
The capacity of an object is measured by its volume. For instance, a cup's capacity is stated to be 100 ml if it can hold 100 ml of water in its brim. Here ice cube has particles that can be drawn closer to occupy smaller volume. The correct option is D.
Due to the strong intermolecular interactions, the solid molecules are very near to one another. Solids have a low volume and a high density as a result. Additionally, the solid molecules cannot be easily crushed due to the narrow intermolecular distance.
So here ice cube has small volume.
Thus the correct option is D.
To know more about volume, visit;
https://brainly.com/question/13807002
#SPJ1
A Sample of helium occupies a volume of 160 cm³ at 100 KPa and 25°C. what Volume will it occupy if the pressure is adjusted to 80 KPa and the temperature remains unchanged?. -273
Boyle's Law-
\(\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}\\\)
(Pressure is inversely proportional to the volume)
Where-
\(\sf V_1\) = Initial volume\(\sf V_2\) = Final volume\(\sf P_1\) = Initial pressure\(\sf P_2\) = Final pressureAs per question, we are given that -
\(\sf V_1\) = 160 cm³\(\sf P_1\) = 100KPa\(\sf P_2\) = 80KPaNow that we have all the required values and we are asked to find out volume which will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged. For that we can put the values and solve for the final volume of helium-
\(\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}\)
\( \:\:\:\:\:\:\longrightarrow \sf 100 \times 160 = 80 \times V_2\\\)
\( \:\:\:\:\:\:\longrightarrow \sf V_2 = \dfrac{100 \times 160}{80}\\\)
\( \:\:\:\:\:\:\longrightarrow \sf V_2 =100\times \cancel{\dfrac{ 160}{80}}\\\)
\( \:\:\:\:\:\:\longrightarrow \sf V_2 = 100 \times 2\\\)
\( \:\:\:\:\:\:\longrightarrow \sf \underline{V_2 = 200 \:cm^3 }\\\)
Therefore, 200 cm³ will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged.Polyethylene is 86.0% C and 14.0%
H. Determine the empirical formula of the compound.
Percent to Mass: How many grams of C/and Hare present in 100.0 g?
The empirical formula of polyethylene can be determined by converting the given percentages of carbon (C) and hydrogen (H) into grams. To find the grams of each element, we assume a 100.0 g sample of polyethylene.
For carbon:
Mass of carbon = 86.0% × 100.0 g = 86.0 g
For hydrogen:
Mass of hydrogen = 14.0% × 100.0 g = 14.0 g
Therefore, in a 100.0 g sample of polyethylene, there are 86.0 grams of carbon and 14.0 grams of hydrogen.
The empirical formula of a compound represents the simplest whole-number ratio of atoms present in the compound. To determine the empirical formula, we need to find the ratio of carbon to hydrogen in terms of moles.
First, we convert the masses of carbon and hydrogen into moles using their respective molar masses. The molar mass of carbon is approximately 12.01 g/mol, and the molar mass of hydrogen is approximately 1.008 g/mol.
Number of moles of carbon = 86.0 g / 12.01 g/mol ≈ 7.162 mol
Number of moles of hydrogen = 14.0 g / 1.008 g/mol ≈ 13.89 mol
Next, we divide the number of moles of each element by the smallest number of moles to get a simplified ratio.
Carbon: Hydrogen ≈ 7.162 mol : 13.89 mol ≈ 1 : 1.939
Since we want to express the ratio in whole numbers, we multiply both sides by 2 to get a whole number ratio.
Carbon: Hydrogen ≈ 2 : 3.878
Rounding to the nearest whole number, we find that the empirical formula of polyethylene is CH₂.
for such more questions on hydrogen
https://brainly.com/question/24433860
#SPJ8
How many grams of NaCl
You would recover 36.525g of NaCl after evaporating all of the water.
How to find the how many grams of NaCl that would be recover when all water is evaporated off of this solution?To find the grams of NaCl that would be recovered after evaporating all the water, we can use the following formula:
mass = moles * molar mass
Where:
Moles = Molarity * Volume
Molarity = 0.250 M
Volume = 2500.0 mL = 2.5 L
Molar mass of NaCl = 58.44 g/mol
mass = 0.250 M * 2.5 L * 58.44 g/mol
mass = 36.525 g
Learn about evaporation here https://brainly.com/question/2013258
#SPJ1
if a population of 50 individuals grew by 30% per year how mhow many years would it take the population to reach more than 100 individuals?
Answer:
3 years
Explanation:
(50*0.3)x>=100
The average dosage of oxcarbazepine for an epileptic child between the ages of 4 and 16 is 9.00 mg per 1 kg of body weight (9.00 mg/kg ). Calculate how many milliliters of oxcarbazepine a child who weighs 47.1 pounds should be prescribed considering the medication is served as a suspension of 60.0 mg/mL . Keep in mind that 1 pound is equivalent to 0.453 kilograms.