Tidal forces were not significant while both stars were on the main sequence, but they are now crucial to the Algol system. The Algol system's main-sequence stars are modest in comparison to their physical distance. Option B is Correct.
Oceanic tides on Earth are produced by tidal forces, with the Moon and, to a lesser extent, the Sun serving as the attracting bodies. In addition, tidal forces are the cause of tidal heating, tidal acceleration, and tidal locking.
Changes in the gravitational potential energy of the Sun, Moon, and Earth cause tidal forces. These forces are what drive the seas' cyclical motion, which shifts water levels momentarily and differently depending on where they are. Option B is Correct.
Learn more about Tidal forces visit: brainly.com/question/29774942
#SPJ4
Correct Question:
Tidal forces are very important to the Algol system today, but were not important when both stars were still on the main sequence. Why not?
A) Main-sequence stars in a system like the Algol system are small compared to their physical separation.
B) Main-sequence stars are too big to be affected by tidal forces.
C) Main-sequence stars are too massive to be affected by tidal forces.
D) Main-sequence stars are unaffected by tidally-induced mass transfer.
Are stairs a type of inclined plane?
Answer:
Inclined planes are simple machines used to make work easier. Ramps, ladders, and staircases are all inclined planes.
Explanation:
Answer:
imma say yes
Explanation:
an experiment is performed using a strip of metal the strip is connected in the cirucit shown above and the potential difference across the strip and the current passing through it are monitored. The best fit-line on a graph of the resulting voltage-current measurments appears as shown. 32. The graph shows that the strip obeys which of the following? (A) Gauss's law (B) Lenz's law (C) Faraday's law (D) Ampere's law (E) Ohm's law
Based on the information provided, the best fit-line on the graph of the voltage-current measurements indicates that the strip of metal obeys Ohm's law.
Ohm's law states that the current passing through a conductor is directly proportional to the potential difference applied across it, provided that the temperature and other physical conditions remain constant. The graph shows a linear relationship between the voltage and current, which is a characteristic of Ohm's law. Therefore, we can conclude that the strip of metal behaves as an ohmic conductor.
Gauss's law relates to electric flux, Lenz's law describes the direction of induced EMF, Faraday's law describes the induced EMF in a conductor due to a changing magnetic field, and Ampere's law describes the relationship between magnetic fields and electric currents.
So, Ohm's law is the correct answer.
Thus, option E is the correct answer.
Learn more about current here,
https://brainly.com/question/1873362
#SPJ11
What is the equation that shows the inverse relationship between wavelength and frequency?
Answer:
V = f * λ velocity equals frequency * wavelength
If f is increased then λ must decrease for the velocity to remain constant.
Supposing d(t) is known to have value D,
what procedure will find the time t at which
this happens?
2. Set d(t) equal to v^2/a
6. Set a to zero
A uniform ladder rests on a rough horizontal ground leaning against a smoth vertical wall.Weight of a ladder is 300 N and a man weighing 500 N stands on one quarter of its length from the bottom. Ladder makes 30 to the horizontal. Find the reaction at the wall and the total force on the ground.
The total force of the ground is 800N and the reaction at the wall on the ground is 476.3 N.
From the given,
weight of ladder (W₁) = 300N
weight of man (W₂) = 500N
The angle (θ) = 30°
The reaction at the wall (R) =?
ΣMg =0
-R.l.sin(30°) + 500×1/4×l(cos 30°) + 300×1/2×l(cos 30°) = 0
125×l(cos 30°) + 150×l(cos 30°) = R.l.sin(30°)
(125 + 150)×l(cos 30°) = R.l×sin(30°)
275 ×l(cos 30°) / l×sin(30°) = R
275×0.866/ 0.5 = R
238.15 ×2 =R
R = 476.3 N
The total force, Fg = 300 + 500
Fg = 800 N.
Thus, the total force Fg is 800 N and the reaction at the wall is 476.3 N.
To learn more about Force :
https://brainly.com/question/31046192
#SPJ1
The ability for a muscle to work against a resistance for an extended period of time is.
Muscular Endurance refers to the ability for a muscle to work against a resistance for an extended period of time
Endurance :-
Perseverance is connected with the capacity to perform work over a drawn out timeframe. Youngsters, for instance, can play effectively for hours. Endurance can be impacted by a singular muscle, a muscle bunch, or the complete body. Muscle perseverance mirrors the capacity to support rehashed muscle compression and is connected with muscle strength.
To learn more about muscle endurance
https://brainly.in/question/15812983
#SPJ4
Read the length of the metal bar with the correct number of significant figures. 15.000 cm 20 cm 15.0 cm 15 cm 15.00 cm
The correct number from the options to describe the length of this metal bar is 15 cm or fifteen centimeters.
What are the units used to measure length?The most common units to measure length include:
CentimeterMeterKilometerMilesHow much does this bar measure?The unit that should be used is centimeters, considering a rule usually contains centimeters, and this is the unit provided in the image.
Moreover, based on the rule it can be determined the length is 15 centimeters. Other numbers such as 15.0 or 15.000 are innaccurate as there is not need to add more figures in this case.
Note: This question is incomplete because the image is missing. Here is the image
Learn more about centimeters in: https://brainly.com/question/19098836
#SPJ1
The hair shaft is made up of three layers: an __ medulla , a cortex, and an ___cuticle
- absent; colored
-Colored; absent
-inner; outer
-outer ; inner
A heavy man and a light man parachute together from a high-flying plane. The first man to attain zero acceleration will be the light man because:
A. The lighter man will not have to fall for as long a time before the air resistance equals
his weight
B. The gravitational force on each man is the same.
C. Both men encounter the same amount of air resistance,
The first man to attain zero acceleration will be the light man because the lighter man will not have to fall for as long a time before the air resistance equals his weight.
What is acceleration?Acceleration is the rate of change of the velocity of an object with respect to time. Accelerations are vector quantities.
To learn more about Acceleration here
https://brainly.com/question/12550364
#SPJ2
the earth revolves blank around the sun each year when viewed from above the north pole.
When viewed above the North Pole, the Earth rotates counterclockwise, from west to east. This is also called a prograde rotation.
When viewed from above Earth's North Pole Which way does Earth orbit the sun?The Earth rotates around the Sun-also counterclockwise viewed from above the North Pole, clockwise observe from the South Pole-to give us our years. The plane of the Earth's orbit is called the sphere where aureole happens. Because of this direction of rotation, we see the sun rising every day in the east and position in the west.
As we viewed above the earth revolves empty around the sun each year when viewed from above the north pole. We know that the Earth is viewed once in twenty-four hours.
So we can conclude that Earth when seen from the top of the north pole, will be seen revolve in anti-clockwise.
Learn more about the North Pole here: https://brainly.com/question/26108197
#SPJ1
(ii) if two successive overtones of a vibrating string (fixed at both ends) are 280 hz and 350 hz, whatis the frequency of the fundamental? which harmonics are these two?
To determine the frequency of the fundamental and identify the harmonics, we need to understand the relationship between the frequencies of harmonics in a vibrating string.
In a vibrating string fixed at both ends, the frequency of the fundamental (first harmonic) is inversely proportional to the length of the string. The frequency of each successive harmonic is an integer multiple of the fundamental frequency.
Let's denote the frequency of the fundamental as f₀. The given frequencies of the two successive overtones are 280 Hz and 350 Hz.
1. Finding the Fundamental Frequency:
The second overtone (first overtone is not given) has a frequency of 350 Hz, which corresponds to three times the frequency of the fundamental. Therefore, we can write:
f₂ = 3 * f₀
350 Hz = 3 * f₀
f₀ = 350 Hz / 3
f₀ ≈ 116.67 Hz
Hence, the frequency of the fundamental (first harmonic) is approximately 116.67 Hz.
2. Identifying the Harmonics:
The frequency of the first overtone (second harmonic) is 280 Hz. Since it is an overtone, we know it is a multiple of the fundamental frequency. Let's calculate the ratio:
f₁ = 280 Hz
f₁ = 2 * f₀
280 Hz = 2 * 116.67 Hz
So, the given frequency of 280 Hz corresponds to the second harmonic.
To summarize:
- The frequency of the fundamental (first harmonic) is approximately 116.67 Hz.
- The 280 Hz frequency corresponds to the second harmonic.
- The 350 Hz frequency corresponds to the third harmonic.
Learn more about frequencies using given link :
brainly.com/question/4290297
#SPJ11
If Wile E. Coyote had enough money to buy all that ACME stuff, why didn't he just buy dinner?
Answer:
I dont know but nice question
Explanation:
I laughed super hard when I saw this
An electron’s position cannot be known precisely. Only its probability of being in a certain location can be known. True or false?.
The statement is TRUE! The precise or specific location of an electron cannot always be known or determined, regardless of what we do.
We can only assume it exists somewhere. It is also known as the "electron cloud model." It demonstrates that we can find electrons by considering "the probability of being in a certain location."
One of the theories that I believe explains this strange physics is the Principle of Heisenberg's Uncertainty. This equation describes electron wave-particle duality.
The peculiarities of the quantum realm have been repeatedly demonstrated. Knowing more means admitting that we know less.
Learn which electrons have the most energy in an atom here: https://brainly.com/question/1255220
#SPJ4
Jose and Taylor used plastic bottles to create mini greenhouses for their science fair projects. Taylor used a clear bottle, and Jose used a green bottle. Explain whose plants will grow better and why.
Hint: Chlorophyll, which captures energy for plants, is a green pigment.
Answer using 3 to 4 complete sentences.
The person who's plants will likely grow better is that of Taylor because they are in a clear bottle that can get sunlight.
Why would the plants grow better ?Plants use a process called photosynthesis to convert sunlight into energy. A key component of photosynthesis is the pigment chlorophyll, which absorbs light most efficiently in the blue and red parts of the electromagnetic spectrum, but not green light, which it reflects, making the plant appear green.
Taylor's plants, in the clear bottle, should grow better than Jose's plants in the green bottle. This is because the clear bottle allows the full spectrum of light to reach the plants, including the red and blue light that chlorophyll uses to perform photosynthesis.
Find out more on Chlorophyll at https://brainly.com/question/15608035
#SPJ1
A mass on a spring in SHM has amplitude A and period T. What is the total distance traveled by the mass after a time interval �?
A) 0
B) A/2
C) A
D) 2A
E) 4A
The total distance traveled by the mass after a time interval is 4A. Option E is correct.
In simple harmonic motion (SHM), the motion of the mass on a spring repeats itself periodically. The total distance traveled by the mass after a time interval τ depends on the relationship between τ and the period T.
The period T is the time it takes for one complete cycle of the motion. In other words, it is the time for the mass to go from one extreme (maximum displacement) to the other extreme and back again. During this time, the mass covers a distance of 2A, where A is the amplitude of the motion.
Now, let's consider the time interval τ. If τ is equal to or less than the period T, it means that the time interval falls within one complete cycle of the motion. In this case, the mass will cover a distance of 2A, as mentioned earlier.
However, if τ is greater than the period T, it means that the time interval spans multiple cycles of the motion. In each cycle, the mass covers a distance of 2A. Since there will be multiple cycles in the time interval τ, the total distance traveled by the mass will be greater than 2A.
The mass will travel a total distance of 4A after the time interval τ.
Therefore, Option E is correct.
Learn more about distance -
brainly.com/question/114551
#SPJ11
Mr. Temper, a 5-foot, 4-inch, 100-pound hothead, tells Mr. Big, a 300-pound professional wrestler, that he is going to "make him regret he set foot in this bar." At the same time, Temper clenches and raises his fists. Big looks at Temper from head to toe and responds, "yeah, right." Big can sue Temper for: a. assault
b. battery
c. assault and battery
d. Big has no cause of action
Big has no cause of action against Temper. In this scenario, while Temper may have made a verbal threat and raised his fists in a confrontational manner, there is no indication that he physically touched or harmed Big.
Assault refers to the act of intentionally causing apprehension or fear of imminent harmful or offensive contact. Battery, on the other hand, involves the intentional and harmful or offensive physical contact with another person without their consent.
In this case, Temper's actions may constitute assault due to the verbal threat and raising his fists, creating an atmosphere of fear or apprehension. However, since no physical contact or harm occurred, battery is not applicable. Therefore, the appropriate response is option d: Big has no cause of action against Temper.
To know more about verbal threat visit:
https://brainly.com/question/32346568
#SPJ11
In a liquid with a density of 1300 kg/m3kg/m3 , longitudinal waves with a frequency of 380 HzHz are found to have a wavelength of 8.10 mm . Calculate the bulk modulus of the liquid.
The bulk modulus of the liquid is K=1.33×10 ³
The liquid that weighs heavier is denser if you weigh two liquids with similar volumes or amounts. A substance that is less dense than water will float if it is gently introduced to the water's surface. You follow the same procedure as you would for a solid to determine the density of a liquid. Determine the fluid's volume, mass it, and then divide mass by volume.
ρ=1300kg/m³
n=400Hz,λ=8.00m,
the velocity of wave v=nλ,
v=400×8.00=3200m/s
v= K/ρ , .....................eq1
3200= K/1300
or 3200×3200=K/1300 ,
or K=1.33×10 ³
Learn more about density here brainly.com/question/21865375
#SPJ4.
I n it in 20 minutes
JL.61 A producer of refrigerator compressors wants to implement
a just-in-time production line to support demand from a neighboring
appliance manufacturer. Demand from the applian
The producer of refrigerator compressors needs to determine the number of kanbans required for implementing a just-in-time production line to meet the demand for 150 compressors per day from a neighboring appliance manufacturer.
To calculate the number of kanbans required, we need to consider the production lead time, safety stock factor, and optimal production quantity. The production lead time is 5 days, which means that it takes 5 days to produce a batch of compressors once the production process starts.
The safety stock factor is 17%, indicating that the producer wants to maintain an additional 17% of the daily demand as safety stock to mitigate any unforeseen fluctuations. The optimal production quantity is 95 units, which is the batch size that minimizes setup costs.
To determine the number of kanbans, we first need to calculate the total demand during the production lead time. Since the demand is 150 compressors per day and the lead time is 5 days, the total demand during the lead time is 150 compressors/day * 5 days = 750 compressors. Adding the safety stock, the total demand becomes 750 compressors + (17% * 150 compressors) = 750 compressors + 25.5 compressors = 775.5 compressors.
Next, we divide the total demand by the optimal production quantity to get the number of kanbans required. The number of kanbans is calculated as 775.5 compressors / 95 compressors per kanban = 8.16 kanbans. Since we cannot have a fraction of a kanban, we round up to the nearest whole number. Therefore, the producer of compressors requires 9 kanbans to meet the demand of 150 compressors per day from the neighboring appliance manufacturer.
Learn more about refrigerator compressors here:
https://brainly.com/question/1383242
#SPJ11
The complete question is:
A producer of refrigerator compressors wants to implement a just-in-time production line to support demand from a neighboring appliance manufacturer. Demand from the appliance manufacturer is for 150 compressors a day. The production lead time is 5 days and the producer wants to have a 17% safety stock factor. This producer has also cut setup costs such that the optimal production quantity is 95 units. How many kanbans does this producer of compressors require?
Which element is always found in bioclastic sedimentary rocks?
The element which is always found in bioclastic sedimentary rocks is carbon.
What are sedimentary rocks?They are the types of rocks which are formed as a result of accumulation of minerals or organic particles at the surface of the earth.Sedimentation is the name given to a collective process which cause the particles to settle.
The study of sedimentary rocks is useful in civil engineering and as important sources of coal, fossil fuels and ores.The color of sedimentary rock is often determined by iron content and sometimes due to the presence of organic matter.
They are classified based on origin in to 4 types which are clastic, biochemical ,chemical and other sedimentary rocks.While based on composition they are classified as siliciclastic,carbonate ,evaporite,organic rich,siliceous ,iron-rich and phosphatic sedimentary rocks.
Learn more about sedimentary rocks,here:
https://brainly.com/question/10709497
#SPJ3
Q.7. For a system with a transfer function of G(s)=- co² s² +2a+w² if the natural frequency is 0.5 and the damping ratio is 1.3, which of the following statements is correct regarding the unit step response of the system?
O A) Damped
O B) Undamped
O C) Underdamped
O D) Crittically Damped
O E) Overdamped
The system described by the transfer function G(s) = -co² s² + 2a + w², with a damping ratio of 1.3 and a natural frequency of 0.5, has an overdamped unit step response. So, the correct option is (E)
The transfer function of the system is given as G(s) = -co² s² + 2a + w², where co represents the damping ratio, a represents an arbitrary constant, and w represents the natural frequency of the system. We are given that the natural frequency is 0.5 and the damping ratio is 1.3.
To determine the type of unit step response, we need to analyze the damping ratio (co) in relation to the critical damping value (co_critical).
The critical damping ratio (co_critical) is defined as the value where the system is on the threshold between being overdamped and underdamped. It is given by the formula co_critical = 2 * sqrt(a * w²).
In our case, the natural frequency (w) is 0.5, so we can calculate co_critical as follows: co_critical = 2 * sqrt(a * 0.5²).
Since the damping ratio (co) is given as 1.3, we can compare it with co_critical to determine the type of unit step response.
If co > co_critical, the system is considered overdamped (Option E).
If co = co_critical, the system is considered critically damped (Option D).
If co < co_critical, the system is considered underdamped (Option C).
Based on the given values, we can determine that the system is overdamped (Option E) because the damping ratio (1.3) is greater than the critical damping ratio.
To know more about damping ratios, refer here:
https://brainly.com/question/31463018#
#SPJ11
If you know the centripetal force acting on an object moving in a circle, which equation will allow you to calculate the velocity of the object?.
Answer: F = mv^2/r
Explanation:
v = square root ( Fr/m )
where ,
v = velocity
F = centripetal force
r = radius of the circle
m = mass of object
What is the biggest animal on land?
Answer:
elephant
Explanation:
Answer:
elephant
Explanation:
17. a light is drawing .5a at 120v for 24 hours. what is the power rating of the light?
The power rating of the light is 60 Watts.
Power rating is the amount of electrical power that is required for a particular device to function. The power rating of a device can be determined using the formula:
P = IV
where P is power in watts, I is current in amperes, and V is voltage in volts. In the question above, the light has a current of 0.5 A and its voltage is 120 V.
Plugging these values into the formula, we get:
P = (0.5 A)(120 V)
P = 60 W
Therefore, the power rating of the light is 60 watts.
Learn more about power rating at https://brainly.com/question/30532124
#SPJ11
The wavelength of a sound wave is 30 m. The frequency is 7 Hz. What is the wave speed?
210 m/s
4.29 m/s
Answer:
210m/s
Explanation:
To find the speed of wave you need to multiply the wave length with the frequency.
How many DAYS occur between a new moon and a first quarter moon?
Answer:
About 29.5
Explanation:
Answer:
7 days or a week
Explanation:
3. Two fans blow at 5 ms^-1 in a easterly direction and 8ms^-1 in a Northerly
direction. What is the total wind speed of both fans combined?
Addition of vectors is done by adding the components of the vectors
The total speed of the fan is approximately 9.43 m/s,
Direction of total wind 58° counterclockwise from the positive x-axis
The reason the value is correct is as follows:
The given parameters are:
The direction at which the fan blowing at 5 m/s is blowing = Easterly
The direction in which the fan blowing 8 m/s is blowing = Northerly
The total speed of the van, |v| ≈ 9.43 m/s
Required:
To find the total wind speed of the fans
Solution:
Taken the easterly direction as the ith component, and the northerly direction as the jth component, the vector representing the speed of the fan is presented as follows
v = 5·i + 8·j
The magnitude of the total wind speed of the fan, |v| = √(5² + 8²) = √(89) ≈ 9.43
The total wind speed of the fan , |v| ≈ 9.43 m/s
The direction of the total speed with respect to the x-axis, θ, is given as follows;
θ = arctan(8/5) ≈ 58°
Learn more about addition of vectors here:
https://brainly.com/question/17691926
find an expression for t1 , the tension in cable 1, that does not depend on t2 . express your answer in terms of some or all of the variables m , θ1 , and θ2 , as well as the magnitude of the acceleration due to gravity g . you must use parentheses around θ1 and θ2 , when they are used as arguments to any trigonometric functions in your answer.
The expression for tension T₁ in cable 1 is calculated to be mgcosθ₁/(sinθ₁ + sinθ₂).
The angle made by strings 1 and 2 are θ₁ and θ₂ respectively. Tension in the strings 1 and 2 are T₁ and T₂ respectively.
Considering the diagram attached, the following tension components are written as,
The energy is directed downward by the weight of the block pressing against the body.
Vertical component of T₁ is T₁ sinθ₁ which acts upwards.
Horizontal component of T₁ is T₁ cosθ₁ which acts to the left.
Vertical component of T₂ is T₂ sinθ₂ which acts upwards.
Horizontal component of T₂ is T₂ cosθ₂ acting towards right.
To maintain an equilibrium, the upward forces and downwards forces must be equal even as the forces on the right and left hand side must be balanced.
Therefore, balancing the vertical components we obtain,
T₁ sinθ₁ + T₂ sinθ₂ = mg
For horizontal forces, T₁ cosθ₁ = T₂ cosθ₂
Re-arranging the above equation and making T₂ the subject of the formula, we can write it as,
T₂ = T₁ cosθ₁/cosθ₂
Substituting T₂ into the vertical component we get,
T₁ sinθ₁ + (T₁ cosθ₁/cosθ₂)sinθ₂ = mg
Multiply by cosθ₂ on both sides, we obtain,
T₁ sinθ₁ cosθ₂ + T₁ cosθ₁ sinθ₂ = mg cosθ₂
T₁ (sinθ₁ cosθ₂ + cosθ₁ sinθ₂) = mg cosθ₂
As we know the formula for sin(a + b) as sin(a)cos(b)+sin(b)cos(a), we get the above equation as,
T₁ sin(θ₁ + θ₂) = mg cosθ₂
Making T₁ as subject, we have,
T₁ = mg cosθ₂/sin(θ₁ + θ₂)
Thus, the equation for T₁ is deduced.
The given question is incomplete without the diagram. The diagram is attached in the attachment below.
To know more about tension:
https://brainly.com/question/30264095
#SPJ4
What is one example of thermal energy
Answer:
Solar Energy
Explanation:
Solar radiation (a form of an object) heats up our atmosphere, that's why heat is felt on earth.
How does your collected data help you to see if you meet your criteria for success
Collected data plays a crucial role in evaluating whether the criteria for success have been met. By analyzing the collected data, one can assess the progress made towards achieving the desired goals and determine if the criteria have been fulfilled.
Data provides an objective measure of performance or outcomes, allowing for an evidence-based assessment of success. It helps to quantify and track key metrics or indicators related to the criteria for success. By comparing the actual data with the predetermined benchmarks or targets, one can determine if the criteria have been met or if further improvements are required.
Data analysis also enables the identification of trends, patterns, and correlations, providing insights into the factors influencing success. It helps in identifying areas of strength and areas that need improvement. Additionally, data can be used for comparative analysis, benchmarking against previous periods or similar projects, to gain a broader perspective on success.
In summary, collected data provides an objective basis for evaluating progress and success by comparing actual performance against predetermined criteria, identifying areas of improvement, and gaining insights for future decision-making.
Know more about evidence-based assessment here:
https://brainly.com/question/31079603
#SPJ8
What is the velocity of a worm moving 1 meter in 2 hours to the East?
Answer:
Velocity = 0.0001389 m/s
Explanation:
Given that the
Distance covered = 1 metre
Time taken = 2 hours
Convert the hour to second
1 hour = 60 × 60 = 3600
2 hours = 2 × 3600 = 7200
What is the velocity of a worm moving 1 meter in 2 hours to the East?
Velocity can be referred as speed.
Velocity = distance/ time
Velocity = 1/7200
Velocity = 0.0001389 m/s