This diagram is attempting to compare the sizes of the four inner planets. What is wrong with this diagram?

Answer:

density = mass ÷ volume

Explanation:

mass = volume × density

       =24.9 cm3 × 2.72 g / cm3

      =67.728 g

b.9.38 ml.The volume of KOH required to neutralize the acetic acid is:9.38ml

The equation for the reaction between acetic acid (CH3COOH) and potassium hydroxide (KOH) is:

CH3COOH + KOH → CH3COO- + K+ + H2O

The titration of acetic acid with potassium hydroxide can be used to determine the concentration of the acetic acid solution. The volume of KOH required to neutralize the acetic acid can be calculated using the equation:

Volume (KOH) =\(\frac{ (Molarity of acetic acid) * (Volume of acetic acid) }{(Molarity of KOH)}\)

In this problem, the volume of KOH required to neutralize the acetic acid is:

Volume (KOH)

\(\frac{(0.400 M) * (15.0 mL) }{ (0.250 M)}\\= 9.38 mL\)

Therefore,It takes 9.38 ml of KOH to neutralise 1 g of acetic acid.

learn more about acetic acid Refer:brainly.com/question/15202177

#SPJ1

Complete question:A 15.0 mL portion of a 0.400 M solution of acetic acid is to be titrated with a standarized 0.250 M solution of KOH. What is the expected volume of the KOH solution needed to reach the phenolphthalein end point?

a.22.50 ml

b.9.38 ml

c.6.00 ml

d.3.75 ml

e.24.00 ml

Solution :

Structure I

The formal charge on both Carbon (C) atom is = 4 valance \($e^-$\) - bonds = 0

Formal charge (O) = 6 V.E - 2 bonds - 4 non bonding electrons = 0

Formal charge on (N) = 5 V.E - 3 bonds - 2 non bonding electrons = 0

F.C. on H = 1 V.E. - 1 bond = 0

Overall charge on the molecule = 0 charge

Structure II

Formal charge on both C atom = 4 valence \($e^-$\) - 4 bonds = 0

Formal charge (O) = 6 V.E. - 1 bonds - 6 non bonding electrons = -1 charge

Formal charge on (N) = 5 V.E. - 4bonds - 0 non bonding electrons = +1 charge

F.C on H = 1 V.E. - 1 bond = 0

Overall charge on the molecule = +1 -1

                                                     = 0 charge

The new volume of the gas is 56.6 liters when the temperature is raised to 325 K and the pressure is lowered to 1.2 atm.

PV = nRT

Where R is the ideal gas constant. Since the number of moles is constant in this problem, we can simplify the ideal gas law to:

P1V1/T1 = P2V2/T2

Where the subscripts 1 and 2 refer to the initial and final states of the gas, respectively.

We can now plug in the given values for the initial state of the gas:

P1 = 2.3 atm

V1 = 25 L

T1 = 299 K

And the given values for the final state of the gas:

P2 = 1.2 atm

T2 = 325 K

We can then solve for V2:

P1V1/T1 = P2V2/T2

(2.3 atm)(25 L)/(299 K) = (1.2 atm)V2/(325 K)

V2 = (2.3 atm)(25 L)(325 K)/(1.2 atm)(299 K)

V2 = 56.6 L (rounded to three significant figures)

for more question on gas

https://brainly.com/question/26758935

#SPJ11

Hard water contains higher levels of minerals such as calcium and magnesium, while soft water has low levels of these minerals. While both hard and soft water can be safe for drinking, hard water is generally considered safer due to the minerals it contains.

The minerals in hard water can actually be beneficial to human health, as they are important for strong bones and teeth. In addition, the minerals in hard water can help to balance the body's electrolytes and may have other health benefits.

Soft water, on the other hand, may contain higher levels of sodium or other chemicals used in the softening process. While these levels are generally considered safe, some people with certain health conditions may need to avoid drinking water with higher sodium levels.

Learn about Hard water here https://brainly.com/question/28178305

#SPJ1

Drift nets are a problem because when they are lost in the sea, they may continue to kill many animals.

This is referred to as a fishing technique where nets, called drift nets, hang vertically in the water column and are arranged to drift with the tide or current  without being anchored to the bottom.

In a situation whereby they are lost or left,  they may continue to kill many animals in what is referred to as ghost fishing which may lead to overexploitation and a disruption in the ecosystem thereby making it the correct choice.

Read more about Drift net here https://brainly.com/question/9570477

#SPJ1

Answer:

A

Explanation:

In genetic terms, a dominant trait is one that is phenotypically expressed in heterozygotes

Answer: i also need help on the same question :(

Explanation:

Answer:

B.

Explanation:

Can you give me brainliest? i need to rank up

Answer:

2nd One is correct

0.1 mol of sodium hydroxide (NaOH) would react exactly with 7.5 g of the diprotic acid \(H_{2}\)A.

What is Molar Mass?

Molar mass is the mass of one mole of a substance, expressed in grams per mole (g/mol). It is calculated by adding up the atomic masses of all the atoms in a molecule or the formula mass of all the ions in an ionic compound.

The balanced chemical equation for the reaction between diprotic acid, \(H_{2}\)A, and sodium hydroxide, NaOH, can be represented as follows:

2\(H_{2}\)A + 2 NaOH -> \(Na_{2}\)A + 2 \(H_{2}\)O

From the balanced equation, we can see that 2 moles of \(H_{2}\)A react with 2 moles of NaOH to produce 1 mole of \(Na_{2}\)A and 2 moles of water (\(H_{2}\)O).

First, we need to calculate the number of moles of \(H_{2}\)A in 7.5g using the formula:

moles = mass / molar mass

moles of \(H_{2}\)A = 7.5g / 150 g/mol = 0.05 mol

Since diprotic acid, \(H_{2}\)A, reacts in a 1:2 ratio with NaOH, we need to multiply the moles of \(H_{2}\)A by 2 to determine the moles of NaOH required for complete reaction:

Moles of NaOH = 2 * Moles of \(H_{2}\)A

Moles of NaOH = 2 * 0.05 mol

Moles of NaOH = 0.1 mol

0.1 mol of sodium hydroxide (NaOH) would react exactly with 7.5 g of the diprotic acid \(H_{2}\)A.

Learn more about Molar Mass from the given link

https://brainly.com/question/837939

#SPJ1

Answer:

3 Covalent Bonds and 1 Co ordinate Bond

Explanation:

4 bonds are in NH4¹+

NH4¹+ is the ammonium ion, which consists of a central nitrogen atom (N) and four hydrogen atoms (H). Nitrogen is located in group 15 of the periodic table and has 5 valence electrons. Hydrogen, on the other hand, has 1 valence electron.

To achieve a stable electron configuration, nitrogen needs to share electrons with the hydrogen atoms. Each hydrogen atom can form a single bond with the nitrogen atom by sharing its valence electron.

In NH4¹+, all four hydrogen atoms form single bonds with the central nitrogen atom. These bonds are represented by lines connecting each hydrogen atom to the nitrogen atom.

So, NH4¹+ has 4 bonds. Each bond represents a pair of electrons shared between the nitrogen atom and a hydrogen atom. The bonding arrangement ensures that the nitrogen atom has a complete octet (eight valence electrons) and each hydrogen atom has two electrons, following the stable configuration of helium.

The "+1" charge on NH4¹+ indicates that the ion has lost one electron, resulting in a positive charge. However, the number of bonds remains the same regardless of the charge.

Therefore, the correct answer is 4 for the number of bonds in NH4¹+.

Know more about the Ammonium ion here:

https://brainly.com/question/13796846

#SPJ8

The average corrected freezing point is 1.5 °C and uncorrected freezing point is 2.5 °C.

Freezing point is defined as the temperature at which a liquid changes to solid when cooled.

Trial                              freezing point (°C)

Run 1                                     0.5

Run 2                                     4.0

Run 3                                     3.0

The average uncorrected freezing point is = ( 0.5 + 4.0 + 3.0 ) / 3

                                                                       = 7.5 / 3

                                                                       =  2.5 °C

corrected freezing points (°C)

                3.5

                0.0

                 1.0

The average corrected freezing point is = (3.5 + 0 + 1 ) / 3

                                                                  =  4.5 / 3

                                                                  =  1.5 °C

Thus, The average corrected freezing point is 1.5 °C and uncorrected freezing point is 2.5 °C.

To learn more about freezing point here

https://brainly.com/question/3121416

#SPJ1

The pH of the solution is 4.58.

pH which denotes "potential of hydrogen", is described as a scale used to specify the acidity or basicity of an aqueous solution.

In order to find the pH of the solution, we need to use the weak base-strong acid equation:

Kb = Kw / Ka = [CH3COO-][H+] / [CH3COOH]\

Ka = [H+][CH3COOH] / [CH3COO-]

[H+] = sqrt(Ka * [CH3COOH]) = √t(1.75x10^-5 * 0.15) = 1.36x10^-5 M

We then  find the concentration of acetate ions from the sodium acetate.

We have 2.05 g of sodium acetate, which is equivalent to 2.05 / (82.03 + (12 + 16 + 1) * 2) = 0.0163 moles.

[CH3COO-] = 0.0163 M

Kb = Kw / Ka = 1.36x10^-5 / 0.0163 = 8.36x10^-10

In conclusion,

pH = pKb + log([CH3COO-] / ([CH3COOH] + [CH3COO-]) = 4.58

Learn more about pH at: https://brainly.com/question/172153

#SPJ1

Given that :

Reaction equation ; \(HB_{r} + KOH ---> KBr + H_{2}O\)

A) and B)  Determine the Initial pH before addition of titrant

First step : compute the value of pOH

pOH = - log ( [OH⁻])

        = -log ( 0.320 ) = 0.50

∴ Initial pH before the titrant is added = 14 - pOH

                                                               = 14 - 0.5 = 13.5

C ) Determine the pH of solution after 5 mL titrant is added

First step : determine the reacting moles of each substance

n kOH = 0.025 mL * 0.320 mol/L = 0.00800 mol

n HBr = 0.005 * 0.750 mol/L = 0.00375 mol

next step : compute the value of the concentration of OH⁻ in final solution

n kOH ( remaining ) = 0.00800 - 0.00375 = 0.00425 mol

final solution = 25.00 mL + 5.00 mL = 30.00 mL

∴ The value of the concentration of [ OH⁻] in 30.00 mL

  = [ OH⁻] = ( 0.0042 mol / 0.0300 mL )

                = 0.142 M

 hence pOH = - log (0.142) = 0.849

Final step; The pH of the solution after 5 mL of titrant is added

= 14 - pOH

= 14 - 0.849 = 13.15

Hence we can conclude that the initial pH before titrant was added is 13.50 and the pH after is as listed above.

Learn more : https://brainly.com/question/23313870

The action that would most likely reduce water pollution is A) initiating efforts to remove trash from the ocean.

Trash and plastic waste in the ocean pose a significant threat to marine life and ecosystems. Initiating efforts to remove trash from the ocean can help mitigate this problem and reduce water pollution. When plastic waste accumulates in oceans, it can break down into microplastics, which are ingested by marine organisms and can enter the food chain, causing harm to both marine life and humans.

By actively removing trash from the ocean, we can prevent it from further degrading and releasing pollutants. This can help protect marine habitats, reduce the risk of entanglement or ingestion by marine animals, and preserve the overall health of ocean ecosystems.

On the other hand, options B, C, and D would likely contribute to increased water pollution:

B) Eliminating laws and regulations on industrial waste would remove important safeguards and oversight, potentially allowing industries to discharge pollutants directly into water bodies, leading to increased water pollution.

C) Promoting the use of oil and gas can lead to oil spills, leakage, and contamination of water sources. This can have severe consequences for aquatic ecosystems and human health.

D) Removing the ban on chlorofluorocarbons (CFCs) would result in the release of these harmful substances, which deplete the ozone layer and can contaminate water sources when disposed of improperly.

In conclusion, initiating efforts to remove trash from the ocean is the most effective action to reduce water pollution, while the other options would likely exacerbate the problem. Therefore, Option A is correct.

Know more about water pollution here:

https://brainly.com/question/20380251

#SPJ11

Answer:

Oxidation is the loss of electrons or an increase in the oxidation state of a chemical or atoms within it.

Iron is oxidized to form the iron oxide known as rust.

No of molecules=26.02×10²³molecules

No of moles

Molar mass

Mass

\(\\ \tt{:}\longrightarrow No\:of\:moles=\dfrac{Molecules}{Avagadro\:no}\)

\(\\ \tt{:}\longrightarrow No\:of\:moles=\dfrac{26.02\times 10^{23}}{6.023\times 10^{23}}\)

\(\\ \tt{:}\longrightarrow No\:of\:moles=4.32mol\)

We need the mass

\(\\ \tt{:}\longrightarrow No\:of\:moles\times molar\:mass\)

\(\\ \tt{:}\longrightarrow 32(4.32)\)

\(\\ \tt{:}\longrightarrow 138.24g\)

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The chemical formula for x and y is Cu₂O and CuO. The mass cooper which can react with 0.5g of oxygen to yield x and y is 2.745 g.

A chemical formula is a phrase that lists the constituent parts of a compound together with their relative quantities. No subscript is used if there is just one atom of a certain kind. A subscript is added to the symbol of an atom if it contains two or more of a certain type of atom.

1. 1.535 g of X → 1.365 g of Copper

1.535 – 1.365 = 0.170g of Oxygen

Atomic weight of Cu = 63.5,

Atomic weight of Oxygen = 16

For Cu 1.365 g / 63.5 = 0.02 mol

For Oxygen 0.170 g / 16 = 0.01 mol

X = Cu₂O

1.450 g of Y → 1.160 g of Cu

1.450 – 1.160 = 0.290 g of Oxygen

For Cu = 1.160 g / 63.5 = 0.018 mol

For Oxygen = 0.290 g / 16 = 0.018 mol

Y = CuO

2. The total mass of Oxygen = 0,170 g + 0,290 g

= 0.460 g

Total mass of Cu = 1.160 g + 1. 365 g

= 2.525 g

0.460 g of Oxygen → 2.525 g of Cu

0.500 g of Oxygen → (2.525 x 0.5) / 0.460

= 2.745 g of Cu

Thus, The law of multiple proportions was formulated by John Dalton in 1804.

To learn more about the chemical formula, follow the link;

https://brainly.com/question/29031056

#SPJ9

Answer:

To convert a measurement of 0.050 ug/dL to g/mL, we need to multiply it by a conversion factor that relates micrograms (ug) to grams (g) and deciliters (dL) to milliliters (mL).

1 ug = 0.000001 g (or 1 g = 1,000,000 ug)

1 dL = 100 mL

So, the missing part of the equation would be:

(0.050 ug/dL) • (0.000001 g/ug) • (1 dL/100 mL) = 0.0000000005 g/mL

Therefore, the answer is 0.0000000005 g/mL.

Explanation:

For every mole of potassium, there are 6.022 1023 potassium atoms. 6.0221023 K atoms make up one mole of KOH, which has one mole of K in it.

To learn more about atoms refer to:

https://brainly.com/question/29040732

#SPJ1

For every mole of potassium, there are 6.022 1023 potassium atoms. 6.0221023 K atoms make up one mole of KOH, which has one mole of K in it.

12 grammes of pure carbon-12 weigh exactly one mole, which is equal to 6.022 x 1023 atoms in that amount of carbon. • Avogadro's Number is the number of particles in a mole (6.0221421 x 1023).

A substance's volume is measured in moles, which are 6.022 x 1023 units (such as atoms, molecules, or ions). Avogadro's number or Avogadro's constant is the quantity 6.022 1023. You can convert between particle mass and number using the idea of a mole. Sal Khan invented it.

You may write this equation as follows: Number of Atoms or Molecules = (Number of Moles)*(6.022*1023) the link between a gramme and an atomic mass unit (amu).

To learn more about Avogadro's number visit:

https://brainly.com/question/1513182

#SPJ1

The correct answer is cation Ni +2 and anion S 2-.

Nickel sulfide

It is discovered that the bonding in NiS is remarkably similar to that in NiO, with a covalent component resulting from bonds between the Ni 3d and the S 3p atom and an ionic contribution resulting from the donation of the Ni 4s electron to the S atom.

With heated concentrated nitric acid or aqua regia, NiS can be easily reactively dissolved, which is followed by sulphur precipitation.

F belongs to Group 7A, while Ni is in Group 5A. (EN: N=3.0, F=4.0) The NF3 molecule and each N-F bond are both polar. F possesses a partial positive charge in the N-F bond. The NF3 molecule and each N-F bond are both non-polar.

To learn more about NiS refer the link:

https://brainly.com/question/7360069

#SPJ9

The volume of 12 gas forms when 21 L Cl2 react at STP is 21 L.

To determine the volume of 12 gas (I assume you mean I2 gas) formed when 21 L of Cl2 reacts at STP (standard temperature and pressure), we need to use the ideal gas law equation.

The ideal gas law equation is given by:

PV = nRT

Where:

P = pressure

V = volume

n = number of moles

R = ideal gas constant

T = temperature

At STP, the pressure is 1 atm, and the temperature is 273.15 K.

From the balanced equation, we can see that the molar ratio between Cl2 and I2 is 1:1. So, if 21 L of Cl2 reacts, it will produce an equal volume of I2 gas.

Given that the volume of Cl2 is 21 L, we can assume the volume of I2 gas formed will also be 21 L.

Therefore, the volume of I2 gas formed is 21 L.

For more such questions on volume

https://brainly.com/question/1749900

#SPJ8

Taking into account the definiton of molar mass and Avogadro's number, there are 8.4322×10²¹ molecules N₂O₄ molecules in a 1.25 g sample of dinitrogen tetroxide.

First of all, you should know that the molar mass of dinitrogen tetroxide, that is, the mass of one mole of the compound, is 92.011 \(\frac{g}{mole}\). Then the number of moles that 1.25 grams of the sample contain can be calculated by:

\(amount of moles=1.25 gx\frac{1 mole}{92.011 g}\)

Then:

amount of moles= 0.014 moles

On the other hand, Avogadro's Number is called the number of particles that make up a substance (usually atoms or molecules) and that can be found in the amount of one mole of said substance. Its value is 6.023×10²³ particles per mole and it applies to any substance.

Then you can apply the following rule of three: if you can define Avogadro's number, 1 mole of the compound contains 6.023×10²³ molecules, 0.014 moles contains how many molecules?

\(number of molecules=\frac{0.014 molesx6.023x10^{23} molecules}{1 mole}\)

number of molecules= 8.4322×10²¹

Finally, there are 8.4322×10²¹ molecules N₂O₄ molecules in a 1.25 g sample of dinitrogen tetroxide.

Learn more about Avogadro's Number:

We can see here that the catalytic cycle for the hydrogenation of alkenes using Wilkinson's catalyst involves several steps.

Here's an overview of the catalytic cycle, including the necessary details:

i. Chemical structure of the catalyst:

Wilkinson's catalyst, also known as chloridotris(triphenylphosphine)rhodium(I), has the following chemical structure: [RhCl(PPh3)3]

ii. Molecular geometry of the catalyst:

The Wilkinson's catalyst has a trigonal bipyramidal geometry around the rhodium center. The three triphenylphosphine (PPh3) ligands occupy equatorial positions, while the chloride (Cl) ligand occupies an axial position.

iii. Type of reactions involved:

The catalytic cycle involves several reactions, including:

iv. Starting material, reagent, and solvent:

The starting material is an alkene, and the reagent is Wilkinson's catalyst ([RhCl(PPh3)3]). The reaction is typically carried out in a suitable solvent, such as dichloromethane (CH2Cl2) or tetrahydrofuran (THF).

v. Major and minor end-products:

The major end-product of the hydrogenation reaction is the fully saturated alkane, resulting from the addition of hydrogen across the double bond. The minor end-product may include cis- or trans-configured alkanes if the original alkene substrate possesses geometric isomers.

vi. Intermediates:

The intermediates in the catalytic cycle include:

These intermediates play a crucial role in facilitating the hydrogenation reaction and enabling the catalytic cycle to proceed.

Learn more about Wilkinson’s catalyst on https://brainly.com/question/31972308

#SPJ1

Answer:

holaholaholaholaholaholaholahola

The volume occupied by the oxygen gas at a pressure of 210 kPa and a temperature of 50°C is 0.126 liters, rounded to three significant figures.

To calculate the volume occupied by the oxygen gas at a pressure of 210 kPa and a temperature of 50°C, we can use the ideal gas law equation:

PV = nRT

where:

P = pressure

V = volume

n = number of moles

R = ideal gas constant

T = temperature

First, we need to convert the given temperature from Celsius to Kelvin by adding 273.15:

T = 50°C + 273.15 = 323.15 K

Next, we rearrange the ideal gas law equation to solve for volume:

V = (nRT) / P

To find the number of moles (n), we can use the answer from question 27, which is the mass of oxygen gas:

m = 32 g

Using the molar mass of oxygen (O₂) which is approximately 32 g/mol, we can calculate the number of moles:

n = m / M = 32 g / 32 g/mol = 1 mol

Now we have all the values needed to calculate the volume:

V = (1 mol * 8.314 J/(mol*K) * 323.15 K) / 210,000 Pa

Using the ideal gas constant (R) of 8.314 J/(mol*K) and the pressure of 210 kPa (which is equivalent to 210,000 Pa), we can substitute these values into the equation and solve for volume.

V = 0.126 liters.

For more such questions on volume visit:

https://brainly.com/question/29796637

#SPJ8

Answer:

Atmospheric pressure, because a liquid is said to be boiling when the vapour pressure equals the atmospheric pressure.