The _____which are numbers that are found on the lower____hand side of each element symbol. This tells you the number of ____of this element in the molecule

Answer:

A chemical change occurs when one chemical substance is morphed into one or another different substances.

Explanation: For example, when iron becomes rust:

The chemical change occurs through the PROCESS of chemical reactions, and the resulting substances have different properties or strategies because their atoms and molecules are placed differently.

Answer:

Q = -897 kJ/mol

Explanation:

From the given information:

The heat released Q = -65.9 kJ

To start with the molar mass of \(H_2O_2\) = 2 × (molar mass of H) + 2 × (molar mass of O)

= (2 × 1.008) + (2 × 16.0 )

= 34.016 g/mol

However, given that:

mass of \(H_2O_2\)  2.50 g

The number of moles of \(H_2O_2\)  = \(\dfrac{mass}{molar \ mass}\)

\(= \dfrac{2.5}{34.016}\)

\(= 7.349 \times 10^{-2} \ mol\)

Finally; Using the formula:

\(\Delta H = \dfrac{Q}{number \ of \ moles}\\ \\ Q = \dfrac{-65.9 \ kJ}{7.349 \times 10^{-2} \ mol}\)

Q = -897 kJ/mol

The volume of \(N_2O_5\) needed to produce 9.64 L of \(NO_2\) is 4.97 L, calculated using stoichiometry and the ideal gas equation.

For more questions on stoichiometry

https://brainly.com/question/14935523

#SPJ8

Molecules with polar bonds or specific functional groups with asymmetric vibrations are most strongly affected by infrared photons. Molecules with nonpolar bonds or symmetric functional groups that lack infrared-active vibrations are least affected.

When a photon interacts with a molecule, the degree to which the molecule is affected depends on whether the photon's energy matches the energy required to excite the molecule's vibrational modes. Infrared (IR) photons have energies that correspond to molecular vibrations, and therefore, molecules with certain characteristics are most strongly affected by them. Molecules with polar bonds or functional groups containing asymmetric stretching or bending vibrations are most strongly affected by infrared photons. Examples include water (H2O), carbon dioxide (CO2), ammonia (NH3), and various organic compounds with functional groups like carbonyl (C=O) and hydroxyl (OH). Molecules with nonpolar bonds or symmetric functional groups that lack vibrational modes in the infrared region are least affected by infrared photons. These include diatomic molecules like oxygen (O2), nitrogen (N2), and noble gases such as helium (He). Hence Molecules with polar bonds or specific functional groups with asymmetric vibrations are most strongly affected by infrared photons. Molecules with nonpolar bonds or symmetric functional groups that lack infrared-active vibrations are least affected.

for more questions on Molecules
https://brainly.com/question/24191825
#SPJ8

The  [OH⁻] of the solution is 5.37×10⁵ M.

This is the negative logarithm to base 10 of hydroxy ion [OH⁻] concentration.

To calculate the hydroxy ion [OH⁻] concentration we use the formula below.

Note:

Formula:

Given:

Substitute the value into equation 1

Hence, The [OH⁻] of the solution is 5.37×10⁵ M.

Learn more about hydroxy ion concentration here: https://brainly.com/question/17090407

The concentration of the hydroxide ion [OH¯] in the solution is 5.89×10¯⁵ M

From the question given above, the following data were obtained:

pH + pOH = 14

9.77 + pOH = 14

Collect like terms

pOH = 14 – 9.77

pOH = 4.23

pOH = –Log [OH¯]

4.23 = –Log [OH¯]

Multiply through by –1

–4.23 = Log [OH¯]

Take the anti-log of –4.23

[OH¯] = anti-log (–4.23)

[OH¯] = 5.89×10¯⁵ M

Learn more about pH:

https://brainly.com/question/3709867

Answer:

5.6 m/s

Explanation:

Given,

First number = 13.254 m/s

Second number = 7.7 m/s

We need to find the difference between these two numbers. First we round off 13.254 to one decimal place i.e. 13.254 = 13.3 m/s

The difference between them is given by :

D = 13.3 - 7.7

= 5.6 m/s

Hence, the difference of the two numbers is 5.6 m/s.

Answer:

The law of  conservation of mass states that mass is  neither created nor destroyed by  chemical reactions the law of  conservation of mass was created in 1789  by a French chemist who discovered that  matter cannot be created or destroyed in  a chemical reaction according to the law  conservation of mass the mass of the  products in a chemical reaction must  equal the mass of the reactants.113 grams when you mix baking soda and  vinegar you get a chemical reaction and  gas is produced after the reaction the  mass of the products is still 113 grams  the same as the mass of the reactants  the mass of the array Acton's was not  created or destroyed it was merely  rearranged the balanced equation for  this reaction.

PLZ BRAINLIEST

Answer:

31.95 g

Explanation:

find the molar mass of Al(NO3)3

(Al = 27, N = 14, O = 16)

molar mass of Al(NO3)3 = 27+ (14+16×3)×3

= 213 gmol^-

mass = 213 ×0.15

= 31.95g

Answer:

i don't think you can, but if you do know let me know

Answer:

the total mass of product is equal to total mass of the reactance

0.13M NaClO

Explanation:

9.5 g NaClO × (1 mol NaClO/74.442 g NaClO)

= 0.13 mol NaClO

Molarity = 0.13 mol NaClO/1 L

= 0.13M NaClO

Answer:

B

Explanation:

Answer:

i want to help but  i   d   k. the answer :( sorry i couldnt help

Explanation:

Answer:

Dry friction. Dry friction resists relative lateral motion of two solid surfaces in contact. The two regimes of dry friction are 'static friction' ("stiction") between non-moving surfaces, and kinetic friction (sometimes called sliding friction or dynamic friction) between moving surfaces.

Answer: Km = 10μM

Explanation: Michaelis-Menten constant (Km) measures the affinity a enzyme has to its substrate, so it can be known how well an enzyme is suited to the substrate being used. To determine Km another value associated to an eznyme is important: Turnover number (Kcat), which is the number of time an enzyme site converts substrate into product per unit time.

Enzyme veolcity is calculated as:

\(V_{0} = \frac{E_{t}.K_{cat}.[substrate]}{K_{m}+[substrate]}\)

where Et is concentration of enzyme catalitic sites and has to have the same unit as velocity of enzyme, so Et = 20nM = 0.02μM;

To calculate Km:

\(V_{0}*K_{m} + V_{0}*[substrate] = E_{t}.K_{cat}.[substrate]\)

\(K_{m} = \frac{E_{t}.K_{cat}.[substrate]-V_{0}*[substrate]}{V_{0}}\)

\(K_{m} = \frac{0.02*600*40-9.6*40}{9.6}\)

Km = 10μM

The Michaelis-Menten for the substrate SAD is 10μM.

Answer:

Explanation:

To determine the mass of NaCl in 1.25L of 0.1035M solution, we can use the formula:

mass = concentration x volume x molar mass

where concentration is in molarity (M), volume is in liters (L), and molar mass is in grams per mole (g/mol).

The molar mass of NaCl is 58.44 g/mol.

Plugging in the given values, we get:

mass = (0.1035 M) x (1.25 L) x (58.44 g/mol)

mass = 7.3188 g

So, there is approximately 7.3188 grams of NaCl in 1.25L of 0.1035M solution.

Answer:

Probably stop taking the prescribed durg and contact your pharmacist and your doctor that gave you your prescription asap.

Explanation:

Both of those health professionals will assist the patient in understanding how to go about the next steps for side effect relief.

Sharing a custom report will share the report configuration and data included in the report: False.

In Go-ogle analytics, a custom report can be defined as a report which is created by an end user and it's based on the following:

Generally, sharing a custom report would not share the report configuration and data included in the report because only the configuration information are shared while user data remains private.

Read more on custom report here: https://brainly.com/question/4672600

#SPJ1

At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.

1: Write the balanced chemical equation:

\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)

2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.

Initial:

\(C_O\)(g) = 0.3500 mol

\(Cl_2\)(g) = 0.05500 mol

\(C_OCl_2\)(g) = 0 mol

Change:

\(C_O\)(g) = -x

\(Cl_2\)(g) = -x

\(C_OCl_2\)(g) = +x

Equilibrium:

\(C_O\)(g) = 0.3500 - x mol

\(Cl_2\)(g) = 0.05500 - x mol

\(C_OCl_2\)(g) = x mol

3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:

Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]

4: Substitute the given equilibrium constant (Kc) value into the expression:

1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)

5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:

1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x

6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.

7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.

8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):

\(Cl_2\)(g) = 0.05500 - x

9: Calculate the value of \(Cl_2\)(g) at equilibrium:

\(Cl_2\)(g) = 0.05500 - x

\(Cl_2\)(g) = 0.05500 - (positive value of x)

10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.

Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.

For more such questions on equilibrium, click on:

https://brainly.com/question/517289

#SPJ8

Sodium carbonate, also known as washing soda or soda ash, has a wide range of applications. Sodium carbonate can be naturally occurring or synthetically produced through various methods, including the Solvay process, which is the most common method of industrial production.

Sodium carbonate, also known as washing soda or soda ash, has many uses, including:

1) Cleaning agent: Sodium carbonate is an effective cleaning agent due to its alkaline nature. It is used in laundry detergents and household cleaners to remove stains and grease from clothes and surfaces.

2) Industrial applications: Sodium carbonate is used in a variety of industrial applications. It is used in the production of glass, pulp and paper, and soaps and detergents. It is also used as a water softener and pH regulator in chemical processes.

Learn more about Sodium Carbonate at

brainly.com/question/31344166

#SPJ1

When dissolved in water, most Group 1 metal salts can be described as strong electrolytes.

When Group 1 metal salts are dissolved in water, they can be described as strong electrolytes. This is because Group 1 metals, such as lithium (Li), sodium (Na), potassium (K), and so on, readily lose their outermost valence electron to form positive ions (cations). These cations then dissociate completely in water, separating from the anions to which they were originally bonded.

The dissociation of Group 1 metal salts in water results in the formation of positively charged metal ions and negatively charged non-metal ions (anions). These ions are free to move and conduct electric current, making the solution a good conductor of electricity. The complete dissociation of Group 1 metal salts in water and the presence of freely moving ions make them strong electrolytes.

Strong electrolytes are substances that ionize completely or almost completely in solution, producing a high concentration of ions. This is in contrast to weak electrolytes, which only partially ionize and produce a lower concentration of ions.

In summary, when Group 1 metal salts are dissolved in water, they form strong electrolytes due to their ability to dissociate completely into ions, leading to a high concentration of freely moving ions in the solution, thus enabling efficient electrical conductivity.

Know more about Group 1 metal salts here:

https://brainly.com/question/13277375

#SPJ8

Answer:

After performing a TLC experiment, you might place the TLC plate in a container with iodine crystals.

We have that the  the density of FeS  is mathematically given as

From the question we are told

Iron(II) sulfide has a primitive cubic unit cell with sulfide ions at the lattice points.

The ionic radii of iron(II) ions and sulfide ions are 88 pm and 184 pm, respectively.

What is the density of FeS (in g/cm3)?

Generally the equation for the Velocity  is mathematically given as

\(V_c=a^3=(2\pi Fe^{2+}+2\pi S^{2-})^3\\\\Therefore\\\\V=a^3(2\pi*0.088+2\pi 0.184)^3\\\\V=16.98*10^{-23}\\\\Therefore\\\\\phi=n\frac{PFeion+PSion}{VNa}\\\\\phi=3*\frac{55.85+32}{16.9*10^{-23}*6.023*10^{23}}\)

For more information on ionic radii visit

https://brainly.com/question/13981855

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

From the information provided, it seems likely that substance A is an acid, and substance B is a carbonate. The fact that mixing the two substances results in bubbles or effervescence, and that a clear solution is formed, suggests that a chemical reaction is taking place.

Acids and carbonates react together to form a salt, water, and carbon dioxide gas. The reaction is as follow:

Acid + Carbonate → Salt + Water + Carbon Dioxide

The carbon dioxide gas forms bubbles in the solution and causes effervescence, and the clear solution formed is due to the fact that both the acid and the carbonate have reacted together to form the salt and water. This reaction is acid-base neutralization reaction as the acid and base will neutralize each other.

As for the acid, since it is said that B gives pH 3 solution after dissolved, it can be inferred that it is not an acid, otherwise it would be acidic. Therefore A which is insoluble is the acid.

As for the gas given off, it's Carbon dioxide.

Explanation:

Answer:

A straight-chain alkane that has five carbon atoms, also known as pentane, differs from a cycloalkane that has five carbon atoms, also known as cyclopentane, in terms of their molecular structure and properties. Pentane has a linear, straight-chain structure, while cyclopentane has a ring-shaped structure. This difference in structure affects their physical and chemical properties. For example, pentane has a higher boiling point and lower melting point than cyclopentane due to the differences in the strength of the intermolecular forces between their molecules

Explanation:

Molar mass of Acetone

Now

Moles of Acetone:-

Amount of heat:-