Answer:
Explanation:
Charles Law
V1/T1 = V2/T2
T2= T1V2/V1 = 384.15 X 3/2=576.23K or 303.08 Celsius
what happens to a 8 L volume of gas as you move from a pressure of 3 atm to 4 atm?
Answer:
the volume reduces to 6 L
Explanation:
Boyle's law states that the volume of a gas is inversely proportional to the pressure, as long as temperature and other physical conditions are kept constant. This means that, as pressure increases, volum decreases and vice versa.
the formula is: (in blue pen in attached image)
P1 = 3 atm
P2 = 4 atm
V1 = 8 L
V2 = x
making V2 subject of the formula (in red pen in attached image),
V2 = 3*8/4
= 6L
have a great day!!!
If 0.652 M of KF has a volume of 723.4 mL. What mass of KF is in the solution.
Answer:
To determine the mass of KF in the solution, we can use the formula:
mass = molarity x volume x molar mass
First, we need to calculate the molar mass of KF:
KF = K + F
= 39.10 g/mol + 18.99 g/mol
= 58.09 g/mol
Now, we can plug in the values:
mass = 0.652 mol/L x 723.4 mL x 0.05809 g/mol
= 26.76 g
Therefore, there are 26.76 g of KF in the solution.
2 examples of metal’s catalytic reaction
Answer:
Example 1
palladium(II) nitrate,
Example 2
Metal catalysts such as Fe, Ni, Mo, and Co are routinely used in the manufacture of CNMs.
Explanation
The three metals used in catalytic converters — rhodium, platinum and palladium — are part of a category known as platinum group metals, or PGMs, which are known for their catalytic properties.
What limitations occurs for chalk in vinegar chemistry pd lab experiment?
Also the precautions to take
Need this asap!!
Answer:
When conducting a chemistry lab experiment using chalk (calcium carbonate) in vinegar (acetic acid), there are several limitations and precautions to be aware of:
Limitations of chalk in vinegar chemistry experiment:
Reaction rate: The reaction between chalk and vinegar is relatively slow, which may require a longer observation period or higher concentration of vinegar to observe significant changes within a reasonable time frame.
Solubility: Chalk may not dissolve completely in vinegar, resulting in incomplete reaction or difficulty in obtaining accurate results.
Product formation: The reaction between chalk and vinegar produces carbon dioxide gas, water, and calcium acetate. The carbon dioxide gas may escape into the atmosphere, leading to loss of product and inaccurate measurements.
pH: Chalk is a basic substance, and the reaction with vinegar, which is acidic, may result in neutralization, leading to a decrease in the overall acidity of the reaction mixture.
Precautions to take in chalk in vinegar chemistry experiment:
Ventilation: The reaction between chalk and vinegar produces carbon dioxide gas, which can displace air and potentially cause asphyxiation in a closed or poorly ventilated area. Conduct the experiment in a well-ventilated area or under a fume hood to ensure adequate air circulation.
Eye and skin protection: Vinegar is an acid and can cause skin and eye irritation. Wear appropriate personal protective equipment (PPE), such as gloves and goggles, to protect yourself from contact with vinegar or any other chemicals used in the experiment.
Chemical handling: Handle the chemicals, including chalk and vinegar, with care, following proper lab safety protocols. Avoid ingestion, inhalation, or direct contact with the chemicals, and dispose of them properly according to local regulations.
Accuracy in measurements: Use calibrated and accurate measuring tools, such as graduated cylinders or burettes, to measure the amount of chalk, vinegar, and other reagents accurately. This will ensure the reliability and accuracy of the experimental results.
Observations: Make careful and detailed observations during the experiment, noting any changes in appearance, gas evolution, or other relevant observations. Take measurements at appropriate intervals and record the data accurately for analysis and interpretation.
It is important to follow good laboratory practices, including proper chemical handling, accurate measurements, and cautious observations, to ensure safe and reliable results in a chalk in vinegar chemistry lab experiment. Consult with a qualified instructor or supervisor for specific guidelines and precautions related to your experiment.
when burning magnesium is lowered in a gas jar full of carbon 4 oxide it continued to burn explain
When burning magnesium is lowered in a gas jar full of carbon dioxide, the burning process continues because the carbon dioxide acts as an oxidizing agent.
What is a combustion reaction?A combustion reaction is a type of chemical reaction that occurs when a fuel, such as a hydrocarbon, reacts with an oxidizing agent, such as oxygen, to produce heat and light in the form of a flame. The basic equation for a combustion reaction is:
Fuel + Oxidant → Heat + Light + Products
In the case of burning magnesium, the fuel is magnesium and the oxidant is carbon dioxide. The products of the reaction are magnesium oxide and carbon dioxide. Combustion reactions are exothermic, meaning they release energy in the form of heat.
This means that the carbon dioxide provides the oxygen necessary for the combustion reaction to continue, allowing the magnesium to continue burning. Additionally, the carbon dioxide also helps to extinguish the flame by removing the heat and the oxygen from the combustion zone.
To know more about energy, visit:
https://brainly.com/question/1932868
#SPJ1
A sample is found to contain 1.29×10-11 g of salt. Express this quantity in picograms
Answer:12.9e-12g or in short 12.9pg
Explanation:as p=1e-12
Ethane (CH3CH3) has a melting point of −183 °C and a boiling point of −89 °C. Predict the melting and boiling points for methylamine (CH3NH2).
This is challenging to provide an exact prediction for the melting and boiling points. Experimental factors, impurities, and other variables can influence these values.
To predict the melting and boiling points for methylamine (CH3NH2), we can consider the differences in molecular structure and intermolecular forces compared to ethane. Methylamine has a nitrogen atom in place of one carbon atom in ethane.
Methylamine exhibits hydrogen bonding due to the presence of the nitrogen atom, which can form hydrogen bonds with other methylamine molecules. Ethane, on the other hand, lacks a hydrogen atom bonded to an electronegative atom, so it does not participate in hydrogen bonding.
Hydrogen bonding is stronger than the London dispersion forces present in ethane. Consequently, methylamine is expected to have stronger intermolecular forces and thus higher melting and boiling points compared to ethane.
Considering this, we can predict that the melting point of methylamine will be higher than -183 °C, the melting point of ethane. Similarly, the boiling point of methylamine will be higher than -89 °C, the boiling point of ethane.
However, without specific experimental data or a detailed analysis of methylamine's properties.
For more such questions on melting
https://brainly.com/question/25074953
#SPJ8
Kindly help me with the number 2 answer
The number of moles of nitrogen, N in 65 moles of Pb(NO₃)₄ is 260 moles
How do I determine the number of mole of N?We'll begin by obtaining the number of mole of N in one mole of Pb(NO₃)₄. Details below:
From the formula of Pb(NO₃)₄, we can see that there are 4 moles of N in 1 mole of Pb(NO₃)₄
With the above information, we can determine the number of mole of N in 65 moles of Pb(NO₃)₄. This is illustrated below:
1 mole of Pb(NO₃)₄ contains 4 moles of N
Therefore,
65 mole of Pb(NO₃)₄ will contain = (65 moles × 4 moles) / 1 mole = 260 moles of N
Thus, we can conclude from the above calculation that the number of mole of N is 260 moles
Learn more about mole:
https://brainly.com/question/13314627
#SPJ1
Where does gravity from planet Earth actually pull you toward?
What is the pH of a solution with [H⁺] = 2.5 x 10-4 M?
Answer:
\(\text{pH}=3.6\)
Explanation:
Given that,
\([H^+]=2.5\times 10^{-4}\ M\)
We need to find the pH of a solution with \([H^+]=2.5\times 10^{-4}\ M\).
We know that,
\(\text{pH}=-\text{log}[H^+]\\\\=-\text{log}[2.5\times 10^{-4}]\\\\=-(-3.6)\\\\=3.6\)
So, the pH of the solution is 3.6.
Vicki is moving a box with 5 newtons of force. Her friend jen comes to help and pushes another 5 newtons of force? What is the total force of their pushing
Answer:
10 n
Explanation:
Which of the following items are made from renewable resources? Select the two correct answers. (1 point)
Responses
plastic fork
plastic fork
metal can
metal can
leather jacket
leather jacket
electronics
electronics
printer paper
A leather jacket and printer paper are examples of items that can be made from renewable resources, while plastic forks, metal cans, and electronics are not considered renewable due to their reliance on non-renewable materials and processes. Option C, E
The two correct answers that are made from renewable resources are:
C) Leather jacket: Leather is derived from animal hides, which are a byproduct of the meat industry. As long as there is a sustainable and responsible approach to animal farming, the production of leather can be considered renewable. The hides are obtained from animals that are raised for meat consumption, and their use in leather production helps reduce waste.
E) Printer paper: Printer paper can be made from various sources, including trees, bamboo, and recycled paper fibers. If the paper is sourced from sustainably managed forests or from fast-growing plants like bamboo, it can be considered renewable. Additionally, the use of recycled paper fibers reduces the demand for materials and promotes a more circular economy.
The other options, A) plastic fork, B) metal can, and D) electronics, are not made from renewable resources:
A) Plastic fork: Plastics are typically derived from fossil fuels, which are non-renewable resources. The production of plastic involves the extraction and processing of petroleum or natural gas, both of which are finite resources.
B) Metal can: Metal cans are predominantly made from aluminum or steel. While these metals can be recycled, their initial production requires the extraction of raw materials from the Earth, which is not a renewable process.
D) Electronics: Electronics are made from a wide range of materials, including metals, plastics, and various chemical compounds. The production of electronics involves the extraction of raw materials, many of which are non-renewable resources.
Option C and E.
For more such questions on renewable resources visit:
https://brainly.com/question/27734408
#SPJ8
list three statements for transverse waves
A chemical equation is balanced when the number of each
type of ____ is the same on both sides of the equation.
Answer:
element
Explanation:
Solving for a reactant using a chemical equation
Ammonia (NH3) chemically reacts with oxygen gas (O₂) to produce nitric oxide (NO) and water (H₂O).
What mass of ammonia is consumed by the reaction of 8.56 g of oxygen gas?
Round your answer to 3 significant digits.
The mass of ammonia that reacts with 8.65 gm of oxygen gas is 3.649 gm.
About 80% of industrial ammonia is used as fertilizer in agriculture. It is also used as refrigerant gas, water purification, and in the production of plastic, explosives, textile, pesticide, dyes, and chemical products.
The balanced chemical equation for ammonia can be written as:
4NH₃ + 5O₂→ 4NO + 6H₂O
This equation is a redox reaction in which the charge of the nitrogen in ammonia goes from -3 to +2 and the charge of the oxygen goes from -0 to -2.
4 moles of ammonia consume 5 moles of O₂.
1 mol of Oxygen = 32gm
So to calculate the mass of ammonia consumed by the reaction of 8.56 g of oxygen gas
8.56 × 1/32 × 4/5 × 17.039/1 = 3.649 gm NH₄.
To learn more about the ammonia, refer to the link:
https://brainly.com/question/29519032
#SPJ6
What is scientific knowledge made of?
Based on the Law of Conservation of Mass,
what mass of products form when baking
soda decomposes?
NaHCO3 → Na₂CO3 + H₂O + CO₂
25.00 g
Give your answer to the correct number of
significant figures.
(g) Sodium Chloride
?g
Enter
Based on the Law of Conservation of Mass, the mass of products form when baking soda decomposes is 168 g/mole.
What is law of conservation of mass?Law of conservation of mass is defined as chemical reactions and physical changes cannot build or remove mass in an isolated system. The mass of the reactants and products in a chemical reaction must equal each other according to the law of conservation of mass.
\(\rm 2NaHCO_3 \rightarrow Na_2CO_3 + H_2O + CO_2\)
Mass of baking soda = 2 x molar mass
Molar mass of NaHCO₃ = 84.007 g/mole
Mass of baking soda = 2 x 84.007 g/mole
Mass of baking soda = 168.014 g/mole ≅ 168 g/mole
Thus, based on the Law of Conservation of Mass, the mass of products form when baking soda decomposes is 168 g/mole.
To learn more about Law of Conservation of Mass, refer to the link below:
https://brainly.com/question/28711001
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Can someone help me ? I choice the element Xenon Xe
Answer:
Xenon is element 54. in a perfect atom it would have 54 neutrons
Answer:
refer to explanation in order V
Explanation:
Atomic number: 54
Protons: 54
Electrons: 54
Neutrons: 77
Mass Number: 131.293 U
6 (1/2): At the upper left is the atomic number, or number of protons. In the middle is the letter symbol for the element (e.g., H). Below is the relative atomic mass, as calculated for the isotopes found naturally on Earth. At the very bottom is the name of the element (e.g., hydrogen).
6 (2/2): On the periodic table, the mass number is usually located below the element symbol.
I hope this helped!
There are 11 runners in a race. Medals are awarded for 1st, 2nd, and 3rd place. In how many different ways can the medals be awarded? 330 990 110 165
Answer:
990
Explanation:
If a chemist starts with 4 moles of H2 and 4 moles of O2, what is the limiting reactant? How do you know?
Explanation:
The balanced equation is
2 H2 + 02 ======> 2 H2 O
so it takes twice as many H2 moles as O2 to complete the reaction
the chemist does not have enough H2 (needs 8 moles) , so H2 is the limiting reactant .
How many grams of the electrolyte Al2(SO4)3 (molar mass=142 g/mole) are required to make 325 mL of solution having an osmotic pressure of 675 mm Hg at 25 oC?
Answer: 0.36g
Explanation:
π = iMRT
π = (inRT)/V
π = (imRT)/(MrV)
When we make m the subject of the formula we have;
m = (πMrV)/(iRT)
m=(0.8882atm x 142g/mol x 325x10-3L)/(5 x 0.08206LatmK-1mol-1 x 298.15K)
m = 0.335078176662g = 0.36g
The strength of an acid is affected by the polarity of the bond connected to the acidic hydrogen. The more highly polarized this bond, the more easily the hydrogen is ionized. Electronegative atoms or groups of atoms present in the structure of an acid can act to withdraw electrons and produce additional polarization. Two common groups of acids to which this principle can be applied are oxoacids and carboxylic acids. In the latter group, the length of the hydrocarbon chain in a carboxylic acid has very little effect on acid strength Longer chains may slightly diminish acidity. Bases act as hydrogen ion acceptors because of the unshared electron pass in their structure. Any group present in a base that withdraws electrons makes these electron pairs less available to accept a hydrogen ion. In contrast, any group that can act as an electron donating group such as hydrocarbon groups (usually represented as II) can increase the base strength. Thus, the addition of electronegative atoms or groups of atoms to the structure of a base decreases the base strength and electron donating groups increase base strength. Many common weak bases are derivatives of ammonia, in which H atom(s) of NH_2 are replaced with other groups.
Arrange the following oxoacids in order of decreasing acid strength. Rank from strongest to weakest acid.
HBrO
HClO
HClO3
HClO2
Answer:
HClO3>HClO2>HClO>HBrO
Explanation:
Hello there!
In this case, in agreement to the given information and the reported acidic dissociation constant (Ka) for these acids, which are shown below:
\(Ka_{HBrO}=2x10^{-9}\\\\Ka_{HClO}=3.5x10^{-8}\\\\Ka_{HClO_2}=1.2x10^{-2}\\\\Ka_{HClO_3}>>>>1\)
In such a way, since the Ka of chloric acid, HClO3 is greater than 1, we infer it is a strong acid so it is the strongest, next we have HClO2, then HClO and the weakest would be HBrO as its Ka is the smallest.
Thus, the order would be:
HClO3>HClO2>HClO>HBrO
Best regards!
What is the osmotic pressure of a 0.850M solution of glucose at 245K?
Use R=0.08206 (L atm/mol K) for the gas constant.
Report your answer using three significant figures.
The osmotic pressure of the system is 17.1 atm.
What is the osmotic pressure?Osmotic pressure is the pressure that must be applied to a solution in order to prevent the flow of solvent from a region of higher concentration to a region of lower concentration across a semi-permeable membrane. A semi-permeable membrane allows only solvent molecules to pass through, while preventing the passage of solute molecules.
π=i c R T
π= osmotic pressure
i = Van't Hoff factor
c = concentration
R = gas constant
T = temperature
π= 1 * 0.85 * 0.08206 * 245
= 17.1 atm
Learn more about osmotic pressure:https://brainly.com/question/12497098
#SPJ1
What practices from the article can members of the public or governmental agencies adopt as they look to improve water quality? Back up your answer with evidence from the article above.
The evidence from the article highlights these practices as effective means of improving water quality. By implementing these measures, both individuals and governmental agencies can contribute to the preservation and protection of water resources.
According to the article, there are several practices that members of the public and governmental agencies can adopt to improve water quality:
Implementing proper wastewater management: This involves treating wastewater before it is released back into the environment. The article emphasizes the importance of implementing advanced treatment technologies to remove pollutants effectively.Promoting sustainable agriculture: The article highlights the significance of adopting practices that minimize the use of fertilizers and pesticides, such as precision agriculture techniques. These practices can reduce the runoff of agricultural chemicals into water bodies.Establishing buffer zones: Creating vegetated buffer zones along rivers, lakes, and streams can help filter and absorb pollutants, preventing them from entering the water bodies. The article suggests that buffer zones should be implemented to reduce sediment, nutrient, and pesticide runoff from adjacent fields.Encouraging responsible industrial practices: The article emphasizes the need for industries to adopt eco-friendly practices, including proper disposal of industrial waste and the use of environmentally friendly production techniques.
Raising awareness and education: Public education campaigns can play a crucial role in improving water quality. The article suggests that educating the public about the impact of their actions on water bodies and providing information on sustainable practices can lead to positive changes.
for such more questions on practices
https://brainly.com/question/30310637
#SPJ8
9.42 g of lead (ii) nitrate was reacted with 0.655 mol/L potassium iodide to produce 2.64 g of precipitate. What volume of potassium iodide was used in this reaction?
The volume of potassium iodide used will be 0.087 L or 87 mL
Stoichiometric calculationThe equation of the reaction goes thus: \(Pb(NO_3)_2(aq) + 2KI --- > PbI_2(s) + 2KNO_3(aq)\)
The mole ratio of the 2 reactants is 1:2.
Mole of 9.42 g \(Pb(NO_3)_2\) = 9.42/331.2 = 0.02844 mol
Equivalent mole of KI = 0.02844 x 2 = 0.05688 mol
Volume of 0.05688 mol, 0.655 mol/L KI = 0.05688/0.655 = 0.087 L or 87 mL
More on stoichiometric problems can be found here: https://brainly.com/question/15047541
#SPJ1
consider a test tube containing benzoic acid to which was added 1.0 m naoh. write the balanced chemical equation representing this reaction. (2 points)
The following balanced chemical equation describes how benzoic acid and 1.0 M NaOH react:
NaOH + C₆H₅COOH → C₆H₅COONa and H₂O.
In this reaction, sodium hydroxide (NaOH) and benzoic acid (C₆H₅COOH) combine to form sodium benzoate ( C₆H₅COONa) and water (H₂O). Exothermic in nature, the reaction causes the emission of heat as it happens. The balanced equation guarantees that each element has an equal amount of atoms on both sides of the equation. One instance of a neutralization reaction, in which an acid and a base combine to create salt and water, is the reaction between benzoic acid and sodium hydroxide.
To Learn More About reaction click
https://brainly.com/question/28984750
#SPJ4
The air pressure inside a balloon is 0.78 atm. What is this
pressure in mmHg?
mmHg
Your answer should be rounded to 2 significant figures. Do not include units in
Answer:
The pressure in mmHg is 59.
Explanation:
Given data:
Pressure of air inside balloon = 0.78 atm
Pressure in mmHg = ?
Solution:
mmHg:
mmHg is referred as manometric unit of pressure. It is define as the pressure exerted by mercury column at height of one millimeter.
Symbol:
"mmHg"
Atmosphere (atm)
atm is unit of pressure. It is used as a standard unit. It is equal to the 101325 Pa.
1 atm = 760 mmHg
Inorder to convert the atm into mmHg we will multiply the given atm value with 760.
0.78 atm × 760 mmHg / 1 atm = 592.8 mmHg
59 mmHg or 59
Give the theoretical yield, in moles, of CO2 from the reaction of 1.45 moles of C8H18 with 1.45 moles of O2.
2 C8H18 + 25 O2 → 16 CO2 + 18 H2O
Answer:
vuvbuvivovoivuighhghgig
6) The density of ammonia gas (NHs) in a 6.0 L container at a pressure of 820 mm Hg and a g/L.
The density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.
To determine the density of ammonia gas (NH3) in a 6.0 L container at a pressure of 820 mm Hg, we need to use the ideal gas law equation, which relates pressure, volume, number of moles, and temperature for a given gas.
The ideal gas law equation is:
PV = nRT
Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.
Since we are given the pressure (820 mm Hg), volume (6.0 L), and assuming standard temperature and pressure (STP), we can use the values for R (0.0821 L·atm/(mol·K)) and convert the pressure to atm by dividing by 760 (1 atm = 760 mm Hg).
820 mm Hg / 760 mm Hg/atm = 1.08 atm
Now we can rearrange the ideal gas law equation to solve for density (d):
d = (P * M) / (RT)
Where M is the molar mass of ammonia (NH3), which is approximately 17.03 g/mol.
Substituting the values, we have:
d = (1.08 atm * 17.03 g/mol) / (0.0821 L·atm/(mol·K) * 298 K)
Simplifying the equation, we find:
d ≈ 0.805 g/L
Therefore, the density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.
For more question on density
https://brainly.com/question/26364788
#SPJ8