The prism is completely filled with 1750 cubes that have edge length of 1/5 ft.
What is the volume of the prism?
Enter your answer in the box.

_____ ft

Answers

Answer 1

The vοlume οf the prism is 14 cubic feet.

What is a rectangular prism?

A three-dimensiοnal structure having six rectangular faces is called a prism. It is alsο knοwn as a rectangular cubοid οr a rectangular parallelepiped.

The prism is cοmpletely filled with 1750 cubes that have an edge length οf 1/5 ft. This means that the vοlume οf each cube is \((1/5)^3 = 1/125\) cubic feet.

Tο find the vοlume οf the prism, we can divide the tοtal vοlume οf the cubes by the number οf cubes:

Vοlume οf prism = (Vοlume οf οne cube) x (Number οf cubes)

Vοlume οf prism = (1/125) x 1750

Vοlume οf prism = 14 cubic feet

Therefοre, the vοlume οf the prism is 14 cubic feet.

To know more about rectangular prism visit:

brainly.com/question/21308574

#SPJ1


Related Questions

the highest temperature ever recorded for today's date in a certain town was 15 Celsius

Answers

To find out the difference, subtract the minimum value from the maximum value

so

15-(-23)=15+23=38 degrees

answer is 38 degrees

expression is 15-(-23)

The answer to
√19
lies between two consecutive integers.
Use your knowledge of square numbers to state which
two integers it lies between.
√19 is between
and

Answers

The most appropriate choice for square root will be\(\sqrt{19}\) lies between 4 and 5

What is square root of a number?

A number's square root is a value that, when multiplied by itself, yields the original number. The opposite way to square a number is to find its square root. Squares and square roots are therefore related ideas. Assuming that x is the square root of y, the equation would be written as x=y or as x2 = y. The radical symbol for the number's root is "" in this instance. When multiplied by itself, the positive number represents the square of the original number. The original number is obtained by taking the square root of a square of a real integer. For instance, the square of 3 is 9, the square root of 9 is 9, and 9 squared equals 3. Finding the square root of 9 is simple because it is a perfect square.

\(\sqrt{p} = p^{\frac{1}{2}}\)

\(\sqrt{19} = 4.36\\\)

4.36 lies between 4 and 5

\(\sqrt{19}\) lies between 4 and 5

To learn more about square root of a number, refer to the link-
https://brainly.com/question/3617398
#SPJ13

Levi spends all of his free time surfing. Today he was out on the waves for 7.1 hours. That is 0% more time than yesterday. How many hours did he spend surfing yesterday?

Round your answer to the nearest tenth.

HELPPPP IVE BEEN STUCK ON THIS FOREVER!!

Answers

Is it not 7.1 hours since the difference is 0%?

plz solve it

If x= 3/4 and y = 7/8 , check that x +y = y + x.

Answers

13/8=13/8
add
3/4+7/8 =7/8+3/4
with substitution you get
13/8=13/8
Add 3/4 and 7/8, then add the totals. If you have to simplify.

Help plz dis is a lil importatnete

Help plz dis is a lil importatnete

Answers

Following order of operations:

3^2 = 9

(10-2) = 8

Now you have :

9 + 8 x 5 -4

Multiplication is next:

9 + 40 -4

Now just add and subtract from left to right:

9 + 40 = 49

49-4 = 45

The answer is 45

Step-by-step explanation:

So first you solve whats inside of the parenthesis 10 -2 aand get 8 then you figure 3^2 which is 9 then multiplie 8 times 5 and get 40. 9 + 40 - 4 is what it is so far then add 9 to 40 which is 49 then subtract 4 and get 45!

The midpoint between x and 27 is -3. Find x.

Answers

Answer:

-33

Step-by-step explanation:

27-(-3)=30

-3-30=-33

Solve for b

10, b, 150degrees, 12degrees

Solve for b10, b, 150degrees, 12degrees

Answers

Hello!

We have all angles of the triangle:

We will use the law of cosines. This relation is valid for all sides of any t

We have:

angle A = 12°

côté a = 10

angle B = 150°

This is therefore the first case of application of the sine law.

So:

\(\sf \dfrac{b}{sin~B} = \dfrac{a}{sin~A}\)

\(\sf b =\dfrac{sin~B~*~a}{sin~A} = \dfrac{sin~150~*~10cm}{sin~12} = \dfrac{arcsin~0.5~*~10cm}{arcsin~0.2079116908} = \dfrac{30~*~10cm}{12} = \dfrac{300cm}{12} = \boxed{\sf25cm}\)

b = 25cm
Solve for b10, b, 150degrees, 12degrees

A shipping container is in the shape of a right rectangular prism with a length of 8.5 feet, a width of 2 feet, and a height of 3-5 feet. The container is completely filled with contents that weigh, on average, 0.34 pound per cubic foot. What is the weight of the contents in the container, to the nearest pound?

Answers

Answer:

3

Step-by-step explanation:

V = 12 ⋅ 8.5 ⋅ 4 = 408

W = 408 ⋅ 0.25 = 102

evaluate 2 - (-4) + 3 + (-6) - (-2)

Answers

Answer:

5

Step-by-step explanation:

2 + 4 +3 - 6 +2

5

plz mark me brainliest

If 10,000 catfish can be accommodated by a pond with an area of 30 square meters, how large a pond is needed if the number of catfish is 20,000?

Answers

Answer:

60

Step-by-step explanation:

10,000 * 2 = 20,000, so multiply 30 by 2:

30 * 2 = 60

Answer:

A 60 square meter pond is needed to accommodate 20,000 catfish.

Step-by-step explanation:

We know that 30 square meters is needed per 10,000 catfish.

How large a pond is needed for 20,000 catfish?

We can create an equation like this

\(\frac{30}{10000} =\frac{x}{20000}\)

let \(x\) represent the number of square meters needed for 20,000 catfish

Lets solve for \(x\).

Cross multiply.

\(30*20000=x*10000\)

Evaluate \(30*20000\)

\(600000=10000x\)

Divide both sides by \(10000\).

\(60=x\)

Can someone help me please

A population of bacteria is growing according to the equation p(t)=1950e^0.16t Estimate when the population will exceed 6371.

t= -------------

Answers

The estimate for when the population will exceed 6371 is t > 20.33. This means that at a time greater than 20.33 units

How to deal with exponential function?

To estimate when the population will exceed 6371, we can set up the inequality:

p(t) > 6371

where p(t) is the population at time t, as given by the equation \(p(t) = 1950e^{0.16t}\)

Substituting the expression for p(t) into the inequality, we get:

\(1950e^{0.16t} > 6371\)

Next, we can divide both sides of the inequality by 1950 to isolate the exponential term:

\(e^{0.16t} > 6371 / 1950\)

To solve for t, we can take the natural logarithm (ln) of both sides, which will eliminate the exponential term:

\(ln(e^{0.16t} > ln(6371 / 1950)\)

Using the property of logarithms that ln(e^x) = x, we get:

\(0.16t > ln(6371 / 1950)\)

Now, we can divide both sides of the inequality by 0.16 to solve for t:

\(0.16t / 0.16 > ln(6371 / 1950) / 0.16\)

Simplifying, we get:

\(t > ln(6371 / 1950) / 0.16\)

Using a calculator, we can find the approximate value of \(ln(6371 / 1950) / 0.16\), which is approximately 20.33 (rounded to two decimal places).

So, the estimate for when the population will exceed 6371 is t > 20.33. This means that at a time greater than 20.33 units

To know more about Exponential function visit:

brainly.com/question/14355665

#SPJ1

One brand of cola co fizz is sold in packs of 4*500ml for 2.50 another brand colo is sold in packs of 10 330mlfo $2 which brand is more expensive

Answers

Based on the given information, the second brand, Cola, is the more affordable option in terms of cost per milliliter compared to Co Fizz.

To determine which brand of cola is more expensive, we need to compare the cost per unit volume for each brand.

For the first brand, Co Fizz, a pack contains 4 bottles, and each bottle has a volume of 500 ml. The cost of the pack is $2.50. Therefore, the total volume in a pack is 4 * 500 ml = 2000 ml. To find the cost per milliliter (ml), we divide the total cost by the total volume: $2.50 / 2000 ml = $0.00125 per ml.

For the second brand, Cola, a pack contains 10 bottles, and each bottle has a volume of 330 ml. The cost of the pack is $2. Therefore, the total volume in a pack is 10 * 330 ml = 3300 ml. To find the cost per milliliter (ml), we divide the total cost by the total volume: $2 / 3300 ml ≈ $0.000606 per ml.

Comparing the two brands, we can see that the cost per milliliter for Co Fizz is $0.00125, while the cost per milliliter for Cola is approximately $0.000606.

Since the cost per milliliter for Co Fizz is higher than the cost per milliliter for Cola, it can be concluded that Co Fizz is more expensive in terms of price per unit volume.

For more such question on brand. visit :

https://brainly.com/question/29129317

#SPJ8

2. une is shown in the coordinate plane.a. What are the coordinates of pointsand ?10b. is the point (16, 20) on line 7Explain how you knowCc. Is the point (2024) on line 7Explain how you know.8d. Is the point (80, 100) on line ?Explain how you know.e. Write a rule that would allow you totest whether (23) is on line

Answers

The equationfor the line is,

\(y=mx+c\)

From the points, (4,0) and (8,10)

\(m=\frac{10-0}{8-4}=\frac{10}{4}=\frac{5}{2}\)

And

A gardener wants to determine which of two brands of fertilizer is best for the plants in a garden. Before using one of the fertilizers on the entire garden, the gardener decides to conduct an experiment using 28 individual plants. Which of the two plans for randomly assigning the treatments should the gardener use? Explain.

Plan A: Choose the 14 unhealthiest-looking plants. Apply Brand X fertilizer to all 14 of those plants. Apply Brand Y fertilizer to the remaining 14 plants.

Plan B: Choose 14 of the 28 plants at random. Apply Brand X fertilizer to those 14 plants and Brand Y fertilizer to the remaining 14 plants.

Plan A, because the unhealthy plants need the fertilizer the most and should be treated first
Plan B, because the sample of plants is randomly chosen
Plans A and B are equivalent because they both follow experimental design
Plans A and B are both poorly designed because there are not enough plants to test
The plans cannot be evaluated from the information given

Answers

Plan B: Choose 14 of the 28 plants at random. Apply Brand X fertilizer to those 14 plants and Brand Y fertilizer to the remaining 14 plants.

What is a sample and its types?

A sample is only a small portion of the population.

Let's imagine you were interested in determining the average income for all Americans in your population.

Instead of knocking on every door in America because of time and money constraints, you decide to ask 1,000 random people. Your sample consists of these a thousand persons.

Given, A gardener wants to determine which of two brands of fertilizer is best for the plants.

And the gardener decides to conduct an experiment using 28 individual plants.

Plan A will be a biased sampling and the experiment would not yield

desired results.

Therefore, The gardener should choose 14 of the 28 plants at random. Apply Brand X fertilizer to those 14 plants and Brand Y fertilizer to the remaining 14 plants.

learn more about samples here :

https://brainly.com/question/8222250

#SPJ1

What is the first step to find the interquartile range of the data set?
A. Find the mean of the data set.
B. Find the sum of the values in the data set.
C. Order the data set from least to greatest.
D. Find the maximum of the data set.

Answers

C. Order the data set from least to greatest.

The outside temperature was 73°f at 1.p.m and decreases at a rate of 1.5°f each hour. What expression can be used to determine the temperature h(h is the variable) hours after 1.p.m?

Answers

Your expression will be h = -1.5°x + 73°

17% of what number is 61.2

Answers

the 17 percent of 360 will be 61.2.

What is percentage?

A value or ratio that may be stated as a fraction of 100 is referred to as a percentage in mathematics. If we need to compute a percentage of a number, we should divide it by its whole and then multiply it by 100. The proportion, therefore, refers to a component per hundred. Per 100 is what the term percent signifies. The letter "%" stands for it.

Given, 17% of the number is 61.2

Let "x" be the number

Thus,

17% * x = 61.2

17/100 * x = 61.2

x = 6120/17

x = 360

therefore, the 17 percent of 360 will be 61.2.

Learn more about percentages here:

https://brainly.com/question/29306119

#SPJ1

13. A car travels at a speed of 55 km/h. Find the distance travelled by the car in 12minutes 30 seconds, giving your answer in meters.

Answers

Answer:

11.46 meters

Step-by-step explanation:

12min 30sec = 12.5min

55km/h * 12.5min * 1h/60min = 11.4583333333meters

What comes next ? Finish the pattern 618427

Answers

5039 that’s the answer I think I could be wrong

The value of the number is 4.

Given to us

Series = {6,1,8,4,2,7}

Assumption

Let the next number in the series be x.

Patterns

looking at the pattern the series can be classified into two

odd series consisting of the numbers {6, 8, 2, x}even series consisting of the numbers {1, 4, 7}

Odd Series

As the x is falling under the odd number series the,

we can see the difference in the odd series is following -2, +6, -2, +6; therefore, following the same series we get

6 + 2 = 8

8 - 6 = 2

2 + 2 = 4

Hence, the value of the number is 4.

Learn more about series and sequence:

https://brainly.com/question/8195467

What comes next ? Finish the pattern 618427

A toy store manager received a large order of Mr. Slinkums just in time for the holidays. The manager places 20% of them on the shelves, leaving the other 120 Mr. Slinkums in storage. How many Mr. Slinkums were in this order?

Answers

Answer:

30

Step-by-step explanation:

.eply *S the deep end the field

The number of Mr. Slinkums in this order will be 30.

What is an expression?

The mathematical expression combines numerical variables and operations denoted by addition, subtraction, multiplication, and division signs.

Mathematical symbols can be used to represent numbers (constants), variables, operations, functions, brackets, punctuation, and grouping. They can also denote the logical syntax's operation order and other properties.

Given that a toy store manager received a large order of Mr. Slinkums just in time for the holidays. The manager places 20% of them on the shelves, leaving the other 120 Mr. Slinkums in storage.

The number of the Mr. Slinkums in the order will be calculated as,

Number =  ( 120 x 100 ) / 80 - 120

Number = 150 - 120

Number = 30

Hence, the number of the order will be 30.

To know more about an expression follow

https://brainly.com/question/11849012

#SPJ2

Apple juice has 216 grams of sugar for every 8 servings. The soda has 234 grams of sugar for every 9 servings

Answers

Answer:

Apple juice contains 1728 g sugar whereas soda contains 1404 g sugar

Step-by-step explanation:

A neighborhood trash pick up comes every 5 days, while the recycling pick up is every 8 days. After how many days will both trash and recycling be picked up on the same day?

Answers

Answer:

40 days

Step-by-step explanation:

8 and 5 have forty in common so yea forty days

y is directly proportional to t. y = 20 when t=4 t is inversely proportional to the square of x. t = 8 when x = 2 Find a formula for y in terms of x. Give your answer in its simplest form.​

Answers

The formula for y in terms of x is y=160​/x^2.

We are given that;

y = 20 when t=4

And t = 8 when x = 2

Now,

To find the value of k by using the fact that y = 20 when t = 4:

20=k⋅4

k=5

Also, y=5t

Next, we use the fact that t is inversely proportional to the square of x. We can write:

t=x2k​

where k is a constant of proportionality. We can find the value of k by using the fact that t = 8 when x = 2:

8=22k​

k=32

Now we know that:

t=x232​

Substituting this into the equation for y:

y=5t=5⋅x232​=160​/x^2

Therefore, by proportions the answer will be y=160​/x^2.

More can be learned about proportions at;

brainly.com/question/24372153

#SPJ1

Which statement is true about the end behavior of the graphed function?

Which statement is true about the end behavior of the graphed function?

Answers

Answer:

As the x-values go to positive infinity, the function's values go to positive infinity.

emilythompson35464

hope this helps srry if this doesn't tho

Answer: A.

Step-by-step explanation:

because the x values increase, the other functions decresse.

1245+557-45677/88765×345.865​

Answers

Answer:

if question is a fraction then -0.001429, if not then 624.0235948

what is the nat term of the sequence -3, 0, 5, 10, 25, 5, 47 ?​

Answers

The nth term of the sequence -3, 0, 5, 10, 25, 5, 47 can be represented by the piecewise function:

nth term =

-3 + (n - 1) * 5, if n mod 5 ≤ 5

5 + (n - 1) * 15, if n mod 5 > 5

To find the nth term of a sequence, we need to identify the pattern or rule that governs the sequence. Upon analyzing the given sequence -3, 0, 5, 10, 25, 5, 47, we can observe the following:

The sequence starts with -3 and increases by 5 each time, except for the 5th term, where it increases by 15 (from 10 to 25). After the 5th term, the sequence starts again with 5 and continues to increase by 15 each time.

Based on this pattern, we can divide the sequence into two parts:

Part 1: -3, 0, 5, 10, 25 (increasing by 5 each time)

Part 2: 5, 20, 35, 50, 65 (increasing by 15 each time)

Now, to determine the nth term, we can consider the formula for arithmetic sequences:

nth term = first term + (n - 1) * common difference

For Part 1, the first term is -3 and the common difference is 5. Thus, the nth term for Part 1 is given by:

nth term = -3 + (n - 1) * 5

For Part 2, the first term is 5 and the common difference is 15. Therefore, the nth term for Part 2 can be expressed as:

nth term = 5 + (n - 1) * 15

However, since the sequence alternates between Part 1 and Part 2, we need to determine which part the nth term falls into. For that, we can use modular arithmetic:

If n mod 5 is less than or equal to 5, then the nth term is from Part 1.

If n mod 5 is greater than 5, then the nth term is from Part 2.

Let's calculate a few terms to illustrate this:

For n = 1, the sequence starts with -3, so the 1st term is -3.

For n = 2, we are still in Part 1, so the 2nd term is 0.

For n = 3, Part 1 continues, so the 3rd term is 5.

For n = 4, we are still in Part 1, so the 4th term is 10.

For n = 5, Part 1 ends, and the 5th term is 25.

For n = 6, the sequence starts with 5 in Part 2, so the 6th term is 5.

For n = 7, Part 2 continues, so the 7th term is 20.

For n = 8, we are still in Part 2, so the 8th term is 35.

Based on this analysis, we can conclude that the nth term for the given sequence is:

If n mod 5 ≤ 5:

nth term = -3 + (n - 1) * 5

If n mod 5 > 5:

nth term = 5 + (n - 1) * 15

Therefore, depending on the value of n and the remainder when divided by 5, we can use the appropriate formula to calculate the nth term.

​for such more question on sequence

https://brainly.com/question/30194025

#SPJ8

Plz answer me will mark as brainliest and will be reported if wrong answer ​

Plz answer me will mark as brainliest and will be reported if wrong answer

Answers

Answer:

1,2,3,6,and 9

Step-by-step explanation:

18=1×18

=2×9

=3×6

=1,2,3,6and9

What is the solution to the equation below?

y + 4.73 = 8.0


A. y = 12.73 B. y = 3.93 C. y = 4.27 D. y = 3.27

Answers

Answer :

It is D because you have to subtract 4.73 from both sides in order to isolate the y by itself and get the answer which is 3.27

Step-by-step explanation:

             - - - - - - - -- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -- -

\(\blue{\textsf{\textbf{\underline{\underline{Question:-}}}}\)

What is the solution to the equation below?

y+4.73=8.0

\(\blue{\textsf{\textbf{\underline{\underline{Answer and how to Solve:-}}}}\)

To solve it, simply subtract 4.73 from both sides:-

y=3.27 (Option D)

Good luck.

         - - - - - -- - - - - - - - - - - - - - - -- - - - - - - - - - - - - - - -- - - - - - - - - - -

Use the scale drawing to determine how wide the duck pond is? A. 18 feet B. 27 feet C. 49.5 feet D. 55.5 feet

Answers

The width of the duck pond is,

⇒ 27 feet

We can see that the given diagram is a rectangle,

And we know that,

Rectangles are four-sided polygons with all internal angles equal to 90 degrees. At each corner or vertex, two sides meet at right angles. The rectangle differs from a square in that its opposite sides are equal in length.

Now, By given diagram we have;

We have to given that;

Use the scale drawing to determine how wide the duck pond is.

And there are 4.5 feet in 1 square,

Therefore,

1 square is equal to 4.5 feet

So, we get;

The width of the duck pond is,

⇒ 6 square

We know that,

To multiply means to add a number to itself a particular number of times. Multiplication can be viewed as a process of repeated addition.

Then to find width of duck pond in feet,

Multiply 6 with 4.5

⇒ 6 × 4.5 feet

⇒ 27 feet

Thus, The width of the duck pond is,

⇒ 27 feet

Learn more about the multiplication visit:

brainly.com/question/10873737

#SPJ1

Use the scale drawing to determine how wide the duck pond is? A. 18 feet B. 27 feet C. 49.5 feet D. 55.5

hurry ASAP 100 points !!!!

hurry ASAP 100 points !!!!

Answers

Answer:

I am pretty sure 1=constant independednt, 2 is inconsistent and three is constant dependent

Step-by-step explanation:

I am not positive tho..

Answer:

the first one is y=-5+2x

Other Questions
Write a Java program using PostFixEvaluator1. Write a class PostFixEvaluator that prompts the user for a postfixexpression whose elements are separated by spaces, and then evaluates thatexpression, as suggested by the sample run below. Ensure support for the "+","-", "*", "/", and "^" operators with operands of type double. A large jar has two colors of marbles, white and yellow. There arethree white marbles for every four yellow marbles. There are 248yellow marbles in the jar. How many white marbles are in the jar?White marblesYellow marblesAnswer: Dont use for points or Ill take it back Help Gray, Inc., a C corporation, has taxable income from operations of $1,452,000 for 2016. It also has a net long-term capital loss of $355,000 from the sale of a subsidiary's stock. The year 2016 is the first year in the last 10 years that Gray has not had at least $500,000 per year of net long-term capital gains.If an amount is zero, enter "0".How much of the net long-term capital loss is deductible in 2016 by Gray? $???Gray's 2016 taxable income is $???.Any unused loss may be carried back for three years, then carried forward for five years as a short-term capital loss against Gray's capital gains . In determining the causes of others' behavior, we overemphasize ________ factors; this is the ___________.A) person; self-serving biasB) person; fundamental attribution errorC) situational; self-serving biasD) situational; fundamental attribution error es el que sabe todo acerca de la historia incluso lo que piensan los personajes Balance equation Co2(CO3)3(s)=Co2O3(s)+CoO2(g) 84 7=( + 4)x = 80 x || + 28 + x 7 If an offender has received two sentences for two different crimes but starts serving both sentences on the same day, this is called a _____________ sentence.consecutive determinate concurrent mandatory maximum What impact did the Ottoman Empire have on Eastern Europe? Does Hansberry succeed in creating real people rather than racial stereotypes?what does she teach us about the American dream for both African American and white Americans For the month of June in a certain city, 87% of the days are cloudy. Also in the month of June in the same city, 73% of the days are cloudy and foggy. What is the probability that a randomly selected day in June will be foggy if it is cloudy What is the strength of an electric field that will balance the weight of a 4.2 gg plastic sphere that has been charged to -1.5 nCnC ?What is the direction of an electric field that will balance the weight of a 4.2 gg plastic sphere that has been charged to -1.5 nCnC ? What is the important role of sport official? How do you describe excellent interpersonal skills? Whenever a salesperson is given a set price list and delivery schedule and is not given the authority to deviate from them. This is known as A) Sales Negotiations B) Sales preparation C) Sales Presentation D) Pure selling 13- Which of the following factors should be investigated in order to increase the likelihood of sales success? A) Product knowledge and benefits B) Knowledge of competitors' products C) sales presentation planning D) All Answers are correct Seala en cul de los siguientes sistemas puede haber un equilibrio fsico dinmico o un equilibrio qumico. a. Cristalizacin y disolucin del cloruro de sodio. b. Conversin de oxgeno gaseoso en ozono. c. Condensacin y evaporacin de un lquido. d. Reaccin entre H2 y l2 para producir Hl. e. Una solucin saturada de azcar. por favor, solo me falta esa pregunta. This era created a bold new sense that nothing was _____. If point (4, 5) is on the graph of a function, which equation must be true? f(5)=4 f(5,4)=9 f(4)=5 f(5,4)=1 Create a list of at least five agencies (government and non-government) that affect health care in the United States. Which one directly affect the physiotherapy profession? Explain how they direct affect this profession? How do these agencies help assure quality in health care delivery?