The pH of a saturated aqueous solution of a manganese(II) hydroxide Mn(OH)2 is 9.83 at 25°C. What is Ksp of Mn(OH)2 at 25°C?

Answers

Answer 1

4.6 * \(10^{(-14\)), represents the sοlubility prοduct cοnstant (Ksp) οf Mn(OH)₂ at 25°C. The sοlubility prοduct cοnstant (Ksp) is a measure οf the equilibrium sοlubility οf a sparingly sοluble cοmpοund in a sοlvent.

What dοes "sοlubility prοduct cοnstant" mean?

The equilibrium cοnstant fοr the dissοlutiοn οf a sοlid substance intο an aqueοus sοlutiοn is the sοlubility prοduct cοnstant. Ksp is used tο represent it. A type οf equilibrium cοnstant, the sοlubility prοduct's value changes with temperature.

The sοlubility prοduct quοtient is represented by Qsp, while the sοlubility prοduct cοnstant is Ksp. The primary distinctiοn between Ksp and Qsp is that Ksp denοtes a substance's sοlubility whereas Qsp denοtes a sοlutiοn's current cοnditiοn.

To learn more about equilibrium constant :

https://brainly.com/question/3159758

#SPJ4


Related Questions

hydrogen fuel cells can potentially be up to _____% efficient.

Answers

Hydrogen fuel cells can potentially be up to 60% efficient. A hydrogen fuel cell is a device that converts the chemical energy of hydrogen into electrical energy.

The process is a simple one. When hydrogen is combined with oxygen from the air, it reacts chemically and produces electrical energy, water, and heat. This method of converting chemical energy into electrical energy is known as an electrochemical reaction. A fuel cell is essentially a battery that is constantly replenished with fuel and oxygen to continue generating electricity. Fuel cells have the potential to be highly efficient and environmentally friendly sources of energy. For example, hydrogen fuel cells can potentially be up to 60% efficient.

To know more about electrochemical reaction, visit:

https://brainly.com/question/31236808

#SPJ11

Which of the following is an amorphous solid?
O
A. Diamond
B. Graphite
O C. Glass
O D. Iron

Answers

Answer:

C. Glass

Explanation:

Amorphous solids have a non-crystalline structure and no order. In that case, Diamonds, Graphite, and Iron all have a crystalline structure and order. You are left with C as your answer.

amorphous carbon is a noncrystalline form. Glass is actually neither a liquid nor a solid. It is an amorphous solid—a state somewhere between those two states of matter.

what is the unique characterization of a ph buffer?

Answers

it has a definite pH value

can you determine the contents of the unlabeled jar through observation alone?

Answers

Answer:

This question appears incomplete but generally the answer is NO

Explanation:

Observation of the contents of an unlabeled jar depends solely on some of the physical properties of the content which is not good enough when identifying the contents of an unlabeled jar. This is because several substances have the same physical properties. For example, water and several acidic solutions appear the same in terms of colour and viscosity. Hence, a jar of water and a jar of hydrochloric acid cannot be differentiated by mere observation but with the use of litmus paper.

And a solution of hydrochloric acid and sulphuric acid cannot be differentiated by observation alone except a jar ammonia is brought close to the two jars (the one with hydrochloric acid will form a white fume with ammonia); hence relying on the chemical properties of both substances.

NOTE: Observation is done through sight, smell, feel, sound and taste without relying on another procedure/analysis to determine them.

which characteristics of an element can be determined by considering only the element’s specific location on the periodic table?

Answers

Answer:

Gas, Solid, or liquid

Explanation:

The number of electron shells tell us which group it’s in and the number of electrons in total (atomic number) tell us exactly where it is

Once all the unsuitable colours are removed, the company claims that its sweets are now free
from artificial colours'.
Does this mean that the sweets contain no additives? Explain your answer. *
(2 points)

Answers

Answer:

I believe that they do contain additives

Explanation:

I think this because everything whether its sweets or food everything have additives

Hope this helps

sorry if not

Plz give brainliest

If 22.00 J of energy is used, what would be the mass of liquid ammonia that could be vaporized? 1.38 kJ/g

Answers

Answer:

32kg/j correct me if I am wrong

Answer:

1.38 kJ/g

Explanation:

it is answer

How many grams of C2H2 are produced when water is added (in excess) to 5.00g CaC2CaC2+2H2O=C2H2+Ca(OH)2

Answers

Step 1

The reaction must be completed and balanced:

CaC2 + 2H2O = C2H2 + Ca(OH)2

---------------

Step 2

Information provided:

H2O (water) is the excess.

CaC2 is the limiting reactant. This limits the production of C2H2

Information needed:

The molar mass of CaC2 (64.0 g/mol) and C2H2 (26.0 g/mol)

---------------

Step 3

By stoichiometry:

1 mol CaC2 = 64.0 g

1 molC2H2 = 26.0 g

64.0 g CaC2 -------- 26.0 g C2H2

5.00 g CaC2 -------- X

X = 5.00 g CaC2 x 26 g C2H2/64.0 g CaC2 = 2.03 g C2H2

Answer: 2.03 g C2H2

monica has a bracelet made of sterling silver. sterling silver is a solid solution made of copper and silver. what type of solid solution is formed

Answers

An alloy is formed from that solution

What is the effect of increasing pressure on the equilibrium? N2 + 3H2 ⇔ 2NH3 a) Equilibrium shifts in forward direction. b) Equilibrium shifts in backward direction. c) No effect d) It does not depends on pressure.

Answers

Answer:

a) Equilibrium shifts in forward direction.

Explanation:

If pressure is increased, equilibrium shifts to the side with the fewer moles of gas.

There are 4 moles of gas in the reactants and 2 moles of gas in the products.

The equilibrium will shift in the forward direction towards the products.

Hope that helps.

Answer:

A

Explanation:

Consider the titration of HClO4 with NaOH. What is the pH after addition of 81 mL of 0.40 M NaOH to 80.0 mL of 0.40 M HClO4

Answers

The pH after the addition of 81 mL of 0.40 M NaOH to 80.0 mL of 0.40 M HClO4 is 13.30

The balanced chemical equation for the reaction between HClO4 and NaOH is:

HClO4 + NaOH → NaClO4 + H2O

First, let's find the moles of HClO4 and NaOH present before the reaction:

moles HClO4 = 0.40 mol/L x 0.080 L = 0.032 mol

moles NaOH = 0.40 mol/L x 0.081 L = 0.0324 mol

Since the moles of NaOH added are greater than the moles of HClO4 initially present, NaOH is the limiting reagent. Therefore, all of the NaOH will react with the HClO4, and we need to find the number of moles of HClO4 that react with the NaOH.

According to the balanced equation, 1 mole of NaOH reacts with 1 mole of HClO4. Therefore, 0.0324 mol of HClO4 will react with the 0.0324 mol of NaOH.

The remaining moles of HClO4 after the reaction is given by:

moles HClO4 remaining = 0.032 mol - 0.0324 mol = -0.0004 mol

Since the resulting moles of HClO4 is negative, this means that all the HClO4 has been used up and the solution is basic. The excess NaOH reacts with water to produce hydroxide ions:

NaOH + H2O → Na+ + OH- + H2O

The total volume of the solution after the reaction is:

V = 80.0 mL + 81 mL = 0.161 L

The concentration of OH- ions produced is given by:

[OH-] = moles NaOH / V = 0.0324 mol / 0.161 L = 0.201 M

Using the expression for the ion product of water, we can calculate the concentration of H+ ions:

Kw = [H+][OH-] = 1.0 x 10^-14

[H+] = Kw / [OH-] = 1.0 x 10^-14 / 0.201 M = 4.975 x 10^-14

The pH of the solution is given by:

pH = -log[H+] = -log(4.975 x 10^-14) = 13.30

To know more about moles please visit:

https://brainly.com/question/31597231

#SPJ11

America is the world’s number one producer of natural gas derived from shale oil. true false

Answers

Correct option:

The statement "America is the world’s number one producer of natural gas derived from shale oil" is True.

Shale gas:

Shale, a form of sedimentary rock, is used to make shale gas, which is natural gas.Over the past ten years, shale gas has gained importance as a natural gas source in the United States. Interest has also grown in possible shale gas reserves in Canada, Europe, Asia, and Australia. With large production in the US and Canada, North America is the region that produces the most shale gas globally. Only Argentina and China have so far produced shale gas on a commercial basis outside of the US and Canada.The environmental dangers associated with shale gas production like, Induced seismicity from hydraulic fracturing has been known to cause earthquakes in three different places across the world and leaks of extraction waste and chemicals into water systems, the release of greenhouse gases during extraction, and the pollution brought on by the poor processing of natural gas have led to its suspension in numerous nations.      

Learn more about shale gas here:

https://brainly.com/question/11335104

#SPJ4

High-frequency sound waves have a shorter_____ and a higher ______ than low frequency sound waves.​

Answers

Answer:

High-frequency sound waves have a shorter wavelength and a higher amplitude than low frequency sound waves.

the decay rate for a radioactive isotope is 5.4 percent per year. find the half-life of the isotope.

Answers

The half-life of a radioactive isotope is the amount of time it takes for half of the atoms in a sample to decay.

What is radioactive isotope?

A radioactive isotope is an unstable form of an element that emits radiation as it decays. It is produced when a neutron is added to the nucleus of an atom, making it unstable and prone to radioactive decay. Radioactive isotopes are used in a variety of medical, scientific and industrial applications. In medicine, they are used to diagnose and treat diseases, while in industry they are used to detect flaws in materials. In scientific research, they are used to measure age and composition of materials.

Therefore, the half-life of this isotope is 12.75 years, since it takes 5.4 percent of the atoms in a sample to decay per year. This means that if we start with a sample of 100 atoms, after 12.75 years, only 50 atoms would remain in the sample. After 25.5 years, only 25 atoms would remain, and so on. This can be calculated by taking the natural log of 2 and dividing it by the decay rate of the isotope, which in this case is 5.4%.

To know more about radioactive isotope click-

https://brainly.com/question/18640165

#SPJ4

identify the most likely cause of earthquakes that occur in the area shown on the map

identify the most likely cause of earthquakes that occur in the area shown on the map

Answers

The most likely cause of earthquakes that occur in the area shown on the map is due to fault lines in the earth's crust.

What are earthquakes?

Earthquakes are natural phenomena characterized by the shaking or trembling of the Earth's surface.

They occur due to the sudden release of energy in the Earth's crust along fault lines, which creates seismic waves that propagate through the Earth.

The Earth's crust is composed of several large tectonic plates that float on the semi-fluid layer of the Earth's mantle.

Learn more about earthquakes at: https://brainly.com/question/248561

#SPJ1

Consider the molecular structure for linuron, an herbicide, provided in the questions below. a) What is the electron domain geometry around nitrogen-1? b) What is the hybridization around carbon-1? c) What are the ideal bond angles > around oxygen-1? d) Which hybrid orbitals overlap to form the sigma bond between oxygen-1 and nitrogen-2? e) How many pi bonds are in the molecule?

Answers

Answer:

a)Electron domain geometry around nitrogen-1 is tetrahedral

b)Hybridization around carbon-1 is sp2

c)The ideal bond angles around oxygen-1 are 120 degrees.

d)Hybrid orbitals overlapping to form the sigma bond between oxygen-1 and nitrogen-2 is sp2 hybrid orbitals from carbon-1 and nitrogen-2

e)There are no pi bonds in the molecule.

Explanation:

a) Electron domain geometry around nitrogen-1 is tetrahedral.The molecular structure of linuron is as follows: There are three carbon atoms in a row. The terminal carbon atom is linked to a methyl group and a chlorine atom. The carbon atom next to it is linked to the nitrogen atom in the herbicide. The third carbon atom is linked to two oxygen atoms, with one of them being a hydroxyl group.

b) Hybridization around carbon-1 is sp2.The carbon atom adjacent to the nitrogen atom is known as carbon-1. This carbon atom is joined to three other atoms. It has an sp2 hybridization since it has three regions of electron density.

c) The ideal bond angles around oxygen-1 are 120 degrees.Bond angles are the angles between two adjacent lines in a Lewis structure. Because oxygen-1 is linked to two other atoms, it has a bent geometry. Its ideal bond angle is 120 degrees.

d) Hybrid orbitals overlapping to form the sigma bond between oxygen-1 and nitrogen-2 is sp2 hybrid orbitals from carbon-1 and nitrogen-2.The sigma bond is the strongest type of covalent bond. Sigma bonds are created when the overlapping orbitals are arranged in a straight line. The sigma bond between oxygen-1 and nitrogen-2 is formed by the overlap of sp2 hybrid orbitals from carbon-1 and nitrogen-2.

e) There are no pi bonds in the molecule.There are no pi bonds in the molecule because all of the bonds are sigma bonds. The molecule consists of single bonds only.

To know more tetrahedral. about refer here: https://brainly.com/question/18612295#
#SPJ11

What is true of a sample of gas as temperature is increased? (3 points)

Answers

As temperature increases, the average kinetic energy of a sample of gas molecules decreases.

I'LL GIVE 30 POINTS PLEASE ANSWER!!!
Which terms correctly identify the indicated structures in this sketch of a cell viewed under a microscope? Match each label to the correct cell part. Question 5 options: Golgi Apparatus Nucleus Endoplasmic Reticulum Mitochodrion Ribosome Lysosome
1.

2.

3.

4.

5.

6.

I'LL GIVE 30 POINTS PLEASE ANSWER!!!Which terms correctly identify the indicated structures in this sketch

Answers

1.Golgi
2. nucleus
3.Endoplasmic
4.Mitochondria
5.Ribosome
6.Lysosome

Someone please HELPPPP

Someone please HELPPPP

Answers

It might me b but I am not sure

which of these places is in an example of a marine ecosystem A. coral reef B. river C. rain forest D. tunda

Answers

Coral reef is an example of a marine ecosystem. So the correct option is A.

A marine ecosystem refers to the diverse communities of organisms that inhabit oceanic and coastal environments. The marine ecosystem includes a wide range of habitats, such as coral reefs, estuaries, mangrove forests, kelp forests, and deep-sea hydrothermal vents. These ecosystems provide a variety of ecological services, including oxygen production, nutrient cycling, and climate regulation, and are home to millions of marine species.

Coral reefs are one of the most diverse and productive marine ecosystems, providing habitat and shelter for numerous species of fish, invertebrates, and algae. Estuaries, on the other hand, are characterized by their brackish water, which is a mix of saltwater and freshwater. They serve as critical nurseries for many commercially important fish species and are important areas for migratory birds.

To know more about  marine ecosystem,

https://brainly.com/question/16929274

#SPJ11

Extra points please someone help

Extra points please someone help

Answers

Answer: Plants and animals share many characteristics, but they are different in some respects hope that helps-

Explanation:

what happens when
limestone is heated ​

Answers

Answer:

When limestone is heated strongly, the calcium carbonate it contains absorbs heat (endothermic ) and decomposes to form calcium oxide. Calcium oxide (also known as quicklime) is a key ingredient in the making of cement and is also used to make certain types of plaster.

Explanation:

Limestone heated

When limestone is heated strongly, the calcium carbonate it contains absorbs heat (endothermic ) and decomposes to form calcium oxide. ... Calcium oxide (also known as quicklime) is a key ingredient in the making of cement and is also used to make certain types of plaster.

Burning Limestone

Burning limestone, which is calcium carbonate, gives you quick lime, calcium oxide. Mixed with water this produces slaked lime, calcium hydroxide. ... This is soft when first mixed, but with time absorbs carbon dioxide from the atmosphere and hardens as it reverts back to calcium limestone.

Limestone exposed to heat and pressure.

Marble is a metamorphic rock that forms when limestone is subjected to the heat and pressure of metamorphism. ... Under the conditions of metamorphism, the calcite in the limestone recrystallizes to form a rock that is a mass of interlocking calcite crystals.

Which substance is a reactant(s)
O2 only
MgO only
Mg and O2
Mg only

Answers

Reactants in all these elements are Mg and O2

Can someone please help

Can someone please help

Answers

Answer:

Water is the answer

Explanation:


Show work for all math problems. Make sure to have the correct unit and significant figures in your each answer.

Convert 2.35 atm to mmHg.

Answers

1786 mmHg
Correct sig figs: 1790 mmHg
Show work for all math problems. Make sure to have the correct unit and significant figures in your each

Lana balanced an equation so that the result was 2c2h3br 5o2 → 4co2 2h2o 2hbr. which most likely represents the starting equation? 2c4h3br 5o2 → 4co2 2h2o 2hbr c2h3br 5o2 → 4co2 h2o 2hbr c4h3br o2 → co2 h2o hbr c2h3br o2 → co2 h2o hbr

Answers

Given the data from the question, the starting equation is

C₂H₃Br + O₂ --> CO₂ + H₂O + HBr

What is a chemical equation?

Chemical equations are representations of chemical reactions using symbols and formula of the reactants and products.

The reactants are located on the left side while the products are located on the right side.

Reactants —> Products

The balancing of chemical equations follows the law of conservation of matter which states that matter can neither be created nor destroyed during a chemical reaction but can be transferred from one form to another.

Considering the equation given from the qustion

2C₂H₃Br + 5O₂ --> 4CO₂ + 2H₂O + 2HBr

We can see that the above equation is already balanced.

Thus, the starting equation will be the skeletal equation which is unbalanced.

Therefore, we can conclude that the starting equation is:

C₂H₃Br + O₂ --> CO₂ + H₂O + HBr

Learn more about chemical equation:

https://brainly.com/question/7181548

#SPJ1

Answer:

D

Explanation:

took the test

How many kilocalories are in a portion of food that contains 8 g protein, 10 g fat, 22 g carbohydrate, 130 mg vitamin c, and 120 ml water?

Answers

There are 210 kilocalories in a portion of food that contains 8 g protein, 10 g fat, and 22 g carbohydrate. The amount of vitamin C and water in the food does not contribute to the number of kilocalories, as they are not sources of energy.

Proteins are large, complex molecules that are made up of long chains of amino acids. They are essential for the growth, repair, and maintenance of tissues in the body, and are involved in a wide range of biological processes.

To calculate the number of kilocalories in a portion of food, we need to use the following formula:

Calories = (grams of protein x 4) + (grams of fat x 9) + (grams of carbohydrate x 4)

Using this formula, we can calculate the number of calories in the given portion of food:

Calories = (8 g protein x 4) + (10 g fat x 9) + (22 g carbohydrate x 4)

Calories = 32 + 90 + 88

Calories = 210 kcal

Therefore, in a portion of food that contains 8 g protein, 10 g fat, and 22 g carbohydrate there are 210 kilocalories.

Learn more about Proteins here:

https://brainly.com/question/30986280

#SPJ4

2.00 L of 1.0 M NaCl solution is prepared in a flask. 400.0 mL of the solution is poured out of the flask into a beaker. What is the concentration of the salt solution in the beaker? Give your answer to two significant figures. ​

Answers

Answer:

Explanation:

The concentration of the salt solution in the beaker is 0.50 M.

Gravity is a force that every mass exerts on every other mass. When you jump up in the air, not only does the Earth
exert a gravitational force on you, but you also exert a gravitational force on the Earth. You, of course, fall back down to
the Earth. Which of the following explains why the Earth is not moving toward you when you jump up in the air?
A. Earth exerts a gravitational force on itself.
B. You don't weigh enough to affect Earth's surface.
C. Your mass is very small compared to Earth's mass.
D. Earth's fixed orbit around the Sun keeps it from moving

Answers

Answer:

Brainliest A and I want brainliest please

Explanation:

That pull is gravity at work. Every object in the universe that has mass exerts a gravitational pull, or force, on every other mass. The size of the pull depends on the masses of the objects. You exert a gravitational force on the people around you, but the Gravity or gravitational forces are forces of attraction. We're not talking about finding someone really cute and adorable. It's like the Earth pulling on you and keeping you on the ground. That pull is gravity at work.

Every object in the universe that has mass exerts a gravitational pull, or force, on every other mass. The size of the pull depends on the masses of the objects. You exert a gravitational force on the people around you, but that force isn't very strong, since people aren't very massive. When you look at really large masses, like the Earth and Moon, the gravitational pull becomes very impressive. The gravitational force between the Earth and the molecules of gas in the atmosphere is strong enough to hold the atmosphere close to our surface. Smaller planets, that have less mass, may not be able to hold an atmosphere.at force isn't very strong, since people aren't very massive.

Obviously, gravity is very important on Earth. The Sun's gravitational pull keeps our planet orbiting the Sun. The motion of the Moon is affected by the gravity of the Sun AND the Earth. The Moon's gravity pulls on the Earth and makes the tides rise and fall every day. As the Moon passes over the ocean, there is a swell in the sea level. As the Earth rotates, the Moon passes over new parts of the Earth, causing the swell to move also. The tides are independent of the phase of the moon. The moon has the same amount of pull whether there is a full or new moon. It would still be in the same basic place.

What is the relationship between energy, power, and work?

Answers

Answer:Force exerted on an object over a distance does work. Work can increase energy, and energy can do work. Power is the rate at which work is done.

Explanation:

Force exerted on an object over a distance does work. Work can increase energy, and energy can do work. Power is the rate at which work is done.

Other Questions
Determine which integer will make the inequality x 3 > 15 true.D: S:{15}A: S:{17}B: S:{18}C: S:{30} quiz helpQuestion 9 0/2 points Mr. Deere has an IV of morphine 2 mg/h that has been infusing since 8:00 pm yesterday. It is currently 7:00 am. The concentration of morphine is NS. How much solution has he rece Jamie's credit card billing period ends on the 10th of every month. The grace period is 20 days. During what period of time will he receive free credit for a purchase made on July 20? A. 30 days B. 21 days C. 41 days D. 36 days a chronic condition in which the heart is unable to pump out all of the blood that it receives is known as The toy car in the diagram runs off the edge of the table that is 1.225m high. The car lands 0.400m from the base of the table. a. How long did it take the car to fall b. how fast was the car going on the table `h(t)=-5t^{2}+10t+3` 35 Points! 11 French Questions. Remplace les lments souligns par le pronom y ou en. Est-ce que tu as -quelques timbres-?Est-ce que tu en quelques as ?Est-ce que tu en as quelques ?Est-ce que tu en as quelques-uns ?Est-ce que tu y as quelques-uns ?Remplace les lments souligns par un pronom tonique.Je me suis assise - ct de Marie- dans le bus.Je me suis assise elle dans le bus.Je me suis assise ct delle dans le bus.Je ct delle me suis assise dans le bus.Je lai assise dans le bus.Remplace les lments souligns par un pronom tonique.Diane est alle au march avec -ses frres-.Diane est alle au march leurs.Diane est alle au march avec ils.Diane est alle au march avec lui.Diane est alle au march avec eux.Complte la phrase avec un pronom tonique.__, je ne suis pas en grve.JeLuiMoiMeComplte la phrase avec un pronom tonique.Par rapport __, je ne suis pas grande.leluiilleurComplte la phrase avec un pronom tonique.Jai fini tout mon travail __-mme.euxluimemoiLordre des pronoms dans cette phrase est-il correct ?Il ne vous y en a pas donn. OuiNonLordre des pronoms dans cette phrase est-il correct ?Jen y ai achet trois. Oui NonLordre des pronoms dans cette phrase est-il correct ?Je leur en nai pas parl. OuiNonLordre des pronoms dans cette phrase est-il correct ?Parle-lui-en ! OuiNonLordre des pronoms dans cette phrase est-il correct ?Tu ne ly as pas vu ?NonOui T/F: when the value of money is on the vertical axis, an increase in the price level shifts money demand to the right. PLSSS HELP IF YOU TURLY KNOW THISS How did mercantilism Affect European countries pursuit of colonies in the Americas A patient with pelvic inflammatory disease will typically complain of _________. Select one: A. bleeding associated with stress B. nausea and vomiting associated with intercourse C. aches and fever associated with urination D. abdominal pain associated with menstruation Which of the following is NOT a function or service provided by secondary markets?A-providing liquidity to owners of existing financial instruments.B-providing information to borrowers and lenders about expectations and attitudes of the economic climate.C-determining the price of the security that the issuing firm sells in the primary market.D-matching lenders (savers) with borrowers in need of funds. What is the perimeter of the triangle? Stella deposited $6,000 at 5% simple interest. How long will it take her before she has $8,400 in her account? What and when was the Great Depression and how did it change the American way of life? I'll give brainlyest , 5 star and 100 points. he cognitive understanding that requires a suspension of judgment as you take on another's viewpoint is which ingredient of empathy? PLZ HELP ME!!!!!!!!!!! HELP NEED HELP NOW!!!!!!!!!!!Use the map of agriculture in China to answer the question.Why is agricultural production in China distributed in this way?A.Much of western China is covered by dense rain forests.B.Much of western China is mountainous and has a desert climate.C.The Huang He frequently floods, destroying farmland in western China.D.The Gobi Desert covers western China, making it incapable of supporting farms. Which is an equivalent ratio to 7:5?Answe1. 14:12Answer2. 21:10Answer3. 21:15 HELP ASAPClassic Cars paid 9000 for a vintage Ferrari and sold for 11,250. What percentage profit did they make?