The pH of 0.010 M aniline(aq) is 8.32. What is the percentage aniline protonated? I know its .021% but i need to know how to get there.

Answers

Answer 1

The percentage of aniline protonated in a 0.010 M solution with a pH of 8.32 is approximately 0.021%.

Aniline (C6H5NH2) is a weak base that can be represented by the equation

C6H5NH2 + H2O ⇌ C6H5NH3+ + OH-.

The equilibrium constant expression for this reaction is

Kb = [C6H5NH3+][OH-]/[C6H5NH2].

At equilibrium, the concentration of aniline that has reacted to form the protonated form is [C6H5NH3+], and the concentration of aniline that has not reacted is [C6H5NH2].

Using the relationship between pH and [OH-] (pH = 14 - pOH), we can calculate that [OH-] = 10^(-5.68) M.

Using the equilibrium constant expression and the known concentration of aniline, we can solve for [C6H5NH3+]/[C6H5NH2], which is approximately 0.000213. This value multiplied by 100 gives the percentage of aniline that is protonated, which is approximately 0.021%.

For more questions like Aniline click the link below:

https://brainly.com/question/31081529

#SPJ11


Related Questions

1. Determine the percentage composition of each of the following compounds:

a. NaClO b. Al 2 (SO 3 ) 3 c. C 2 H 5 COOH d. BeCl 2

2. Determine the percentage by mass of water in the hydrate CuSO 4 5H 2 O

Answers

The percentage by mass of water in the hydrate \(CuSO^{4}.5H^{2}O\) is 47.6%.

The percentage composition of each of the following compounds are

1.a. NaClO:

The molar mass of NaClO =

22.99 g/mol + 35.45 g/mol + 15.99 g/mol = 74.43 g/mol

Percentage composition of Na =

(22.99 g/mol / 74.43 g/mol) *  100 \ percent \ = 30.9percent

Percentage composition of Cl =

(35.45 g/mol / 74.43 g/mol) *  100percent \ =  47.6percent

Percentage composition of O =

(15.99 g/mol / 74.43 g/mol) * 100percent \ =  21.5percent

Therefore, the percentage composition of NaClO is approximately:

30.9% Na, 47.6% Cl, and 21.5% O.

1.b. \(Al^{2}(SO^{3})^{3}\):

The molar mass of \(Al^{2}(SO^{3})^{3}\) = \(2 * (26.98 g/mol) + 3 * (32.06 g/mol + 3 * 16.00 g/mol) = 342.14 g/mol\)

Percentage composition of Al =

\((2 * 26.98 g/mol / 342.14 g/mol) * 100 \ = 3.99\)%

Percentage composition of S =

\((3 * 32.06 g/mol / 342.14 g/mol) * 100 \ = 8.99\)%

Percentage composition of O =

\((9 * 16.00 g/mol / 342.14 g/mol) * 100 \ = 10.47\)%

Therefore, the percentage composition of \(Al^{2}(SO^{3})^{3}\) is approximately:

3.99% Al, 8.99% S, and 10.47% O.

1.c. \(C^{2}H^{5}COOH\):

The molar mass of \(C^{2}H^{5}COOH\) = \(2 * (12.01 g/mol) + 6 * (1.01 g/mol) + 12.01 g/mol + 16.00 g/mol = 60.05 g/mol\)

Percentage composition of C =

\((2 * 12.01 g/mol / 60.05 g/mol) * 100 \ = 40.0\)%

Percentage composition of H =

\((6 * 1.01 g/mol / 60.05 g/mol) * 100\ \ = 10.1\)%

Percentage composition of O = \((2 * 16.00 g/mol + 12.01 g/mol / 60.05 g/mol) * 100 \ = 49.9\)%

Therefore, the percentage composition of \(C^{2}H^{5}COOH\) is approximately:

40.0% C, 10.1% H, and 49.9% O.

1.d. \(BeCl^2\):
The molar mass of \(BeCl^2\) = \(9.01 g/mol + 2 * 35.45 g/mol = 79.91 g/mol\)

Percentage composition of Be = \((9.01 g/mol / 79.91 g/mol) * 100 \ = 11.3\)%

Percentage composition of Cl =

\((2 * 35.45 g/mol / 79.91 g/mol)* 100 \ = 88.7\)%

Therefore, the percentage composition of \(BeCl^2\) is approximately:

11.3% Be and 88.7% Cl.

2. \(CuSO^{4}.5H^{2}O\):

Mass of CuSO4.5H2O = 8.40 g

Mass of anhydrous \(CuSO^{4}\) = mass of \(CuSO^{4}.5H^{2}O\) - mass of water

Mass of water = mass of \(CuSO^{4}.5H^{2}O\) - mass of anhydrous CuSO4

\(= 8.40 g - 4.40 g= 4.00 g\)

So, the mass of water in the hydrate is 4.00 g.

To determine the percentage by mass of water in the hydrate, we need to divide the mass of water by the mass of the entire compound (\(CuSO^{4}.5H^{2}O\)) and multiply by 100%:

Percentage by mass of water = (mass of water/mass of \(CuSO^{4}.5H^{2}O\)) x 100%

\(= (4.00 g/8.40 g) * 100= 47.6\)%

Therefore, the percentage by mass of water in the hydrate \(CuSO^{4}.5H^{2}O\) is 47.6%.

For more question on mass click on

https://brainly.com/question/30390726

#SPJ11

Which of the following is a propagation step in the free radical chlorination of methane?

∙CH3 + Cl2 → CH3Cl + Cl∙

∙CH3 + Cl∙ → CH3Cl

∙CH3 + ∙CH3 → CH3CH3

Cl2 → ∙Cl + ∙Cl

Answers

The propagation step in the free radical chlorination of methane is:

∙CH₃ + Cl∙ → CH₃Cl

In the free radical chlorination of methane, the propagation step is a crucial part of the overall reaction mechanism. It involves the interaction between a methyl radical (∙CH₃) and a chlorine radical (Cl∙), resulting in the formation of chloromethane (CH₃Cl).

During the propagation step, the methyl radical (∙CH₃) and chlorine radical (Cl∙) combine to produce chloromethane (CH₃Cl). This reaction occurs through the abstraction of a hydrogen atom from methane by the chlorine radical, forming a new C-Cl bond and generating a new methyl radical. The overall reaction can be represented as follows:

∙CH₃ + Cl∙ → CH₃Cl

Learn more about chlorine and methane from the link given below.

https://brainly.com/question/2409985

#SPJ4

in the science lab, the temperature of the chemical in adam’s test tube was −9°f. after only a few seconds over the bunsen burner, the temperature of the chemical increased to 6°f. part a which equation represents this situation? −6 x

Answers

In this situation, we need to find an equation that represents the change in temperature from -9°F to 6°F.  To find the change in temperature, we subtract the initial temperature from the final temperature.

Final Temperature - Initial Temperature = Change in Temperature 6°F - (-9°F) = 6°F + 9°F = 15°F So, the change in temperature is 15°F. Since the temperature increased, we need to use a positive value in the equation.  The equation that represents this situation is:

Change in Temperature = Final Temperature - Initial Temperature Change in Temperature = 6°F - (-9°F) Change in Temperature = 6°F + 9°F Change in Temperature = 15°F, Therefore, the correct equation for this situation is Change in Temperature = 15°F.

To know more about equation visit:

brainly.com/question/31967154

#SPJ11

Has anyone done this essay I need help and it’s due today

Has anyone done this essay I need help and its due today
Has anyone done this essay I need help and its due today
Has anyone done this essay I need help and its due today
Has anyone done this essay I need help and its due today

Answers

Explanation:

could you post the text? its inconvenient to go back and forth to the picture.

17. Interpret each chemical formula Mn₂(CO3)3. Determine how many atoms of each
element make up the compound.

Answers

The chemical formula Mn₂(CO₃)₃ represents a compound composed of manganese (Mn) and carbonate (CO₃) ions and contains 2 manganese atoms, 9 carbon atoms, and 9 oxygen atoms.

Understanding the Component of a Chemical Formula

To determine the number of atoms of each element in the compound, we need to break down the formula and analyze the subscripts.

Breaking down the formula

- Mn₂ indicates that there are two manganese atoms in the compound.

- (CO₃)₃ indicates that there are three carbonate ions in the compound. Each carbonate ion consists of one carbon atom (C) and three oxygen atoms (O).

Analyzing the carbonate ion

Since there are three carbonate ions in the compound, we need to multiply the number of atoms in each ion by three:

- There are three carbon atoms (C) in each carbonate ion, so in total, there are 3 x 3 = 9 carbon atoms.

- There are three oxygen atoms (O) in each carbonate ion, so in total, there are 3 x 3 = 9 oxygen atoms.

Summing up the atoms

- Manganese (Mn): 2 atoms

- Carbon (C): 9 atoms

- Oxygen (O): 9 atoms

Therefore, the compound Mn₂(CO₃)₃ contains 2 manganese atoms, 9 carbon atoms, and 9 oxygen atoms.

Learn more about chemical formula here:

https://brainly.com/question/11574373

#SPJ1

Which of the following is likely to be affected by a growing human population?

Question 5 options:

Amount of land for farming


Amount of air pollution


Amount of clean water


All of the above


None of the above

Answers

Answer:

D.) All of the above

is the correct answer

By a growing human population, amount of land for farming, amount of air pollution and clean water is likely to be affected.

What is population?

Population tells about the relative numbers of people present in particular area.

When there is a increase in the population of people then there is decrease in the amount of land for farming because more people want more land and this results in lack of land for individual. The affect of increased population results in the increase of air pollution, noise pollution, land pollution as well as water pollution.

Hence, option (d) is correct i.e. all of the above.

To know more about pollution, visit the below link:

https://brainly.com/question/24704410

PLEASE HELP ME QUICKLY (select all that apply) Enzymes made by extremophiles can be harvested and used in everyday applications. These uses include
making laundry detergents.
making dish detergents.
recycling old tires.
de-hairing hides.
making paper.

Answers

Answer:

A, B, D, E

Explanation:

did it on edg

Answer:

A. Making laundry detergent

B. Making dish detergent

D. De-hairing hides

E. Making paper

Explanation:

1.9 gm of a gas at 27 0C & 1.1 atm pressure occupies a volume of 1 ltr. The molecular mass of gas is, *
42.5 amu
3.83 amu
44 amu
32.5 amu

Answers

Answer:

42.5 amu

Explanation:

Using the ideal gas law equation;

PV = nRT

P = pressure (atm)

V = volume (L)

n = number of moles (mol)

R = gas law constant (0.0821 Latm/molK)

T = temperature (K)

According to the information provided in this question;

mass = 1.9g

T = 27°C = 27 + 273 = 300K

P = 1.1atm

V = 1L

n = ?

PV = nRT

1.1 × 1 = n × 0.0821 × 300

1.1 = 24.63n

n = 1.1/24.63

n = 0.045mol

Mole = mass/molecular mass

0.045 = 1.9/M.M

M.M = 1.9/0.045

M.M = 42.54amu

You open the fridge and the milk is sour (spoiled). What has
happened?
O Observation of an extensive property
O Observation of a physical property
O A physical change.
O Achemical change

You open the fridge and the milk is sour (spoiled). What hashappened?O Observation of an extensive propertyO

Answers

Pretty sure it’s a chemical change.

Answer:

D it's a chemical change

As soon as you realize that you are in danger, you feel your heart speed up. You feel very aware of your surroundings. Your whole body is preparing to run or fight for your life. Which of the following would be the response of your nervous system?

A)heart rate speeds up

B)body moves to a safer place

C)senses become sharper so you are better able to respond

D)stress hormones are transported around the

Answers

Answer:

C would be the nervous system reacting

If you wanted to know about the other answers:

A and D are the circulatory system since it's transporting stress hormones through the blood and the heart rate speeds up

B is the muscular and skeletal system since they are the ones that make your body move

A compound formed from a metal and a non-metal will have which type of bond?

A. Covalent

B. Hydrogen

C. Ionic

D. Atomic

Answers

it's an ionic bond

btw i love your profile picture never understand is one of my favorites

The answer is C
Ionic bond

What defines the mass number of an isotope? the sum of the neutrons and protons the sum of the neutrons and electrons the number of neutrons the number of protons

Answers

Answer:

The mass number of an isotope is the sum of neutrons and protons.

Explanation:

In any elemental isotope, the only things that will affect molar mass and mass number is the number of protons and neutrons. Electrons are not counted because we usually assume they are equal to the amount of protons and have no weight.

Protons are what gives the element its atomic number and the neutrons determine the type of isotope it is within the element.

For instance:

There can be a regular Carbon - 12

But there are isotopes like Carbon - 13 and Carbon - 14.

*The number of protons stays the same but the number of neutrons are different

A very large tank initially contains 100 L of pure water. Starting at time t=0 a solution with a salt concentration of 0.3 kg/L is added at a rate of 7 L/min. The solution is kept thoroughly mixed and is drained from the tank at a rate of 5 L/min. Answer the following questions. 1. Let y(t) be the amount of salt (in kilograms) in the tank after t minutes. What differential equation does y satisfy? Use the variable y for y(t). Answer (in kilograms per minute):
dt/dy = 2. How much salt is in the tank after 40 minutes? Answer (in kilograms):

Answers

1. The differential equation satisfied by y(t) is:  dy/dt = 0.6 kg/min

The amount of salt in the tank after t minutes can be represented by the function y(t). We need to find the differential equation that y satisfies.
Initially, the tank contains 100 L of pure water, which means there is no salt in the tank. As time passes, a solution with a salt concentration of 0.3 kg/L is added at a rate of 7 L/min. The salt concentration in the tank will increase with the addition of this solution.
At the same time, the solution is drained from the tank at a rate of 5 L/min. This will result in a decrease in the salt concentration in the tank.
To find the differential equation satisfied by y(t), we need to consider the rate of change of salt in the tank.
Rate of change of salt in the tank = Rate of salt added - Rate of salt drained
The rate of salt added is given by the product of the concentration of the solution (0.3 kg/L) and the rate at which the solution is added (7 L/min). So, the rate of salt added = 0.3 kg/L * 7 L/min.

The rate of salt drained is given by the product of the concentration of the solution (0.3 kg/L) and the rate at which the solution is drained (5 L/min). So, the rate of salt drained = 0.3 kg/L * 5 L/min.

Therefore, the differential equation satisfied by y(t) is:
dy/dt = (0.3 kg/L * 7 L/min) - (0.3 kg/L * 5 L/min)

Simplifying the equation:
dy/dt = 2.1 kg/min - 1.5 kg/min
dy/dt = 0.6 kg/min

So, the differential equation satisfied by y(t) is:
dy/dt = 0.6 kg/min

2. The amount of salt in the tank after 40 minutes is 24 kilograms.

To find the amount of salt in the tank after 40 minutes, we can solve the differential equation.

dy/dt = 0.6 kg/min

Integrating both sides with respect to t:
∫dy = ∫0.6 dt

Integrating, we get:
y = 0.6t + C

To find the value of C, we can use the initial condition that the tank initially contains 100 L of pure water, which means there is no salt. So, at t = 0, y = 0.

Substituting these values into the equation:
0 = 0.6(0) + C
C = 0

Therefore, the equation becomes:
y = 0.6t

Now, we can find the amount of salt in the tank after 40 minutes by substituting t = 40 into the equation:
y = 0.6(40)
y = 24 kg


Learn more about differential equations from the given link:

https://brainly.com/question/1164377

#SPJ11

Why do electrons falling into different orbits give off characteristics wavelengths?​

Answers

Explanation:

Because the difference in energy between orbits is different in different types of atoms, moving electrons between different orbits requires photons carrying different amounts of energy (different wavelengths).

What causes the periodic (recurring)
patterns seen in the periodic table?

Answers

Valence elections, electron affinity, electronegativity, atomic radius

A chipmunk (mass of approximately 1 kg) does push-ups by using a force of 5 N to elevate its center-of-mass by 6 cm in order to do 0.70 Joule of work. If the chipmunk does all this work in 2 seconds, what is its power?

Answers

Answer:

Approximately \(0.35\; \rm W\) on average.

Explanation:

There are multiple to find power:

Power \(P\) is equal to the product of force \(F\) and the speed \(v\) at which that force moves the object. That is: \(P = F \cdot v\).On the other hand, average power \(P\) is also equal to the rate at which work \(W\) is done. In other words, average power \(P\!\) is the average work done in unit time. If work \(W\!\) is done in time \(t\), the average power would be \(P = W / t\).  

The question did not state the speed at which the arm of the chipmunk moves. However, the question did state the work done (\(W = 0.70\; \rm J\)) and the time required (\(t = 2\; \rm s\)).

Therefore, the equation \(P = W / t\) seem to be more suitable.

\(\begin{aligned}&P\\ &= \frac{W}{t} \\ &= \frac{0.70\; \rm J}{2\; \rm s} \approx 0.35\; \rm W\end{aligned}\).

Which type of soil do you think will result in the tallest plants with the most mass? HURRY PLEASE. NO EXPLANATION NEEDED

Answers

Answer:

The best soil for most plants to ensure optimum growth is a rich, sandy loam.

Wk-14
Date
Page
Assignment
1. Calculate the percentage of iron in K3 Fe (CN)
[K= 39, Fe =56, C= 12, N =14]

Answers

Answer:

The mass percentage of iron in \(\rm K_3[Fe(CN)_6]\)  (potassium ferricyanide) is approximately \(17\%\).

Explanation:

Start by finding the formula mass of potassium ferricyanide, \(\rm K_3[Fe(CN)_6]\), using relative atomic mass data from the question:

\(\begin{aligned} & M(\mathrm{K_3[Fe(CN)_6]}) \\ &\approx 3 \times 39 + 56 + 6 \times (12 + 14) \\ &= \rm 329 \; g \cdot mol^{-1}\end{aligned}\).

In other words, every one mole of \(\rm K_3[Fe(CN)_6]\) formula units have a mass of approximately \(329\; \rm g\).

On the other hand, note that there is one iron \(\rm Fe\) atom in every one mole of \(\rm K_3[Fe(CN)_6]\) formula units. Hence, there would be exactly one mole of iron atoms in every one mole of \(\rm K_3[Fe(CN)_6]\) formula units. The mass of that one mole of iron atoms is approximately \(56\; \rm g\) (again, from the relative atomic mass data of the question.)

Therefore:

\(\begin{aligned}& \text{Mass percentage of $\mathrm{Fe}$ in $\mathrm{K_3[Fe(CN)_6]}$} \\ &= \frac{\text{Mass of $\mathrm{Fe}$ in one mole of $\mathrm{K_3[Fe(CN)_6]}$ formula units}}{\text{Mass of one mole of $\mathrm{K_3[Fe(CN)_6]}$ formula units}}\times 100\% \\ &= \frac{M(\mathrm{Fe}) \times (\text{Number of $\mathrm{Fe}$ atoms in each $\mathrm{K_3[Fe(CN)_6]}$ formula unit)}}{M(\mathrm{K_3[Fe(CN)_6]})} \times 100\%\end{aligned}\)

\(\begin{aligned}&\approx \frac{1 \times 56\; \rm g \cdot mol^{-1}}{329\; \rm g \cdot mol^{-1}}\end{aligned}\).

the partial pressures of ch4, n2, and o2 in a sample of gas were found to be 155 mmhg, 476 mmhg, and 669 mmhg, respectively. what is the mole fraction of nitrogen?

Answers

The mole fraction of nitrogen in the gas sample is 0.119 or approximately 11.9%. To find the mole fraction of nitrogen, we first need to calculate the total pressure of the gas sample. This can be done by adding the partial pressures of each gas:

155 mmHg + 476 mmHg + 669 mmHg = 1300 mmHg

Now we can use Dalton's Law of Partial Pressures to calculate the mole fraction of nitrogen. This law states that the total pressure of a gas mixture is equal to the sum of the partial pressures of each gas in the mixture. The mole fraction of a gas is equal to its partial pressure divided by the total pressure of the mixture.

The partial pressure of nitrogen is the pressure of the gas sample minus the partial pressures of CH₄ and O₂:
476 mmHg + 669 mmHg = 1145 mmHg
1300 mmHg - 1145 mmHg = 155 mmHg

The mole fraction of nitrogen is then:
Mole fraction of nitrogen = 155 mmHg / 1300 mmHg = 0.119

Therefore, the mole fraction of nitrogen in the gas sample is 0.119 or approximately 11.9%.

Learn more about mole fraction here:

https://brainly.com/question/29808190

#SPJ11

Label each of the following substances as an acid, base, salt, or none of the above. Indicate whether the substance exists in aqueous solution entirely in molecular form, entirely as ions, or as a mixture of molecules and ions. A) HF, B) acetonitrile (CH,CN), C) NaCIO D) Ba(OH)

Answers

The substances hydrogen fluoride (HF) is an acid, Acetonitrile (CH₃CN) is not an acid, base, or salt, sodium hypochlorite (NaClO) will be a salt, and barium hydroxide (Ba(OH)₂) is a base.

HF; Acid

Exists in aqueous solution as a mixture of molecules and ions (partially dissociates into H⁺ and F⁻ ions). HF is a weak acid and undergoes partial ionization in water.

Acetonitrile (CH₃CN); None of the above (not an acid, base, or salt)

Exists in aqueous solution entirely in molecular form (does not ionize in water). Acetonitrile is a polar organic solvent commonly used in various chemical reactions and extractions.

NaClO; Salt

Exists in aqueous solution entirely as ions (completely dissociates into Na⁺ and ClO⁻ ions). NaClO, also known as sodium hypochlorite, is commonly used as a disinfectant and bleaching agent.

Ba(OH)₂; Base

Exists in aqueous solution entirely as ions (completely dissociates into Ba²⁺ and OH⁻ ions). Ba(OH)₂ is a strong base that completely ionizes in water. It is commonly used in various applications, including as a reagent and in the production of ceramics.

To know more about acid here

https://brainly.com/question/1512259

#SPJ4

What is the volume of a book that is 22.0 cm tall, 13 cm wide, and 3.2 cm thick? Use sig figs and correct units


1. 915.2 cm

2. 920 cm

3. 920 cm^3

4. 915 cm^3

Answers

Answer:

4. 915 cm^3

Explanation:

Length = 22.0cm

Breadth = 13 cm

Thickness = 3.2 cm

Volume = Length * Breadth * Thickness

Volume =  22 * 13 * 3.2

Volume = 915.2 cm^3

Volume = 915cm^3. The correct option is option 4.

A peach falls from a tree with an acceleration of 9.8 m/s2. The peach has a mass of
7.4 g. How much force acts on the peach? (Hint: Convert g to kg)

Answers

Answer:

F = 0.0725 N

Explanation:

Given that,

The mass of peach, m = 7.4 g

We need to find the force acts on the peach when it falls from a tree. The force is given by :

F = mg

So,

\(F=7.4\times 10^{-3}\times 9.8\\\\F=0.0725\ N\)

So, the force is 0.0725 N.

a 23.6 ml solution of 0.150 m ch3cooh (aq) is titrated with 0.25 m naoh. how many ml of naoh are needed to reach the half-equivalence point for this titration? express your answer in units of milliliters (ml) using at least three significant figures.

Answers

The amount naoh in ml required to reach the half-equivalence point for this titration is calculated to be 7.08 ml.

The half-equivalence point of a titration is reached when half of the acid has reacted with the base. At this point, the moles of acid and base are equal, and we can use this information to calculate the volume of base needed to reach the half-equivalence point.

First, we can calculate the number of moles of acetic acid present in the solution:

moles of CH3COOH = concentration x volume

moles of CH3COOH = 0.150 mol/L x 0.0236 L

moles of CH3COOH = 0.00354 mol

At the half-equivalence point, half of the acetic acid will have reacted, so the number of moles of acetic acid remaining will be:

moles of CH3COOH remaining = 0.00354 mol / 2

moles of CH3COOH remaining = 0.00177 mol

Since the reaction between acetic acid and sodium hydroxide is 1:1, we will need an equal number of moles of sodium hydroxide to react with the remaining acetic acid:

moles of NaOH needed = 0.00177 mol

Finally, we can use the concentration of sodium hydroxide to calculate the volume needed to provide this many moles:

volume of NaOH = moles of NaOH / concentration of NaOH

volume of NaOH = 0.00177 mol / 0.25 mol/L

volume of NaOH = 0.00708 L

volume of NaOH = 7.08 mL

Therefore, the volume of NaOH needed to reach the half-equivalence point is 7.08 mL.

Learn more about Titration and Moles :

https://brainly.com/question/31229711

#SPJ4

Which of the following correctly matches the chemical formula with the name of the compound? Select all that apply.
a. K3NK3N, potassium nitride
b. SO2SO2, sulfur dioxide
c. Cl2OCl2O, chlorine(II) oxide
d. MgOMgO, monomagnesium monoxide
e. Fe2(SO4)3Fe2(SO4)3 (iron has variable charges), iron(III) sulfate

Answers

Every chemical formula has a name. In a perfect world, this name would describe the compound's characteristics as well as its makeup.

Chemical formula that correctly matches with the name of the compound

K3N, potassium nitride

SO2, sulfur dioxide

Fe2(SO4)3, iron(III) sulfate

These names are based on a set of IUPAC standards and are referred to as systematic names. Although every chemical has a scientific name, many compounds also have popular names.

But where do the names of chemical substances come from?

Ionic compound names:

Chemical formula known as ionic compounds have ionic bonds holding the constituent ions together. These are composed of negatively charged polyatomic ions and positively charged metal cations. To be classified as an ion, they must have a positive or negative charge, though.

To learn more about chemical formula name, visit

https://brainly.com/question/14289104

#SPJ13

True or false?
Cadmium is not in the mixture because the mixture does not contain a spectral line at 515nm

Answers

Answer:

true sorry if I am wrong i think it's true

What approximate volume of the oxytocin solution with the 10 mM Zn2+ additive was analyzed if 2.2 à 10â6 moles of oxytocin acetate (MW = 1067 g/mol) were recovered from the sample after 4 weeks at 50 °C?

Answers

moles = mass / molar mass We know the moles of oxytocin acetate recovered (2.2 x 10^-6 moles) and its molar mass (1067 g/mol). We need to find the mass of the oxytocin acetate in the solution, and from there we can determine the volume of the solution.

mass = moles x molar mass
mass = 2.2 x 10^-6 moles x 1067 g/mol
mass = 2.3454 x 10^-3 g

Now, we need to take into account the 10 mM Zn2+ additive. We don't know the exact concentration of the oxytocin solution, but we can assume that the 10 mM Zn2+ additive does not significantly change the volume of the solution. Therefore, we can calculate the volume of the solution using the mass of oxytocin acetate and its concentration in the original sample.Let's assume that the original sample had a concentration of 1 mM (this is just an example, the actual concentration could be different). This means that there was 1 mmol of oxytocin acetate per liter of solution. To find the volume of the solution that was analyzed, we can use the following formula:
volume = mass / (concentration x molar mass)
volume = 2.3454 x 10^-3 g / (1 x 10^-3 mol/L x 1067 g/mol)
volume = 2.3454 x 10^-6 L or 2.3454 µL
Therefore, the approximate volume of the oxytocin solution with the 10 mM Zn2+ additive that was analyzed is 2.3454 µL.

To know more about volume  please vist :-

https://brainly.com/question/15861918

#SPJ11

The approximate volume of the oxytocin solution with the 10 mM Zn²⁺ additive that was analyzed is 2.3454 µL.

moles = mass / molar mass

We know the moles of oxytocin acetate recovered (2.2 x 10⁻⁶ moles) and its molar mass (1067 g/mol).

mass = moles x molar mass

mass = 2.2 x 10⁻⁶ moles x 1067 g/mol

mass = 2.3454 x 10⁻³ g

Utilizing the mass of oxytocin acetate and its concentration in the first sample, we can determine the volume of the solution. Assume for the sake of argument that the first sample had a concentration of 1 mM (the real concentration may have been different).

This indicates that each litre of solution contained 1 mmol of oxytocin acetate. Using the following formula, we can get the volume of the solution that was examined:

volume = mass / (concentration x molar mass)

volume = 2.3454 x 10⁻³ g / (1 x 10⁻³ mol/L x 1067 g/mol)

volume = 2.3454 x 10⁻⁶ L or 2.3454 µL

Therefore, the approximate volume of the oxytocin solution with the 10 mM Zn²⁺ additive that was analyzed is 2.3454 µL.

Learn more about Volume of oxytocin:

https://brainly.com/question/28854491

#SPJ4

The metal component that is protected from corrosion is called the?
a) Cathode
b) Anode
c) Rectifier
d) Electron

Answers

The metal component that is protected from corrosion is called the option A: cathode.

Metal surfaces experience corrosion, an electrochemical process, when they come into contact with electrolytes. Corrosion is the process of converting a metal back to its original form as an ore; during this transformation, the metal disintegrates and loses structural integrity. Pipelines, structures, and ships all make use of these metal surfaces.

It is crucial to make sure that these metals endure as long as possible, which calls for cathode protection. Cathode is a metal rod placed in an electrolyte where oxidation takes place so that it loses electrons in the electrolyte and get oxidized. Zinc metal is generally used as a cathode electrode.

To know more about corrosion, refer:

https://brainly.com/question/29854677

#SPJ4

ice added to a hot soup for the purpose must be made from what type of water

Answers

When adding ice to a hot soup, it is generally recommended to use ice made from potable or drinkable water.

The water used to make the ice should be clean and free from any contaminants that could affect the taste or safety of the soup.

It is advisable to use filtered or purify water to make the ice to ensure that it is of good quality. This helps prevent any unwanted flavors or impurities from transferring to the soup.

Using tap water can also be acceptable if it meets the drinking water standards in your area and is considered safe for consumption. However, if you have concerns about the quality of your tap water, using filtered water is a safer option.

Ultimately, the goal is to add ice made from water that is safe and of good quality to avoid any negative impact on the taste or safety of the soup.

To know more about purify water here

https://brainly.com/question/13704419

#SPJ4

what is a molecule? ————-

Answers

According to the context, the term may or may not include ions that meet this requirement. A molecule is a collection of two or more atoms held together by the attractive forces known as chemical bonds. 

Thus,  When speaking of polyatomic ions, the distinction between them and ions is frequently ignored in the fields of quantum physics, organic chemistry, and biochemistry.

A molecule can be heteronuclear, which is a chemical compound made up of more than one element, such as water (two hydrogen atoms and one oxygen atom; H2O), or homonuclear, which is a molecule made up of atoms of one chemical element, such as the two  molecule in the oxygen molecule (O2).

The term "molecule" is frequently used to refer to any gaseous particle, regardless of its composition, in the kinetic theory of gases.

Thus, According to the context, the term may or may not include ions that meet this requirement. A molecule is a collection of two or more atoms held together by the attractive forces known as chemical bonds. 

Learn more about Chemical bonds, refer to the link:

https://brainly.com/question/30387060

#SPJ1

The whole reason things stay afloat or sink is because water is​

Answers

Answer:

I think the density of the object determines if it floats or sinks

Other Questions
SOMEONE PLEASE ACTUALLY HELP MEEE!!!!! Write an example of the Identity Property of Addition using the number 43.Question 5 options:43 x 0 = 043 x 1 = 4343 + 0 = 4340 + 3 = 43 what quantity in moles of chlorine gas at 120.0 c and 33.3 atm would occupy a vessel of 12.0 l? Which statement best summarizes the central idea of this paragraph?It is difficult to identify Ebola in dead specimens.Performing a necropsy is a tedious procedure.Signs of simian fever and Ebola can be similar.Ebola has unusual effects on infected monkeys Bonus: Write the equation of a line in slope intercept form that isperpendicular to y=-9x+17 and contains the point (-8,4)* 1. History is the record of _____events.2. Historians ask_________ questions that begin with W. 3. ____sources are second-hand accounts of what happened. 4. ____sources might include what an eyewitness wrote in newspapers, diaries, and letters. 5. History lives in our ___ and our customs. In this standard, your writing's purpose is to (1)____ your audience to your way of thinking. Your topic should be (2)___ rather than Irivial, and the issue should have at least (3)____ sides. The main way to present your position is to develop a (4) statement which tells your reader what your thoughts are about the topic. In order to win the audience over, you need to make clear (5)____. These ideas are then supported by (6)_____ which can take the form of statistics, facts, anecdotes, expert opinion, and examples. Besides presenting your own line of reasoning, you must consider other possible The three key steps in your writing that help organize your paper are (8)____,(9)____ and analysis. (10)_____ statements in your paragraphs follow and support the case presented. 100x100x325x1773x3.44554x34444x6i78754x23324 The rectangle shown is rotated about line k. Rectangle A B C D is shown. A line of rotation goes through the midpoint of sides A B and D C to cut the side into two equal lengths of 5 inches. Side A D has a length of 4 inches.What is the approximate base area of the resulting figure?Area of a circle: A = r231 sq. in.50 sq. in.79 sq. in.314 sq. in.The rectangle shown is rotated about line k. Rectangle A B C D is shown. A line of rotation goes through the midpoint of sides A B and D C to cut the side into two equal lengths of 5 inches. Side A D has a length of 4 inches.What is the approximate base area of the resulting figure?Area of a circle: A = r231 sq. in.50 sq. in.79 sq. in.314 sq. in. You are a financial advisor with a client who purchased 100 shares of stock in a fund with a net asset value of $21. 30 and an offer price of $21. 45. Your client wants to make $20 per share on the stock when it is sold. The client calls you to find out why you have not sold the shares today, because they saw the stock listed with a net asset value of $41. 30 and an offer price of $41. 45. Explain to your client why you have not sold the shares. which of the following has greater number of hydrogen molecule ? 9 gm of CH4 or 10gm of NH3 An auto has a sticker price of $20,000. A company purchases the auto, but negotiates with the sales person and pays a price of only $18,000. What value will be reported for the auto on the balance sheet of the four steps shown below, identify which step in the accounting cycle comes first:a) Prepare a worksheetb) Post the journal entriesc) Analyze transactionsd) Record adjusting entries (11 + 40 - 3):3 + 62 Which sentence describes an approach used by good fiction writers to orient readers early in a story?Describe the sequence of important events leading to the storys climax.Tell the reader what the story will be about, in a brief summary.Introduce major characters, provide some setting details, and reveal the conflict using sensory details.Carefully describe the narrator and point of view for the story. Maturity factoring, is a type of factoring that involves the offering of A/R as security (the company still retains ownership of A/R), in order to secure a loan to help fund working capital True False In a sale, a clothes shop reduces its prices by 30%.A shirt usually costs $24.How much is it in the sale? Write the expression as oneinvolving only sin x and cos x.sin 2x + cos x A new waste truck is needed for a portion of the city. Compare the asset with the Benefit-Cost method? The interest rate is 8% Present value = $55,000 Annual cost $11,500 Annual savings $28,500 Salvage value = $6,800 Life in years = 10 O a. B/C= 1.40 Ob.B/C= 1.88 OC. B/C= 1.47 O d.B/C=0.72 unbundle a hundred to make enough tens 603 -239 ____ Family preservation, child care, and parenting skills services are examples of?