The molecule XeOF4 belongs to the point group Cav (a) (15pts)Obtain a representation based on all the motions of the atoms in XeOF4. Hint place an x,y,z coordinate systems on each atoms and have them all pointing in the same way (b) (8pts)Reduce the representation determined in part (a) to its component irreps. (c) (4pts )Classify the irreps indicating which are for translation, rotation, and vibrational motion (d) (3pts) Examine the vibrational irreps and determine if the are IR active or not. (e) (4pts) Determine the irreducible representation matching the Xe-O stretching vibration. Is this vibration expected to be active? Explain.

Answers

Answer 1

The molecule XeOF4 belongs to the point group Cav. The representation for XeOF4 is A1: x,y,z; A2: -x,-y,-z; A3: x,y,-z; A4: -x,-y,z. The irreps are E: x,y,z; -x,-y,-z; x,y,-z; -x,-y,z with E representing translation.

a) Representation for XeOF4:

A1: x,y,z

A2: -x,-y,-z

A3: x,y,-z

A4: -x,-y,z

b) Irreps:

E: x,y,z ; -x,-y,-z ; x,y,-z ; -x,-y,z

c) E: Translation

d) The vibrational irreps are IR active.

e) The irreducible representation matching the Xe-O stretching vibration is A1. This vibration is expected to be active because stretching vibrations are typically IR active.

The molecule XeOF4 belongs to the point group Cav. The representation for XeOF4 is A1: x,y,z; A2: -x,-y,-z; A3: x,y,-z; A4: -x,-y,z. The irreps are E: x,y,z; -x,-y,-z; x,y,-z; -x,-y,z with E representing translation. The vibrational irreps are IR active and the irreducible representation matching the Xe-O stretching vibration is A1, which is expected to be active because stretching vibrations are typically IR active.

The molecule XeOF4 belongs to the point group Cav, which is a point group consisting of a single C2 axis perpendicular to a threefold rotation axis. To obtain a representation based on all the motions of the atoms in XeOF4, an x,y,z coordinate systems should be placed on each atom and all of them should point in the same way. This gives us the representation A1: x,y,z; A2: -x,-y,-z; A3: x,y,-z; A4: -x,-y,z. After reducing this representation, the irreps obtained are E: x,y,z; -x,-y,-z; x,y,-z; -x,-y,z, with E representing translation. The vibrational irreps are IR active and the irreducible representation matching the Xe-O stretching vibration is A1. This vibration is expected to be active because stretching vibrations are typically IR active. This means that when the Xe-O bond in XeOF4 is stretched, it will absorb IR radiation and cause a change in the molecule's energy state.

learn more about molecule here

https://brainly.com/question/19556990

#SPJ4


Related Questions

How long it would take for drug to degrade to 15% of the initial concentration (0.1M)? k = 0.1hr-1?

Answers

It would take approximately 8.09 hours for the drug to degrade to 15% of the initial concentration.

To calculate the time it would take for the drug to degrade to 15% of the initial concentration (0.1M), we can use the first-order degradation equation:

ln([A]/[A]0) = -kt

where [A] is the concentration of the drug at time t, [A]0 is the initial concentration of the drug, k is the rate constant, and t is the time interval.

We can rearrange this equation to solve for t:

t = -(ln([A]/[A]0)) / k

Plugging in the given values, we get:

t = -(ln(0.15/1)) / 0.1 hr^-1 = 8.09 hours

to know more about first-order degradation refer here:

https://brainly.com/question/29306751#

#SPJ11

What does the VSEPR theory describe

Answers

Answer:

The shape of a molecule based on the number of electron pairs on the valence shell of its central atom

Explanation:

The improvement of the Sidgwick-Powell theory came to be known as the Valence Shell Electron Pair Repulsion theory (VSEPR). This theory approaches the determination of molecular shape from the perspective of the number of electron pairs on the valence shell of the central atom in the molecule.

Electron pairs on the valence shells of atoms leads to repulsion. Repulsion between two lone pairs is greater than repulsion between a lone pair and a bond pair which is also greater than repulsion between two bond pairs.

Lone pairs cause more repulsion, hence they distort molecules from the ideal shape predicted based on their electron domain geometry.

What types of intermolecular forces exist between HI and H2S? A) dispersion forces, dipole-dipole, and ion-dipole B) dispersion forces, hydrogen bonding, dipole-dipole, and ion-dipole C) dispersion forces, dipole-dipole, and ion-dipole D) dispersion forces and dipole-dipole E) dipole-dipole and ion-dipole

Answers

Hydrogen iodide (HI) and hydrogen sulfide (H2S) both have polar covalent bonds due to the difference in electronegativity between the atoms involved. The correct answer is D) dispersion forces and dipole-dipole.

Dispersion forces, also known as London dispersion forces or van der Waals forces, exist between all molecules. They arise from temporary fluctuations in electron distribution, resulting in temporary dipoles. These temporary dipoles induce dipoles in neighboring molecules, leading to attractive forces.

Dipole-dipole forces occur between polar molecules and result from the attraction between the positive end of one molecule and the negative end of another. Both HI and H2S have polar bonds and can exhibit dipole-dipole interactions.

Hydrogen bonding, which is a special type of dipole-dipole interaction, occurs when hydrogen is bonded to highly electronegative atoms such as nitrogen, oxygen, or fluorine. In this case, neither HI nor H2S contains a hydrogen atom bonded to such electronegative atoms. Therefore, hydrogen bonding is not present in this scenario.

Ion-dipole forces occur between an ion and the dipole of a polar molecule. In this case, neither HI nor H2S is an ion, so ion-dipole forces are not relevant.

Therefore, the correct answer is D) dispersion forces and dipole-dipole.

To know more about covalent bonds refer to-

https://brainly.com/question/19382448

#SPJ11

what is the IUPAC name to this structure?

what is the IUPAC name to this structure?

Answers

1,3-dichloro, 4-ethyl, 8-methyloctone

not sure honestly haven't seen a compound like this before.

22. A student carefully measures a certain quantity of four different substances
into trays that will be used in a laboratory exercise. Which of these trays would
contain the largest number of atoms?
Sample
Mass of tray
with sample
Water
Mass of
empty tray
37.86g
36.59g
37.418
55.88g
Table Salt (NaCl)
Copper Wire
95.03g
100.96g
245.20g
Lead Shot
38.08g

Answers

Answer:

Water

Explanation:

The substance that has the highest number of moles also has the highest number of atoms.

The number of atoms of a substance can be calculated using the Avogadro's number. This number gives the number of elementary entities such as atoms, molecules and ions in one mole of a substance.

All you need to do is to find out which substance has the highest number of moles. This substance will also have the highest number of atoms present.

Learn more about Avogadro's number: https://brainly.com/question/1445383

where is water you can feel?
plz help me

Answers

Answer:

Ocean

Explanation:

Classify the following elements into metals, non-metals and metalloids :
C, Mg, Si, S, Hg, As.

Answers

The classification of the given elements is as follows:

Metals: Mg (Magnesium), Hg (Mercury)

Non-metals: C (Carbon), S (Sulfur)

Metalloids: Si (Silicon), As (Arsenic

Elements can be classified into three main categories: metals, non-metals, and metalloids.

Metals are typically shiny, conductive, and malleable, while non-metals are generally dull, non-conductive, and brittle.

Metalloids exhibit properties that are intermediate between metals and non-metals.

Let's classify the given elements based on these characteristics.

C (Carbon) - Non-metal: Carbon is a non-metal. It is a non-conductive element that can exist in various forms, including graphite and diamond.

Mg (Magnesium) - Metal: Magnesium is a metal. It is a shiny, silver-white element that is a good conductor of electricity and heat. It is also malleable and ductile.

Si (Silicon) - Metalloid: Silicon is a metalloid. It exhibits properties of both metals and non-metals. It is a semi-conductor, which means it can conduct electricity under certain conditions but not as effectively as metals.

S (Sulfur) - Non-metal: Sulfur is a non-metal. It is a yellow, brittle element that is a poor conductor of electricity and heat.

Hg (Mercury) - Metal: Mercury is a metal. It is the only metal that is liquid at room temperature. It is a good conductor of electricity and has a shiny appearance.

As (Arsenic) - Metalloid: Arsenic is a metalloid. It has properties that are intermediate between metals and non-metals. It can conduct electricity under certain conditions but is not as effective as metals.

In conclusion, the classification of the given elements is as follows:

Metals: Mg (Magnesium), Hg (Mercury)

Non-metals: C (Carbon), S (Sulfur)

Metalloids: Si (Silicon), As (Arsenic)

To know more about  elements visit:

https://brainly.com/question/28851779

#SPJ11

How does the amount of lime needed to neutralize the residual acidity in a clay loam soil compare to that needed to neutralize the active acidity in that soil

Answers

Answer:

Residuals Requires 5,000 times greater

3. Which hereditary disease results in difficulties with breathing and with digesting food?
muscular dystrophy
hemophilia
O
Down syndrome
cystic fibrosis

Answers

Answer:

cystic fibrosis

Explanation:

The cells that make mucus, perspiration, and digestive fluids are impacted by cystic fibrosis. These fluids start to thicken and cling together as a result. They then block off all of the tubes, ducts, and passages.

Select any and all of these molecules that have at least one chiral carbon atom. Group of answer choices 3,4-dimethylhexane 3,3-dimethylpentane CH3CH2CH(OH)CH3 CH3CH2CH(CH3)CH2CH2CH3 CH3C(CH3)2CH(CH2CH3)C(CH3)3

Answers

Answer:

3,4-dimethylhexane, CH3CH2CH(OH)CH3, CH3CH2CH(CH3)CH2CH2CH3

Explanation:

A chiral carbon atom is also referred to as a asymmetric carbon atom. This is a carbon atom that is bonded to four different substituents.

So what we need to do is to look at each compound and consider all the carbon atoms in each compound. Drawing out the full structural formula is very helpful here.

After drawing each structure out, we now look out for carbon atoms that have four dissimilar substituents. Those are the chiral carbons. If we do so for all the molecules listed in the answer, we will discover that each of them contains an asymmetric carbon atom.

How does your model explain why the distribution of water-storage traits changed over time?

Answers

The distribution of water-storage traits changed over time.

The distribution of water-storage traits can change over time due to a combination of genetic and environmental factors. Environmental factors such as climate change, availability of water, and changes in the amount of sunlight can all influence the selection pressures on different water-storage traits. As these environmental factors change, certain water-storage traits may become more advantageous than others, leading to changes in their distribution within the population.

Genetic factors such as mutations, genetic drift, and gene flow can also play a role in changing the distribution of water-storage traits over time. Mutations can introduce new alleles that code for different water-storage traits, which may be more or less advantageous in certain environmental conditions. Genetic drift, which refers to random changes in allele frequencies due to chance events, can also lead to changes in the distribution of water-storage traits over time. Gene flow, which refers to the movement of alleles between populations due to migration, can also introduce new alleles and alter the distribution of water-storage traits.

Over time, the combination of these genetic and environmental factors can lead to changes in the distribution of water-storage traits within a population. For example, in a dry environment, individuals with larger water-storage organs may be more likely to survive and reproduce, leading to an increase in the frequency of this trait within the population. Conversely, in a wet environment, individuals with smaller water-storage organs may be more likely to survive and reproduce, leading to an increase in the frequency of this trait within the population.

Hence, the distribution of water-storage traits is shaped by a complex interplay of genetic and environmental factors, and changes in this distribution over time reflect the dynamic nature of these interactions.

To know more about water-storage here

https://brainly.com/question/31184311

#SPJ1

Which particle makes the atom an unstable isotope (make sure to check the box at the bottom that says stable/unstable)

Answers

The particle that makes the atom an unstable isotope is the neutron. When there is an excess or a deficiency of neutrons in an atom's nucleus, it becomes an unstable isotope.

Unstable isotopes are isotopes that decay and emit radiation until they reach a stable state. They are also known as radioactive isotopes. The radioactive isotopes are unstable and have an unpredictable lifespan because they have an unstable ratio of neutrons to protons. This excess of neutrons in the nucleus results in a greater electrostatic repulsion between protons, causing instability and eventually decay.Neutrons are the particles that are responsible for making atoms unstable isotopes. The excess or deficiency of neutrons in an atom's nucleus leads to an unstable state and eventually decay. Radioactive isotopes are important for various practical applications such as nuclear power, radiography, and cancer treatment.

Therefore, neutrons makes the atom an unstable isotope. The decay of unstable isotopes can be used for many practical applications such as nuclear power, radiography, and cancer treatment.

To know more about isotope click:

brainly.com/question/27475737

#SPJ11

Given the following equation,
HCl aq) + NaOH aq
NaClaq) + H2O(l)
How many moles of H20 will be produced if there are 5 moles of HCI?​

Answers

Answer:

5 moles

Explanation:

Given data:

Number of moles of HCl = 5 mol

Number of moles of H₂O produced = ?

Solution:

Chemical equation:

HCl + NaOH     →   NaCl + H₂O

Now we will compare the moles of HCl with H₂O.

                          HCl            :           H₂O

                             1               :             1

                             5               :            5

5 moles of water will be produced.

The energy state of an atom is given by four quantum numbers: n I mi m, . Which of the following is not a valid set of quantum numbers? O 321+½ O 311-ya O 310+½ О 331-½

Answers

The four quantum numbers describe the energy state of an atom. The set of quantum numbers that is not valid is 3 3 1 -½.

The principal quantum number (n) indicates the energy level of the electron and can have integer values greater than zero. The orbital angular momentum quantum number (l) indicates the shape of the orbital and can have integer values from 0 to n-1. The magnetic quantum number (ml) indicates the orientation of the orbital and can have integer values from -l to +l. The spin quantum number (ms) indicates the direction of spin of the electron and can have values of +1/2 or -1/2.
Out of the given sets, the set 3 3 1 -½ is not valid because the absolute value of the magnetic quantum number (ml) must be less than or equal to the orbital angular momentum quantum number (l). In this case, |ml| is greater than l, which violates this rule.

Therefore, this set of quantum numbers is not possible for an electron in an atom.

Learn more about quantum numbers here:

https://brainly.com/question/16746749

#SPJ11

In which of the following processes do the molecules become more orderly? Olemonade mix dissolving in water water freezing O ice melting O dry ice subliming O rubbing alcohol evaporating

Answers

The following processes in which the molecules become more orderly is:

b) water freezing.

In water freezing, the molecules transition from a liquid state to a solid state as the temperature decreases. As the temperature drops below the freezing point, the water molecules arrange themselves in a more ordered and structured manner, forming a solid crystal lattice. The molecules align themselves in a specific pattern, with fixed positions and regular spacing between them.

In contrast, the other options involve processes where the molecules become less orderly:

a) Lemonade mix dissolving in water: When the lemonade mix dissolves in water, the molecules of the mix disperse throughout the water, creating a homogeneous solution. The molecules become more randomly distributed, rather than ordered.

c) Ice melting: Ice melting occurs when the temperature increases, causing the solid ice to transition into liquid water. The molecules gain enough energy to break free from their fixed positions in the crystal lattice, resulting in a more disordered arrangement.

d) Dry ice subliming: Dry ice, which is solid carbon dioxide, sublimes when it is exposed to warmer temperatures. Instead of melting into a liquid, dry ice directly converts from a solid to a gas. The molecules rapidly escape the solid state and disperse as a gas, leading to a more chaotic arrangement.

e) Rubbing alcohol evaporating: Evaporation of rubbing alcohol involves the liquid molecules gaining enough energy to transition into a gas phase. As the molecules gain energy, they escape the liquid surface and disperse as a gas. The process of evaporation does not involve an increase in orderliness.

To know more about water freezing here

https://brainly.com/question/4954490

#SPJ4

PLEASE HELP ME 40 POINTS RIGHT ANSWERS ONLY!!!!! :)
Consider the solubility curve at right. which solid material is a solid solute?

PLEASE HELP ME 40 POINTS RIGHT ANSWERS ONLY!!!!! :)Consider the solubility curve at right. which solid

Answers

Substance C is a solid solute according to the solubility curve. So option B is correct.

Solubility is the maximum solubility that a solute can have in a 100 g solvent at a specific temperature. Solubility curves are plots of the temperature and the solubility value of a specific solute.

The curve of solubility is a curved line on a graph that indicates the relationship between temperature and solubility for a given substance at different temperatures. The graph of the relationship of solubility to temperature is called the Solubility curve. Most solubility curves are sigmoidal, meaning that the peak solubility occurs at the inflection point.

To learn more about the solubility curve, refer to the link:

https://brainly.com/question/9824349

#SPJ1

What is the volume of 1.8 moles of O2?

Answers

Answer:

33.6 i think

Explanation:

33.6 is the correct answer

Which balances the equation Mg + O2
Mgo?
O Mg + 202 - 4MgO
O 2Mg + 202 - 2MgO
O 2Mg + O2 - 2MgO
O 2Mg + 202 4MgO

Answers

The answer is C.
It’s this answer because if you add Mg and O2 the 2 would go at beginning of Mg. And then you would add the 2 to MgO

The balanced equation obeys the law of conservation of mass. Here among the given options, the balanced equation is 2Mg + O₂ → 2MgO. The correct option is C.

What is a balanced equation?

A chemical equation in which the number of atoms of reactants and products on both sides of the equation are equal is defined as the balanced chemical equation. The amount of reactants and products on the both sides of the equation are equal.

The numbers which are used to balance the chemical equation are called the co-efficient. The coefficient is added in front of the formula. Since it obeys the law of conservation of mass, mass can neither be created nor be destroyed.

Here the balanced equation is:

2Mg + O₂ → 2MgO

The number of 'Mg' and 'O' atoms on both sides of the equation are equal. So it is a balanced equation.

Thus the correct option is C.

To know more about balanced equation, visit;

https://brainly.com/question/15052184

#SPJ7

When scientists obtain new information, what happens to an existing scientific theory?
It is revised
It is reevaluated
It becomes a law
It remains the same

Answers

Answer:

It is reevaluated

Explanation:

Because of this new evidence, the theory can change, so the scientists must reevaluate the theory

A sample of an unknown compound is vaporized at 170, "C. The gas produced has a volume of 1140 ml at a pressure of 1.00 atm, and it weighs 1.07. Assuming the gas behaves as an ideal gas under these conditions, calculate the molar mass of the compound. Be sure your answer has the correct number of significant digits.

Answers

The molar mass of the compound is 58.9 g/mol.

The ideal gas law equation can be used to solve for the molar mass of the compound. First, convert the temperature to Kelvin by adding 273.15. Next, use the ideal gas law equation PV = nRT to solve for the number of moles of gas present. Rearranging the equation to solve for n, we get n = PV/RT. Plug in the given values and solve for n. Once we have the number of moles, we can use the formula molar mass = mass/moles to calculate the molar mass. Convert the given mass to grams and plug in the calculated number of moles to solve for the molar mass. The answer should be rounded to 3 significant figures, giving us a molar mass of 58.9 g/mol.

A compound's molar mass indicates the mass of one mole of that substance. To put it another way, it tells you how many grams a mole of a compound has. The units for molar mass are, consequently, grams/mole.

know more about molar mass of the compound, here:

https://brainly.com/question/14444241

#SPJ11

Give me a sentence of hypothesis

Answers

Answer:a supposition or proposed explanation made on the basis of limited evidence as a starting point for further investigation.

Explanation: Do you mean definition, because if you do here is the definition of a hypothesis, also it would help if you went into further detail of what the hypothesis is for.

(b) Which of the following molecules can form hydrogen bonds with other molecules of the same kind: CH3F, CH3NH2, CH3OH, CH3Br?

Answers

CH₃NH₂ and CH₃OH can form hydrogen bonds with other molecules of the same kind.

Hydrogen bonding occurs when there is a significant electronegativity difference between hydrogen and a more electronegative element such as nitrogen, oxygen, or fluorine. In CH₃F, hydrogen is bonded to fluorine, but the carbon-fluorine bond prevents the formation of hydrogen bonds.

CH₃NH₂ has a hydrogen-nitrogen bond, allowing hydrogen bonding to occur. CH₃OH has a hydrogen-oxygen bond, also allowing hydrogen bonding to take place. In CH₃Br, hydrogen is bonded to carbon, and bromine is not electronegative enough to enable hydrogen bonding. Therefore, only CH₃NH₂ and CH₃OH can form hydrogen bonds with molecules of the same kind.

Learn more about hydrogen bonding here:

https://brainly.com/question/30885458

#SPJ11

Mention any three ways of making salt. (please help me Asap)​

Answers

Solar Evaporation Method. This is the oldest method of salt production. ...
Rock Salt Mining Method. Morton also uses the second oldest method of producing salt – underground mining. ...
Vacuum Evaporation Method.

6 NH4Cl
How many hydrogen atoms are shown?

Answers

Answer:

24

Explanation:

6*4=24

1) Escribe oraciones coherentes que incluyan los siguientes términos con los conceptos correspondientes:

CARBÓN-PETRÓLEO-GAS NATURAL-RECURSO NO RENOVABLE-

COMBUSTIBLES FÓSILES-HIDROCARBUROS-RESERVAS-CONTAMINACIÓN-

MAREAS NEGRAS

Answers

La respuesta correcta para esta pregunta abierta es la siguiente.

Estas son las oraciones apropiadas.

El carbón, el petróleo, y el gas natural son recursos naturales no renovables.

Estos generadores naturales de energía son considerados combustibles  fósiles que produce la mayor parte de hidrocarburos que se usan en el mundo. Sin embargo, estas reservas energéticas se están agotando porque son recursos naturales no renovables. Además, estos combustibles son altos generadores de contaminación como es el caso de las mareas negras.

Independientemente de estas ideas, es apropiado decir que los combustibles fósiles han sido fuertemente cuestionados por los ambientalistas y los científicos porque son causantes del llamado calentamiento global y del cambio climático.

Por esa razón, la sociedad y los expertos ambientalistas están pidiendo que los gobiernos comiencen a utilizar más energías alternativas y renovables como la energía solar y las turbinas de viento o energía eólica.

Express the ratio 1:
\(1 \frac{1 }{8} \)
in its simplest form.​

Answers

Explanation:

To out this fraction in its simplest form, you need to multiply the 8 by the 1 and then add the 1 in the numerator.

You end up getting

\( \frac{9}{8} \)

Answer:

\( \frac{9}{8} \)

A student suggests that the colorless liquid collected in the U‐tube is water.
Describe how to test the colorless liquid to show it contains water.

A student suggests that the colorless liquid collected in the Utube is water.Describe how to test the

Answers

Answer:

How would you confirm that a colourless liquid given to you is pure water? A very easy solution is to take a sample of the colourless liquid and put it on the stove if it starts boiling exactly at 100 ºC then it is pure water. Any other colourless liquid such as vinegar always has a different boiling point.

if 67.9 ml of lead(ii) nitrate solution reacts completely with excess sodium iodide solution to yield 0.699 g of precipitate, what is the molarity of lead(ii) ion in the original solution?

Answers

The molarity of lead(II) ion in the original solution is 0.0112 M.

The balanced chemical equation for the reaction between lead(II) nitrate and sodium iodide is:

Pb(NO3)2 + 2 NaI → PbI2 + 2 NaNO3

From this equation, we can see that 1 mole of lead(II) nitrate reacts with 2 moles of sodium iodide to produce 1 mole of lead(II) iodide precipitate.

First, let's calculate the number of moles of lead(II) iodide precipitate formed in the reaction:

mass of PbI2 = 0.699 g

The molar mass of PbI2 is 461.01 g/mol, so the number of moles of PbI2 formed is:

moles of PbI2 = 0.699 g ÷ 461.01 g/mol = 0.001515 mol

Since the reaction is between lead(II) nitrate and sodium iodide, the number of moles of lead(II) nitrate present in the solution can be calculated using the stoichiometry of the balanced chemical equation:

moles of Pb(NO3)2 = 1/2 × moles of PbI2 = 0.0007575 mol

Now, we can calculate the molarity of lead(II) ion in the original solution using the volume of the lead(II) nitrate solution:

volume of Pb(NO3)2 solution = 67.9 mL = 0.0679 L

Molarity of Pb2+ = moles of Pb(NO3)2 / volume of Pb(NO3)2 solution

Molarity of Pb2+ = 0.0007575 mol / 0.0679 L = 0.0112 M

Therefore, the molarity of lead(II) ion in the original solution is 0.0112 M.

To know more about Molarity:

https://brainly.com/question/9558971

#SPJ4

What is a double bond

Answers

Answer:

a chemical bond in which two pairs of electrons are shared by two atoms and a molecule. Examples of compounds with double bonds include oxygen gas, carbon dioxide, acetone, and ozone

a chemical bond in which two pairs of electrons are shared between two atoms.

Consider the following chemical reaction of bromothymol blue indicator. It appears yellow in undissociated form and blue in its dissociated aqueous solution. HC2H3O2(aq) Double headed arrow. H (aq) C2H3O2–(aq) yellow blue What will be the color of the solution if a large amount of H2CO3 is added? The solution will remain yellow. The solution will turn blue. The solution will turn pink. The solution will turn green.

Answers

The addition of hydrogen carbonate to bromothymol blue turns the solution blue. Thus, option B is correct.

The balanced equation for the dissociation of bromothymol blue is:

\(\rm HC_2H_3O_2\;\leftrightharpoons H^+\;+\;C_2H_3O_2^-\)

The color of dissociated form is yellow and undissociated form is blue.

What is the final color of solution?

The addition of hydrogen carbonate results in the dissociated ions as:

\(\rm H_2CO_3\;\rightarrow\;2\;H^+\;+\;CO_3^-\)

The dissociation results in the increased hydrogen ion concentration. The undissociated form in the reaction mixture increases.

Thus, the color of the solution will turn blue. Hence, option B is correct.

Learn more about bromothymol blue, here:

https://brainly.com/question/24319054

Answer:

A. The solution will remain yellow.

Explanation:

Correct on Edge 2022!!!

Good luck everyone, you got this! Have a great day!

Other Questions
On February 10, an owner took out a $10,000 mortgage on her land with a bank. On February 15, the owner conveyed the land for $50,000 to a buyer who was not aware of the mortgage. On February 17, the bank recorded its mortgage interest in the land. On February 21, the buyer recorded his deed to the land.Does the buyer hold the land subject to the bank's mortgage?response - incorrectA Yes, in a race-notice jurisdiction.B Yes, regardless of the type of recording statute.C No, in a race-notice jurisdiction.D No, because the buyer was a bona fide purchaser for value who bought the land before the bank recorded its mortgage. Whats this correct answer for this question Which of the following statements highlights the idea that mental illness can be socially constructed?group of answer choicesO mental illness is clearly definable using the latest dsm produced by the american psychiatric association.O an individual can determine for themselves if they have a mental illness.O the meanings and definitions of mental illness vary over time and place.O an individual with a mental illness may not show external signs Which of the following statements best describes the accelerator effect? An______ is filled out for each breakdown or equipment problem immediately after the problem is solved Find the value of x. (Hint: The sum of the angle measures of a quadrilateral is 360degrees .) Please help! the first state to pass licensure for counselors in the 1970s was Alexis de Tocqueville on self interest What are some reasons that child labor was used? a 1.500 g mixture of caco3 and cao is heated. what was the mass percentage of caco3 in the mixture if the mass after heating is 1.103g How does a lithium cation compare to a lithium atom?The cation is larger.The cation has the same radius.The cation is smaller.The cation has the same charge. 1. Allen had 12 goals on the season. If heplayed in 8 games, how many goals didhe average per game? Round your answerto the nearest hundredth.A. 0.67B. 1.5C. 2.3D. 3.2WILL MARK Brainlyest Which of these is a common risk factor for heart disease?A) Having low blood pressureB) Being overweightC) Exercising regularlyD) Having a balanced diet A net torque of magnitude 600 Nm is ex-erted on the rotor of an electric generator for31 s.What is the magnitude of the angular mo-mentum of the rotor at the end of 31 s if itwas initially at rest?Answer in units of kg m/s.2 a. What is an Organization Structure? Discuss its role and importance for a new venture? b. Compare and Contrast between Organic growth and Inorganic growth for a business organization. Suppose there are 28,200,000 small businesses in the economy today. Twenty-five percent of those businesses have no employees. What is the number of businesses in the economy with no employees? beth operates a plumbing firm. in august of last year, she signed a contract to provide plumbing services for a renovation. beth began the work that august and finished the work in december of last year. however, beth didn't bill the client until january of this year, and she didn't receive the payment until march when she received payment in full. when should beth recognize income under the accrual method of accounting? Put the following equation of a line into slope-intercept form, simplifying all fractions. in 2015, the nation of burundi had an average bandwidth per internet connection of 11.24 kb/s. in 2016, their average bandwidth was 6.91 kb/s.which statement is true based on those statistics?choose 1 answer: in hughes v. oklahoma, the supreme court applied which test regarding the constitutionality of a state law prohibiting the export of minnows?