The half-life of phosphorus−33 is 25.0 days. How much of a 2.7−oz sample of phosphorus−33 will remain after 150 days?

Answers

Answer 1

If phosphorus-33 have an half-life of 25 days the amount of phosphorus-33 that will remain after 150 days is 0.042 oz.

What is half-life?

Half-life is the time taken for half the sample of a radioactive substance to decay.

To calculate the amount of phosphorus-33 that will remain after 150 days, we use the formula below.

Formula:

R' = R/\(2^{T/t}\)........ Equation 1

Where:

R = Original amount of phosphorus-33R' = Amount of phosphorus-33 that will remain after 150  daysT = Total timet = half-life

From the question,

Given:

R = 2.7 ozT = 150 dayst = 25 days

Substitute these values into equation 1

R' = 2.7/(\(2^{150/25\))R' = 2.7/\(2^{6}\)R' = 2.7/64R' = 0.042 oz

Hence the amount of phosphorus-33 that will remain after 150 days is 0.042 oz.

Learn more about half-life here: https://brainly.com/question/25750315

#SPJ1


Related Questions

6. Which layer of the earth is solid because of pressure?

Answers

Answer:

the answer is inner core

Explanation:

The inner core is solid, the outer core is liquid, and the mantle is solid/plastic. This is due to the relative melting points of the different layers (nickel–iron core, silicate crust and mantle) and the increase in temperature and pressure as depth increases

What is epoxy?
....................

Answers

A clear chemical compound.

Answer:

1. any class of adhesives, plastics, or other materials that are polymers of epoxies.

2. something like glue or resin

Explanation:

that's the dictionary definition of epoxy.

Given that the initial rate constant is 0.0120s−1
at an initial temperature of 29 ∘C
, what would the rate constant be at a temperature of 160. ∘C
for the same reaction described in Part A?

Answers

The rate constant at a temperature of 160°C for the same reaction described at an initial temperature of 29°C would be 2.26 s⁻¹.

To determine the rate constant at a temperature of 160°C for the same reaction described at an initial temperature of 29°C, we can use the Arrhenius equation:

k2 = Ae^(-Ea/RT2)

where k2 is the rate constant at temperature T2, Ea is the activation energy of the reaction, R is the gas constant, T2 is the final temperature (in Kelvin), and A is the pre-exponential factor.

First, we need to convert the initial temperature of 29°C to Kelvin:

T1 = 29°C + 273.15 = 302.15 K

Assuming the activation energy remains constant, we can solve for k2 using the following equation:

ln(k2/k1) = (-Ea/R) x (1/T2 - 1/T1)

where k1 is the initial rate constant at temperature T1.

Plugging in the given values, we get:

ln(k2/0.0120s⁻¹) = (-Ea/8.314 J/mol·K) x (1/433K - 1/302.15K)

Solving for k2, we get:

k2 = 2.26 s⁻¹

As a result, the rate constant at 160°C for the identical reaction given at 29°C as a beginning temperature would be 2.26 s⁻¹.

To know more about the Reaction, here

https://brainly.com/question/14931215

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

1. You have samples of 3 different dandelion poisons. They cost $10 a gallon, $20 a gallon and $30 a gallon respectively. You would like to determine which one is the most effective. State your hypothesis, design an experiment, and state a result that would support your hypothesis. (1 point)

Answers

The most effective poison is the poison that cost $30 per gallon.

Procedure to determine the sample that is most effective

i) Hypothesis : Most expensive poison is the most effective

ii) Experiment :

Plant 12 dandelions under similar conditions which are :

same soil same temperature water light

Divide the 12 Dandelions into four (4) different groups labelled ;

A B CD

Apply the most expensive ( $30 ) poison to group A

Apply the second most expensive ( $20 ) poison to group B

Apply $10 poison to group C

Keep group D under natural conditions

iii) Result

The Dandelions grouped in Group A will die off faster than the plants grouped in other groups. which makes the poisons that cost $30 to be most effective.

Hence we can conclude that the most effective poison is the one that cost $30 per gallon.

Learn more about Dandelion : https://brainly.com/question/878684

Why sunlight is an essential source of life sustenance on Earth ?​

Answers

Answer:

The sun is important to Earth because it helps regulate the climate, is the main source of energy for producers in the ecosystems and it keeps the oceans from freezing, along with providing light. If just one of these factors changed dramatically, it would impact all life on Earth. Without the sun, the planet’s oceans would freeze, temperatures would drop and all life would die off without light or food.

The sun is important to every single aspect of life on the planet. Human life could not exist without it because it would cause all of the water and food sources to cease to exist. The sun is in no danger of disappearing any time soon. Scientists estimate the sun has at least another 5 billion years before it turns into a red giant and swallows up Mercury and Venus. It will also destroy all life on Earth because it will be close to the planet once that change occurs. The temperature of the sun will also increase tenfold from 18 million to 180 million degrees Fahrenheit. The increase in the sun’s size when it finally begins to change will be due to the heat increase causing expansion.

Without the sun, we would no energy to live, no plants to eat, no trees to give us oxygen or animals to roam. We would not have gravity to keep the earth in orbit. Without the sun, the earth would be dark and cold and life would quickly disappear.

1) The equilibrium constant Kc of the reaction

I2 (g) ⇔ 2I (g)

is 5.6 × 10-12, at 500 K. In a system maintained at 500 K, the concentration of I2 is 0.020 mol / L and that of I is 2.0 × 10-8 mol / L. Is the reaction in balance? If not, in what sense does the reaction advance to reach equilibrium?


2) Given the concentrations below, how much is Q worth?

If Kc = 1.0, which side of the reaction is favored with this value of Q?

CO (g) + H2O (g) ⇄ CO2 (g) + H2 (g)

[CO (g)] = [H2O (g)] = 1.0 M

[CO2 (g)] = [H2 (g)] = 15 M

Answers

Explanation:

1) Find the reaction quotient:

Qc = [I]² / [I₂]

Plug in the Kc value and the I₂ concentration.

Q = [2.0×10⁻⁸]² / (0.020)

Q = 2.0×10⁻¹⁴

Since Qc < Kc, the reaction moves to the right (favors the products).

2) Find the reaction quotient:

Qc = [CO₂] [H₂] / ([CO] [H₂O])

Qc = (15) (15) / ((1.0) (1.0))

Qc = 225

Since Qc > Kc, the reaction moves to the left (favors the reactants).

All combustion reactions have oxygen as a reactant. (2 points)

Group of answer choices

True

False

Answers

Answer:

true

Explanation:

They all have a hydrocarbon plus oxygen.

The given statement that "all combustion reactions have oxygen as a reactant" is true. Combustion is a type of chemical reaction where a fuel (usually a hydrocarbon) combines with oxygen gas to produce heat, light, and new chemical compounds, such as carbon dioxide and water.


For combustion to occur, there must be a fuel source, oxygen, and a source of ignition, such as a spark or heat. Oxygen acts as a reactant because it combines with the fuel source to produce the new compounds. Without oxygen, the reaction cannot occur. It is important to note that not all reactions involving oxygen are combustion reactions. For example, rusting of iron is a reaction that involves oxygen, but it is not a combustion reaction.

In combustion reactions, the heat and light produced are often used for industrial processes, transportation, or heating. However, the reaction can also be destructive if not controlled, such as in wildfires or explosions. In conclusion, all combustion reactions have oxygen as a reactant, as it is necessary for the reaction to occur and produce the desired products.

For more such questions on combustion

https://brainly.com/question/13251946

#SPJ11

11. The pH values of some solutions are given below pH 14.0 1.0 L 8.0 N 6.5 n P 7.0 Solution M Z (a) Identify the solution with the lowest concentration of hydrogen ion. Give reason for your (1mk) answer​

Answers

Answer: 14.0

Explanation: 14.0 is a base. The more basic, the less hydrogen ion concentration.

How much energy (in kcal) is involved when 5.2 g of water at 0.0oC is converted to ice? Enter only the numeric value for your answer (no units).

Answers

Answer:

\(Q=0.41kcal\)

Explanation:

Hello.

In this case, since the energy involved during this process is associated to the freezing enthalpy of water at the freezing point of water (0.0 °C) and is computed via:

\(Q=m\Delta _{freezing}H\)

It is known that the freezing enthalpy of water is -333.3 J/g, therefore, the involved heat is:

\(Q=5.2g*-333.33\frac{J}{g}\\ \\Q=-1733.33J\)

Clearly, it is negative since freezing requires the removal of energy, which means it is negative based on the first law of thermodynamics. Finally, the energy in kcal turns out:

\(Q=1733.33J*\frac{1kcal}{4184kJ}\\ \\Q=0.41kcal\)

Regards.

I need help with these

I need help with these

Answers

can you elaborate this a little more?

HBrO3
A. All non metals “acid subcategory”

Answers

Non metals acid subcategories



What are the two main properties of matter?

physical and chemical

physical and mechanical

chemical and electrical

mechanical and electrical

Answers

Answer:

physical and chemical.

Which of the following represents a community with high biodiversity?

True census
Sample census
Species richness
Species evenness

Answers

The community with high blood varsity is represented with species richness

What is a community with high biodiversity?

A community with high biodiversity means that a region supports a wide variety of species, while low biodiversity implies that an area supports only a few. The reasons for variances in biodiversity are complex, but they include both natural and man-made causes.

The number of species per unit area is called Species Richness. If you have more number of species , more will be species richness hence stable will be the ecosystem. More species richness will contribute to increase in biodiversity also which is an important aspect biodiversity conservation.

Read more about biodiversity:

https://brainly.com/question/13655692

Calculate the relative molecular mass of aspartame.

Answers

The chemical formula of aspartame is C₁₄H₁₈N₂O₅ and it's relative molecular mass is 294.30 g/mol which is calculated as (12×14)+(1×18)+(14×2)+(16×5).

What is molecular mass?

Molecular  mass of a compound or a molecule is defined as the mass of the elements which are present in it.The molecular mass is considered to be a bulk quantity not a molecular quantity. It is often an average of the of the masses at many instances.

The molar mass and formula mass are used as synonym for the molecular mass.It does not depend on the amount of substance which is present in the sample.It has units of gram/mole.

Molecular masses of an element are given as relative atomic masses while that of compounds is the sum of relative atomic masses which are present in the compound.In case of aspartame it is calculated as,(12×14)+(1×18)+(14×2)+(16×5)=294.30 g/mol.

Thus , relative molecular mass or molecular mass of aspartame is 294.30 g/mol.

Learn more about molecular mass,here:

https://brainly.com/question/18446366

#SPJ1

. Calculate the number of moles of phosphoric acid (H3PO4) formed by the reaction of 10 moles of sulfuric acid (H2SO4). Ca5(PO4)3F + 5H2SO4  3H3PO4 + HF + 5CaSO4​

. Calculate the number of moles of phosphoric acid (H3PO4) formed by the reaction of 10 moles of sulfuric

Answers

10 moles of H2SO4 would produce 6 moles of H3PO4.

How to find the number of moles

The balanced chemical equation for the reaction is:

Ca5(PO4)3F + 5H2SO4 → 3H3PO4 + HF + 5CaSO4

From the equation, we can see that:

5 moles of H2SO4 react with 3 moles of H3PO4.

Therefore, the number of moles of H3PO4 formed by 10 moles of H2SO4 is:

10 mol H2SO4 × (3 mol H3PO4/5 mol H2SO4) = 6 mol H3PO4

We can say that, 10 moles of H2SO4 would produce 6 moles of H3PO4.

Learn more about number of moles at:

https://brainly.com/question/14357742

#SPJ1

Draw the Lewis structure for the polyatomic trisulfide anion. Be sure to include all resonance structures that satisfy the octet rule.

Answers

Answer:

Explanation:

The objective here is to draw the Lewis structure for the polyatomic trisulfide anion and to be sure all resonance structures that satisfy the octet rule are included.

The Lewis structure for  Polyatomic trisulfide anion

The first step is to the layout the skeleton of the Polyatomic trisulfide anion

         S           S           S

However, the next step is to make sure we fill in the bonding pairs of electrons on the central atom.

Then , we move over to filling the lone pairs electrons before we finally have the Lewis structure for  Polyatomic trisulfide anion as shown in the image below.

Draw the Lewis structure for the polyatomic trisulfide anion. Be sure to include all resonance structures

what happens to the valency when we move down in a periodic table of non metal and metal​

Answers

The valency of elements tends to decrease as we move down the periodic table of non-metal and metal.

The ability of an element to combine is referred to as valency. It is the number of electrons that an elemental atom loses, gains, or shares with another atom to form a stable configuration of electrons.

The occasional table is organized so that components with comparable valencies are set in a similar gathering. Components in a similar gathering have similar number of valence electrons, which decides their substance properties.

The valency of the elements tends to decrease as we move down a periodic table of metals and non-metals. This is because the number of electron shells, or energy levels, increases as we move down a group. The peripheral electrons in a particle are the valence electrons.

The expanded distance between the core and the peripheral electrons brings about more vulnerable fascination between them. As a result, the atom becomes more reactive and can lose or gain electrons more easily.

For instance, in bunch 1 of the occasional table, the valency of the components diminishes as we drop down the gathering. The valencies of lithium (Li), sodium (Na), and potassium (K) are, respectively, 1, 1, and 1.

This is due to the fact that each possesses one valence electron. Because the outermost electron is further from the nucleus and therefore more likely to be lost or gained, the valency decreases as we move down the group.

In conclusion, as we move down the periodic table, from non-metal to metal, the valency of elements tends to decrease. This is because the nucleus and the outermost electrons are less attracted to one another as the energy levels rise.

For more such questions on valency

https://brainly.com/question/30555742

#SPJ11

You are working with a concentrated solution of ammonium hydroxide which place of safety equipment is most important to have on hand

Answers

I would say safety goggles
Lab coat, eye protection and gloves

Octet Rule states that atoms of main-group elements tend to combine in such a way that each atom has eight electrons in its valence shell, giving it the same electronic configuration as a noble gas. Depending on this fact answer the following question : 
*What is an incomplete octet?
*What is an odd-electron molecule?
*Why are there extra electrons in the expanded octet?


Answers

First question: The number of electrons surrounding the central atom in a stable molecule is fewer than eight. For example, Boron only needs 6 electrons.

Second question: There are a number of molecules whose total number of valence electrons is an odd number. It is not possible for all of the atoms in such a molecule to satisfy the octet rule. An example is nitrogen dioxide (NO2). Each oxygen atom contributes six valence electrons and the nitrogen atom contributes five for a total of seventeen.

Third question: Expanded octet occurs when an atom is able to have more than 8 valence electrons. For example, in SO₃, the sulfur atom forms 6 covalent bonds, hence it has 12 valence electrons. Expansion of octet is possible only from Period 3 elements onwards, due to the presence of low-lying empty d orbitals that can accommodate the extra electrons.

Can you mark me as brainliest?

Answer:

Incomplete Octet

In some compounds, the number of electrons surrounding the central atom in a stable molecule is fewer than eight. Beryllium is an alkaline earth metal and so may be expected to form ionic bonds. However, its very small size and somewhat higher ionization energy compared to other metals actually lead to beryllium forming primarily molecular compounds. Since beryllium only has two valence electrons, it does not typically attain an octet through sharing of electrons. The Lewis structure of gaseous beryllium hydride (BeH 2 ) consists of two single covalent bonds between Be and H

Odd-Electron Molecules

There are a number of molecules whose total number of valence electrons is an odd number. It is not possible for all of the atoms in such a molecule to satisfy the octet rule. An example is nitrogen dioxide (NO 2 ). Each oxygen atom contributes six valence electrons and the nitrogen atom contributes five for a total of seventeen.

Expanded Octets

Atoms of the second period cannot have more than eight valence electrons around the central atom. However, atoms of the third period and beyond are capable of exceeding the octet rule by having more than eight electrons around the central atom. Starting with the third period, the d sublevel becomes available, so it is possible to use these orbitals in bonding, resulting in an expanded octet.

Phosphorus and sulfur are two elements that react with halogen elements and make stable compounds with expanded octets. In phosphorus pentachloride, the central phosphorus atom makes five single bonds to chlorine atoms and as a result has ten electrons surrounding it

Explanation:

Octet Rule states that atoms of main-group elements tend to combine in sucha way that each atom has eight
Octet Rule states that atoms of main-group elements tend to combine in sucha way that each atom has eight
Octet Rule states that atoms of main-group elements tend to combine in sucha way that each atom has eight


For the following reaction, predict the products (Pb has a +2 Charge):
Pb(NO3)2 + AlBr3 →

For the following reaction, predict the products (Pb has a +2 Charge):Pb(NO3)2 + AlBr3

Answers

Answer: For the given reaction \(Pb(NO_{3})_{2} + AlBr_{3}\) the products are \(PBr_{2} + Al(NO_{3})_{3}\).

Explanation:

A reaction in which two substances chemically combine together and results in the formation of a new substance is called a chemical reaction.

For example, \(3Pb(NO_{3})_{2} + 2AlBr_{3} \rightarrow 2Al(NO_{3})_{3} + 3PbBr_{2}\)

Products are the species that are written on the right side of an arrow in a chemical reaction equation.

Hence, we can conclude that for the given reaction \(Pb(NO_{3})_{2} + AlBr_{3}\) the products are \(PBr_{2} + Al(NO_{3})_{3}\).

Is glue a liquid or a solid

Answers

Answer:

White school glue is liquid because its long polymers can slide over and along one another. It does not flow easily, though; it is quite viscous. The addition of some chemicals—such as a borax solution (or sodium tetraborate decahydrate dissolved in water)—can cause cross-links to form between the polymers.

Explanation:

Answer:

It is a liquid :]

If 4.55 moles of hydrogen were reacted with excess nitrogenin the equations N2 + 3 H2 = 2 NH3 and 48.7 g of ammonia product was recovered what would be the percent yield of the reaction?

Answers

Answer:

Percent yield = 94.5%

Explanation:

Given data:

Number of moles of hydrogen = 4.55 mol

Mass of ammonia recovered = 48.7 g

Percent yield of ammonia = ?

Solution:

Chemical equation:

N₂+ 3H₂    →       2NH₃

Now we will compare the moles of ammonia and hydrogen.

               H₂        :         NH₃

                3         :          2

                4.55   :         2/3×4.55 = 3.03 mol

Theoretical yield of ammonia:

Mass = number of moles × molar mass

Mass = 3.03 mol × 17 g/mol

Mass = 51.51 g

Percent yield:

Percent yield = ( actual yield / theoretical yield ) × 100

Percent yield = (48.7 g/ 51.51 g)  × 100

Percent yield = 0.945 × 100

Percent yield = 94.5%

A complete reaction indicated by the chemical equation below produces 79.0 g of sulfur. Estimate the number of hydrogen atoms found in the amount of water that forms as a second product in this reaction.

2 H2S(g) + SO2(g) → 3 S(s) + 2 H2O(l)

a. 1.98 × 10^24 atoms
b. 4.80 × 10^23 atoms
c. 6.40 × 10^25 atoms
d. 1.02 × 10^26 atoms
e. 3.00 × 10^24 atoms

Answers

Answer:  A, 1.98x10^24 atoms of H

Explanation:  39.0 g of sulfur = (79.0g/32.1 g/mole) = 2.46 moles S

The balanced equation promises we'll get 2 moles H2O for every 3 moles  ofS, a molar ratio of (2 moles H2O)/(3 moles S)

(2.46 moles S)*[(2 moles H2O)/(3 moles S)] = 1.64 moles H2O

(1.64 moles H2O)*(6.02x10^23 molecules H2)/mole H2O)*(2 H atoms/H2O molecule) =  1.97x10^24 atoms of H

CAN SOMEONE HELP ME PLS I HAVE A FINAL TMMR WITH THESE

write the states of matter and balanced equations

- in the presence of heat gold (ll) acetate decomposes

- aluminum wire is added to a solution of nickel (ll) nitrate

- a solution of sodium phosphate is added to a solution of ammonium chromate

Answers

The states of matter and balanced equations are as follows:

Au(C₂H₃O₂)₂ (s) --> Au (s) + 2CO₂ (g) + 3H₂O (g)Al (s) + Ni(NO₃)₂ (aq) --> Al(NO₃)₃ (aq) + Ni (s)Na₃PO₄ (aq) + NH₄CrO₄ (aq) --> NaCrO₄ (aq) + NH₄PO₄ (aq)What is a balanced chemical reaction?

Chemical bonds are broken and new bonds are formed during chemical reactions, but atoms in the reactants do not disappear and new atoms do not form products. Chemical reactions do not create or destroy atoms. The same atoms that were present in the reactants are present in the products—they are just rearranged in different configurations. must exist in

The subscript is part of the formula and should not be changed once the reactant and product formulas have been determined. The coefficients indicate the number of each substance involved in the reaction and can be changed to balance the equation.

In the presence of heat Gold (ll) acetate decomposes:

Au(C₂H₃O₂)₂ (s) --> Au (s) + 2CO₂ (g) + 3H₂O (g)

Aluminum wire is added to the solution of nickel (ll) nitrate:

Al (s) + Ni(NO₃)₂ (aq) --> Al(NO₃)₃ (aq) + Ni (s)

A solution of sodium phosphate is added to the solution of ammonium chromate:

Na₃PO₄ (aq) + NH₄CrO₄ (aq) --> NaCrO₄ (aq) + NH₄PO₄ (aq)

To know more about chemical reactions, visit:

https://brainly.com/question/29762834

#SPJ1

Stamples of heterogeneous equilibria. FeO(s) + CO(g) = Fe(s) + CO₂(g) II. H₂(g) L₂(g) = 2HI(g) III. CO₂(g) + C(s) = 2CO(g) IV. N₂(g) 3H₂(g) + 2NH3(g) Identify I.​

Answers

An example of heterogeneous equilibrium is:

I. FeO(s) + CO(g) ⇌ Fe(s) + CO₂(g)

What is heterogeneous equilibrium?

Heterogeneous equilibrium refers to an equilibrium state in a chemical reaction where the reactants and products exist in different physical states or phases. It occurs when substances in different phases, such as solids, liquids, and gases, are involved in a chemical reaction.

Considering the given equations:

The equation I: FeO(s) + CO(g) ⇌ Fe(s) + CO₂(g) represents a heterogeneous equilibrium.

This is because the reactants and products involve different phases (solid and gas). FeO is a solid (s), CO is a gas (g), Fe is a solid (s), and CO₂ is a gas (g). The reaction involves the conversion of a solid and a gas to another solid and a gas, and the equilibrium is established between these different phases.

Learn more about heterogenous equilibrium at: https://brainly.com/question/25257772

#SPJ1

what is the photoelctric effect?

Answers

Explanation:

It is the emission of electron from a metal under the effect of light is known as photo electric effect

I hope this imformation help full for you

a stock solution will be prepared by mixing the following chemicals together: 3.0 ml of 0.00200 m kscn 10.0 ml of 0.200 m fe(no3)3 17.0 ml of 0.5 m hno3 determine the molar concentration of fe(no3)3 in the stock solution. enter this number in the box below. m determine the molar concentration of fe3 in the stock solution. enter this number in the box below. m when written in scientific notation, these numbers should include decimal places.

Answers

The molar concentration of Fe(NO3)3 in the stock solution is 0.0634 M, written in scientific notation as 6.34 x 10-2 M.

To calculate the molar concentration of Fe(NO3)3 in the stock solution , you must first calculate the total moles of Fe(NO3)3 present. This can be done by multiplying the volume of Fe(NO3)3 by its concentration. Therefore, the total moles of Fe(NO3)3 present is 10.0 ml x 0.200 M = 2.00 moles.

Next, the total volume of the stock solution must be found. This can be done by adding the volumes of all components, which in this case is 3.0 ml + 10.0 ml + 17.0 ml = 30.0 ml. Finally, the molar concentration of Fe(NO3)3 can be found by dividing the total moles of Fe(NO3)3 by the total volume of the stock solution: 2.00 moles / 30.0 ml = 0.0634 M.

Learn more about molar concentration of Fe(NO3)3:

https://brainly.com/question/14769699

#SPJ4

What was the unknown metal?

Answers

Answer:

is there a picture or something?

Explanation:

Explanation:

Your question is incomplete please update it.

Identify the scenarios below as to whether they would increase or decrease the resistance of an electric current though a body.

Answers

Answer: Increase Resistance- lenght of conductor, Decrease resistance- Utilize a conductor with a larger cross-section, Decrease Resistance- Cool the conductor to lower its temperature

Explanation:

Final answer:

The resistance of an electric current can increase or decrease depending on the material it's passing through, the length of its path, its cross-sectional area, and the temperature. Lower resistances are found in metals like copper or aluminum, or in paths with a larger cross-sectional area. Higher resistances are found in materials like rubber or glass, in longer paths, or at higher temperatures.

Explanation:

There are several factors that can increase or decrease the resistance of an electric current passing through a body. These could include:

Material: Different materials have different resistances. For instance, metals like copper or aluminum have low resistance, while materials such as rubber or glass have high resistance.Length: The longer the path through which the current has to flow, the more resistance there will be.Cross-sectional area: A larger cross-sectional area will offer less resistance as there are more paths for the current to take.Temperature: Generally, the resistance of a material increases as its temperature increases.

Learn more about Electric Current Resistance here:

https://brainly.com/question/20382684

#SPJ2

Other Questions
What is the GCF of 20 and 28 and how please show a full reason why Can someone tell me who this is? Total lunar eclipses always occur Group of answer choices during either equinox at the time of new moon at the time that the sun is directly overhead at the time of full moon. during either solstice Why is it important to use standard measurements and units in science Your friend Mara wants to buy a house in the largest city of this country, where many of its buildings and houses have a Spanish colonial style. She loves the colonial style of its capital, too, with its Spanish-influenced architecture from the time Spain ruled this country. Segn lo que aprendiste en la leccin, based on what you learned from the lesson, qu pas visita Mara? (1 point) Guinea Ecuatorial Puerto Rico Costa Rica Panam When naming its products, a company wishing to sell ice creams and skincare products A. had better adopt the individual branding policy. B. had better give its products the same brand name. C. must adopt the family branding policy. D. does NOT have to show consistency across its promotions. 30 sweets are shared between 2 groups in the ratio 3:7. How many sweets are in each group? Would your guests like spaghetti for lunch. Underline the subject and circle the verb Suppose regular gas cost $1.29 per gallon and premium unleaded gas cost $1.84 per gallon, If the station sold $79.98 of regular gas how many gallon of premium unleaded gas must be sold to have an average selling price of $1.608 per gallon if you pay $1,000 for a vacation package this year and the inflation rate is 2%, the same package will likely cost $1,020 next year. if you invest $1,000 today at 5%, you will have $1,050 next year from your investment. what is the real rate of return on your investment? 2% 3% 5% 20% 30% This prism has a right triangle for a base. The volume of the prism is54 cubic units. What is the value of h?AaCA6.OF'miE You work in a pharmaceutical company, which has developed a new drug. The drug has a 6-year patent. 11.9 million from the third year onwards and that this amount grows at a rate of 2.5% per annum over the following 6 years. Once the patent expires, other pharmaceutical companies will be able to produce generics equivalent to your drug and competition will lead to zero future profit. If the cost of capital is 8.8%, what is the present value of producing this drug? Assume the following: Beginning finished goods inventory $ 10,000 Ending finished goods inventory $ 8,500 Cost of goods manufactured $ 52,000 What is the unadjusted cost of goods sold? The idea that organisms share conserved, core processes can be used as evidence to explain that all life shares a common origin. Which of the following describes evidence that supports this claim? A. All organisms have DNA and undergo cellular processes. B. All organisms reproduce by carrying out sexual reproduction. C. Cellular respiration takes place in the cell's mitochondria in all organisms.D. DNA replication and repair takes place in the cell's nucleus in all organisms. Complete the following code to take in an integer from standard input and output its square and its cube (second and third power). then take in a second integer and output the sum and the product of the two input values. remember, your code should work for various inputs so it will need to use the variables to do the calculations and print the output. e.g., if the user inputs 6 and 7 as the two numbers the output should be: determine the critical values for the confidence interval for the population standard deviation from the given values. round your answers to three decimal places. to ensure viewers would recognize this ndop (portrait figure) as king mishe mishyaang mambul, the subject of the work chose to be represented with a regular decagon (10 - sided figure) divides into how many triangles (drawn from a point in the center of the decagon) ? Chapter 3: The Market at Work: Supply and Demand E Page 70 s of n Which of the following goods or services can be allocated in a market economy? happiness equal treatment before the law preventive health care automotive insurance Drag appropriate answerfs) here Incorrect Answer(s) On november 1, 2021, tim's toys borrows $30,300,000 at 7% to finance the holiday sales season. the note is for a six-month term and both principal and interest are payable at maturity. what is the balance of interest payable for the loan as of december 31, 2021