The temperatures describing the value of C is 100 °C, because it is the boiling point of water.Hence, The correct answer is Option (B)
What is Phase change ?A phase change is when matter changes to from one state (solid, liquid, gas, plasma) to another.
These changes occur when sufficient energy is supplied to the b(or a sufficient amount is lost), and also occur when the pressure on the system is changed.
The given heating curve has two flat lines (Or plateaus) ;
The first one is the melting point,The second one is the boiling point.(Image is attached for reference)
In the given problem, C is the second flat line, so it is boiling point.
Therefore , The temperatures describing the value of C is 100 °C, because it is the boiling point of water.Hence, The correct bis Option (B)
Learn more about Phase change here ;
brainly.com/question/12390797
#SPJ2
1. What organ system is responsible for controlling all of the body
functions?
Answer:
The human brain is the body's control center, receiving and sending signals to other organs through the nervous system and through secreted hormones. It is responsible for our thoughts, feelings, memory storage and general perception of the world. The human heart is a responsible for pumping blood throughout our body
For the following problem convert both the reactants to moles and balance chemical equationsThe reaction of 167 g Fe2O3 with 85.8 g CO produces. 72.3g Fe. START to determine the limiting reactant Fe2O3+CO—->Fe+CO2
Let's start by balancing the reaction:
\(Fe_2O_3+CO\longrightarrow Fe+CO_2\)As we can see, C appears only on two comopunds, CO and CO₂, and since both have 1 C each, their coefficients have to be the same for C to be balanced. However, CO has 1 O and CO₂ has 2, so there is a difference of 1 O betwee them.
The other source of O is Fe₂O₃, that has 3 O. So, we must choose a coefficient for CO and CO₂ such that the difference between the numbers of O is a multiple of 3, that way we can fix this difference with the O from Fe₂O₃. So, we can put coefficients of 3 on both of them:
\(Fe_2O_3+3CO\longrightarrow Fe+3CO_2\)That way, we maintained C balanced (3 on each side) and now we have 3 + 3 O on the left side and 6 O on the right side, so the same amount.
Now, we just have to calance Fe, but it is easy since we have it alone in Fe. Since we have 2 on the left side, it is enough to put a coefficient of 2 on Fe to get the balanced reaction:
\(Fe_2O_3+3CO\longrightarrow2Fe+3CO_2\)Now, to convert from mass to number of moles, we need the molar masses of the reactants, which we can calculate from the atomic weights of the elemnts in each of them:
\(M_{Fe_2O_3}=2\cdot M_{Fe}+3\cdot M_O=(2\cdot55.845+3\cdot15.9994)g/mol=159.6882g/mol\)\(M_{CO}=1\cdot M_C+1\cdot M_O=(1\cdot12.0107+1\cdot15.9994)g/mol=28.0101g/mol\)Now, we can convert their masses to number of moles:
\(\begin{gathered} M_{Fe_{2}O_{3}}=\frac{m_{Fe_2O_3}}{n_{Fe_{2}O_{3}}} \\ n_{Fe_2O_3}=\frac{m_{Fe_2O_3}}{M_{Fe_{2}O_{3}}}=\frac{167g}{159.6882g/mol}=1.045787\ldots mol \end{gathered}\)\(\begin{gathered} M_{CO}=\frac{m_{CO}}{n_{CO}} \\ n_{CO}=\frac{m_{CO}}{M_{CO}}=\frac{85.8g}{28.0101g/mol}=3.063180\ldots mol \end{gathered}\)Now, to determine the limiting reactant, we need to divide both the number of mole by their coefficients on the balanced reaction, so we can see how many we need per reaction of each:
\(\begin{gathered} Fe_2O_3\colon\frac{n_{Fe_2O_3}}{1}=\frac{1.045787\ldots mol}{1}=1.045787\ldots mol \\ CO\colon\frac{n_{CO}}{3}=\frac{3.063180\ldots mol}{3}=1.021060\ldots mol \end{gathered}\)Now, the limiting reactant is the one we have less number of moles per reaction. We can see that we have less CO than Fe₂O₃, so the limiting reactant is CO.
The Ksp of yttrium iodate, Y(IO3)3 , is 1.12×10−10 . Calculate the molar solubility, s , of this compound.
Answer:
1.427x10^-3mol per L
Explanation:
\(Y(IO_{3} )_{3} ---- Y^{3+} +IO_{3} ^{3-}\)
I could use ⇌ in the math editor so I used ----
from the question each mole of Y(IO3)3 is dissolved and this is giving us a mole of Y3+ and a mole of IO3^3-
Ksp = [Y^3+][IO3-]^3
So that,
1.12x10^-10 = [S][3S]^3
such that
1.12x10^-10 = 27S^4
the value of s is 0.001427mol per L
= 1.427x10^-3mol per L
so in conclusion
the molar solubility is therefore 1.427x10^-3mol per L
In the balanced equation
2C₂H6+702--> 4CO2+6H₂O
if 21 g of C₂H6 react with 32 g O2, what is the limiting reactant?
02
C₂H6
CO₂
H₂O
In the balanced equation \(2C_{2} H_{6}\) + \(7 O_{2}\) --> \(4 CO_{2}\) + \(6H_{2}O\) if 21 g of \(C_{2} H_{6}\) reacts with 32 g O₂, C₂H6 is the limiting reactant.
To determine the limiting reactant, we need to compare the amount of each reactant to the stoichiometric ratio in the balanced equation.
Let's calculate the number of moles for each reactant using their molar masses:
For \(C_{2} H_{6}\) (ethane):
Molar mass of \(C_{2} H_{6}\) = 2(12.01 g/mol) + 6(1.01 g/mol) = 30.07 g/mol
Number of moles of C₂H6 = 21 g / 30.07 g/mol ≈ 0.698 mol
For O₂ (oxygen):
Molar mass of O₂ = 2(16.00 g/mol) = 32.00 g/mol
Number of moles of O₂ = 32 g / 32.00 g/mol = 1.00 mol
Next, we compare the moles of each reactant to the stoichiometric ratio in the balanced equation:
2 moles of \(C_{2} H_{6}\) react with 7 moles of O₂ to produce 4 moles of CO₂ and 6 moles of H₂O.
From the given amounts, we have:
0.698 mol \(C_{2} H_{6}\) and 1.00 mol O₂.
Using the stoichiometric ratio, we can calculate the expected amount of CO₂ and H₂O produced for each reactant:
For C₂H6:
Expected moles of CO₂ = 0.698 mol C₂H6 * (4 mol CO₂ / 2 mol C₂H6) = 1.396 mol CO₂
For O₂:
Expected moles of CO₂ = 1.00 mol O₂ * (4 mol CO₂ / 7 mol O₂) ≈ 0.571 mol CO₂
Comparing the expected moles, we see that the calculated amount of CO₂ is greater when used \(C_{2} H_{6}\) as the limiting reactant. Therefore, the limiting reactant in this reaction is \(C_{2} H_{6}\).
Know more about the Balanced equation here:
https://brainly.com/question/13451900
#SPJ8
What do the atoms in solids do when melted into liquid? Would that cause an increase or decrease in density Explain your reasoning
Hey there! I'll try to provide you with my best answer.
Answer: Atoms are the smallest particle of a chemical element that can exist. In the three states of matter, atoms in solids are tightly packed. And atoms in liquid are abit farther away from each other.
Basically what happens when they melt is that they gain a sort of heat energy. This heat energy comes from the fire or anything we are using to heat the solid material up. As we heat it, the tightly packed atoms vibrate. This vibration from even one single atom can cause other atoms to vibrate as well. As the vibration spreads and heat energy increasing if we constantly heat it, they obtain so much energy that at a point they start displacing from their position. This heat energy makes the atoms be in an excited state.They continiously hit each other and move farther away. They will keep on moving far until they stop gaining any heat energy. Eventually this slow process happens from solid to liquid. Just like how we see solid ice melt into water.
This cause an decrease in density. As in solids the atoms were very close to each other. But as soon as they are converting to liquid the atoms there has a gap between them. We can see this just like hold a solid object which doesn't move at all. But when water dropped at a place, this spreads wide out.
Hope it helps! And sorry for making it so long!
Heat is added to ice at 0 °C. Explain why the temperature of the ice does not change. What does change?
Heat is added to ice at 0 °C. Explain why the temperature of the ice does not change. What does change?When heat is added to ice at 0°C, the temperature of the ice does not change. This happens because all the heat energy is used up in overcoming the intermolecular forces of attraction (hydrogen bonds) that exist between the water molecules in ice.
As a result, the ice undergoes a phase change, from a solid to a liquid. This process is called melting. During melting, the temperature of the ice remains constant at 0°C because all the heat energy is used up in overcoming the intermolecular forces of attraction.The energy required to melt ice is known as the heat of fusion. The heat of fusion is the amount of heat energy required to change 1 kilogram of a solid into a liquid at its melting point. For water, the heat of fusion is 334 kJ/kg. This means that 334 kJ of heat energy is required to melt 1 kg of ice at 0°C. Therefore, during the melting of ice, the temperature of the ice does not change, but the internal energy of the ice does change, and this is manifested in the change of phase from a solid to a liquid.In summary, when heat is added to ice at 0°C, the temperature of the ice does not change, and all the heat energy is used up in overcoming the intermolecular forces of attraction between the water molecules in ice. This results in the melting of ice without any change in temperature.For such more question on molecules
https://brainly.com/question/475709
#SPJ8
A chamber contains equal molar amounts of C₂H₂, CH₄, and H₂. If the total chamber pressure is 5.00 atm, then the partial pressure of C₂H₂ is:
Answer: 1.67 atm
Explanation:
Since the molar amounts are equal, this means that the partial pressure of acetylene is 1/3 of the total chamber pressure.
Describe what each component of the Currents Tank Investigation represents. WILL MARK BRIANNLIST PLEASE!!!!!!!
In the Currents Tank Investigation,
a. the water represents
b. the sides of the tank represent
c. blowing through the straw represents
d. the moving pepper helps illustrate the movement of
1. currents
2.prevailing winds
3.the ocean
4.continents
Answer:
Its b
Explanation:
The average titration volume of the 0.09876 M NaOH used in back titration is 29.59
ml. Calculate the number of mmoles of HCl in the 250 ml volumetric flask.
Answer:
The number of moles of HCl in the 250 mL volumetric flask is 0.003 moles
Explanation:
Firstly, we solve for the concentration of acid using the formula
CaVa/CbVb = nₐ/nb
where Ca is the concentration of acid
Cb is the concentration of base
Va is the volume of acid
Vb is the volume of base
nₐ is the number of moles of acid (from the equation)
nb is the number of moles of base (from the equation)
Ca × 250/0.09876 × 29.59 = 1/1
Ca = 0.09876 × 29.59/250
Ca = 0.012 M
To determine the number of moles of HCl acid present in the 250 ml volumetric flask, the formula for molarity is used
Molarity = number of moles ÷ volume (in liter or dm³)
Volume needs to be converted to liter; 250 ml ⇒ 0.25 L
Molarity of the acid is 0.012 M
From the formula above, number of moles = molarity × volume (in liter)
number of moles = 0.012 × 0.25
number of moles of acid = 0.003 moles
How many liters of hydrogen can be produced at a pressure of 2 atm and a temperature of 298 K
Answer:
1.17 L of H₂
Explanation:
We'll begin by calculating the number of mole in 2.3 g of Mg. This can be obtained as follow:
Mass of Mg = 2.3 g
Molar mass of Mg = 24 g/mol
Mole of Mg =?
Mole = mass /molar mass
Mole of Mg = 2.3 / 24
Mole of Mg = 0.096 mole
Next, we shall determine the number of mole of H₂ produced by the reaction of 2.3 g (i.e 0.096 mole) of Mg. This can be obtained as follow:
Mg + 2HCl —> MgCl₂ + H₂
From the balanced equation above,
1 mole of Mg reacted to 1 mole of H₂.
Therefore, 0.096 mole of Mg will also react to produce 0.096 mole of H₂.
Finally, we shall determine volume of H₂ produced from the reaction. This can be obtained as follow:
Number of mole (n) of H₂ = 0.096 mole
Pressure (P) = 2 atm
Temperature (T) = 298 K
Gas constant (R) = 0.0821 atm.L/Kmol
Volume (V) of H₂ =?
PV = nRT
2 × V = 0.096 × 0.0821 × 298
Divide both side by 2
V = (0.096 × 0.0821 × 298) /2
V = 1.17 L
Therefore, 1.17 L of H₂ were obtained from the reaction.
When a hydrogen atom is added to a polyatomic ion, the amount of negative charge . Following this pattern, we can see that hydrogen carbonate has a charge of and hydrogen sulfate has a charge of .
If we add one or two hydrogen ions to a polyatomic ion that has a 3-charge, as the phosphate ion (PO₄3-), it will still be a polyatomic ion. (Three H+ would entirely cancel out the 3-charge, turning it into a neutral molecule and removing it from the category of polyatomic ions.
Why does carbonate have a negative 2 charge?As a result, the carbonate ion has 2 more electrons than protons due to its negative charge. The doubly bonded oxygen in the carbonate ion is neutral, whereas each single bonded oxygen has a negative charge. This is the cause of the total charge of "-2," then.
An essential component of the atmosphere of stars like the Sun is the hydrogen anion.
learn more about carbonate ion
https://brainly.com/question/28770987
#SPJ1
Cytokinesis happens differently for plant and animal cells. Both separate cytoplasm between two new daughter cells. However, which type of cell cytokinesis has the old cell membrane begin changing into a new cell wall between the two connected newly formed daughter cells?
Question 1 options:
Both
Plant cell cytokinesis
Animal cell cytokinesis
Neither
50 points need answer will give crown
Answer:
C
Explanation:
What type of heat transfer drives plate tectonics?
Answer:
Convection, or the flow of mantle material transporting heat, drives plate tectonics.
Explanation:
Have a nice day !!! :)
Even though the phone is ringing, no sound comes out of the jar. What does this tell
you about the space inside the jar?
Answer:
the jar is powerful for people to hear thing because if a phone ring it would be loud to hear
Explanation:
tiny sacs in the lungs where gas exchange takes place are called ____?
Answer:
Alveoli
Explanation:
I hope this helps you.
What did J. J. Thomson's cathode ray experiment show about atoms?
Answer:
atoms contain tiny negatively charged subatomic particles or electrons
how many sodium ions are in 1.4 kg of sodium chloride, NaCl?
Answer:
1.44 x 10²⁵ ions of Na⁺
Explanation:
Given parameters:
Mass of NaCl = 1.4kg = 1400g
Unknown:
Number of ions of sodium = ?
Solution:
The compound NaCl in ionic form can be written as;
NaCl → Na⁺ + Cl⁻
In 1 mole of NaCl we have 1 mole of sodium ions
Now, let us find the number of moles in NaCl;
Number of moles = \(\frac{mass}{molar mass}\)
Molar mass of NaCl = 23 + 35.5 = 58.5g/mol
Number of moles = \(\frac{1400}{58.5}\) = 23.93mol
So;
Since 1 mole of NaCl gives 1 mole of Na⁺
In 23.93 mole of NaCl will give 23.93 mole of Na⁺
1 mole of a substance = 6.02 x 10²³ ions of a substance
23.93 mole of a substance = 6.02 x 10²³ x 23.93
= 1.44 x 10²⁵ ions of Na⁺
all matter has physical and chemical properties. These properties can be used to identify the type of matter. Which of these statements describe a physical property?
Explanation:
Physical properties of matte tells us everything about a substance when no change is occurring to its constituents.
Such properties are best observed with our senses. Also, physical properties can be observed using equipment in the laboratory or some apparatus.
Examples of these properties are state of matter, color, odor, taste, texture, hardness, solubility in water, melting point, boiling point, density, viscosity and spectroscopic patterns.MgSO4(aq) + 2NaOH(aq) Mg(OH)2(s) + Na2SO4(aq) i. Write the complete ionic equation from the balanced equation. (3 points) Please help!
Answer:
Mg²⁺(aq) + SO₄²⁻(aq) + 2Na⁺(aq) + 2OH⁻(aq) → Mg²⁺(aq) + 2OH⁻(s) + 2Na⁺(aq) + SO₄²⁻(aq)
Explanation:
The complete ionic equation is the chemical equation where the chemical species in the aqueous phase (aq) are written as ions.
In the reaction:
MgSO₄(aq) + 2NaOH(aq) → Mg(OH)₂(s) + Na₂SO₄(aq)
MgSO₄ dissociates in Mg²⁺ and SO₄²⁻, NaOH in Na⁺ and OH⁻, Mg(OH)₂ doesn't dissociate because is as solid and NaSO₄ dissociates in Na⁺ and SO₄²⁻ ions.
That means the complete ionic equation is:
Mg²⁺(aq) + SO₄²⁻(aq) + 2Na⁺(aq) + 2OH⁻(aq) → Mg²⁺(aq) + 2OH⁻(s) + 2Na⁺(aq) + SO₄²⁻(aq). Calculate the molarity of 2.00 L of a glucose solution that contains 582.0 g of glucose (C6H12O6).
Answer:
\(M=1.62M\)
Explanation:
Hello.
In this case, since the molarity is computed by the division of the moles of the solute by the volume of the solution in liters:
\(M=\frac{n_{solute}}{V_{solution}}\)
We first compute the moles of glucose (molar mass 180 g/mol) as shown below:
\(n_{solute}=582.0g*\frac{1mol}{180g} =3.233mol\)
Therefore, the molarity turns out:
\(M=\frac{3.233mol}{2.00L}\\ \\M=1.62M\)
Best regards.
6. How many moles are in 8.30 x 1023 molecules of CO₂?
a.
b.
C.
d.
1.37
2.8
55.5
100
WILL MAKE BRAINLIEST IF ANSWERED ASAP
Which choice gives the correctly
balanced equation for this reaction?
AgNO3(aq) + Na₂CO3(aq) →
Ag₂CO3(s) + NaNO3(aq)
The reaction's chemically balanced equation is as follows:3CCl4 + 3N2 + 6H2 = 3CH4 + 3 N2Cl4
Which option provides the reaction's properly balanced equation?The reaction's chemically balanced equation is as follows:3CCl4 + 3N2 + 6H2 = 3CH4 + 3 N2Cl4A chemical reaction that has the same number of moles in the reactant and product sides is said to have a balanced chemical equation.
Determining that the chemical reaction is a balanced chemical equation, it follows the law of conservation of mass.
The missing image, which is included below, shows what the picture represents:
The side that reacts:
Three molecules each of CH4 and N2Cl4
The component side:
6 molecules of H2, 3 molecules each of CCl4, N2, and 3.
Consequently, the following is the reaction's balanced chemical equation:
3CCl4 + 3N2 + 6H2 = 3CH4 + 3 N2Cl4
To learn more about chemically balanced equation refer
https://brainly.com/question/11904811
#SPJ1
difference between boiling point and freezing point
Answer:
Lower vapor pressures of a substance has an obvious effect on a boiling point. The freezing point the rate at which the solid melts is equal to the rate which freezes.
Explanation:
In practice, small differences between these quantities can be observed. It is difficult, if not impossible, to heat a solid above its melting point because the heat
Hope this helps (:
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
When fossil fuels are burned, they emit carbon dioxide into the atmosphere. After centuries of large amounts of carbon dioxide accumulating in the atmosphere, the earth's temperature increases by 1°C.
What is the connection between increasing carbon dioxide and increasing temperature?
The connection between increasing carbon dioxide and increasing temperature is: carbon dioxide absorbs heat from the sun and traps it in earth's atmosphere. Since the heat cannot escape, it causes the earth's temperature to increase which is the first option.
When carbon dioxide (CO₂) and other greenhouse gases are present in the atmosphere, they act as a natural blanket, allowing sunlight (solar radiation) to pass through and reach the Earth's surface. Some of this solar radiation is absorbed by the Earth's surface, while the rest is reflected back towards space as heat (infrared radiation). However, greenhouse gases like carbon dioxide have the property of absorbing and re-emitting infrared radiation.
Learn more about fossil fuel here
https://brainly.com/question/2029072
#SPJ1
5 F2 (g) + 2 NH3 (g) → N2F4 (g) + 6 HF (g)If you reacted 7.78 moles of F2 how many moles of HF would be produced?
5 F2 (g) + 2 NH3 (g) → N2F4 (g) + 6 HF (g)
2. Determine mole proportions , then solveFrom the above balanced reaction, we can see that :
5 moles of F2 reacts to form : 6 moles of HF ,
so, 7.78moles F2 will give :x moles of HF
Therefore,x mole HF =( 6 moles HF * 7.78 mole F2)/ 5 mole F2
= 6 * 7.78/5
=9.336
≈9.34moles HF
• This means that , if you reacted 7.78 moles of F2 , ,9.34 moles of HF would be produced,.
if there are more products than reactants, does that mean there is an increase in the forward or backward reaction? And if there are more reactants that products, is there an increase in the forward or backward reaction?
Answer:
If there are more products than reactants, that means the reaction has shifted towards the left, which is the backward direction. If there are more reactants than products, that means the reaction has shifted towards the right, which is the forward direction.
The equation 2NaNO3 + CaCl2 - 2NaCl + Ca(NO3)2 is balanced. How many atoms
of sodium (Na) are there on either side of the equation?
one
two
four
six
Answer:3
Explanation:
I took the test
the correct answer is two
If we have 1.23 mol of NaOH in solution and 0.85 mol of Cl2 gas is available to react, which one is the limiting reactant? Give your reason.
Answer:
NaOH is the limiting reactant.
Explanation:
Hello there!
In this case, since the reaction taking place between sodium hydroxide and chlorine has is:
\(NaOH+Cl_2\rightarrow NaCl+NaClO+H_2O\)
Which must be balanced according to the law of conservation of mass:
\(2NaOH+Cl_2\rightarrow NaCl+NaClO+H_2O\)
Whereas there is a 2:1 mole ratio of NaOH to Cl2, which means that the moles of the former that are consumed by 0.85 moles of the latter are:
\(n_{NaOH}=0.85molCl_2*\frac{2molNaOH}{1molCl_2}\\\\n_{ NaOH}=1.7molNaOH\)
Therefore, since we just have 1.23 moles out of 1.70 moles of NaOH, we infer this is the limiting reactant.
Regards!