the graph above represents the data collected under certain conditions for the decomposition of n2o4(g) according to the chemical equation above. based on the graph, at approximately which time is equilibrium established?

Answers

Answer 1

Based on the graph, equilibrium is established at approximately 400 seconds. This can be determined by identifying the point where the rate of the forward reaction (represented by the blue line) and the rate of the reverse reaction (represented by the orange line) become equal.

At this point, the concentration of N2O4(g) and NO2(g) are constant, indicating that the system has reached equilibrium. The graph shows that initially, there is a rapid decrease in the concentration of N2O4(g), indicating that the forward reaction is favored.

However, as the concentration of N2O4(g) decreases, the rate of the reverse reaction increases until it is equal to the rate of the forward reaction, establishing equilibrium.

To determine when equilibrium is established, you need to analyze the graph by looking for the point where the concentration of N2O4(g) remains constant, meaning it does not change over time.

Equilibrium occurs when the rate of the forward reaction (decomposition of N2O4) equals the rate of the reverse reaction, so the concentrations of reactants and products remain constant. Once you find that point on the graph, you can determine the approximate time at which equilibrium is established.

To know more about equilibrium visit:

https://brainly.com/question/30807709

#SPJ11


Related Questions

What are the three (3) things involved in stoichiometry problems???

Answers

Answer:

Molar Mass (moles  

grams)

Stoichiometric Coefficients (moles  )

Avagadro's number

Explanation:

Suppose naoh standardization of khp determined that a volume of 25. 00 ml naoh has a concentration of 0. 049 m. Suppose 22. 20 ml of khp was used to get to the endpoint in this standardization. What is the mass of khp dissolved in 50. 00 ml of the standardization khp titrant?.

Answers

The mass of KHP that was dissolved in 50.00 mL of the standardization titrant is 0.5634 g.

1 mol of KHP reacts with 1 mol of NaOH, which would mean that the amount of NaOH used is equal to the amount of KHP in the sample. We can use this to calculate the number of moles:

c = n/V, so n = c * V = 0.049 M * 0.025 L = 0.001225 mol of NaOH and KHP

Using this amount, we can then calculate the KHP moles in the sample of the standardization titrant:

22.20 mL : 0.001225 mol = 50.00 mL : X

X = 0.001225 mol * 50.00 mL / 22.20 mL = 0.002759 mol

Then, by using the M value of KHP (204.22 g/mol), we obtain the mass of KHP of the sample:

n = m/M, so m = n * M = 0.002759 mol * 204.22 g/mol = 0.5634 g

You can learn more about KHP here:

brainly.com/question/20410909

#SPJ4

An epicenter station is4,000 km away. How long after the the first wave did the first wave arrive?

Answers

The first wave appear after 320 seconds and after the arrival of P wave

We can use the formula TD = d × t / 100 km

TD = d × t / 100 km

= ( 4000 km × 8 s ) / 100 km

= 32000 km /s / 100 km

= 320 seconds

The first s-wave will arrived in 320 seconds after the arrival of the first p-wave

The earliest waves to reach a seismograph are known as P waves, or primary waves. The fastest seismic waves, known as P waves, can pass through solid, liquid, or gas. On the medium they travel through, they leave a trail of compressions and rarefactions

The second waves to arrive during an earthquake are called S waves, or secondary waves. They can only pass through solids and are substantially slower than P waves

to learn more about waves:

https://brainly.com/question/3639648

#SPJ4

Why are sodium and chlorine the largest dissolved components in ocean water? What is the most abundant dissolved gas in ocean water?

Answers

Sodium (Na) and chlorine (Cl) are the largest dissolved components in ocean water due to the abundance of sodium and chloride ions in the Earth's crust and the continuous input of these elements into the oceans through various processes. Sodium is one of the most common elements in the Earth's crust, and chlorine is widely distributed in rocks, minerals, and salts.

Over millions of years, weathering of rocks, volcanic activity, and erosion release these elements into rivers and ultimately into the oceans. The combination of sodium and chlorine ions results in the formation of sodium chloride, which is commonly known as table salt and contributes to the salinity of seawater.

The most abundant dissolved gas in ocean water is carbon dioxide (CO2). Carbon dioxide dissolves in the surface waters of the ocean through gas exchange with the atmosphere. It plays a crucial role in regulating the pH of seawater and is an essential component of the carbon cycle. Carbon dioxide is involved in various biological and chemical processes in the ocean, including photosynthesis by marine plants and the formation of calcium carbonate shells by marine organisms. Additionally, the increase in atmospheric carbon dioxide due to human activities has led to ocean acidification, which is a significant concern for marine ecosystems.

To know more about Sodium (Na) and chlorine (Cl), click here, https://brainly.com/question/5319005

#SPJ11

Due to the fact that they combine to form the ionic compound sodium chloride (NaCl), also known as salt, sodium (Na) and chlorine (Cl) are the two most abundant dissolved elements in ocean water.

Thus, Salts are among the many dissolved compounds that water from rivers and streams transports into the ocean.

In particular, sodium and chloride ions have accumulated in the ocean throughout time, leading to the high concentration of these elements in seawater. Magnesium, calcium, potassium, and sulphate ions are among the other dissolved substances in ocean water.

Oxygen  is the dissolved gas that is most prevalent in ocean water.

Thus, Due to the fact that they combine to form the ionic compound sodium chloride (NaCl), also known as salt, sodium (Na) and chlorine (Cl) are the two most abundant dissolved elements in ocean water.

Learn more about Ocean, refer to the link:

https://brainly.com/question/12738467

#SPJ4

Gold has a density of 19.3g/cm^3. what is the mass, in kg, of a cube of gold measuring 2.0 inches on each side? use unit analysis, not the density formula.

Answers

The mass of the cube of gold measuring 2.0 inches on each side is 2.56 kg.

Given that gold has a density of 19.3 g/cm³ and the cube of gold has sides of 2.0 inches, we need to calculate the mass of the cube in kg without using the density formula. We can convert the length of each side of the cube from inches to cm by using the conversion factor 1 inch = 2.54 cm.

Therefore, each side of the cube measures:2.0 inches × 2.54 cm/inch = 5.08 cm. The volume of the cube can be calculated by raising the length of one side to the third power, i.e.,

V = (side)³ = (5.08 cm)³ = 132.5 cm³

The mass of the cube can be calculated by using the density of gold and the volume of the cube. However, we are not supposed to use the density formula, so we can use unit analysis to determine the mass in kg. We have:

19.3 g/cm³ = 19.3 g/cm³ × 1 kg/1000 g = 0.0193 kg/cm³

Multiplying this by the volume of the cube in cm³, we get:

0.0193 kg/cm³ × 132.5 cm³ = 2.56 kg

Therefore, the mass of the cube of gold measuring 2.0 inches on each side is 2.56 kg.

To know more about density visit:

https://brainly.com/question/29775886

#SPJ11

If you wanted to mix pure methane with water and end up with 90 gallons of 60% methane, how many gallons of each should you use?
You should use ________ gallons of water and _________ gallons of methane

Answers

To determine the amount of water and methane needed, we can set up a system of equations based on the desired composition of the mixture. you should use 36 gallons of water and 54 gallons of methane to obtain a mixture of 90 gallons with a methane concentration of 60%.

Let's assume x represents the number of gallons of water and y represents the number of gallons of methane. We have the following information: The total volume of the mixture is 90 gallons: x + y = 90. The mixture should be 60% methane: (y / (x + y)) * 100 = 60. Simplifying the second equation: y / (x + y) = 0.6. Now we can solve the system of equations: From equation 1, we can express x in terms of y: x = 90 - y. Substituting this into equation 2: y / ((90 - y) + y) = 0.6. Simplifying further: y / 90 = 0.6. Solving for y: y = 0.6 * 90. y = 54. Now we can find x using equation 1: x = 90 - y. x = 90 - 54. x = 36. Therefore, you should use 36 gallons of water and 54 gallons of methane to obtain a mixture of 90 gallons with a methane concentration of 60%.

To learn more about methane, https://brainly.com/question/31473733

#SPJ11

Consider the reaction 4FeS2 + 11O2 → 2Fe2O3 + 8SO2. If 8 moles of FeS2 react with 15 moles of O2, what is the limiting reactant? (3 points)


Select one:

a. FeS2

b. Fe2O3

c. O2

d. SO2

Answers

If 8 moles of FeS2 react with 15 moles of O2, the limiting reactant is O2.

WHAT IS LIMITING REACTANT:A limiting reactant is reactant that is totally consumed when the chemical reaction is completed.

According to this question, the following reaction was given: 4FeS2 + 11O2 → 2Fe2O3 + 8SO2.

4 moles of FeS₂ reacts with 11 moles of O₂

This means, 8 moles of FeS₂ will react with (8 × 11/2) = 22 moles of O₂

15 moles of O₂ is available. In comparison with 22 moles, O₂ is in short supply .

Therefore, If 8 moles of FeS2 react with 15 moles of O2, O₂ is the limiting reagent.

Learn more about limiting reactant at: https://brainly.com/question/14225536

Answer:

They are right it's O2

Explanation:

I accidently rated it low but it's 100% right

a chemistry student needs 85.0 g of dimethyl sulfoxide for an experiment. by consulting the crc handbook of chemistry and physics, the student discovers that the density of dimethyl sulfoxide is 1.10 g*cm^-3. calculate the volume of dimethyl sulfoxide the student should pour out. round your answer to significant digits.

Answers

The volume of Dimethyl sulfoxide the student should pour out is, 77.27ml

Since the 1960s, dimethyl sulfoxide (DMSO) has been used in humans for medical treatment and as a pharmacological agent. DMSO is now primarily used in the cryopreservation of stem cells, the treatment of interstitial cystitis, and as a penetrating vehicle for various drugs.

Dimethyl sulfoxide has a density of 1.10 g/103L, or 1.10 g/mL.

Now we develop the following argument:

If a volume of 1 mL is contained in 1.10 g of dimethyl sulfoxide

The volume of 85 g of dimethyl sulfoxide is then X mL.

Dimethyl sulfoxide: X = (85X1) / 1.10= 77.27ml

To know more about density visit

https://brainly.com/question/29775886

#SPJ4

What does a ground wire do?

Answers

Answer:

A ground wire helps those positive charges get to the ground in a safe, direct and controlled way, where they can be discharged without the risk of electrical shock or fire. Shock Absorber Excess electrical charges are common in any home.

Explanation:

:3

A scientist finds several hundred fish fossils in the dessert. This evidence best supports which of the following scientific Ideas?

Which answer should I do?​

A scientist finds several hundred fish fossils in the dessert. This evidence best supports which of the

Answers

Answer:

Explanation:

The only answer you can get would be that the area was once covered with water.

A glacier wouldn't allow the fish to move

Predators would likely eat more than they would leave behind as evidence.

If they developed limbs, at some of them would show up that way.

When asked why a chlorine atom gains one electron to form an anion with 1-charge a classmate ask " Because noble gas configuration are stable. " Is this statement generally true? Explain

Answers

Yes, this statement is generally true. A chlorine atom gains one electron to form an anion with a 1-charge because noble gas configurations are stable.

This is because noble gases have a full valence shell of electrons, which is the most stable electron configuration. By gaining one electron, the chlorine atom achieves the same electron configuration as the noble gas argon, making it more stable. This is why elements tend to gain or lose electrons in order to achieve the same electron configuration as the nearest noble gas.

Learn more about noble gas configuration:

https://brainly.com/question/7036466

#SPJ11

Why can Solids Support Objects Easier Than Fluids

Answers

Answer:

because the particles in solids are more close together and strong so they would support it better than fluid because fluid particles are spread out

Explanation:

Have A Wonderful Day !!

Due to properties of solid substances, they support objects easier than liquid.

Solids can support objects easier than fluids because in solid, particles are present on fix place as compared to liquid which is not fix and can move from one place to another. In Solid substances, particles are fix so they provides better support to the objects which are placed on them.

While on the other hand, in liquid substances particles are mobile so they are not considered better supporter for objects so we can conclude that due to properties of solid substances, they support objects easier than liquid.

Learn more: https://brainly.com/question/20688004

how many atoms make up a molecule of ethanol c2h6o

Answers

A molecule of ethanol (C2H6O) is composed of 9 atoms.

Breaking down the molecular formula: C2H6O

There are 2 carbon atoms (C2).

There are 6 hydrogen atoms (H6).

There is 1 oxygen atom (O).

In total, the molecule of ethanol contains 2 carbon atoms, 6 hydrogen atoms, and 1 oxygen atom, summing up to a total of 9 atoms.

A molecule of ethanol (C2H6O) consists of 2 carbon atoms (C), 6 hydrogen atoms (H), and 1 oxygen atom (O). Therefore, there are a total of 2 + 6 + 1 = 9 atoms in a molecule of ethanol.

Adding up the individual atoms, we get a total of 2 carbon atoms, 6 hydrogen atoms, and 1 oxygen atom, which sum up to 9 atoms in total.

To learn more about  atoms

https://brainly.com/question/17545314

#SPJ11

5.(08.02 MC)
A 0.0400 M NaCl solution was formed when 32.0 grams of NaCl was dissolved in enough water. What was the total volume of the solution formed? (5 points)
O 7.20 liters
9.80 liters
13.7 liters
18.1 liters

Answers

Answer:

13.7 liters

Explanation:

I took the test and got it right

The total volume of the NaCl solution whose molarity is 0.04 M is 13.7 liters.

What is molarity?

Molarity of any solution is define as the number of moles of solute present in per liter of the solution and it will be represented as:

M = n/V

Mass from moles will be calculated as:
n = W/M, where

W = given mass of NaCl = 32g

M = molar mass of NaCl = 58.44g/mol

mole = 32g / 58.44g/mol = 0.547 mol

Molarity of solution = 0.04 M

On putting values on the above equation, we get volume as:
V = 0.547 mol / 0.04mol/L

V = 13.67 L = 13.7L

Hence required value of volume is 13.7 L.

To know more about molarity, visit the below link:
https://brainly.com/question/489225

In the harber-bosch process, the reactant nitrogen is drawn from the air while the hydrogen is produced by burning methane gas (CH4) in a series of processes that can be simplified as: CH4 + 2H2O —> CO2 + 4H2 3a. A small ammonia plant used 123,000 g of H2 gas per day. Determine the mass of CO2 (in g) that will be released as the H2 is produced. Show all work

Answers

Answer:Main Answer:

The mass of CO2 released in the production of 123,000 g of H2 gas is 265,200 g.

Explanation: From the given equation, we can see that the production of 4 moles of H2 requires the combustion of 1 mole of CH4, resulting in the release of 2 moles of H2O and 1 mole of CO2. The molar mass of H2 is 2 g/mol, and the molar mass of CO2 is 44 g/mol. Therefore, the mass of CO2 released in the production of 123,000 g of H2 is (123,000/2) x (1/4) x 44 = 265,200 g.

An ion has 26 protons, 28 neutrons, and 24 electrons. Which element is this ion? a. Xe b. Ni c. Fe d. Mg e. Cr

Answers

The ion that has 26 protons, 28 neutrons, and 24 electrons is Iron (Fe) (option c).

An element can be determined by the number of protons in the nucleus of its atom. The number of protons present in an atom is referred to as the atomic number of the element.

This means that the number of protons in an atom is unique to a specific element.

Iron (Fe) has 26 protons in the nucleus of its atom.

Therefore, an ion with 26 protons is an ion of the element iron (Fe).

Magnesium (Mg) has 12 protons, Chromium (Cr) has 24 protons, Xenon (Xe) has 54 protons and Nickel (Ni) has 28 protons.

Thus, an ion which has 26 protons, 28 neutrons, and 24 electrons  is Fe (option c)

To learn more about proton:

https://brainly.com/question/1481324

#SPJ11

Suppose one wanted to make 4-methyl-2-phenyl-2-pentanol. If bromobenzene is used as one of the starting compounds, what other compound would be required in the preparation of this compound by a Grignard Synthesis? Show how the same alcohol could be prepared using a different bromo and different carbonyl compound from the above.

Answers

To prepare 4-methyl-2-phenyl-2-pentanol via a Grignard synthesis using bromobenzene as one of the starting compounds, we would need the other starting compound to be a ketone that contains a five-carbon chain.

One possible ketone that could be used is 2-pentanone, also known as methyl propyl ketone. The synthesis would proceed as follows:

React magnesium turnings with iodine to form activated magnesium.

Add the activated magnesium to dry ether to form a Grignard reagent.

Add bromobenzene to the Grignard reagent to form the phenylmagnesium bromide intermediate.

Add 2-pentanone to the reaction mixture to form the alcohol product.

The overall reaction can be represented as follows:

PhBr + Mg → PhMgBr (phenylmagnesium bromide)

PhMgBr + CH3CO(CH2)3CH3 → CH3CH(OH)CH(C6H5)CH2CH2CH3 (4-methyl-2-phenyl-2-pentanol)

To learn more about grignard reagent please visit0
https://brainly.com/question/30144052
#SPJ4

How does genetic variation play a role in evolution? I give Brainless

Answers

Answer:

Evolution is the process by which populations of organisms change over generations. Genetic variations underlie these changes

Explanation:

If a trait is advantageous and helps the individual survive and reproduce, the genetic variation is more likely to be passed to the next generation.

Brain-List?

Which of the following options correctly describe enolate formation for a ketone such as the one shown? Select all that apply.
a. Deprotonation of the alpha carbon
b. Formation of a double bond between the alpha carbon and carbonyl carbon
c. Loss of a proton from the carbonyl oxygen
d. Formation of a nucleophile

Answers

The following options correctly describe enolate formation for a ketone such as the one shown are:

a. Deprotonation of the alpha carbon

d. Formation of a nucleophile

For a ketone, the process of enolate formation involves the following options:

a. Deprotonation of the alpha carbon: This option is correct. Enolate formation involves the removal of a proton (deprotonation) from the alpha carbon adjacent to the carbonyl group. The resulting species is called an enolate.

b. Formation of a double bond between the alpha carbon and carbonyl carbon: This option is incorrect. Enolate formation does not involve the direct formation of a double bond between the alpha carbon and the carbonyl carbon. Instead, the enolate is formed as an intermediate, which may subsequently tautomerize to form an enol, where the double bond forms between the alpha carbon and the carbonyl carbon.

c. Loss of a proton from the carbonyl oxygen: This option is incorrect. In the process of enolate formation, a proton is not lost from the carbonyl oxygen. Instead, a proton is removed from the alpha carbon, resulting in the formation of the enolate.

d. Formation of a nucleophile: This option is correct. Enolate formation leads to the creation of a nucleophilic species. The negative charge that develops on the oxygen of the carbonyl group makes it nucleophilic, and the alpha carbon becomes electron-rich and capable of nucleophilic attack.

Therefore, correct options are:

a. Deprotonation of the alpha carbon

d. Formation of a nucleophile

To know more about enolate formation here

https://brainly.com/question/31558549

#SPJ4

Which statement is the best description of a chemical bond

Answers

a chemical bond holds atoms together

what is 2 + 2 + 2 -8-9-100

Answers

The Answer is:

-111.0

How many significant figures are in 0.0034 cm? a 2 b 3 c 1 d 4

Answers

Answer:

A. 2 sig figs

Explanation:

In the number 0.0034, the zeros are called leading zeros. The only function of leading zeros is to fix the decimal point. Leading zeros are not counted as significant figures.

Help!
Which of the following can scientists NOT interpret by examining fossils?
A. How earth's environment has changed overtime.
B. How plants and animals have changed overtime.
C. The age of certain layers of rocks. D. How the pull of gravity has changed.​

Help!Which of the following can scientists NOT interpret by examining fossils? A. How earth's environment

Answers

D. How the pull of gravity has changed.

Answer the questions about the following reaction. 4al(s) + 3o2(g) 2al2o3 (s) how many molecules of o2 are used in the reaction? how many oxygen atoms are required? how many moles of al2o3 are formed? what is the mole ratio of al to o2?.

Answers

The mole ratio of Al to O2 is 4:3

The reaction is 4Al(s) + 3O2(g) -> 2Al2O3(s)

Four molecules of O2 are used in the reaction.

Twelve oxygen atoms are required in the reaction.

2 moles of Al2O3 are formed in the reaction.

The mole ratio of Al to O2 is 4:3, meaning that 4 moles of Al react with 3 moles of O2 to form 2 moles of Al2O3.

It is important to note that these ratios refer to the stoichiometry of the reaction, which is a measure of the relative amounts of reactants and products involved in a chemical reaction. The stoichiometry of a reaction is a fundamental concept in chemistry and is used to predict the amount of products that will be produced from a given amount of reactants, as well as to understand the underlying mechanisms of chemical reactions.

Learn more about mole:

brainly.com/question/26416088

#SPJ4

Patience, a popular card game in Mendeleev's time, is also known as Go Fish.
A. True
B. False

Answers

Answer:

B. False

Explanation:

step by step explanation

Answer:

False

Explanation:

Is brass a heterogeneous or homogeneous mixture ??????

Answer me first and right and then I promise you I will mark you the brainliest.

Also 20 points

Answers

Answer:

Brass is a homogenous mixture of copper and zinc

Hope it helped u, plz put thanks

Answer:

Brass is an alloy made up of uniform composition of copper and zinc. It is a homogeneous mixture in which zinc and copper can be varied to create a range of brasses with varying properties.

Explanation:

Hope it helps jenita or jeni , ya jenny

Wind is moving particles of air. Wind can be gentle or strong. Often, wind can cool you off on hot, sunny days near the ocean and lakes. Look at the look at this photograph for signs of wind blowing. How can we use the movement of air to predict pressure and temperature? Which way is the wind blowing in relation to the land and ocean?

Wind is moving particles of air. Wind can be gentle or strong. Often, wind can cool you off on hot, sunny

Answers

Differences in temperature lead to variations in density between warm and cold air, causing hot-air masses to rise up while cooler ones sink down. This vertical motion sets off two distinct atmospheric zones: one with low-pressure beneath ascending hot-air parcels and another featuring high-pressure atop descending cool-air pockets.

Consequently, wind results from airflow travelling from spots with higher-pressure zones towards locations with lower ones — faster winds indicate more potent differences in these pressures.

Which way is the wind blowing in relation to the land and ocean?

It's apparent that in this image winds seem to be moving seamlessly across waters onto lands; However, it's worth noting that such movement has underlying principles governing these movements. One such mechanism involves heating disparities between waters and soils where warming rates vary depending on numerous factors.

Consequently, the formerly mentioned disparities in heating engender differences in temperature gradients wherein colder denser air over oceans results in areas of high pressure while warmer rising air forms low-pressure pockets over land. This creates a powerful force that moves winds from cold marine regions towards hot continental regions.

Learn about pressure here https://brainly.com/question/28012687

#SPJ1

A temperature change of 51 deg * C would be equivalent to a temperature change of

Answers

i don't know if you mean C° to F° but in F° the change would be 123.8°

What equipment is used for
filtration?

Answers

Answer:

Filtration paper is equipment is used for

filtration.

Hope it helps

Mark me as brainliest please

Have a nice day ahead

Which of the following statements is true about osmoses? A. Osmosis will always cause crenation in cells.B. Only water and small solute particles travel through the semipermeable membrane.C.Only solute particles travel through the semipermeable membrane.D.Water will flow from high solute concentration to low solute concentration.E.none are correct

Answers

Osmosis is the movement of water through a semipermeable membrane.

From the given choices none of them is completely true.

Osmosis not always causes crenation.

In osmosis, solute particles do not travel through the membrane.

And water flows from a low solute concentration to a high solute concentration.

It means that the correct answer is E. none are correct.

Other Questions
y. if the relative intensity of a sound is multiplied by 10 and results in a loudness of 120 decibels, what was the relative intensity of the original sound? In what way does the self-interest of a butcher or baker benefit you or me? when vela arrives at the office with her mother, who has a limited english vocabulary, she asks whether she can stay during her mother's examination to help translate and lend support. as the preliminary examination begins, it becomes apparent that vela is speaking for her mother and is not allowing her to answer questions concerning her own health. how would you handle this situation? provide details and examples in your response. Considering the evolution of currency in our country, what were some of the negative aspects of previously used currency? what are the positive aspects of the currency we use today? labor on rice plantations in South Carolina and Georgia was generally done byA.task labor B.gang labor C.overseers. D.women and children. NEED HELP PLEASEEEE!!!! I WILL MARK!!!Q.15A real estate company balances the books for its business on the first day of each month. It hopes to sell houses every other day of the month. The average number of houses, S, the company sells each day, t, is represented by the inverse of the function Inverse of S is equal to the quantity t squared plus 4 times t minus 5 end quantity over the quantity t squared minus 7 times t plus 6 end quantity Which equation represents the average sales each day for the real estate company? A. S equals the quantity 6 times t plus 5 end quantity over the quantity t minus 1 end quantity B. S equals the quantity 6 times t minus 5 end quantity over the quantity t plus 1 end quantity C. S equals the quantity t minus 5 end quantity over the quantity t plus 6 end quantity the structure of the dna determines which amino acids are put together to form a specific protein which is used to carry out out the essential functions of life. The school of thought in psychology that turned away from the study of consciousness during the first half of the last century was called Explain, in detail to your friend what net working capital is. Your explanation should (6) include details with regards to the different components of net working capital. What scientific area was the most developed at the beginning of the academic-discipline movement? At a local restaurant, every 10th customer was asked their opinion of the service at the restaurant as they exited. What sampling technique was used The measures used by a crna researcher to maintain uniformity of conditions in a quantitative research study refer to:___________. 100 POINTS AND BRAINLIEST FOR BEST ANSWER!!Marine iguanas are large lizards that live in the Galpagos Islands. They feed on algae growing on rocks at the edge of the sea. When an El Nio event occurs, the sea around the islands becomes warmer, and the algae do not grow as rapidly as they do during typical temperatures. Scientists studies the relationship between the size of male iguanas on one of theGalapagos Islands and their survival during typical temperatures or during an El Nino event. The data are shown in the graph. Based on the data, identify which size male iguanas are most affected by an El Nio event AND explain the MOST LIKELY cause for this size of male iguanas to be affected more than other sizes. a hypothetical population of 200 cats has two alleles, tl and ts, for a locus that codes for tail length. the table below describes the phenotypes of cats with each possible genotype, as well as the number of individuals in the population with each genotype. which statements about the population are true? enry holds that directors are more the ""authors"" of a film than are the writers. to what film theory does he ascribe? a. grand theory b. medium essentialism c. medium specificity d. auteur theory\ grocery stores place selected items on end caps at the ends of aisles where customers are more likely to notice them. they do this because consumers are likely to buy things they hadn't planned to buy when they see them, or make multiple choice purchases from their evoked set. purchases from their inept set. impulse purchases. extended problem-solving decisions. limited problem-solving decisions the nurse administers acetaminophen 325 mg and codeine 30 mg orally to a patient reporting a severe headache. when should the nurse reassess the patient's pain? What was the purpose of John Wheatley's letter to the publisher of Phillis Wheatley's poems? You want to buy a house and will need to borrow $210,000. the interest rate on your loan is 5.35 percent compounded monthly and the loan is for 25 years. what are your monthly mortgage payments? How are physical and chemical changes similar? (2 points) Group of answer choices Neither can change the number of atoms of each element that are present. Neither can cause chemical bonds to break. Neither can result in a phase change. Neither can cause a substance to give off heat or light.