The sound waves from the siren will reflect off the smooth surface of the wall. The light waves from the emergency vehicle will reflect off the smooth surface of the wall. Rougher sections of the wall surface will cause the light waves from the emergency vehicle to scatter.
When sound waves hit a smooth surface, they reflect off the surface in a predictable way called the law of reflection. So, the sound waves from the siren will reflect off the smooth surface of the wall.
Similarly, light waves also follow the law of reflection when they hit a smooth surface. Therefore, the light waves from the emergency vehicle will also reflect off the smooth surface of the wall.
However, when light waves encounter a rough surface, they scatter in all directions due to the irregularities on the surface. Therefore, rougher sections of the wall surface will cause the light waves from the emergency vehicle to scatter.
To learn more about sound waves, here
https://brainly.com/question/21995826
#SPJ1
2Ca+1O2 -> 2CaO
How many grams of calcium is used in this reaction, if 15.0g calcium oxide are produced
20. (01.08 MC)
Alchemy is a branch of ancient knowledge that states that all matter is composed of air, fire, earth, ar
Which of these best explains whether alchemy is a science or pseudoscience? (4 points)
It is a science because all matter is known to be made of elements.
it is a science because air, fire, earth, and water all are forms of matter.
It is pseudoscience because all matter is known to be made of atoms.
It is pseudoscience because ancient knowledge is mystical yet reliable.
It is pseudoscience because each metal is known to be a unique element alchemy is a science or pseudoscience.
What is a matter in chemistry?Matter is anything that occupies space and has mass; in other respects, matter is the "thing" that the cosmos is made of. The fundamental constituents of all stuff are called elements. These are not changed into other elements by conventional chemical processes and have distinct chemical and physical properties.
What does matter consist of?Matter can be solid, liquid, or gaseous on Earth. Solid particles, fluids, and gases are supported by the exceptionally small building components known as atoms and molecules. A solid's component particles are attracted to one another strongly. They are close to one another and vibrate en position without passing each other.
To know more about Matter visit:
https://brainly.com/question/28945834
#SPJ13
The complete question is -
Alchemy is a branch of ancient knowledge that states that all matter is composed of air, fire, earth. Which of these best explains whether alchemy is a science or pseudoscience?
A-It is a science because all matter is known to be made of elements.
B-It is a science because air, fire, earth, and water all are forms of matter.
C-It is pseudoscience because all matter is known to be made of atoms.
D-It is pseudoscience because ancient knowledge is mystical yet reliable.
E-It is pseudoscience because each metal is known to be a unique element.
You want to make a bracelet and have two materials: gold and silver. The bracelet needs to be eight inches long. You want to use the least amount of material possible and can only make the bracelet out of gold or silver. What would you need to know about each atom, and how would this information help you make a decision? Explain.
Answer:
I'm going to call the length of the bracelet the number of times you have to add to get back to the first bead. This is the same as the number of beads, except in one case:
The shortest bracelet has length 1 and starts with (0,0). If you add one time, you get back to the first 0. But the bracelet has two beads. (Every bracelet has to have at least two beads to start.) The next shortest bracelet starts with (0,5), and has length 3: 0 5 5.
There is a bracelet of length 4 that starts with (2,6) (the first example on the main page):
2 6 8 4
There is a bracelet of length 12 that starts with (1,3) (the second example on the main page):
1 3 4 7 1 8 9 7 6 3 9 2
There is a bracelet of length 20 that starts with (0,4)
0 4 4 8 2 0 2 2 4 6 0 6 6 2 8 0 8 8 6 4
There is a bracelet of length 60 that starts with (0,1)
Calculate the pH of a solution that is a mixture of 0.035M HNO3, 0.40M CH3COOH, and 0.045M HI. Ka for CH3COOH = 1.8 × 10-5
1.22
0.92
1.35
1.52
1.10
To calculate the pH of the solution, we need to first determine the concentration of H+ ions in the solution.
HNO3 is a strong acid, so it will dissociate completely to form H+ and NO3- ions. HI is also a strong acid and will dissociate completely. CH3COOH is a weak acid and will partially dissociate according to the following equation:
CH3COOH + H2O ⇌ CH3COO- + H3O+
To determine the concentration of H+ ions, we need to find the equilibrium concentration of H3O+ from the dissociation of CH3COOH. We can use the expression for the acid dissociation constant (Ka) of CH3COOH to find this concentration:
Ka = [CH3COO-][H3O+]/[CH3COOH]
1.8 × 10-5 = (x)(x)/(0.40 - x)
where x is the equilibrium concentration of H3O+.
Assuming that x << 0.40, we can simplify the equation to:
1.8 × 10-5 = x2/0.40
Solving for x, we get:
x = 1.34 × 10-3 M
The total concentration of H+ ions in the solution is then:
(0.035 M) + (1.34 × 10-3 M) + (0.045 M) = 0.08034 M
The pH of the solution can be calculated using the expression:
pH = -log[H+]
pH = -log(0.08034) = 1.09
Therefore, the closest option to the calculated pH value of the solution is 1.22.
To know more about strong acid, visit :
https://brainly.com/question/16749233
#SPJ1
1. A student is titrating 0.61 M KOH with 14.5 mL of 0.47 M H2SO4
ii. What volume of 0.61 M KOH is needed to titrate the H2SO4?
ii. What mass of water can be produced if 131 g of the H2SO4 solution react with 225 mL
of 0.61 M KOH?
Can someone help me with this?
Answer:
M KOH = 0.61 M
V H2SO4 = 14.5 ml
M H2SO4 = 0.47 M
Volume KOH = ?
( V . M . valensi) KOH = (V . M . valensi) H2SO4
V . 0.61 . 1 = 0.47 . 14.5 . 2
V KOH = (0.47 . 14.5 . 2) / 0.61
V KOH = 22.34 ml
see more the answer at the pic
Aluminum can be made by reducing alumina Al2O3 by carbon in the reaction equation
2 Al2O3 + 3 C → 4 Al + 3 CO2
according to. How much carbon is needed to reduce Al2O3 to produce 491 grams of pure aluminum? To give an answer to the gram, be sure to add the unit g after the numerical value of your answer.
Taking into account the reaction stoichiometry, 163.67 grams of C is needed to reduce Al₂O₃ to produce 491 grams of pure aluminum.
Reaction stoichiometryIn first place, the balanced reaction is:
2 Al₂O₃ + 3 C → 4 Al + 3 CO₂
By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:
Al₂O₃: 2 molesC: 3 molesAl: 4 molesCO₂: 3 molesThe molar mass of the compounds is:
Al₂O₃: 102 g/moleC: 12 g/moleAl: 27 g/moleCO₂: 44 g/moleThen, by reaction stoichiometry, the following mass quantities of each compound participate in the reaction:
Al₂O₃: 2 moles ×102 g/mole= 204 gramsC: 3 moles ×12 g/mole= 36 gramsAl: 4 moles×27 g/mole= 108 gramsCO₂: 3 moles×44 g/mole= 132 gramsMass of carbon requiredThe following rule of three can be applied: if 108 grams of Al are produced by 36 grams of C, 491 grams of Al are produced by how much mass of C?
mass of C= (491 grams of Al× 36 grams of C)÷ 108 grams of Al
mass of C= 163.67 grams
Finally, 163.67 grams of C is required.
Learn more about the reaction stoichiometry:
brainly.com/question/23035393
brainly.com/question/24741074
brainly.com/question/21683406
brainly.com/question/24653699
#SPJ1
The heat capacity of copper metal is 0.38 J/goC. Assume you had a 75 g cube of copper at 25.0oC. What would the final temperature of the copper be (in oC) if it absorbed 150 J of heat?
The final temperature of the copper would be 30.26°C if it absorbed 150 J of heat.
To solve this problem, we can use the formula:
q = m * C * deltaT
where q is the heat absorbed by the copper, m is the mass of the copper, C is the heat capacity of copper, and deltaT is the change in temperature.
Rearranging the formula, we get:
deltaT = q / (m * C)
Substituting the given values, we get:
deltaT = 150 J / (75 g * 0.38 J/g°C) = 5.26 °C
Therefore, the final temperature of the copper will be:
25.0°C + 5.26°C = 30.26 °C
Learn more about heat capacity, here:
https://brainly.com/question/28302909
#SPJ1
In a coffee-cup calorimeter, 1.60 g of NH4NO3 was mixed with 75.0 g of water at an initial temperature of 25.008C. After dissolution of the salt, the final temperature of the calorimeter contents was 23.348C.
Required:
a. Assuming the solution has a heat capacity of 4.18 J 8C21 g21, and assuming no heat loss to the calorimeter, calculate the enthalpy of solution (DHsoln) for the dissolution of NH4NO3 in units of kJ/mol.
b. If the enthalpy of hydration for NH4NO3 is 2630. kJ/mol, calculate the lattice energy of NH4NO3.
Answer:
Explanation:
mass of the solution m = 1.6 + 75 = 76.6 g
fall in temperature = 25 - 23.34 = 1.66°C
heat absorbed = mass x specific heat x fall in temperature
= 76.6 x 1.66 x 4.18
= 531.5 J .
= .5315 kJ .
mol weight of ammonium nitrate = 80 g
heat absorbed by 1.6 g = .5315 kJ
heat absorbed by 80 g or one mole = 26.575 kJ
enthalpy change ΔH = +26.575 kJ
b )
enthalpy of hydration = 2630 kJ / mol
lattice energy = enthalpy of hydration + enthalpy change
= 2630 + 26.575
= 2656.575 kJ .
How many electrons are in the n = 2 shell of a magnesium atom?
Answer:
eight
Explanation:
That means there are 12 electrons in a magnesium atom
hope this helps
Consider the equilibrium of methanol vapor and the liquid.
CH₂OH(1) CH₂OH(g)
What is the vapor pressure of the methanol at -30 °C?
What is the vapor pressure of the methanol at 40 °C?
Thermodynamic Table at 25 °C
Substance AH; (kJ/mol) S (J/mol-K) AG; (kJ/mol)
CH₂OH(1)
126.8
CH₂OH(g)
239.9
Pvap 5
Pap
=
=
-239.2
-201.0
-166.6
-162.3
atm
atm
The vapor pressure of methanol at 40°C is 0.234 atm.
What distinguishes ethanol from methanol?Only two types of alcohol are methanol and ethanol. Ethanol, sometimes referred to as ethyl alcohol, has a chemical composition of two carbon atoms. Methanol, sometimes referred to as methyl alcohol, is made up of just one carbon atom.
ln(P2/P1) = (ΔHvap/R) x (1/T1 - 1/T2)
ΔGvap = -RTln(Pvap/P) = ΔHvap - TΔSvap
ΔGvap = -RTln(Pvap/P) = -166.6 kJ/mol
ΔSvap = S(g) - S(l) = 239.9 J/mol-K - 126.8 J/mol-K = 113.1 J/mol-K
ΔHvap = ΔGvap + TΔSvap = -166.6 kJ/mol + (298.15 K)(113.1 J/mol-K) = -134.6 kJ/mol
Now we can use the Clausius-Clapeyron equation to find the vapor pressure of methanol at -30°C and 40°C.
At -30°C, we have:
T1 = 25°C + 273.15 = 298.15 K
T2 = -30°C + 273.15 = 243.15 K
ΔHvap = -134.6 kJ/mol
R = 8.314 J/mol-K
ln(P2/5 atm) = (-134.6 kJ/mol / 8.314 J/mol-K) x (1/298.15 K - 1/243.15 K)
P2 = 0.0038 atm
Therefore, the vapor pressure of methanol at -30°C is 0.0038 atm.
At 40°C, we have:
T1 = 25°C + 273.15 = 298.15 K
T2 = 40°C + 273.15 = 313.15 K
ΔHvap = -134.6 kJ/mol
R = 8.314 J/mol-K
ln(P2/5 atm) = (-134.6 kJ/mol / 8.314 J/mol-K) x (1/298.15 K - 1/313.15 K)
P2 = 0.234 atm
To know more about vapor pressure visit:-
https://brainly.com/question/11864750
#SPJ1
In a 0.25 M solution of HA (a weak acid), 1.0 % if the HA is ionised.
a) Calculate the actual concentration of HA, H₂O ^+ and A^- in this solution ?
Answer:
dunno
Explanation:
Why is molecular polarity important for life?
Molecular polarity is important for life because it plays a crucial role in many biological processes.
What is molecular polarity?Molecular polarity refers to the distribution of electrical charge within a molecule. It is a property that results from differences in the electronegativity of the atoms in a molecule.
Molecular polarity is important for life because many biological molecules, including proteins, DNA, and carbohydrates, are polar, meaning they have regions of positive and negative charge.
This allows them to interact with other polar molecules, such as water, through hydrogen bonding, which helps to stabilize their structures and maintain their functionalities.
More on molecular polarity can be found here: https://brainly.com/question/4248472
#SPJ1
Cooking Oil
Specific Heat (J/g°C)
Corn oil
2.50
Olive oil
1.96
Sesame oil
1.63
Soybean oil
1.97
Vegetable oil
1.67
Based on the table above,
___ oil would
transfer heat the best because its specific heat is
the _____
Answer:
Sesame oil
lowest
Explanation:
bruh
Based on the table provided, corn oil would transfer heat the best because its specific heat is the highest.
Specific heat is a measure of the amount of heat energy required to raise the temperature of a substance by a certain amount. A higher specific heat value indicates that the substance can absorb more heat energy without a significant increase in temperature.
In the given table, corn oil has the highest specific heat value of 2.50 J/g°C. This means that corn oil can absorb a relatively larger amount of heat energy per gram compared to the other oils listed. Consequently, corn oil would be more effective in transferring heat compared to the other oils listed, as it can store and release more heat energy per unit mass.
Learn more about Specific heat from the link given below.
https://brainly.com/question/31608647
#SPJ2
Give the formula of Plaster of Paris And some of its uses..
:))
A 1.00 M sample HI is placed in a 1-L vessel at 460°C, and the reaction system is allowed to come
to equilibrium. The Hl partially decomposes, forming Hz and I2. What is the equilibrium
concentration of HI if the equilibrium constant is 52.8?
H2(g) + 12(g) = 2 HI(g) at 460°C?
Answer:
[HI] = 0.784M
[I₂] = 0.108M
[H₂] = 0.108M
Explanation:
Based on the equilibrium reaction:
H₂(g) + I₂(g) ⇄ 2HI(g)
The equilibrium constant, K, is:
K = 52.8 = [HI]² / [H₂] [I₂]
Where [] are equilibrium concentrations of each gas.
As initial concentration of HI is 1.00M, the equilibrium concentrations of the gases is:
[HI] = 1.00M - 2X
[I₂] = X
[H₂] = X
Replacing:
52.8 = [1.00-2X]² / [X] [X]
52.8X² = 4X² - 4X + 1
0 = -48.8X² - 4X + 1
Solving for X:
X = -0.1899M. False solution, there is no negative concentrations
X = 0.108M. Right solution.
Replacing, equilibrium concentrations are:
[HI] = 1.00M - 2*0.108M
[HI] = 0.784M[I₂] = 0.108M[H₂] = 0.108Mdoes the reaction Fe + CuNO3 occur
Answer:
yes
Explanation:
how is matter described?
Answer:Matter is defined as anything that has mass and takes up space (it has volume). ... Volume is the amount of space something occupies. Words such as big, little, long, or short are used to describe volumes.
Explanation:
How many grams of a 26.9% sugar solution contain 49.0 g of sugar?
Answer:
182.156g
Explanation:
grams = 49/.269 = 182.156g needed
How many grams of Cl are in 31.2g CF2Cl2
Answer:
Mass = 42.6 g
Explanation:
Given data:
Mass of CF₂Cl₂ = 31.2 g
Mass of Cl₂ = ?
Solution:
Number of moles of CF₂Cl₂ = mass/molar mass
Number of moles = 31.2 g/121 gmol
Number of moles = 0.3 mol
1 mole of CF₂Cl₂ contain 2 moles of Cl atom.
0.3 mol × 2 = 0.6 mol
Mass of Cl₂:
Mass = number of moles × molar mass
Mass = 0.6 mol × 71 g/mol
Mass = 42.6 g
What are the possible values of 1 and m for
n=4 ?
Answer:
If n = 4, then the possible values of 1 and m depend on the equation or expression being used. Without more information, it is impossible to determine what the possible values of 1 and m might be. Can you please provide more context or information about the problem you are trying to solve?
What is the half-life for I-131 in hours? show workThe half-life for I-131 is 8 days
We know that there are 24 hours in 1 day. We will use that conversion to go from days to hours.
1 day = 24 hours
half life = 8 days = 8 days * 24 hours/(1 day)
half life = 192 hours
Answer: the half-life for I-131 is 192 hours.
31.7 grams of water form based on the following equation. What was the change in heat
for the reaction?
CH4 + 2 O2 → CO₂ + 2 H₂O
ΔΗ = -890.8 kJ/mol
31.7 g of water formation in the given reaction releases 783.02 kJ of heat energy.
The change in heat in the given equation is -890.8 kJ/mol. This means that when one mole of CH4 reacts with 2 moles of O2, it produces one mole of CO2 and 2 moles of H2O while releasing 890.8 kJ of heat energy.Now, we have to find out how much heat energy will be released when 31.7 g of water is formed. To do this, we need to first calculate the number of moles of water formed from 31.7 g of H2O.Molar mass of H2O = 2 × 1.008 + 15.999 = 18.015 g/molNumber of moles of H2O = 31.7 g / 18.015 g/mol = 1.759 molNow we know that 2 moles of H2O are formed when 1 mole of CH4 reacts. Therefore, the number of moles of CH4 required to produce 1.759 mol of H2O will be:1 mole of CH4 : 2 moles of H2Ox moles of CH4 : 1.759 moles of H2Ox = 1.759/2 = 0.8795 molSo, 0.8795 moles of CH4 are required to produce 1.759 moles of H2O. And the heat released during the reaction of 0.8795 mol CH4 can be calculated using the given change in heat.ΔH = -890.8 kJ/molHeat released during the reaction of 0.8795 mol CH4= ΔH × number of moles= -890.8 kJ/mol × 0.8795 mol= -783.02 kJ.
for more questions on heat
https://brainly.com/question/30738335
#SPJ8
A compound has an empirical formula of C3H10 and a molar mass of 92.26 g/mol. What is its
molecular formula?
Answer:
C6H20
Explanation:
Use this formula to convert emperical to molecular:
Actual mm (molar mass) = n(emperical mm)
Emperical mm:
C3H10= 3(12.01)+10(1.01)=46.04g/mol
Now plug in:
92.26=n(46.04)
n=2.00391
Round it as 2
Then take the n value and multiply it with the subscripts of the emperical formula:
(C3H10)2
C6H20
What changes sodium pellets to liquid
Answer:
when placed in water, a sodium pellet catches on fire as hydrogen gas is liberated and sodium hydroxide forms. chemical change = fire is a sign of chemical reaction.
Explanation:
When placed in water the sodium pellets catch the fire and liberate the hydrogen gas. On mixing with water solid sodium forms a colorless basic solution.
What are the properties of sodium?Sodium is a soft metal. It is a very reactive element with a low melting point. Sodium reacts very quickly with water, snow, and ice to produce sodium hydroxide and hydrogen. It is an alkali metal and the sixth most abundant metal on earth. It has a silvery white color.
It has a strong metallic luster. On reacting with oxygen it produces sodium oxide which on reacting with the water produces sodium hydroxide.
It is used to improve the structure of certain alloys and soaps. It is also used in the purification of metals. Sodium is also present in sodium chloride, an important compound found in the environment.
To learn more about sodium, refer to the link:
https://brainly.com/question/29327783
#SPJ2
Fission
1.Uranium-235 decays naturally, by alpha decay. Write the balanced decay equation below. (5 points)
2.Uranium-235 has a half-life of about 700 million years. If 1 kg of U-235 is put on a shelf in a laboratory, how much of it will be left after 700 million years? (5 points)
.Uranium-235 is a popular choice of fuel for nuclear reactors. But U-235 doesn't always fission the same way. Below are three ways it can split. Complete the nuclear equations so they balance. (6 points)
days. After 1 kg of U-235 undergoes fission, the mass of the products is 8.4 x 10-4 kg less than the initial 1 kg. How much energy was produced by the fission of 1 kg of U-235? (Hint: Use Einstein's equation, E = mc2, where E is energy in Joules, m is mass in kilograms, and c is the speed of light, 3 x 108 m/s.) (8 points
Fusion
5.The fusion of two hydrogen isotopes is shown below. Complete the nuclear equation so it balances. (5 points)
6.If 1 kg of fuel is used in the above fusion reaction, the resulting helium has a mass of 0.993 kg. In other words, 0.007 kg of mass is converted to energy. How much energy is produced by the fusion of 1 kg of hydrogen? (Hint: Use Einstein's equation, E = mc2, where E is energy in Joules, m is mass in kilograms, and c is the speed of light, 3 x 108 m/s.) (6 points)
Alternative Energy
7.Hydrogen fuel cells combine hydrogen and oxygen to produce water and energy. Assume 1 kg of fuel is used, and the mass of the water produced is 1.10 x 10-11 kg. How much energy is produced by this fuel cell? (Hint: Use E = mc2.) (7 points)
btw i can predict the future and i can see that a dude named jamescodwell is gonna answer this question
Answer:
Fission
1.Uranium-235 decays naturally, by alpha decay. Write the balanced decay equation below. (5 points)
235/92 U = 231/90 Th + 4/2 He (i couldn't type the arrow thingy)
2.Uranium-235 has a half-life of about 700 million years. If 1 kg of U-235 is put on a shelf in a laboratory, how much of it will be left after 700 million years? (5 points)
1/2 kg of u-235 I think
3.Uranium-235 is a popular choice of fuel for nuclear reactors. But U-235 doesn't always fission the same way. Below are three ways it can split. Complete the nuclear equations so they balance. (6 points)
it can split into Be-56, Pu-52, and un 36.
4. Instead of allowing 1 kg of U-235 to decay naturally, imagine it is used as fuel in a nuclear
reactor. It is bombarded with neutrons, causing it all to fission in a matter of days. After 1 kg of U-235 undergoes fission, the mass of the products is 8.4 x 10-4 kg less than the initial 1 kg. How much energy was produced by the fission of 1 kg of U-235? (Hint: Use Einstein's equation, E = mc2, where E is energy in Joules, m is mass in kilograms, and c is the speed of light, 3 x 108 m/s.) (8 points)
Energy = mc2
Energy = (8.4 x 10^- 4) (3 x 10^8) ^2
Energy = 7.56 x 10^13
there will be about 75600000000000 or 7.56 x 10^13 joules of energy produced by the fission of 1 kilogram of uranium 235
(fact: this one problem alone took me 20 min of checking and rechecking and redoing and starting over to do, and I'm still pretty sure I got the number of 0's at the end wrong lol, though lucky for me I'm in honor's algebra so it didn't take me like 2 years to find the answer UWU)
Fusion
5.The fusion of two hydrogen isotopes is shown below. Complete the nuclear equation so it balances. (5 points)
2/1 H +2/1 H = 4/2 He + 1/0 N
wow this actually makes sense now
6.If 1 kg of fuel is used in the above fusion reaction, the resulting helium has a mass of 0.993 kg. In other words, 0.007 kg of mass is converted to energy. How much energy is produced by the fusion of 1 kg of hydrogen? (Hint: Use Einstein's equation, E = mc2, where E is energy in Joules, m is mass in kilograms, and c is the speed of light, 3 x 108 m/s.) (6 points)
6.3 x 10^14 joules of energy
Alternative Energy
7.Hydrogen fuel cells combine hydrogen and oxygen to produce water and energy. Assume 1 kg of fuel is used, and the mass of the water produced is 1.10 x 10-11 kg. How much energy is produced by this fuel cell? (Hint: Use E = mc2.) (7 points)
5.76 x 10^7 joules of energy.
Comparison
8.Complete the following table and questions. (8 points)
Reaction Mass "Lost" Energy Produced
Fission of 1 kg of U-235 1/2 kg 7.56 x 10^13 joules
Fusion of 1 kg of hydrogen 1/3 kg 6.3 x 10^13 joules
Fuel cell with 1 kg of hydrogen and oxygen 1/3 kg 5.4 x 10^13 joules
Which type of reaction "loses" the most mass?
the fission reaction of 1 kilogram of uranium 235
Which type of reaction produces the most energy? Why?
also the fission reaction of 1 kilogram of uranium 235, one reason that I think it is the reaction that produces more energy than the two other reactions is because of its "mass lost" since it lost 1/6 more mass than the other two reactions, or it might just be the elements that they use since they used uranium for fission, hydrogen for fusion, and hydrogen and oxygen for cell fueling.
Explanation:
A copper sulphate solution has a molar absorptivity value of 20 L mol-1 cm-1. Beta -carotene is an organic compound found in vegetables and is responsible for the color of carrots. Its molar absorptivity is 100,000 L mol-1 cm-1. Which compound is easier to be detected at low concentration using spectrophotometer?
Answer: beta-carotene
Explanation: The molar absorptivity is a measure of how strongly a compound absorbs light at a specific wavelength. The higher the molar absorptivity, the more strongly the compound absorbs light, and the easier it is to detect at a low concentration.
In this case, beta-carotene has a much higher molar absorptivity than copper sulphate. Beta-carotene has a molar absorptivity of 100,000 L mol-1 cm-1, while copper sulphate has a molar absorptivity of only 20 L mol-1 cm-1.
Therefore, beta-carotene is much easier to detect at low concentrations using a spectrophotometer. Even at low concentrations, beta-carotene will absorb a significant amount of light, while copper sulphate will absorb much less. This means that beta-carotene can be detected at lower concentrations than copper sulphate, making it easier to detect and quantify using a spectrophotometer.
what are 2 ways that all hydrocarbons are alike?
Answer:
Composition: All hydrocarbons are made up of only two types of atoms: carbon and hydrogen. They are like building blocks that contain carbon and hydrogen stuck together.
Organic Nature: Hydrocarbons are special because they are part of a group of compounds that come from living things or things that were once alive. They have carbon and hydrogen in them, which is what makes them different from other types of compounds.
Explanation:
Eglin land animals have evolved to produce eggs with the tough shells to ensure that
A.external fertilization can take place
B. The egg and the sperm can fuse
C. Parental care is unnecessary
D. The developing embryo does not dry out
Answer:
c
Explanation:
parrntal care is unnecessary
Answer: well, I think the answer is D
Explanation: I mean it is for protection, but it doesn't do a very good job but to not let the embryo dry out in land it does a good job at that
Predict and explain the structure of the major and minor products when hydrogen bromide is added to 2-methylbut-2- ene, (Ch3)2CCHCH3
Pls help with homework!!!!
When hydrogen bromide (HBr) is added to 2-methylbut-2-ene ((CH3)2CCHCH3), an electrophilic addition reaction takes place, where the π bond of the alkene is broken, and the hydrogen and bromine atoms are added to the resulting carbocation.
The reaction proceeds through a Markovnikov addition, where the hydrogen atom attaches to the carbon atom with the greater number of hydrogen atoms.
In this case, the initial addition of HBr to 2-methylbut-2-ene leads to the formation of a primary carbocation, as the positively charged carbon atom only has one alkyl group attached to it. The primary carbocation is relatively unstable, and it can undergo a rearrangement to form a more stable secondary carbocation.
The major product that is typically obtained is the 2-bromo-2-methylbutane. The hydrogen atom from HBr adds to the carbon with three hydrogen atoms (the more substituted carbon), resulting in the formation of a secondary carbocation.
On the other hand, a minor product is also formed, which is 3-bromo-2-methylbutane. This product arises from the addition of HBr to the primary carbocation, which is less stable. Although the primary carbocation is less favored, it can still be formed and lead to the formation of the minor product.
In summary, the addition of HBr to 2-methylbut-2-ene yields two products: the major product is 2-bromo-2-methylbutane, resulting from the addition of HBr to the more stable secondary carbocation, and the minor product is 3-bromo-2-methylbutane, originating from the less stable primary carbocation.
For more such questions on electrophilic addition visit:
https://brainly.com/question/9643304
#SPJ8
How do you out pizza the hut?