The circumference of a circular pool is 7.8 meters. Find its diameter, rounded to one decimal place.

Answers

Answer 1

Given:

a.) The circumference of a circular pool is 7.8 meters.

Recall: The formula for getting the circumference of a circle.

 Circumference = πd

Where,

d = diameter of the circle

We get,

 Circumference = πd 7.8 m = πd 7.8π m = d 7.83.14 m = d 2.4840764331 m = d  2.5 m  d 

Therefore, the diameter of the circular pool is 2.5 m


Related Questions

A market research firm supplies manufacturers with estimates of the retail sales of their products from samples of retail stores. Marketing managers are prone to look at the estimate and ignore sampling error. A random sample of 36 stores this year shows mean sales of 83 units of a small appliance with a standard deviation of 5 units. During the same point in time last year, a random sample of 49 stores had mean sales of 78 units with standard deviation 3 units.Required:Construct a 95 percent confidence interval for the difference in population means.

Answers

Answer:

The 95% confidence interval for the difference in population means is (−26.325175  , 36.325175)

Step-by-step explanation:

Given that :

sample size n₁ = 36

sample mean  x₁ = 83

standard deviation σ₁ = 5

sample size n₂ = 49

sample mean  x₂= 78

standard deviation σ₂ = 3

The objective is to construct a 95% confidence interval for the difference in the population means

Let the population means be μ1  and  μ2

The 95% confidence interval or the difference in population means can be calculated by using the formula;

(x1x2)±tα/2 ×sp

where;

the pooled standard deviation  sp=(n11)s12+(n21)s22n1+n22

sp=(361)52+(491)3236+492

sp=(35)25+(48)983

sp=875+43283

sp=130783

sp = 15.75

degree of freedom = n1+n22

degree of freedom = 36+49 -2

degree of freedom = 85 - 2

degree of freedom = 83

The Critical t- value 95% CI at df = 83 is

t  critical = T.INV.2T(0.05, 83) = 1.9889

Therefore, for the population mean , we have:

= (83 - 78) ± (1.9889 × 15.75)

= 5 ± 31.325175

= 5  - 31.325175 , 5 + 31.325175

= (−26.325175  , 36.325175)

{ (-2, 4), (0, 2), (-1, 3), (4, -2)}
The set of ordered pairs above:
DONE
Domain
-3
4
-1
5
Range
3
7
-2
The mapping diagram above:
DONE
y=x²
DONE
x
-3
-1
y
5
2
-1
The table above:
DONE ✔

{ (-2, 4), (0, 2), (-1, 3), (4, -2)}The set of ordered pairs above:DONEDomain-34-15Range37-2The mapping

Answers

The set of ordered pairs above: is a function.

The mapping diagram above: is a function.

y = x²: is a function.

The table above: is not a function.

What is a function?

In Mathematics and Geometry, a function is a mathematical equation which is typically used for defining and representing the relationship that exists between two or more variables such as an ordered pair.

Based on the set of ordered pairs, mapping diagram, and the equation above, we can reasonably infer and logically deduce that it represent a function because the input values (domain, x-value, or independent values) are uniquely mapped to the output values (range, y-value or dependent values).

In this context, we can reasonably infer and logically deduce that the table does not represent a function because the input value (-1) has more than output values (2 and 4 respectively).

Read more on function here: brainly.com/question/27862183

#SPJ1

Calculate the rate of power draining per hour if the capacity of the cell phone is 3 600mAh

Answers

I believe The answer is 13.32

Pablo used a total of 5 3/4 gallons of gas while driving his car. Each hour he was driving, he used 5/6 gallons of gas. What was the total number of hours he was driving? Write your ans

Answers

Let x be the number of hours Pablo was driving.

We know that he used 5/6 gallons of gas per hour of driving.

So, the total amount of gas he used is 5/6 * x.

We also know that he used a total of 5 3/4 gallons of gas.

So, we can set up the equation:

5/6 * x = 5 3/4

To solve for x, we can first convert 5 3/4 to an improper fraction:

5 3/4 = 23/4

Then, we can multiply both sides of the equation by the reciprocal of 5/6:

x = (5 3/4) / (5/6)

x = (23/4) / (5/6)

x = (23/4) * (6/5)

x = 27.6/4

x = 6.9

Therefore, Pablo was driving for a total of 6.9 hours.

brainliest???

Does anyone know this answer??

Does anyone know this answer??

Answers

Answer:

96.25%

Step-by-step explanation:

The empirical rule regarding mean and standard deviation is that

Around 68% of scores are between 40 and 60.Around 95% of scores are between 30 and 70.Around 99.7% of scores are between 20 and 80.

Therefore between mean and +2 standard deviation or between mean and -2 standard deviation you will find  approximately 95/2 = 47.5% of the values

Between mean and ± 3 standard deviations you will find approximately 97.5/2 = 48.75% of the values

Therefore between 2 standard deviations above and 3 standard deviations below you will find approximately 47.5 + 48.75 = 96.25% of values

I need help on this. An answer and an explanation would be great!!

I need help on this. An answer and an explanation would be great!!

Answers

Answer:

60 & 55

Step-by-step explanation:

1. the sum of the angles 1; 2 and 3 is 180°, then

m∠1=m∠2=m∠3; ⇒m∠3=60°;

2. m∠3=m∠r; ⇒ m∠r=60°;

3. m∠α= 180-(m∠r+65°)°; ⇒ m∠α=55°

all the details are in the picture.

I need help on this. An answer and an explanation would be great!!

12-(4y+8)=0.5(8y-16)

Answers

Answer:

y=3/2, decimal form, y=1.5, mixed number y=1 1/2

Step-by-step explanation:

120-10\left(4y+8\right)=5\left(8y-16\right)\=120-40y-80

-40y+40

x+y=-1 and x=y+19 solve for x

Answers

Answer:

X=9

Step-by-step explanation:

What is 100,000 written as a power of 10 in exponent. Help

Answers

If we have the following number:

100,000

and we want to write it as a power of 10 in exponent, we just have to count the zeros of the number, in this case there are 5, and that would be our exponent, then, we have:

100,000=105

Someone help with this equation

Someone help with this equation

Answers

The answer is:

g(x + 1) = 6x + 1

g(4x) = 24x -5

Work/explanation:

To evaluate, I plug in x + 1 into the function:

g(x)=6x5

g(x+1)=6(x+1)5

Simplify

g(x+1)=6x+65

g(x+1)=6x+1

------------------

Do the same thing with g(4x)

g(4x)=6(4x)5

g(4x)=24x5

Hence, these are the answers.

Sally was driving her own car and collided with a pick-up truck. Sally sustained $150,000 in injuries and her passenger sustained $1,000 in injuries. If her coverage was 100/300/50, what are the total medical expenses the insurance company would pay for this accident?

Answers

The insurance company would pay a total of $101,000 for the medical expenses resulting from the accident.

In this scenario, Sally's car insurance policy has coverage limits of 100/300/50. These numbers represent the maximum amount the insurance company will pay for different types of damages in an accident. Let's break down what these numbers mean in the context of the collision.

The first number, 100, represents the maximum amount (in thousands of dollars) that Sally's insurance company will pay for bodily injury per person. Since Sally sustained $150,000 in injuries and her passenger sustained $1,000 in injuries, the insurance company will cover Sally's medical expenses up to the policy limit, which is $100,000.

The second number, 300, represents the maximum amount (in thousands of dollars) the insurance company will pay for bodily injury per accident. In this case, both Sally and her passenger were injured, so the insurance company will cover their combined medical expenses up to the policy limit, which is $300,000.

The third number, 50, represents the maximum amount (in thousands of dollars) the insurance company will pay for property damage per accident. However, since the question only mentions injuries and not property damage, we can disregard this number for now.

Therefore, the total medical expenses the insurance company would pay for this accident would be $100,000 for Sally's injuries and $1,000 for her passenger's injuries, totaling $101,000.

To learn more about insurance

https://brainly.com/question/989103

#SPJ8

2x + 2 = 5x -8 simplify

Answers

10x = 10
Answer, x = 1

Let Q be an orthogonal matrix with an eigenvalue λ1=1. Let x be an eighenvector beloinging to λ1. Show that x is also an eigenvector of QT

Answers

If Q is an orthogonal matrix with an eigenvalue λ1 = 1, then x, the eigenvector corresponding to λ1, is also an eigenvector of QT with an eigenvalue λ2 = λ1 * (QT * x).

To show that x is also an eigenvector of QT, we need to demonstrate that QT * x is a scalar multiple of x.

Given that Q is an orthogonal matrix, we know that QT * Q = I, where I is the identity matrix. This implies that Q * QT = I as well.

Let's denote x as the eigenvector corresponding to the eigenvalue λ1 This means that Q * x = λ1 * x.

Now, let's consider QT * x. We can multiply both sides of the equation Q * x = λ1 * x by QT:

QT * (Q * x) = QT * (λ1 * x)

Applying the associative property of matrix multiplication, we have:

(QT * Q) * x = λ1 * (QT * x)

Using the fact that Q * QT = I, we can simplify further:

I * x = λ1 * (QT * x)

Since I * x equals x, we have:

x = λ1 * (QT * x)

Now, notice that λ1 * (QT * x) is a scalar multiple of x, where the scalar is λ1. Therefore, we can rewrite the equation as:

x = λ2 * x

where λ2 = λ1 * (QT * x).

This shows that x is indeed an eigenvector of QT, with the eigenvalue λ2 = λ1 * (QT * x).

In conclusion, if Q is an orthogonal matrix with an eigenvalue λ1 = 1, then x, the eigenvector corresponding to λ1, is also an eigenvector of QT with an eigenvalue λ2 = λ1 * (QT * x).

for more such question on matrix visit

https://brainly.com/question/2456804

#SPJ8

Aubrey is painting a mural of an ocean scene. The triangle sail on a sailboat has a base of 6 feet and a height of 4 feet. Aubrey will paint the sail using a special white paint. A container of this covers 10 squares feet and costs $6.79 per container. How much will Aubrey spend on the white paint?

Answers

Aubrey spend on the white paint will be equal to the value of $8.15 to paint the sail from the given question of triangle.

The area needed for painting is a triangle with base = 6 and height = 4

Area of a Triangle is given by:

A = 0.5bh

Where b is the base and h is the height

So area needed for painting is:

A = 0.5bh

A = 0.5 (6) (4)

A = 12

Given,

10 sq. ft. requires 6.79 dollars, we need to find how much dollars would be need to paint 12 sq. ft.

We can write a ratio and solve for the amount Aubrey would need (let amount be "x"). We write ratio, cross multiply, and solve. Shown below:

106.79=12x

10x=12(6.79)

x = 8.148

Therefore, Aubrey would need $8.15 to paint the sail.

Learn more about Triangle:

https://brainly.com/question/13952275

#SPJ1

A rectangle has an area of 18 square centimeters.
Which of the following could be the rectangle's length and width?
(Area = length x width)
Choose all answers that apply:
B
C
1 cm and 18 cm
2 cm and 9 cm
3 cm and 6 cm
4 cm and 5 cm

Answers

Answer:

1 cm and 18 cm

2 cm and 9 cm

3 cm and 6 cm

Step-by-step explanation:

We need to find the factors of 18
which are; 1,18; 2,9; 3,6
So therefore we'd pick:
1 cm and 18 cm

2 cm and 9 cm

3 cm and 6 cm

Kendra took a total of 10 quizzes over the course of 2 weeks. After attending 7 weeks of school this quarter, how many quizzes will Kendra have taken in total? Assume the relationship is directly proportional.

Answers

well if Kendra took 10 quizzes in 2 weeks it means that she took 5 quizez each week  5*7=35 therefore she took 35 quizzez in 7 weeks

This morning, Kendall drank a cup of coffee that had 95 milligrams of caffeine in it. She didn't have any more caffeine for the rest of the day. Kendall read online that the amount of caffeine in her body will decrease by approximately 13% each hour. Write an exponential equation in the form y=a(b)x that can model the amount of caffeine, y, in Kendall's body x hours after drinking the coffee. Use whole numbers, decimals, or simplified fractions for the values of a and b. y = ____. To the nearest milligram, how much caffeine will be in Kendall's body after 12 hours?

Answers

An exponential equation in the form y=a(b)x that can model the amount of caffeine, y, in Kendall's body x hours after drinking the coffee is

The amount of caffeine that will be in Kendall's body after 12 hours is 18 milligrams.

What is an exponential function?

In Mathematics, an exponential function can be modeled by using the following mathematical equation:

f(x) = a(b)^x

Where:

a represents the initial value or y-intercept.x represents time.b represents the rate of change.

Since Kendall drank a cup of coffee that had 95 milligrams of caffeine which is decreasing at a rate of 5% per day, this ultimately implies that the relationship is geometric and the rate of change (decay rate) is given by:

Rate of change (decay rate) = 100 - 13 = 87% = 0.87.

By substituting the parameters into the exponential equation, we have the following;

f(x)=95(0.87)x

When x = 12, we have;

f(12)=95(0.87)12

f(12) = 17.86 ≈ 18 milligrams.

Read more on exponential equation here: brainly.com/question/28939171

#SPJ1

Is square root of 49/5 a rational number?

Answers

It depends on how that’s written mathematically.

If it’s sqrt(49) / 5, then yes, since that’s 7/5 and 7/5 is a fraction of two integers.

If it was sqrt( 49/5 ), where the /5 is inside the square root, then the answer is no.

I don’t know if my answers are right. If not, can you guys help me?

I dont know if my answers are right. If not, can you guys help me?

Answers

The average rate of change of the function for the interval given in first part (a) is equal to -2 and the average rate of change for the second interval (b)  is = 5.

What about rate of change?

The rate of change is a mathematical concept that describes the speed at which a quantity is changing over a given period of time. It refers to how quickly or slowly a value is changing with respect to another value or variable. The rate of change can be calculated by finding the difference between two values and dividing that difference by the amount of time it took to achieve that difference.

Define about function:

A function is a relation between two sets of values, where each value in the first set (the domain) is associated with a unique value in the second set (the range). In other words, a function takes an input, performs a specific operation on it, and produces a unique output.

A function can be represented by an equation or a graph, and it can be described using different notations such as f(x) or y = f(x), where x is the input and y is the output.

According to the given information:

As, we know that the rate of change of the given interval is given in the form of (x) = fb)f(a)ba

So, In first case (A) the value of a = -2 and b = 0

Rate of change is:

f(0)f(2)0(2)9(49)(0)+2=2

For the second case (B) the value of a = 2 and b = 3

Rate of change is:

f(3)f(2)32(99)(49)32=5  

To know more about function visit:

https://brainly.com/question/12431044

#SPJ1

A cone has a height of 6 inches and a diameter of 10 inches. What is its volume?

Use ​ ≈ 3.14 and round your answer to the nearest hundredth

Answers

Answer:

V = 157 in³

Step-by-step explanation:

the volume (V) of a cone is calculated as

V = 13 πr²h ( r is the radius and h the height )

here diameter = 10 , then r = 10 ÷ 2 = 5 , then

V = 13 × 3.14 × 5² × 6 ( cancel 3 and 6 by 3 )

  = 3.14 × 25 × 2

 = 3.14 × 50

= 157 in³

Una persona arrastra un baúl de 15 kg sobre una superficie horizontal, tirando de este con una fuerza horizontal constante de +100 N. Sobre el baúl actúa una fuerza de rozamiento de -80 N. Calcule el trabajo desarrollado por esta fuerza para un desplazamiento de +5,00 m

Answers

The work done by this force for a displacement of +5.00m is 100 joules.

What is work done?

Work done on a body is the dot product of force and displacement caused by the force to the body. Mathematically, we can write work done as -

W = FdcosФ

Given is that a person drags a 15 kg trunk on a horizontal surface, pulling it with a constant horizontal force of + 100 N. A friction force of - 80 N acts on the trunk.

We can write the work done as -

W = FdcosФ

W = Fdcos(0)

W = Fd

W = (F{h} - |F{f}|)d

W = (100 - 80) x 5

W = 20 x 5

W = 100 joules

Therefore, the work done by this force for a displacement of +5.00m is 100 joules.

To solve more questions on work done, visit the link below-

https://brainly.com/question/13662169

#SPJ9

{Question in english -

A person drags a 15 kg trunk on a horizontal surface, pulling it with a constant horizontal force of +100 N. A friction force of -80 N acts on the trunk. Calculate the work developed by this force for a displacement of +5.00m}

18- A clothing store sells a shirt costing $20 for $33 and a jacket costing $60 for $93.
(i) If the markup policy of the store is assumed to be linear, write an equation that expresses retail price R
in terms of cost C.
(ii) What does a store pay for a suit that retails for $240?
(i) (a) R = 1.5C + 12
(b) R = 1.5C+3
(c) R = 3C + 1.2
(d) R = 3C +1.5
(ii) (a) 158
(b) 185
(c) 155
(d) 188

I cant solve this and I need steps while solving it.

Answers

Trevor mevpr skiff yhirjf

Does anyone know?!!!!!

Does anyone know?!!!!!

Answers

Answer:

units

Step-by-step explanation:

Answer:

Just units

Step-by-step explanation:

The circumference is neither squared nor cubed, and it has to be labeled.

Bernard saved $26 in June, $38 in July, and $30 in August. Then Bernard spent $11 on school supplies and $17 on new clothes. How much money does Bernard have left?

Answers

Answer:

66$

Step-by-step explanation:

26+38+30=94

94-11-17=66

A grocery store has bananas on sale for 2 pounds for $1.50. What is the cost of 6 pounds of bananas?

Answers

Answer:

$4.50

Step-by-step explanation:

6 / 2 = 3

$1.50 x 3 = $4.50

4.5 dollars
2/1.5 is equal to 6/x
You cross multiply and you get 4.5

The cone and cylinder below both have a height of 11 feet.

The cone has a radius of 3 feet.

The cylinder has a volume of 310.86 cubic feet.



Complete the statements using 3.14 for . Any non-integer answers in this problem should be entered as decimals rounded to the nearest hundredth.

The volume of the cone is
cubic feet.

The radius of the cylinder is
feet.

The ratio of the volume of the cone to the volume of the cylinder is 1:
.

The cone and cylinder below both have a height of 11 feet.The cone has a radius of 3 feet.The cylinder

Answers

Answer:

The radius of the cylinder is 2.99ft

Which shows the zeros of f(x) = 4x² - 9?
2 and 3
-2 and -3
-3/2and 3/2
-2/3and2/3

Answers

The zeros of the function are -3/2 and 3/2. So the correct option is -3/2 and 3/2.

What are the zeros of the function?

The zero of a function is any replacement for the variable that will produce an answer of zero. Graphically, the real zero of a function is where the graph of the function crosses the x‐axis; that is, the real zero of a function is the x‐intercept(s) of the graph of the function.

The zeros of f(x) = 4x² - 9 can be found by setting the function equal to zero and solving for x:

4x² - 9 = 0

Adding 9 to both sides:

4x² = 9

Dividing both sides by 4:

x² = 9/4

Taking the square root of both sides (remembering to include both the positive and negative roots):

x = ± 3/2

Therefore, the zeros of the function are -3/2 and 3/2.

So the correct option is: -3/2 and 3/2.

To learn  more about the zeros of the function  visit:

https://brainly.com/question/65114

#SPJ1

The response to a question has three alternatives: A, B, and C. A sample of 120 responses provides 60 A, 12 B, and 48 C. Show the frequency and relative frequency distributions.

Answers

Answer:

CLASS     FREQUENCIES     RELATIVE FREQUENCIES

A                        60                                 0.5

B                        12                                  0.1

C                        48                                 0.4

TOTAL              120                                  1

Step-by-step explanation:

Given that;

the frequencies of there alternatives are;

Frequency A = 60

Frequency B = 12

Frequency C = 48

Total = 60 + 12 + 48 = 120

Now to determine our relative frequency, we divide each frequency by the total sum of the given frequencies;

Relative Frequency A = Frequency A / total = 60 / 120 = 0.5

Relative Frequency B = Frequency B / total = 12 / 120 = 0.1

Relative Frequency C = Frequency C / total = 48 / 120 = 0.4

therefore;

CLASS     FREQUENCIES     RELATIVE FREQUENCIES

A                        60                                 0.5

B                        12                                  0.1

C                        48                                 0.4

TOTAL              120                                  1

6th GRADE MATH! PLEASE HELP EEEEEEEEE

6th GRADE MATH! PLEASE HELP EEEEEEEEE

Answers

Answer:

-4m+10

Step-by-step explanation:

Answer:

-4m+10

explanation:

6m-10=-4m

+10

-4m+10

2. (07.02 MC)
Find the measure of angle y. Round your answer to the nearest hundredth. (please type the numerical answer only)

2. (07.02 MC)Find the measure of angle y. Round your answer to the nearest hundredth. (please type the

Answers

Answer:

y° = 11.54

Step-by-step explanation:

Because this is a right triangle, we can find the measure of angle y using inverse trigonometry.

When angle y is the reference angle:

the side that is 4 units long is the opposite side,and the side that is 20 units long is the hypotenuse (i.e., the side always opposite the right angle).

Thus, we can use the inverse sine ratio, which is given by:

sin^-1 (opposite / hypotenuse) = θ, where

θ is the reference angle.

Thus, we plug in 4 for the opposite side and 20 for the hypotenuse:

sin^-1 (4 / 20) = θ

sin ^-1 (1 / 5) = θ

11.53695903 = θ

11.54 = θ

Thus, the measure of y is 11.54.

Other Questions
How did the writings of Hemingway and Fitzgerald differ? How much does Disney spend on employee training? use this equation to draw a graph y>-5/3x-4 what is an example of a multinational organization? Pls help me :(Solve for x what scientific and medical developments in the twentieth century help explain the trends seen in the chart? A manufacturer, such as BMW, wouldA. use a purchases account to calculate COGS.B. have three classes of inventory: DM, DL, and OH.C. be a push manufacturer, using Fords model.D. None of the above are true.Which of the following should be classified as a period cost?A. Salaries of personnel who perform quality control oversight on the plant floor.B. Salaries of personnel who move work in process from the production line to finished goods.C. Salaries of personnel who inspect work in process.D. None of these should be classified as period costs. Oxidative phosphorylation uses ALL of the following for energy production EXCEPT: Group of answer choices electrons from NADH. glycolysis. membrane-associated electron transport chain. an ATP synthase. a proton motive force. evaluating a landscape involves considering phenomena or processes that ______. which of the following will increase the peak emf in an ac generator without changing the frequency?a.Replace the magnet with a stronger one (increase the magnetic field strength). b.Replace the coil with one with more turns. c.Increase the coll with one with a larger area. d.All of the above. e.None of the above Which of these is a living organism that can beused by scientists to "infect" plants (such as thesoybeans shown here) with genes that can benefithumans?A. amino acidsC. AgrobacteriumB. amoebasD. genetic clones which of the following statements about location options are true? multiple select question. adding new locations while keeping existing ones may draw demand from existing locations instead of increasing overall demand. shutting down existing facilities and opening new ones is a poor strategy, leading to significant unnecessary costs. expansion costs are often less than those of other alternatives. Is the line increasing or decreasing?y=-2x+5(pls explain because im totally lost) i put 100 points on this pls help In which interval is the median distance the upper big branch mine and deepwater horizon incidents both point out the need for which of these Overproduction results in more individuals in a population than the resources can support. What does this cause? HELPP THIS IS FOR AN ASSIGNMENT DUE TWO WEEKS AGO AND I DODNT KNOW I HAD IT: what role did the protesters play in the new governments that formed after the fall of the communism in eastern Europe? Use the stacked box and whisker plot in the diagram below. What conclusion can be made about the lower quartile of the two data sets? what structure does the hard and soft palates separate the mouth from?A. nasal cavityB. body midlineC. glottisD. epiglottis