The blank is like a conductor of an orchestra because both control and coordinate activities

Answers

Answer 1

Answer: Nucleus

Explanation:

The nucleus is like a conductor of an orchestra because both control and coordinate activities.

In a cell, the nucleus is considered to be the most important organelle due to it being the control center. Like a conductor does in an orchestra, the nucleus controls and coordinates activities to ensure the cell's survival.

It does this primarily by controlling protein synthesis due to it being the structure that houses DNA which in turn contains the instructions for synthesizing protein.


Related Questions

Which statement correctly describes hydrogen bonds? Which statement correctly describes hydrogen bonds? They hold together adjacent water molecules. They form when opposite charges repel each other. They happen only between water molecules. They form between the hydrogen atoms of different water molecules.

Answers

Answer:

They form between the hydrogen atoms of different water molecules.

Explanation:

A hydrogen bond is always a dipole-dipole bond. It is an attraction between a slightly positive atom of a molecule with the negative atom of the another molecule containing hydrogen. Thus, in a water molecule, oxygen atom will attract the electrons in the O–H bonds. Its interaction always involves a hydrogen atom.

They form between the hydrogen atoms of different water molecules is the correct statement about hydrogen bonds.

A hydrogen bond refers to a kind of bond that occurs from the attraction between a hydrogen atom and a negatively charged oxygen, fluorine, or nitrogen atom.

This attraction, for its part, is known as a dipole-dipole interaction and links the positive pole of one molecule with the negative pole of another.

Oxygen is very electronegative, that is, it attracts electrons from the bond much more strongly than hydrogen.

This dipole-dipole interaction between water molecules is known as hydrogen bond.

Water molecules can form hydrogen bonds with other molecules.

Therefore, we can conclude that they form between the hydrogen atoms of different water molecules is the correct statement about hydrogen bonds.

Learn more here: https://brainly.com/question/20813810

15 points
Use the Periodic Table to determine the number of PROTONS for the
element: Magnesium, Mg (Atomic # 12). Only include the number in your
answer

Answers

Answer:

The number of proton of magnisium = 12

which aqueous solution has the lower freezing point, 0.60 m cacl2 or 0.60 m glucose?

Answers

The aqueous solution that has the lower freezing point is 0.60 m glucose.

What is freezing point depression?

Freezing point depression is the reduction in the temperature at which a liquid freezes caused by dissolved particles. The freezing point depression (ΔTf) of a solution is proportional to the molality (m) of the solute, which is the number of moles of solute per kilogram of solvent.

Freezing point depression is a colligative property, which means it depends only on the number of solute particles in the solution, not on their nature. The van't Hoff factor (i) is used to account for the dissociation of solutes in the solution. The van't Hoff factor of glucose is 1, whereas the van't Hoff factor of CaCl2 is 3.

To calculate the freezing point depression, we use the formula:

ΔTf = i * Kf * m

To calculate the freezing point depression, we use the formula:

ΔTf = i * Kf * m

The freezing point depression constant of water is 1.86 °C/m.

Thus, for the given molality of the solutions, the freezing point depression is

:ΔTfcacl2 = 3 * 1.86 °C/m * 0.60 m = 3.348 °CΔTfglucose = 1 * 1.86 °C/m * 0.60 m = 1.116 °C

Therefore, 0.60 m glucose has a lower freezing point depression than 0.60 m CaCl2.

learn more about freezing point depression here

https://brainly.com/question/31357864

#SPJ11

the orbital hybridization on the carbon atoms in c2h2 is

Answers

The orbital hybridization on the carbon atoms in C₂H₂ (ethyne) is sp hybridization.

In C₂H₂(ethyne or acetylene), the orbital hybridization on the carbon atoms is known as sp hybridization.

Each carbon atom in ethyne forms a triple bond with another carbon atom, giving the compound a linear molecular shape. Each carbon atom goes through sp hybridization in order to accommodate the bonding configuration and ensure optimal orbital overlap.

Two sp hybrid orbitals are created when each carbon atom's two 2s orbitals and one 2p orbital, in this case the 2px orbital, merge during sp hybridization. These sp hybrid orbitals have an angle of 180 degrees between them and are oriented linearly along the carbon-carbon axis.

The 2py and 2pz orbitals, which are the final two 2p orbitals on each carbon atom, are still unhybridized and parallel to the molecular axis. These open-source p orbitals can be used for π-bonding, forming the π bonds in the ethyne molecule.

So, in summary, the orbital hybridization on the carbon atoms in C₂H₂(ethyne) is sp hybridization.

To know more about hybridization:

https://brainly.com/question/32752412

#SPJ4

Give two differences between the physical properties of the elements in Group 1 and those of the transition elements. [2 marks​

Answers

Due to their stronger metallic bonding and more compact atomic structure, the transition elements have higher melting and boiling temperatures and are often denser than the alkali metals.

What are group one metals' two physical characteristics?

Elements from Group 1 have similar properties. All of them are supple silver metals. These metals are extremely reactive and have low melting temperatures due to their low ionisation energy. As you descend the chart, this family becomes more reactive.

What are the transitional elements?

The d orbitals of transitional elements are only partially filled. A transition element is defined by IUPAC as an element that may form stable cations and has an electron d subshell that is only partly filled.

To know more about transition elements visit:-

https://brainly.com/question/1948991

#SPJ1

What does the position of lithium on the periodic table tell you about its tendency to react with other elements? (2 points)

Answers

The modern periodic law states that the physical and chemical properties of the elements are periodic functions of their atomic numbers. The elements are arranged in the increasing order of their atomic numbers.

Here the element Lithium is a alkali metal which is located in the group 1 of the periodic table and placed in the second period. Its atomic number is 3. Alkali metals are highly electropositive and are good reducing agents.

Lithium reacts with the elements of groups 16 and 17 and form compounds, they also burn in oxygen and react with water.

The reaction of lithium with water is:

2Li + 2H₂O → 2LiOH + H₂

To know more about periodic table, visit;

https://brainly.com/question/29769486

#SPJ1

Why must the final product of a decay series be stable?

a. The daughter isotope of any radioactive decay is stable.
b. No decay chain can emit more than two particles.
c. Each decay results in a net loss of particles.
d. If the daughter isotope is unstable, it will decay.

Answers

Answer:

I think its d

Explanation:

Because isotopes decay due to being unstable so if the daughter isotope is unstable it will just decay till it produces a stable isotope

Answer:

d. If the daughter isotope is unstable, it will decay

Explanation:

got it correct on quiz

1.The two green substances are not same thing because some of their properties are different and some of them are the same. If they were the same substance, all of their properties would have to be the same.

How could the explanation be improved?

Answers

Answer:

Even though the two substances possess many similarities, they have some unique properties. In turn, since they have the same properties, if they were the same substance, it would make matters worse, if the same chemical was in two different places, there would not be a difference between them since they are the same, just as it is with are two different chemicals would have differing properties since they are two properties would vary from one another since they are 2 totally different things!

Explanation:

What are the 4 limiting factors

It’s in the image~

What are the 4 limiting factors Its in the image~

Answers

Answer:

I'm pretty sure you have it correct

Given the formula representing a compound: What is the IUPAC name of this compound?

Given the formula representing a compound: What is the IUPAC name of this compound?

Answers

Answer:

2,2- dichloro-heptane

Explanation:

The IUPAC name of the compound is 2,2-dichloro-heptane

In the same condition, what happens to the net force acting on the rope?

Answers

Answer:

Explained below

Explanation:

Newton's law of inertia states that An object at rest will remain continue at rest or if in motion, will continue in motion unless in both cases it is acted upon by a net external force.

Now, If two forces on the rope are equal and opposite forces, then the net force on the rope will be zero and it will not move. Thus,balance force is present in the rope and the rope will remain at rest since the net force is zero or it will continue in motion if already in motion without stopping since net force is zero

However, if the forces are acting in the same direction, it will result in an unbalanced force which means that the net force will be equal to the sum of the two forces and this will result in a stronger force than even the 2 individual forces and consequently it will cause the rope at rest to move, or if the rope is in motion, it will cause it to stop.

In order to make 1 batch of cookies it requires 2 cups flour, 3 eggs, and 1 cup sugar. What would be the coefficients for the flour, eggs, and sugar, assuming you wanted to make 10 batches of cookies? Write the coefficients below!

Answers

Answer:

Explanation:

Let e=eggs

Let f=flour

2/3*f=e

describe in detail, how the ethanol standards should be made in order to obtain the most accurate results.

Answers

Ethanol standards should be made using pure ethanol with known concentration and verified with multiple analytical methods.


In order to obtain the most accurate results, ethanol standards should be made with pure ethanol that has a known concentration. The concentration should be verified using multiple analytical methods, such as gas chromatography or titration. The standards should also be properly stored and handled to ensure their stability and accuracy.

It is important to use a standard that is close to the expected concentration range of the samples being tested to minimize any potential errors. The standards should also be periodically verified and recalibrated to ensure their accuracy over time. Following these guidelines will ensure that ethanol standards are made in a precise and accurate manner, leading to more reliable and reproducible results in ethanol analysis.

Learn more about ethanol here:

https://brainly.com/question/18597444

#SPJ11

In your OWN words explain how season are formed

Answers

Answer: Weather currents change wind tempature and there for change the weather of the seasons.

I am assuming that you mean seasons.
Seasons are formed through the Earth orbiting the sun and the Earth rotating.

OxYgen and hydrogen particles are kept in a container. Which of the following
accurately describes diffüsion of these gases?
OOxygen and hydrogen particles concentrate at the center of the container.
Oxygen particles move to one corner of the container and hydrogen particles go
to the opposite corner
DOxygen particles and hydrogen particles repel each other.
O Oxygen particles mix evenly with hydrogen particles.

Answers

Answer:

Option D

Oxygen particles mix evenly with hydrogen particles.

Explanation:

Diffusion refers to the movement of gasses from a region of higher concentration to a region of lower concentration.

Diffusion occurs in gases because their particles are in a state of constant random motion.

Due to this continuous random motion, once the oxygen and the hydrogen are added to the container, they will begin to mix freely with each other until they fill up the entire volume of the container.

Plzzz help do your best to answer these questions

Plzzz help do your best to answer these questions

Answers

The empirical formula is the simplest formula of a chemical compound.

To find the empirical formula, we take the following steps;

Divide the percentage by mass of each element by its relative atomic mass.Divide the quotient of each by the lowest value obtained instep 1 aboveWrite the result of step 2 above as the subscript following each atom.

1) O - 88.10/16,      H - 11.190/1

  O - 5.5,               H - 11.19

  O - 5.5/5.5,        H - 11.19/5.5

  O -  1,                 H - 2

Empirical formula = OH2

2) C - 41.368/12  H - 8.101/1,   N - 32.162/14,   O - 18.369/16

   C - 3,               H - 8,           N - 2,                  O - 1

   C - 3/1,            H - 8/1          N - 2/1                 O - 1/1

    C - 3,             H - 8,           N - 2,                   O - 1

Empirical formula = C3H8N2O

To obtain the molecular formula where n = number of atoms of each element;

Molecular weight = 174.204 g/mol

[ 3(12) + 8(1) + 2(14) + 16]n = 174

n= 174/88

n = 2 (to the nearest whole number)

Hence, we have;

[C3H8N2O]2

The molecular formula is C6H16N4O2

3)  C - 19.999/12,  H - 6.713/1,   N - 46.646/14,   O - 26.641/16

    C - 2,                H - 7,            N -  3,                 O - 2

    C - 2/2,            H - 7/2,         N -   3/2,             O - 2/2

    C - 1,                H - 4,            N -  2,                  O - 1

Empirical formula - CH4N2O

https://brainly.com/question/1363167

Suppose that 2.5 mmol of N2(g) occupies 42 cm3 at 300 K and expands isothermally to 600 cm3. Calculate the AG for the process (assuming that N2 is a perfect gas).

Answers

The Gibbs free energy for the process is 0.0166 kJ/mol

Given to us is:

MilliMoles of N₂ = 2.5 mmol = 0.0025 moles

Initial volume V₁ = 42 cm³

Final volume V₂ = 600 cm³

Temperature T = 300 K

To determine the change in Gibbs free energy, ΔG

The change in Gibbs free energy is related to the ratio of the volumes:

ΔG = -nRTln(V₂)/(V₁)

     = -0.0025×8.314×300×ln(600/42)
     = -16.582 J/mol

Therefore, the Gibbs free energy for the process is 0.0166 kJ/mol.

Learn more about Gibbs free energy here:

https://brainly.com/question/13795204

#SPJ4

how much heat is produced if 7.0 moles of ethane undergo complete combustion?

Answers

The balanced equation for the combustion of ethane, C2H6, is: C2H6 + 3O2 → 2CO2 + 3H2OTo determine how much heat is produced if 7.0 moles of ethane undergo complete combustion, we need to use the balanced equation and the standard enthalpies of formation of the reactants and products.

The standard enthalpy of formation of a compound is the enthalpy change when one mole of the compound is formed from its constituent elements, with all reactants and products in their standard states (usually at 1 atm and 25°C).The standard enthalpies of formation of the reactants and products in the combustion of ethane are:

ΔHf°(C2H6) = -84.68 kJ/mol

ΔHf°(O2) = 0 kJ/mol

ΔHf°(CO2) = -393.51 kJ/mol

ΔHf°(H2O) = -285.83 kJ/mol

Now we can calculate the heat produced by using the difference between the enthalpies of the products and reactants:

2CO2 + 3H2O - (C2H6 + 3O2)

ΔH = 2(-393.51 kJ/mol) + 3(-285.83 kJ/mol) - (-84.68 kJ/mol + 3(0 kJ/mol))

ΔH = -1560.78 kJ/mol

Therefore, if 7.0 moles of ethane undergo complete combustion, the amount of heat produced will be:

-1560.78 kJ/mol x 7.0 mol

= -10,925.46 kJ or -10,925,460 J.

Note that the negative sign indicates that heat is released by the reaction, which is exothermic.

To know more about exothermic visit

https://brainly.com/question/4345448

#SPJ11

PLS HELP FOR FINAL!!!!!!!!!!!!!!

PLS HELP FOR FINAL!!!!!!!!!!!!!!

Answers

Answer:

The answer is Ernest Rutherford.

Answer :

Ernest Rutherford

Hope I help

Good Luck

Please help fast please please

Please help fast please please

Answers

Answer:

crome .comxbdbshshdhdgsvsgsvdhjsjfskkt

plssss no fake answers no pdf no files pls jus the answer if you dont know it just dont put nothing but pls if you do know it help me out i have till 9 am today​

plssss no fake answers no pdf no files pls jus the answer if you dont know it just dont put nothing but

Answers

For the First part I believe elements naturally exist in nature and compounds are formed so elements can be more stable. (I think this is right I’m not 100% but I’m close)

For the second part the two main types of bonds are ionic and covalent. Ionic bonds involve the transfer of electrons and covalent bonds involve the sharing of electrons. (I’m 100% on this one)

Predictions about the future based on the position of planets is an example of physics biology earth science pseudoscience

Answers

Answer:

Pseudoscience

Explanation:

Predicting the future based solely on the position of the planets is an example of pseudoscience.

Pseudoscience is a body of knowledge that is not based on the scientific method but on some unverifiable/unprovable claims.

Predictions about the future can only be valid if it is based on the scientific method, not just about the position of the planet. The scientific method involves observation, hypothesis formulation, testing of the hypothesis through repeatable experiments, and arriving at conclusion.

Any other statement or belief that is not based on these procedures is said to be pseudoscientific.

Answer:

The answer to your question is pseudoscience.

Explanation:

I took the module 1 exam and got it right, yesterday.

Predictions about the future based on the position of planets is an example of physics biology earth

PLEASE HELP, I WILL MARK YOU BRAINLEST!!

Ex. A 20-gram object has a volume of 5 cm3.

Find its density. Remember D=Mass/volume

Answers

Explanation:

V = 20

V = 5

M/V = Density

20 / 5 = 4

Consider the titration of 30. 0 mL of 0. 050 M NH3 with 0. 025 M. HCl. Calculate the PH after the following volumes of titrant have been added 0 ml 20 mL 59. 1 mL 60. 0 mL 71. 4 mL 73. 4 mL

Answers

The pH after the following volumes of titrant have been added 0 ml 20 mL 59. 1 mL 60. 0 mL 71. 4 mL 73. 4 mL are 11.89, 11.89, 8.45, 8.45, 7.98, 8.95 respectively.

The reaction between NH3 and HCl can be represented by the following equation: NH3 + HCl → NH4+ + Cl-

To calculate the pH after different volumes of titrant have been added, we need to determine the amount of titrant that has reacted with the analyte and the resulting concentration of the products.

A. 0 mL of titrant (initial state)

At the start, there is no titrant added to the analyte, so the concentration of NH3 is 0.050 M. NH3 is a weak base, so we can use the Kb expression to calculate the concentration of OH-:

Kb=[NH4+][OH]/[NH3]

1.8105=x2/(0.050x)

initial concentration of NH3 is much greater than the initial concentration of HCl, we can assume that the concentration of NH3 does not change significantly during the titration.

Kb=x2/0.050x=Kb0.050=1.3103M

The concentration of OH- is equal to 1.3103M, so we can calculate the pH:

pH=14pOH=14(log[OH])=11.89

Therefore, the pH at the start of the titration is 11.89.

B. 20 mL of titrant

After adding 20 mL of 0.025 M HCl, the volume of the solution is 50 mL (30 mL NH3 + 20 mL HCl). The moles of HCl added is:

moles of HCl = volume x concentration = 0.020 L x 0.025 mol/L = 5 x 10^-4 mol

Since the reaction is a 1:1 reaction, the moles of NH3 remaining is equal to the moles of HCl added.

concentration of NH3 = moles of NH3 / volume of NH3 = (0.050 mol/L x 0.030 L - 5 x 10^-4 mol) / 0.030 L = 0.048 mol/L

Since the concentration of NH3 has decreased, we need to recalculate the concentration of OH- using the new concentration of NH3:

Kb=[NH4+][OH]/[NH3]1.8105=x2/(0.048x)

Solving for x, we get:

x=1.3103M

The concentration of OH- is still x=1.3103M, so we can calculate the pH:

pH = 14 - pOH = 14 - (-log[OH-]) = 11.89

Therefore, the pH after adding 20 mL of titrant is still 11.89.

Similarly for  C. 59.1 mL of titrant

The pH after adding 59.1 mL of titrant is 8.45.

D. 60 mL of titrant

The pH after adding 60 mL of titrant is 8.45.

E. 71.4 mL of titrant

The pH after adding 71.4 mL of titrant is 7.98.

F. 73.4 mL of titrant

The pH after adding 73.4 mL of titrant is 8.95.

For more question on pH click on

https://brainly.com/question/12609985

#SPJ11

decide which of the following bonds is least polar on the basis of electronegativities of atoms: , , .

Answers

To determine which bond is least polar, we need to compare the electronegativities of the atoms involved. Electronegativity is the measure of an atom's ability to attract electrons towards itself in a covalent bond. The greater the difference in electronegativity between two atoms, the more polar the bond will be.

According to the Pauling scale of electronegativities, the electronegativity of oxygen is 3.44, nitrogen is 3.04, and carbon is 2.55. Therefore, the bond between carbon and nitrogen (C-N) will be the least polar because the difference in electronegativity between the two atoms is only 0.49. On the other hand, the bond between oxygen and nitrogen (O-N) will be the most polar because the difference in electronegativity is 0.4. The bond between carbon and oxygen (C-O) will be moderately polar because the electronegativity difference is 0.89.

In summary, the C-N bond is the least polar among the three bonds due to the least difference in electronegativities of the atoms. The bond polarity plays an important role in determining the physical and chemical properties of a compound. A polar bond will have a dipole moment, and it will tend to interact with other polar molecules or ions. In contrast, nonpolar bonds will interact with other nonpolar compounds. Hence, understanding bond polarity is crucial in predicting the behavior of a chemical compound.

To know more about electronegativities visit:

https://brainly.com/question/3393418

#SPJ11

Calculate the average atomic mass of chromium, given the following percent abundances and isotope masses: 4.350 % 49.946 amu; 83.790% 51.941 amu; 9.500% 52.941 amu and 2.360% 53.939 amu

Answers

Asnwer: average atomic mass of chromium is 52amu

Calculations:

49.946amu: 4.350%= 0.0435

51.941amu: 83.790%= 0.8379

52.941amu: 9.500%= 0.095

53.939amu: 2.360%= 0.0236

Average atomic mass of chromium = 0.0435(49.946) + 0.8379(51.941) + 0.095(52.941) + 0.0236(53.939)

= 51.9963703amu

= 52 amu

acid rain results when humans put excess amounts of ________ into the atmosphere.

Answers

Acid rain results when humans put excess amounts of sulfur dioxide (SO2) and nitrogen oxides (NOx) into the atmosphere.

These pollutants are released primarily from industrial processes and the burning of fossil fuels, which then react with water, oxygen, and other chemicals to form sulfuric acid and nitric acid. These acids then fall to the ground in the form of precipitation, known as acid rain.

Any type of precipitation that contains acidic elements, such as sulfuric or nitric acid, that falls to the ground from the atmosphere in wet or dry forms is referred to as acid rain, also known as acid deposition. This can apply to rain, snow, fog, hail, and even corrosive dust.

More on Acid rain: https://brainly.com/question/30271624

#SPJ11

This is the process that cells reproduce and replace old or damaged cells.

Question 5 options:

Mitosis


Meiosis


Ribosomes


Cytokinesis

Answers

the answer is A. mitosis
A. Mitosis

Didnndxbdbdn

would the air in a tire decreace or increase on a hot day

Answers

Answer:

The air pressure in tires increases as the temperature goes up. Scientists have figured out that for every 10 degrees (Fahrenheit) that the temperature rises the tire pressure will increase by one pound per square inch

Explanation:

Answer:

decrease

Explanation:

A 75 kg Skydiver is spotted at a height of 1000 m above the Earth's surface how much GPE does the skydiver possess

Answers

Answer:

735,000

Explanation:

75 × 9.8

Other Questions
Miranda v. arizona held that ______. amazon customers often find it helpful to read reviews for products they're considering purchasing. after ultimately making the purchase, the customer can go to amazon and post his or her opinion of the recently purchased product. this strategy not only assists other customers with their decision making, it helps amazon assess the products it sells. which statement attests to the value of this service? For the following reaction, choose the most likely reaction pathway and draw the major product. Only draw the resulting organic species, omit counterions. the loaves of rye bread distributed to local stores by a certain bakery have an average length of 30 centimeters and a standard deviation of 2 centimeters. assuming that the lengths are normally distributed, what percentage of the loaves are (a) longer than 31.7 centimeters? (b) between 29.3 and 33.5 centimeters in length? (c) shorter than 25.5 centimeters? If you acquiesce to a plan, what is most likely true? a) Using examples from organizations of your choice, clearlyexplain the indicators for the need of corporate restructuring.b) Discuss the various forms of corporate restructuring. According to a recent article from Forbes, retail operations in the United States are experiencing over $60 billion a year in losses primarily due to employee theft. Imagine you have been hired as a loss prevention specialist for a large retail chain and your first assignment is to identify and address the current problems with inventory shrinkage. Select and discuss one of the following internal controls below you would implement to help prevent future employee fraud/theft? Be sure to provide your rationale. Option A: More stringent background screenings for new hires (i.e. reference checks, criminal record checks, credit record checks) Option B: Tighter security controls (i.e. video surveillance, random inventory/cash audits, computer system audits, segregation of duties) penelope is a 15-year-old girl who weighs 82 pounds and is gaunt and frail. although she fears food and eating, she focuses on food by talking about it, collecting cookbooks, and cooking huge meals for others. whenever she looks at herself in the mirror, she thinks she is disgustingly fat. penelope is suffering from . Which of the following is NOT likely to help a Stage 2 country transition into a Stage 3 country?- Economic growth- Improvements in medicine- Tax credits for large families-... Match the firewall type on the right with the OSI layer at which it operates. Each OSI Layer may be used once, more than once, or not at all. which of the following is not true of a concentric contraction? a. this type of contraction produces more force than an eccentric contraction. b. a concentric contraction is an acceleration activity. c. muscle attachments move closer together. d. movement occurs against gravity. DeAngelo is selecting a fiction text for personal enjoyment. He is in eleventh grade and reads well; he loves biology, classical music, and biking.Based on this information, which book(s) would be the best recommendation? Check all that apply. USE THE DOT PLOT GRAPH TO FIGURE THIS OUT!!What is the most appropriate measure of center for the data set about 7th graders?A)meanB)medianC)rangeD)IQR A client with a nagging chronic cough has no other symptoms other than shortness of breath. Upon assessment, the client mentions having a spouse who is a heavy smoker and smokes approximately two packs per day. When educating the client on the increased risk of cancer, the client quickly states, "I don't breathe in that much smoke." What information should be given to the client? Select all that apply.1. Even small amounts of smoke cause damage to the vessels and abnormal heart rate.2. Secondhand smoke leads to increased risk for stroke and increased death from cancer.3. There is no safe level of exposure to second hand smoke.4. Once a person stops smoking, the body begins to repair itself.5. Smoke inhalation can lead to emphysema and COPD. Using the data given below, calculate the income from unknown sources for years 2 and 3 respectively.Year 1 Year 2 Year 3Total Assets $252,000 $266,000 $309,000Total Liabilities 244,000 134,000 64,000Known Income 30,000 69,000 74,000Total Living Expenses 17,500 10,800 8,800a. (i) -3,200; -26,200b. (i) 65,800; 47,800c. (i) 76,600; 56,600d. (i) 69,000; 74,000 Alton Incorporated is working at full production capacity producing 20,000 units of a unique product. Manufacturing costs per unit for the product are as follows: Direct materials $ 9 Direct labor 8 Manufacturing overhead 10 Total manufacturing cost per unit $ 27 The per-unit manufacturing overhead cost is based on a $4 variable cost per unit and $120,000 fixed costs. The nonmanufacturing costs, all variable, are $8 per unit, and the sales price is $45 per unit. Sports Headquarters Company (SHC) has asked Alton to produce 5,000 units of a modification of the new product. This modification would require the same manufacturing processes. However, because of the nature of the proposed sale, the estimated nonmanufacturing costs per unit are only $4 (not $8). Alton would sell the modified product to SHC for $35 per unit. Required: 1-a. Calculate the contribution margin for 5,000 units for both the current and special order. 1-b. Should Alton produce the special order for SHC Find the general solution to y'' + 5y' - 14y = 0|, Give your answer as y = ... |, in your answer, use c_1| and c_2| to denote arbitrary constants and the independent variable. Enter c_1| as c1 and c_2| as c2. At noon, ship A is 50 nautical miles due west of ship B. Ship A is sailing west at 16 knots and ship B is sailing north at 15 knots. How fast (in knots) is the distance between the ships changing at 6 PM? (Note: 1 knot is a speed of 1 nautical mile per hour. ) beta golf was considering entering the market with its hxl technology by grammatical name for too well