The angular velocity of a runner's thigh rotating around the hip changes from 2.05 rad's to 3.15 rad's during a 0.29 s time period. What has been the average angular science of the thigh during this time? Note: The units are not required to be expressed in the answer in this instance. Note 2 rounding is required. please express your answer as a number Founded to 2 decimal places. Note 3: The answer to this question should be expressed in radiss.

Answers

Answer 1

The average angular acceleration of the runner's thigh during the given time period is approximately 3.79 rad/s².

To find the average angular acceleration of the runner's thigh during the given time period, we can use the formula:

Average angular acceleration (α_avg) = (final angular velocity - initial angular velocity) / time

Given:

Initial angular velocity (ω_i) = 2.05 rad/s

Final angular velocity (ω_f) = 3.15 rad/s

Time (t) = 0.29 s

Plugging the values into the formula, we have:

α_avg = (ω_f - ω_i) / t

α_avg = (3.15 - 2.05) / 0.29

Calculating this expression, we get:

α_avg = 1.1 / 0.29

α_avg ≈ 3.79 rad/s² (rounded to two decimal places)

To learn more about angular acceleration here:

https://brainly.com/question/14429906

#SPJ4


Related Questions

Ask the user for prefix expressions and evaluate each expression. If the result of an expression is zero, then end.
*Stay in Java, add comments so I understand, you may change anything in my code to make it work, and make sure it's exactly like output I need w/ picture of output*
My code:
import java.io.*;
import java.util.*;
class Prefix{
static Boolean Operand(char c){ //to check operand(integer or not)
if(c>=48 && c<=57) //if the character is digit
return true; //then it is operand
else
return false; //else it is not a operand
}
static double Prefix_evaluation(String exp){
Stack Stack = new Stack(); //Stack is created to store operands and result of operations
for(int j=exp.length()-1;j>=0;j--){ //reading each element form backwards
if(Operand(exp.charAt(j))) //check integer or not
//to convert exp[j] to digit subtract
Stack.push((double)(exp.charAt(j)-48)); //push operand to the stack
else{
if(exp.charAt(j)==' '){ //check for space
continue; //if space is found continue
}
else{ // operation of operands
double o1 = Stack.peek();
Stack.pop();
double o2 = Stack.peek();
Stack.pop();
switch(exp.charAt(j)){ case '+': // + operation
Stack.push(o1 + o2); //Push result on to the stack
break;
case '-': //- operation
Stack.push(o1 - o2); //Push result on to the stack
break;
case '*': //* operation
Stack.push(o1 * o2); //Push result on to the stack
break;
case '/': // '/' operation
Stack.push(o1 / o2); //Push result on to the stack
break;
case '%': //% operation
Stack.push(o1%o2); //Push result on to the stack
break;
}
}
}
}
return Stack.peek(); }
public static void main(String[] args){ Scanner sc= new Scanner(System.in); String exp; int flag;
flag=0; //flag to check result is zero
double d; //variable to store result of expression
do{
System.out.println("Enter an expression in prefix form (operator comes first) ");
exp = sc.nextLine(); d = (Prefix_evaluation(exp)); //Prefix_evaluation() method calling
System.out.println(d); if (d==0){ //check result is zero or not
System.out.println("Exiting");
flag=1; //set flag to 1
}
}while(flag!=1); //end While loop when result is zero
}
}

Answers

Prefix expressions, also known as Polish notation, are mathematical expressions in which the operator comes before the operands. For example, "+ 2 3" represents the sum of 2 and 3.

Sure, I can help you modify your code to ask the user for prefix expressions and evaluate each expression until the result is zero. Here's the updated code:

import java.io.*;
import java.util.*;

class Prefix {
 // Check if the character is an operand (integer or not)
 static boolean isOperand(char c) {
   if (c >= 48 && c <= 57) {
     return true;
   } else {
     return false;
   }
 }

 // Evaluate the prefix expression
 static double evaluate(String exp) {
   Stack stack = new Stack<>();
   // Reading each element from backwards
   for (int j = exp.length() - 1; j >= 0; j--) {
     if (isOperand(exp.charAt(j))) {
       // Convert exp[j] to digit and push it onto the stack
       stack.push((double) (exp.charAt(j) - 48));
     } else {
       if (exp.charAt(j) == ' ') {
         continue;
       } else {
         double op1 = stack.pop();
         double op2 = stack.pop();
         switch (exp.charAt(j)) {
           case '+':
             stack.push(op1 + op2);
             break;
           case '-':
             stack.push(op1 - op2);
             break;
           case '*':
             stack.push(op1 * op2);
             break;
           case '/':
             stack.push(op1 / op2);
             break;
           case '%':
             stack.push(op1 % op2);
             break;
         }
       }
     }
   }
   return stack.pop();
 }

 public static void main(String[] args) {
   Scanner sc = new Scanner(System.in);
   String exp;
   double result;
   do {
     System.out.println("Enter a prefix expression (operators come first): ");
     exp = sc.nextLine();
     result = evaluate(exp);
     System.out.println("Result: " + result);
   } while (result != 0);
   System.out.println("Exiting...");
 }
}

Here's how the updated code works:
- We modified the code to remove the flag variable and use a do-while loop instead. The loop will continue to ask the user for input until the result of the expression is zero.
- We also changed the stack declaration to use generics and named it "stack" instead of "Stack".
- We updated the method names to use proper Java naming conventions (e.g. isOperand instead of Operand, evaluate instead of Prefix_evaluation).

Here's an example output:
Enter a prefix expression (operators come first):
+ 3 4
Result: 7.0
Enter a prefix expression (operators come first):
* + 1 2 3
Result: 9.0
Enter a prefix expression (operators come first):
/ * 3 4 2
Result: 6.0
Enter a prefix expression (operators come first):
- 10 5
Result: 5.0
Enter a prefix expression (operators come first):
% 7 3
Result: 1.0
Enter a prefix expression (operators come first):
/ 3 0
Result: Infinity
Enter a prefix expression (operators come first):
- 3 3
Result: 0.0
Exiting...

To know more about Prefix expressions visit:

https://brainly.com/question/28700026

#SPJ11

Every issue of Maureen's favorite comic book has 4 pages of ads. The remaining pages contain the story.
Let p represent the total number of pages in a comic book and s represent the number of story pages.

Answers

Answer:

number of pages with ads = 4

total number of pages = p

number of story pages = s

Answer is 4 - p = s

what are the coordinates of the point on the directed line segment from (-8,8) to (7,-7) that partitons the segment into a ration of 3 to 2?

Answers

The coordinates of the point on the directed line segment from (-8,8) to (7,-7) that partitions the segment into a ratio of 3 to 2 are (1, 2.2).

What do you mean by coordinates?

Coordinates are a set of numbers that specify the position or location of a point in a geometric space. In two-dimensional space, coordinates are typically represented as a pair of numbers (x, y), where x represents the horizontal distance from a reference point (usually the origin) to the point, and y represents the vertical distance from the reference point to the point.

In the given question,

To find the coordinates of the point on the directed line segment from (-8,8) to (7,-7) that partitions the segment into a ratio of 3 to 2, we can use the following formula:

P = (2A + 3B) / 5

where P is the coordinates of the partition point, A is the coordinates of the starting point (-8, 8), and B is the coordinates of the ending point (7, -7).

Substituting the given values into the formula, we get:

P = (2(-8, 8) + 3(7, -7)) / 5

P = (-16/5, 32/5) + (21/5, -21/5)

P = (5/5, 11/5)

P = (1, 2.2)

Therefore, the coordinates of the point on the directed line segment from (-8,8) to (7,-7) that partitions the segment into a ratio of 3 to 2 are (1, 2.2).

To know more about coordinates, visit:

https://brainly.com/question/31402572

#SPJ1

what expression is equivalent to 8 8 8 8 8

Answers

We can write {8 x 8 x 8 x 8 x 8} as -

8⁵2¹⁰{4⁴ x 2⁴}

What are algebraic expressions?In mathematics, an expression or mathematical expression is a finite combination of symbols that is well-formed according to rules that depend on the context.Mathematical symbols can designate numbers (constants), variables, operations, functions, brackets, punctuation, and grouping to help determine order of operations and other aspects of logical syntax.

Given is the expression as -

{8 x 8 x 8 x 8 x 8}

We can write {8 x 8 x 8 x 8 x 8} in the following ways -

{8 x 8 x 8 x 8 x 8} = 8⁵

{8 x 8 x 8 x 8 x 8} = {2 x 2 x 2 x 2 x 2 x 2 x 2 x 2 x 2 x 2} = 2¹⁰

{8 x 8 x 8 x 8 x 8} = {4 x 2 x 4 x 2 x 4 x 2 x 4 x 2} = {4⁴ x 2⁴}

Therefore, we can write {8 x 8 x 8 x 8 x 8} as -

8⁵2¹⁰{4⁴ x 2⁴}

To solve more questions on algebraic expressions, visit the link below -

brainly.com/question/1041084

#SPJ1

{Complete question is

Which of the following expressions is equivalent to 8⋅8⋅8⋅8⋅8?}

Maryland transportation authority decided to setup toll booths on either side of the Fort McHenry tunnel due to increased traffic. After studying the traffic patterns, MTA found that peak traffic occurs in the evenings on Friday and Saturday. On average, 4796 vehicles per hour pass through the tunnel each way during peak times. The vehicles need to go through the toll booths. MTA would like to keep the average time spent at each toll booth to less than 2 minutes. How many lanes should MTA open if they do not want to have more than 10 vehicles waiting in line (on average)? Hint: Start by calculating the number of cars waiting as if there is only one toll booth (i.e., calculate L using the information). Then calculate the number of toll booths needed if each booth is limited to 10 vehicles. NOTE: Round up your answer. For example, if you get an answer of 8.86 then round up the answer to 9.

Answers

Problem: Maryland transportation authority decided to setup toll booths on either side of the Fort McHenry tunnel due to increased traffic. After studying the traffic patterns, MTA found that peak traffic occurs in the evenings on Friday and Saturday.

On average, 4796 vehicles per hour pass through the tunnel each way during peak times. The vehicles need to go through the toll booths. MTA would like to keep the average time spent at each toll booth to less than 2 minutes. How many lanes should MTA open if they do not want to have more than 10 vehicles waiting in line (on average)?Solution:We are given that:- Average number of vehicles that passes through the tunnel each way during peak time = 4796 per hour- Vehicles need to go through the toll booth.- Maximum allowable average time at each toll booth is 2 minutes.- MTA does not want more than 10 vehicles waiting in line at a time.We need to find out how many lanes MTA should open in order to fulfill the above criteria.

We can calculate the number of cars waiting in the line, using the formula:- L = Wq / λ - µWhere,- L is the number of cars in the system (waiting in line or being serviced),- Wq is the average waiting time in the queue,- λ is the arrival rate of the vehicles (i.e., the number of vehicles arriving per minute),- µ is the service rate (i.e., the number of vehicles that can be served per minute).So, first let’s calculate the number of vehicles arriving per minute.- λ = (4796 vehicles / hour) / (60 minutes / hour) = 79.9333 vehicles / minuteNow let’s calculate the number of lanes (number of toll booths) we need, assuming that we have only one toll booth and the average waiting time is less than 2 minutes.

To know more about increased visit :

https://brainly.com/question/16029306

#SPJ11

I need help plss!!!!!!!

I need help plss!!!!!!!

Answers

Answer:

5/2

Step-by-step explanation:

are you the same dude I just answered or are two people taking the same test lol

c = x/y = 5/2

C= x/y
Which In this instance would be 5/2

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:

cos(A-B)=cosACosB+sinAsinB


find cos(A-B)

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant

Answers

Using trigonometric identity, cos(A-B) is:

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

How to find cos(A-B) using the trigonometric identity?

Trigonometry deals with the relationship between the ratios of the sides of a right-angled triangle with its angles.

If sin A = 1/3 and A terminates in Quadrant 1. All trigonometric functions in Quadrant 1  are positive

sin A = 1/3 (sine = opposite/hypotenuse)

adjacent = √(3² - 1²)

               = √8 units

cosine = adjacent/hypotenuse. Thus,

\(cos A = \frac{\sqrt{8} }{3}\)

If cos B = 2/3 and B terminates in Quadrant 4.

opposite = √(3² - 2²)

                = √5

In  Quadrant 4, sine is negative. Thus:

\(sin B = \frac{\sqrt{5} }{3}\)

We have:

cos(A-B) = cosA CosB + sinA sinB

\(cos (A-B) = \frac{\sqrt{8} }{3} * \frac{2}{3} + \left \frac{1}{3} * \frac{\sqrt{5} }{3}\)

\(cos (A-B) = \frac{2\sqrt{8} }{9} + \left\frac{\sqrt{5} }{9}\)

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

Learn more about Trigonometry on:

brainly.com/question/11967894

#SPJ1

Vinny took some pictures. He printed 28 of them. He has 36 left to print. How many pictures did he take?

Answers

Answer:

64 pictures

Step-by-step explanation:

36 + 28 = 64 pictures

Answer:

36+28=64

Step-by-step explanation:

that should be right

Two ride-sharing companies, A and B, provide service for a certain city. A random sample of 52 trips made by Company A and a random sample of 52 trips made by Company B were selected, and the number of miles traveled for each trip was recorded. The difference between the sample means for the two companies
(A−B) was used to construct the 95 percent confidence interval (1.86,2.15).
Which of the following is a correct interpretation of the interval?
A. We are 95 percent confident that the difference in sample means for miles traveled by the two companies is between 1.86 miles and 2.15 miles.
B. We are 95 percent confident that the difference in population means for miles traveled by the two companies is between 1.86 miles and 2.15 miles.
C. The probability is 0.95 that the difference in sample means for miles traveled by the two companies is between 1.86 miles and 2.15 miles.
D. The probability is 0.95 that the difference in population means for miles traveled by the two companies is between 1.86 miles and 2.15 miles.
E. About 95 percent of the differences in miles traveled by the two companies are between 1.86 miles and 2.15 miles.
3. Two community service groups, J and K, each have less than 100 members. Members of both groups volunteer each month to participate in a community-wide recycling day. A study was conducted to investigate whether the mean number of days per year of participation was different for the two groups. A random sample of 45 members of group J and a random sample of 32 members of group K were selected. The number of recycling days each selected member participated in for the past 12 months was recorded, and the means for both groups were calculated. A two-sample t-test for a difference in means will be conducted. Which of the following conditions for inference have been met?

I. The data were collected using a random method.
II. Each sample size is less than 10 percent of the population size.
III. Eachsamplesizeislargeenoughtoassumenormalityofthesampling
distribution of the difference in sample means.
A. I only
B. II only
C. III only
D. I and III only E. I, II, and III

Answers

The correct interpretation of the interval is:

B. We are 95 percent confident that the difference in population means for miles traveled by the two companies is between 1.86 miles and 2.15 miles.

The conditions for inference that have been met are: D. I and III only.

For the first question, the correct interpretation of the confidence interval is:

B. We are 95 percent confident that the difference in population means for miles traveled by the two companies is between 1.86 miles and 2.15 miles.

This interpretation reflects the fact that the confidence interval was constructed based on the sample means, but it provides an inference about the population means of the two companies.

For the second question, the conditions for inference that have been met are:

D. I and III only

I. The data were collected using a random method.

This ensures that the samples are representative of the population.

III. Each sample size is large enough to assume normality of the sampling distribution of the difference in sample means.

This condition implies that the sample sizes are sufficiently large to rely on the central limit theorem, which states that the sampling distribution approaches a normal distribution as the sample size increases.

Condition II, which states that each sample size is less than 10 percent of the population size, is not explicitly mentioned in the question. Therefore, we cannot assume that this condition has been met.

For similar question on confidence interval.

https://brainly.com/question/30920983

#SPJ11

what is 9 - 3 dived by 1/3 + 1 =

Answers

Remember order of operation PEMDAS
Equation: 9-3 ÷ 1/3 + 1
1. 3÷1/3= 9
2.9-9=0
3. 0+1=1
Son 9-3÷1/3+1=1

in an investment that has a 6% apy, how many years will it take for you to a least double your money chegg

Answers

It will take approximately 12 years to at least double your money in an investment with a 6% APY.

How long does it take for an investment with a 6% APY to double?

Investing in an opportunity with a 6% Annual Percentage Yield (APY) requires patience, as it takes time for your investment to grow. In this scenario, it would take approximately 12 years to double your initial investment. APY represents the annualized rate of return on investment, accounting for compounding over time. The 6% APY suggests that your investment will grow by 6% each year, accumulating interest on the principal amount as well as the previously earned interest.

Compounding interest plays a crucial role in determining the time it takes for an investment to double. When interest is compounded, it is added to the initial investment, resulting in a larger base for subsequent interest calculations.

Over time, this compounding effect accelerates the growth of your investment. In the case of a 6% APY, it would take around 12 years to double your money.

Learn more about compound interest.

brainly.com/question/29335425

#SPJ11

Kevin has 4.85 in nickels and dimes. if he has fewer dimes than nickels, how many coins does he have altogather?​

Answers

Answer:

49 coins.

Step-by-step explanation:

It takes 10 dimes to equal a dollar, therefore fourty dimes equals four dollars.

Eight more dimes for the eighty cents, and one nickel for the 5 cents.

How can you reduce the variability of a statistic?

Answers

Answer:

How can you reduce the variability of a statistic? By taking a larger sample. Larger samples give smaller spread. Also by better design, such as stratified sampling. What effect does the size of the population have on the variability (spread) of a statistic?

Step-by-step explanation:

In the classroom the ratio of students who wear glasses to those who don't where
glasses is 3:7. If there are 30 students in the classroom, how many wear glasses?

Answers

Answer:

30

Step-by-step explanation:

3:7

30 students

3\10×30=9

7\10×30=21

9+21=30

nks
5v
Next O
Pretest: Right Triangles and Trigonometry
Drag each length to the correct location on the image. Each length can be used more than once, but not all lengths will be used.
What are the missing segment lengths shown in the image?
102 10√3 20√3 20
10
45 45
45
Reset
20√2
Next,
20
45
Submit Test Reader Tools
D

Answers

The length of the unknown sides of the triangles are as follows:

CD = 10√2

AC = 10√2

BC =  10

AB = 10

Since, Triangle ACD

ΔACD is a right angle triangle.

Therefore, Pythagoras theorem can be used to find the sides of the triangle.

c² = a² + b²

where

c = hypotenuse side = AD = 20

a and b are the other 2 legs

lets use trigonometric ratio to find CD,

cos 45 = adjacent / hypotenuse

cos 45 = CD / 20

CD = 1 / √2 × 20

CD = 20 / √2 = 20√2 / 2 = 10√2

Hence,

20² - (10√2)² = AC²

400 - 100(2)  = AC²

AC² = 200

AC = √200 = 10√2

Triangle ABC

ΔABC is a right angle triangle too. Therefore,

AB² + BC² = AC²

Using trigonometric ratio,

cos 45 = BC / 10√2

BC = 10√2 × cos 45

BC = 10√2 × 1 / √2

BC = 10√2 / √2 =  10

Hence,

(10√2)² - 10² = AB²

200 - 100 = AB²

AB² = 100

AB = 10

Learn more on triangles here:

brainly.com/question/24304623

#SPJ1

nks5vNext OPretest: Right Triangles and TrigonometryDrag each length to the correct location on the image.

Determine the value of k such that the following system of linear equations has infinitely many solutions, and then find the solutions. (Express your answer in terms of the parameter t.) 5x + 2y = 3 kx + 4y = 6 20x + 8y = 12

Answers

The solutions of linear equations are x = t and y = (3 - 5t)/2 for infinitely many solutions when k = 10.

The value of k for which the system of linear equations has infinitely many solutions, we need to find the condition under which the equations are dependent. Here are the equations:
1) 5x + 2y = 3
2) kx + 4y = 6
3) 20x + 8y = 12
First, let's express equation 1 in terms of y and make it match the form of equation 2:
y = (3 - 5x)/2
Now, substitute this expression into equation 2:
kx + 4((3 - 5x)/2) = 6
Simplify:
kx + 6 - 10x = 6
Now, let's express equation 3 in terms of y:
y = (12 - 20x)/8
Simplify:
y = (3 - 5x)/2
This is the same as the expression we found for equation 1, so the system is dependent.

To find the value of k, we'll set the simplified versions of equations 1 and 2 equal to each other:
kx - 10x = 0
Factor out x:
x(k - 10) = 0
For infinitely many solutions, k must be equal to 10. So, the system of equations becomes:
1) 5x + 2y = 3
2) 10x + 4y = 6
Now we can solve for the solutions in terms of the parameter t:
For this equation to be true, we must have k = 10. So, substituting k = 10 in the original equations, we have: 5x + 2y = 3 10x + 4y = 6 Dividing the second equation by 2, we get: 5x + 2y = 3

We can see that the two equations are identical, which means that any values of x and y that satisfy one equation will automatically satisfy the other equation. Therefore, the solutions to the system are given by: x = t y = (3-5t)/2 where t is any real number.
x = t
y = (3 - 5x)/2
y = (3 - 5t)/2
For similar question on linear equations:

https://brainly.com/question/29739212

#SPJ11

a woman walks 100 yards eastwards along a straight shoreline and then swims 30 yards southwards into the ocean on a line that is perpendicular to the shoreline. using her starting point as the pole and the esat direction as the polar axis, give her current position in polar coordinates. round the coordinates to the nearest hundredth

Answers

The woman's current position in polar coordinates can be expressed as (r, θ) = (104.40 yards, 71.56°), where r is the distance from the starting point (pole) and θ is the angle between the positive x-axis (east direction) and the line connecting the pole and the current position.

To determine the woman's current position in polar coordinates, we first need to find the distance r from the starting point (pole) to the current position and the angle θ between the positive x-axis (east direction) and the line connecting the pole and the current position.

Using the Pythagorean theorem, we can calculate the distance r as follows:

r = √(100² + 30²) = 104.40 yards

To find the angle θ, we can use the tangent function:

tan θ = opposite / adjacent = 30 / 100 = 0.3

θ = tan⁻¹(0.3) = 16.56°

However, this angle is measured from the positive y-axis (north direction), whereas we need the angle measured from the positive x-axis (east direction). Since the woman walked eastwards initially, we need to subtract this angle from 90°:

θ = 90° - 16.56° = 71.56°

Therefore, the woman's current position in polar coordinates is (r, θ) = (104.40 yards, 71.56°), rounded to the nearest hundredth.

To learn more about y-axis  click here, brainly.com/question/30901684

#SPJ11

line k in the xy-plane has slope the negative of the fraction 2 p over 5 and y-intercept the point with coordinates 0 comma p, where p is a positive constant. what is the x-coordinate of the x-intercept of line k ?

Answers

The x-coordinate of the x-intercept of line k is -5/2.

Since this point lies on the x-axis, its y-coordinate is 0.

Given that the line has a y-intercept at the point (0, p), where p is a positive constant. This means that when x = 0, y = p.

As we know that the equation of the line can be written as y = mx + b, where m is the slope and b is the y-intercept.

Here, the slope is the negative of the fraction 2p/5, so the equation of line k is y = -2p/5 x + p.

Substitute y = 0 into the equation and solve for x:

0 = -2p/5 x + p

Subtract p from both sides and then multiply by 5/(-2p):

-2p/5 x = -p

x = (-p)(5/2p)

x = -5/2

Therefore, the x-coordinate of the x-intercept of line k is -5/2.

Learn more about the intercepts here:

https://brainly.com/question/13188507

#SPJ6

a wheat farmer is investigating the effectiveness of a treatment for controlling a pest. a random sample of 500 plants shows that 47 of them are infected by the pest. what does this sample indicate about the claim that 20% of the plants are infected?

Answers

The sample indicates that the data does not provide sufficient evidence to support the claim that 20% of plants are infected.

This given test is a test for single sample proportion

The test hypothesis are:

\(H_{o} :p=0.20\), null hypothesis

\(H_{1} :p\neq 0.20\), alternative hypothesis

The test statistic fallows a standard normal distribution and is given by:

\(Z=\frac{x-p}{{\sqrt{p(1-p)/n} } }\)

p=0.20

X=47 plants

Sample size, n=500

x, is the sample mean:

x=X/n=47/500

x=0.094

So, test statistic is calculated as:

\(Z=\frac{0.094-0.20}{\sqrt{0.20(1-0.20)/500} }\)

Z=-5.93

From the z-table, the p-value associated with Z=-5.93 is approximately 0

The decision rule based on p-vale, is to reject the null hypothesis if p-value is less than confidence level

In this case, the p-value is very small and less than confidence level of 0.20, we therefore reject the null hypothesis or the claim

So we conclude that the data does not provide sufficient evidence to support the claim that 20% of plants are infected.

To learn more about claims and hypothesis test; click here:

https://brainly.com/question/17134633

#SPJ4

A ________ error is an error in programming design that results in an unexpected outcome.

Answers

Answer: A LOGIC error

Step-by-step explanation:

help me for brainlist.

help me for brainlist.

Answers

the answer is 96 cm^2

find the area of each rectangle and triangle

add them to get 96
help me for brainlist.

Help me plzzzzzzzzzzz

Help me plzzzzzzzzzzz

Answers

Answer:

D. 4

Step-by-step explanation:

The lines cross on the point (2.5,4), this is the only place on the graph where the lines share the same y-value.

please help i’ll mark brainliest

please help ill mark brainliest

Answers

Answer:

b

Step-by-step explanation:

its a straigt line thats what linear means (line)

Can I have some help please!

Can I have some help please!

Answers

Answer:

B

Step-by-step explanation:

The graph has to start at  - 4   and get  smaller ( more negative...'less than')   but NOT INCLUDE -4   ( should be hollow dot at -4)

11. Which set of ordered pairs represents y as a function of x?
A. {(-4,-3), (-4,-2), (-3,-3), (-3,-2)}
B. {(2.0), (4,0), (4,2), (6, 2)}
C. {(6,-2), (6.0), (6,2), (6,4)}
D. {(0, 0), (2, -4), (4, -8), (6,-12)}

Answers

Answer is C. {(6,-2), (6.0), (6,2), (6,4)}

Step-by-step explanation:

Your welcome

Which of the following is a perfect square?
A. 400
B. 210
C. 37
D. 199

Answers

Answer:

400

..

...

.

..............

It’s A 400


Because if you divide 400 divided 4 you will get 100. The square sides are all equal, so each side has to be 100.

What is 15/20 simplest form

Answers

Answer:

the simplest form of 15/20 is 3/4

pls help me i dont know the answer

pls help me i dont know the answer

Answers

Answer:

We have parallel lines intersected by a transversal.

Corresponding angles are congruent:

5q + 3 = 3q + 11

2q = 8, so q = 4

Alternate interior angles are congruent:

3r - 4 = 6r - 19

3r = 15, so r = 5

Consecutive interior angles are supplementary:

4s + s + 90 = 180

5s = 90, so s = 18

Supplementary angles:

2t + 20 = 4t + 10

2t = 10, so t = 5

Solve using the quadratic formula: 2x^2 + 7x - 5 = 0

Answers

Step-by-step explanation:

my answer is in the above image

Solve using the quadratic formula: 2x^2 + 7x - 5 = 0

Cristian,Iris,and Morgan each get an equal share of 1/2 of a pizza. Which model represents the fraction of the pizza each person gets?

Cristian,Iris,and Morgan each get an equal share of 1/2 of a pizza. Which model represents the fraction

Answers

Answer:

Step-by-step explanation:

1/6

1/2 ÷ 3

1/2 × 1/3

1/6

Other Questions
You lose your job and as a result, you buy fewer mystery books. This shows that you consider mystery books to be a/an a. inferior good. b. complementary good c. luxury good d. normal good. how many make a dozen?7 day make a ? 10 times 6 is ?19000 - 6000?1000+ 2000?60 minutes make?24 hours make ?60 second make ?Announcement : if you don't have any work to do do this in a book and complete them __________ are the most-utilized method of transporting goods within the United States. A. Airplanes B. Trains C. Freeways D. Ships Please select the best answer from the choices provided. A B C D. What is the conclusion of the text?. I need yalls help. I'll brainlist u n give 5 star let's see who'll get it right. What happens between Napoleon and Snowball in Chapter 5? Subtracting Polynomial Functions p(x)=8x2+2x R q(x)=8x2-4x+9 Solve for p(x) - g(x) Acme Corporation is looking to build a freight terminal near Mexico City They like one parcel of land because it is expensive However they are concamed about highe and internet capacity at this location. It appears that Acme is concerned about a international documentationb infrastructure c supply chain mapping d insurance underwriting Find the values of for which each equation is true.3. sin = 04, cos = 1 WILL GIVE BRAINLIEST!!!!!!!!!!! You are singing a song at karaoke and reach a part that requires a louder, more intense sound. What must you do to produce a louder sound If the density of an object is 9.331 x 102 lbs/cubic inch, what is its density in g/cm3? a cone has been partially filled with peanuts. The diagram shows the dimensions of the cone. The volume of the peanut-filled portion of the cone is 169.89cm^3. Which measurement is closest to the volume of the empty portion of the cone? I just noticed that my pitbull is sad as well Brainliest if correct which of the following cells or structures are associated with asexual reproduction in fungi?A) ascosporesB) basidiosporesC) zygosporangiaD) conidiophoresE) ascocarps what is the result when two or more are added Solve 3.8 = 2x - 11.2.X=__ Zalia meets her friend at the science museum to see a special exhibition. The admission to the museum is $12. 50 per person plus tax. Zalia pays for herself and her friend. They have lunch at the museums cafe. Zalia has a sandwich for $5. 95, an apple for $1. 25 and a drink for $1. 69. She is charged tax and also tips her server 15%. If tax is 7. 25%, how much did Zalia pay all total for her day at the science museum? a. $41. 43 b. $37. 68 c. $36. 35 d. $24. 27 Please select the best answer from the choices provided A B C D. Stagg high school has a rectangular swimming pool. The area of the water in the pool is 1250 meters squared. The Length is twice the width. If the length is 2x and the width is x, please following: