The alcoholic, blue solution from Part I of your experiment is commonly used in weather-forecasting devices found in coastal areas of the USA. Based on your observations in the lab explain how this reaction can indicate coming rain

Answers

Answer 1

Answer:

The reaction referred to in this question is likely the reaction between hydrated copper(II) sulfate and anhydrous copper(II) sulfate, where the former is blue and the latter is white.

When the blue solution of hydrated copper(II) sulfate is exposed to moist air, it slowly turns white as water is absorbed, forming anhydrous copper(II) sulfate. This reaction is exothermic, meaning it releases heat, and is reversible. The reverse reaction occurs when anhydrous copper(II) sulfate is exposed to water vapor in the air, forming hydrated copper(II) sulfate and releasing heat.

In coastal areas, the humidity in the air tends to increase before a storm, which can trigger the reverse reaction between anhydrous copper(II) sulfate and water vapor. This releases heat, causing the weather-forecasting device to warm up, indicating that rain may be on the way.

Therefore, the observation of the blue solution turning white in the lab, which indicates the reversible reaction between hydrated copper(II) sulfate and anhydrous copper(II) sulfate, can indirectly indicate the presence of moisture in the air and the possibility of rain, similar to the process in weather-forecasting devices.


Related Questions

It is difficult to measure the volume of a gas​

Answers

Answer:

Gases are more difficult to measure than liquids, because measured volumes are highly affected by temperature and pressure. Gas meters measure a defined volume, regardless of the pressurized quantity or quality of the gas flowing through the meter.

Explanation:

It is difficult to measure the volume of agas because measured volumes are highly affected by temperature and pressure.

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

4.Using their general formula, CnH2n-2 derive the molecular formula of the alkynes when n = 5, 6, 7, 8)


5.Write the condensed structural formula of the molecules in #4.

Answers

C₅H₆ is the first pentyne, C₆H₁₂ is the first hexyne, C₇H₁₀ is the first heptyne,

C₈H₁₂  is the last pentyne (this is 1-octyne). pentyne: 1-Butyne, hexyne: 3-methylpentane, heptyne: 3,3-dimethylbut-1- ene, and octyne: 5-(2-methylpropyl)-decane

Alkynes have the generic formula :

Alkynes are hydrocarbons with at least one triple bond between two carbon atoms. Alkynes have the general formula. Alkyne must contain at least two carbon atoms, much like alkene.

What does the general formula represent?

The -ane ending in the name indicates that the substance is an alkane. Methane, ethane, propane, butane, pentane, hexane, heptane, and octane are the names of the alkanes. The general formula for alkanes.

To know more about heptyne :

brainly.com/question/24229597

#SPJ1

PLEASE HELP ASAP!!!!! What word is the best description for world population growth over the past 200 years?

Question 1 options:

Experimental


Arithmetic


Logarithmic


Exponential

Answers

Answer:

 Exponential

Explanation:

Because its the numbers/anything that is becoming more and more rapid.

what is the concentration of a nitric acid solution if 10.0 ml of the solution is neutralized by 3.6 ml of 0.2 m naoh?

Answers

Answer:

The concentration of the nitric acid (HNO3) solution is 72 M.

Explanation:

To determine the concentration of the nitric acid solution, we can use the concept of stoichiometry and the equation of the neutralization reaction between nitric acid (HNO3) and sodium hydroxide (NaOH):

HNO3 + NaOH → NaNO3 + H2O

The balanced equation shows that the molar ratio between HNO3 and NaOH is 1:1. This means that 1 mole of HNO3 reacts with 1 mole of NaOH.

Given:

Volume of HNO3 solution = 10.0 ml

Volume of NaOH solution = 3.6 ml

Molarity of NaOH solution = 0.2 M

To find the concentration of the HNO3 solution, we need to calculate the number of moles of NaOH used in the neutralization reaction:

moles of NaOH = volume of NaOH solution * molarity of NaOH solution

= 3.6 ml * 0.2 M

= 0.72 mmol (millimoles)

Since the molar ratio between HNO3 and NaOH is 1:1, the number of moles of HNO3 in the solution is also 0.72 mmol.

Now, we can calculate the concentration of the HNO3 solution using the formula:

concentration (in M) = moles of solute / volume of solution (in L)

concentration = 0.72 mmol / 0.010 L

= 72 mmol/L

= 72 M

Therefore, the concentration of the nitric acid (HNO3) solution is 72 M.

N₂ +
H₂O →>>
NH, -
+
0₂

Answers

The balanced chemical equation for the reaction is:

N₂ + 3H₂O → 2NH₃ + O₂

The equation shows that nitrogen gas (N₂) and water (H₂O) react to form ammonia (NH₃) and oxygen gas (O₂). The coefficients in the balanced equation indicate that one molecule of N₂ reacts with three molecules of H₂O to produce two molecules of NH₃ and one molecule of O₂.

What is true about dominant alleles? a They almost never appear as the trait. b They appear as the trait only when there are two of them c They appear as the trait over a recessive allele d They appear as the trait if there is not recessive allele

Answers

They appear as the trait over a recessive allele. Statement C) is true about the dominant alleles.

Dominant alleles are genetic variants that, when present in an individual's genotype, are expressed phenotypically, meaning they determine the visible or observable traits. Dominant alleles are represented by capital letters, while recessive alleles are represented by lowercase letters in genetics.

In terms of inheritance, if an individual has at least one copy of the dominant allele, it will be expressed in the phenotype, regardless of the presence of a recessive allele. This is because dominant alleles exert their influence over recessive alleles, thus "dominating" their expression.

To illustrate this, let's consider a specific example using a trait controlled by a single gene with two possible alleles: dominant (A) and recessive (a). If an individual is homozygous dominant (AA), meaning they possess two copies of the dominant allele, the dominant trait will be expressed.

However, if an individual is homozygous recessive (aa), with two copies of the recessive allele, the recessive trait will be expressed since there are no dominant alleles to override it.

Therefore, dominant alleles appear as the trait over recessive alleles, regardless of the presence or absence of a recessive allele. The presence of even a single copy of the dominant allele is sufficient for its expression in the phenotype. Option C

For more such questions on  recessive allele visit:

https://brainly.com/question/16048928

#SPJ8

When zinc reacts with copper sulfate solution, zinc sulfate solution and copper are formed.(i) An experiment was carried out to measure the temperature change when zinc powder reactswith copper sulfate solution.initial temperature of copper sulfate solution = 20 °Cfinal temperature of mixture after the reaction = 46 °CExplain what the temperature readings show about the type of heat change that occurs duringthis reaction.

Answers

The temperature increase from 20 °C to 46 °C indicates that the reaction between zinc and copper sulfate solution is exothermic, with heat being released into the surroundings.

In the given reaction between zinc and copper sulfate solution, the temperature change can provide insights into the type of heat change occurring during the reaction. Based on the provided information, the initial temperature of the copper sulfate solution was 20 °C, and the final temperature of the mixture after the reaction was 46 °C.

The temperature increase observed in this reaction indicates an exothermic heat change. An exothermic reaction releases heat energy into the surroundings, resulting in a temperature rise. In this case, the reaction between zinc and copper sulfate solution is exothermic because the final temperature is higher than the initial temperature.

During the reaction, zinc displaces copper from copper sulfate to form zinc sulfate and copper metal. This displacement reaction is known as a single displacement or redox reaction. Zinc is more reactive than copper and therefore replaces copper in the compound.

The formation of new chemical bonds during the reaction releases energy in the form of heat. This energy is transferred to the surroundings, leading to an increase in temperature. The heat released is greater than the heat absorbed, resulting in a net increase in temperature.

The exothermic nature of this reaction can be explained by the difference in bond energies between the reactants and products. The breaking of bonds in the reactants requires energy input, while the formation of new bonds in the products releases energy.

In this case, the energy released during the formation of zinc sulfate and copper metal is greater than the energy required to break the bonds in copper sulfate and zinc.

For more such question on temperature visit:

https://brainly.com/question/4735135

#SPJ8

Ice has a density of 0.92g/cm3. It will float in water.

Answers

The density of pure water is 1 g/cm^3.

Its density is 0.98 g cm 3 at room temperature, in comparison with the handiest zero.92 g cm 3 for ice, a reality that has to be defined through atomic, and molecular concepts. If ice has been no longer much less dense than water, it might sink, having a devastating impact on lake backside ecosystems. believe it or now not, ice is honestly about 9% much less dense than water. for the reason that water is heavier, it displaces the lighter ice, causing the ice to glide to the pinnacle.

The density of ice is about 90 percent that of water, but that could range because ice can contain air, too. meaning that about 10 percent of an ice cube or iceberg will be above the water line. The density of water is maximum at four∘C, and the density of the ice is much less than the water due to its susceptible intermolecular pressure of attraction. as the density of water is more, it's miles heavier than ice. therefore ice floats on the floor of the water. Ice continually floats due to the fact it's far less dense than everyday water. because frozen water molecules shape a crystal.

Learn more about A density here:-https://brainly.com/question/17780219

#SPJ9

How many grams are in 6.02x1023 formula units of Al2O3?

Answers

The number of grams in 6.02 × 10²³ formula units of aluminium chloride is 101.96g.

How to calculate mass?

The mass of a substance can be calculated from the formula units by dividing the number of formula units by Avogadro's number.

According to this question, there are 6.02 × 10²³ formula units of aluminum oxide. This means that;

no of moles = 6.02 × 10²³ ÷ 6.02 × 10²³

no of moles = 1 mole

molar mass of aluminium oxide = 101.96g/mol

mass of aluminum oxide = 101.96g/mol × 1 mole = 101.96g

Learn more about mass at: https://brainly.com/question/29353833

#SPJ1

PO3-


2.64 Complete the table by filling in the formula for the ionic compound formed by each pair of cations and anions, as shown for the first pair.


Ion


02-


Na


Ca2+


Fe2+


A13+


Na2O


NO3


AsO43-

Answers

The completed table that fills the formula for the ionic compound has been given below:

How to solve

To form an ionic compound from the given cation and anion we need to balance the charges of the cation and anions.

For example: Suppose we have a cation C3+ and an anion A-. Thus, to balance the charge we need 1C3+ and 3A-, the formula of the ionic compound formed CA3.

Ion K+ NH4+ Mg2+ Fe3+

Cl- KCl NH4Cl MgCl2 FeCl3

OH- KOH NH4OH Mg(OH)2 Fe(OH)3

CO32- K2CO3 (NH4)2CO3 MgCO3 Fe2CO3

PO43- K3PO4 (NH4)3PO4 Mg3(PO4)2 FePO4

Read more about ionic compounds here:

https://brainly.com/question/1332431

#SPJ1

PO3-2.64 Complete the table by filling in the formula for the ionic compound formed by each pair of cations

what mass of glucose c6h12o6 would be required to prepare 5000 mL of a 0.215 M solution

Answers

Approximately 194.0 grams of glucose (C6H12O6) would be required to prepare a 5000 mL solution with a concentration of 0.215 M.

To determine the mass of glucose (C6H12O6) required to prepare a 0.215 M solution in 5000 mL, we need to use the formula:

Molarity (M) = moles of solute / volume of solution (in liters)

First, let's convert the volume of the solution from milliliters (mL) to liters (L):

5000 mL = 5000/1000 = 5 L

Now, we can rearrange the formula to solve for moles of solute:

moles of solute = Molarity (M) x volume of solution (L)

moles of solute = 0.215 M x 5 Lmoles of solute = 1.075 mol

Since glucose (C6H12O6) has a molar mass of approximately 180.16 g/mol, we can calculate the mass of glucose using the equation:

mass of solute = moles of solute x molar mass of solute

mass of glucose = 1.075 mol x 180.16 g/mol

mass of glucose = 194.0 g (rounded to three significant figures)

Therefore, approximately 194.0 grams of glucose (C6H12O6) would be required to prepare a 5000 mL solution with a concentration of 0.215 M. It's important to note that the molar mass of glucose used in this calculation may vary slightly depending on the level of precision required.

For more such questions on glucose visit:

https://brainly.com/question/397060

#SPJ8

what's the molecular geomrtry of SiCI4​

Answers

Answer:

Tetrahedral

Explanation:

The molecular geometry of SiCl₄ is a tetrahedral shape. According to the VESPR molecular theory, the compound has a shape of a tetrahedron.

In this compound there are four bond pairs and no lone pairs. The total electron pair is 4 . The valence shell electron pair repulsion theory uses the total number of electrons pairs surrounding the central atom of a specie.

This type of evidence is testimonial evidence. Statements that are made under oath

A. Trace Evidence

B. Indirect Evidence

C. Direct Evidence

D. Physical Evidence

Answers

Answer:

B

You are only trained as a Fry man kitchen helper in your restaurant. One day, one of the trained kitchen helpers assigned to the sauté station was absent. The Executive chef immediately assigned you to the sauté station by force.

What will you do considering that you have no training in that station?

What are insulated foam cups most likely made out of?​

Answers

Answer:

polyethylene polystyrene nylon thread vulcanized rubber.

Answer:

A- polyethylene

Explanation:

just took the quiz

Which is an aspect of the kinetic-molecular theory and can be used to explain the compressibility of plasmas? Particles move independently of one another and are widely spaced. Particle kinetic energy increases with increasing temperature. Particles exert no attractive or repulsive force on one another. Particles always move even when they have fixed positions.

Answers

Answer: Particles move independently of one another and are widely spaced.

Explanation:

The postulates of kinetic theory are:

1)All the molecules are made up of molecules which are rigid spheres

2) The molecules are identical for a particular gas and different for different gases.

3) All the molecules move in random motion in all direction.

4) During random motion they collide with each other as and hence exert pressure

5) During collision the molecules move in a straight line path known as free path

6) The size of the molecule of a gas is negligible as compare to the distance between the molecule.

Answer:

A

Explanation:

Right on edge

You estimate that you sent 135 texts last week but when you get the bill, it was actually 175. Calculate the percent error

Answers

Answer: -40

Explanation: Percent error is calculated by subtracting the value you actually recieved from the literature value (175 in your case)  SO your answer should be 135-175=-40.

What is meant by the term enthalpy of formation?

Answers

Answer:

Explanation:

There is no way to measure the absolute value of the enthalpy of a substance. Only values relative to an arbitrary reference can be determined.

The reference point for all enthalpy expressions is called the standard enthalpy of formation (ΔHºf). Substances are said to be in the standard state at 1 atm, hence the term “standard enthalpy.” The superscript “°” represents standard-state conditions (1 atm), and the subscript “f” stands for formation. By convention, the standard enthalpy of formation of any element in its most stable form is zero.

For instance, molecular oxygen (O₂) is more stable than the other allotropic form of oxygen, ozone (O₃), at 1 atm and 25°C. Thus, we can write ΔHºf (O₂) 5 0, but ΔHºf (O₃) 5 142.2 kJ/mol.

Based on this reference for elements, we can define the standard enthalpy of formation of a compound as the heat change that results when 1 mole of the compound is formed from its elements at a pressure of 1 atm.

Answer:

This is the enthalpy change that occurs when a compound is formed from its component elements.

Explanation:

This is the enthalpy change that occurs when a compound is formed from its component elements.

How is static electricity transferred during charging by conduction?

Answers

Answer:

Static electricity is transferred during charging by conduction when electrons from a charged from one object to another object by direct contact. For example, on a carpet, charges are transferred from a person's feet to the rest of his/her body.

Which of the following sequences describes how a four-stroke engine cycle
powers the engine?
O A. Expansion, air and fuel intake, compression and ignition,
extinguishment
B. Air and fuel intake, compression and ignition, combustion and
expansion, exhaust
O C. Hydrogen and fuel intake, expansion, compression and ignition,
exhaust
O D. Contraction, compression and ignition, air and fuel intake, exhaust

Answers

The sequence which describes the four-stroke engine cycle is air and fuel intake, compression and ignition, combustion and expansion, exhaust.

What is four stroke engine cycle?

Four stroke engine cycle is a type of engine in which internal combustion takes place by the piston.

Stroke in the engine stands for the whole travel of piston along the cylinder. Following are the sequence of processes that occur in the engine:

Injection: In this process air and fuel are injected to the engine.Ignition: The intake material will compressed and ignition of them takes place.Combustion: As a result of the ignition, combustion of the fuel takes place and due to the formation of products from the combustion reaction again expansion takes place.Exhaust: In this step piston pushes out burned gases from the engine.

Hence, correct sequence is air and fuel intake, compression and ignition, combustion and expansion, exhaust.

To know more about 4-stroke engine, visit the below link:

https://brainly.com/question/16195593

#SPJ1

Please help solve these chemistry questions!!!

Practice with percent composition.
1. What is the percent composition of Fe if 111.7 g of Fe is recovered from a 159.7 g sample of Fe2O3?




2. What is the percent composition of O if 12 g of O is recovered from a 38 g sample of Cr2O3?




3. Calculate the percent composition of KCl.





4. Calculate the percent composition of N2O5.





Practice with empirical formulas
5. What is the empirical formula for a compound that contains 0.0260 mol C, 0.0325 mol H, and 0.0065 mol O.



Practice with Molecular Formulas
6. Determine the molecular formula for a compound that has an empirical formula of NO2 and a molar mass of 138.015 g/mol.





7. Nicotine is 74.1% C, 8.6% H, and 17.3% N by mass. It’s molar mass is about 160 g/mol.
a. What is it’s empirical formula?




b. What is it’s molecular formula?

Answers

To find the percent composition of Fe in Fe2O3, we need to calculate the molar mass of Fe and the molar mass of Fe2O3. The molar mass of Fe is 55.85 g/mol, and the molar mass of Fe2O3 is 159.7 g/mol.
To calculate the percent composition of Fe:
(55.85 g/mol / 159.7 g/mol) × 100% = 34.9%

Therefore, the percent composition of Fe in Fe2O3 is 34.9%.

Similarly, to find the percent composition of O in Cr2O3, we need to calculate the molar mass of O and the molar mass of Cr2O3. The molar mass of O is 16.00 g/mol, and the molar mass of Cr2O3 is 152 g/mol.
To calculate the percent composition of O:
(16.00 g/mol / 152 g/mol) × 100% = 10.5%

Therefore, the percent composition of O in Cr2O3 is 10.5%.

The formula for potassium chloride (KCl) consists of one potassium atom (K) and one chlorine atom (Cl). To calculate the percent composition of KCl, we need to calculate the molar mass of KCl.
The molar mass of KCl is:
39.10 g/mol (molar mass of K) + 35.45 g/mol (molar mass of Cl) = 74.55 g/mol

To calculate the percent composition of K:
(39.10 g/mol / 74.55 g/mol) × 100% = 52.4%

To calculate the percent composition of Cl:
(35.45 g/mol / 74.55 g/mol) × 100% = 47.6%

Therefore, the percent composition of KCl is 52.4% K and 47.6% Cl.

The formula for dinitrogen pentoxide (N2O5) consists of two nitrogen atoms (N) and five oxygen atoms (O). To calculate the percent composition of N2O5, we need to calculate the molar mass of N2O5.
The molar mass of N2O5 is:
2 × (14.01 g/mol) (molar mass of N) + 5 × (16.00 g/mol) (molar mass of O) = 108.01 g/mol

To calculate the percent composition of N:
(2 × 14.01 g/mol / 108.01 g/mol) × 100% = 25.9%

To calculate the percent composition of O:
(5 × 16.00 g/mol / 108.01 g/mol) × 100% = 74.1%

Therefore, the percent composition of N2O5 is 25.9% N and 74.1% O.

To determine the empirical formula for a compound with given mole ratios, we need to divide each mole value by the smallest mole value to obtain the simplest whole number ratio.
Given:
0.0260 mol C
0.0325 mol H
0.0065 mol O

Dividing each mole value by 0.0065 (the smallest mole value), we get:
C: 0.0260 mol / 0.0065 mol = 4
H: 0.0325 mol / 0.0065 mol = 5
O: 0.0065 mol / 0.0065 mol

How can you identify the gas produced in a chemical reaction without observing the atoms and molecules directly?

Answers

To identify the gas produced in a chemical reaction without observing the atoms and molecules directly through the characteristics of the gas.

Chemical reaction is defined as the process by which substances (known as reactants) combine together with the formation of bonds to form products.

There are some signs that shows that chemical reaction has occurred. They include:

Color Change Change of temperatureGiving off gas (Evolution of gas)

Therefore, the production of gas from a chemical reaction shows that a reaction has occurred.

These gases can be identified without observing the molecules through that characteristics of the gas. This include:

the smell of the gas: For example when a gas is given off, and it smells like urine, it's likely to be ammonia gas. color change that occurs during the chemical reaction can show the type of gas that was given off. For example when lime water turns into milky color, it shows the presence of carbondioxide gas.

Learn more here:

https://brainly.com/question/15740593

Please help.

If a pill is tested with formaldehyde and sulfuric acid and turns the solution orange, ecstasy was present.
O True
O False

Answers

False, if a pill is tested with formaldehyde and sulfuric acid and turns the solution orange, it does not necessarily mean that ecstasy was present.

The effect of ecstasy in a pill test

While ecstasy does produce this reaction, other substances can as well. Formaldehyde and sulfuric acid are reagents used in the “Marquis test” to identify the presence of certain alkaloids. When these two chemicals are mixed together, a reaction will occur with certain compounds to produce an orange solution.

This reaction can occur with other substances like codeine, heroin, and even caffeine. Therefore, the orange solution is not a definitive indicator of the presence of ecstasy.

To identify the exact substance, a sample of the pill must be tested using a more advanced method such as a gas chromatography–mass spectrometry or high performance liquid chromatography (HPLC). These methods can accurately identify the exact components of the pill. while the Marquis test can be used as a preliminary test to identify the presence of certain compounds, it cannot definitively determine if ecstasy was present.

Learn more about pill test here:

https://brainly.com/question/25670641

#SPJ1

which type of measurement would you use to determine the mass of sugar?

Answers

Answer:

When it comes to how to measure sugar, you need the right measuring tools. All sugar varieties are considered a dry ingredients so use dry measuring cups and measuring spoons.

Explanation: well there are only a few things you can use to measure things that aren't water so this only makes sense.

summarize the processes by which glucagon, epinephrine and insulin affect the breakdown or synthesis of glycogen

Answers

Similar to glucagon, epinephrine increases glycogenolysis in the liver, which raises blood glucose levels.

How does breakdown of glycogen take place and how glucagon, epinephrine and insulin affect the process?

Glycogenolysis is the biological process through which glucose and glucose-1-phosphate are produced from glycogen. Both myocytes and hepatocytes contribute to the reaction. The process is affected by glycogen, epinephrine and insulin in such a way that-

The pancreas produces the hormone insulin, which enables glucose to enter body cells. Insulin's anabolic action on glycogen metabolism results in a decline in glycogen synthase phosphorylation. Other enzymes involved in the creation of glycogen are also affected. As a result, when the blood glucose level rises, insulin drives the creation of glycogen.Glucagon is a type of hormone that interacts with other hormones to help regulate blood glucose levels. It prevents the drop in blood glucose levels. Glycogen is released into the bloodstream and the breakdown of glycogen into a usable form is triggered. Additionally, it stops the production of glycogen.Epinephrine signals the liver and skeletal muscle to convert stored glycogen to glucose and release it primarily by starting gluconeogenesis when the level of blood glucose drops too low. This helps to increase blood sugar levels.

Know more about biology of glycogenolysis at:

https://brainly.com/question/29429567

#SPJ4

I need help asap please help me

I need help asap please help me

Answers

Answer:

it says the answer is variation

the answer might be B.variation

Does anyone know the name of this measuring tool​

Answers

Measurement tools have various types; major products include vernier calipers, micrometers, dial gauges, gauges of varied types, bubble levels, protractors and rulers; they are tools used in production processes and quality checks.

what is 1.01 km to mm in scientific notation​

Answers

Answer:

= 3.456 × 1011

Explanation:

WS 3.5 more Lewis structures

Answers

Kinda confused what worksheet your on
WS 3.5 more Lewis structures

Question 2 (1 point)
What is the concentration when 45 mL of 1.5 M Na₂SO4 is diluted to 500 mL?
16.7 M
0.14 M
0.015 M
1.35 x 10-4 M

Answers

Answer: The concentration(molarity) of the solution will be 1.35 X10-4 M

Explanation: Molarity is defined as number of moles of solute present in one litre of any solution.

Mathematically,

Molarity= no of moles of solute/volume of solution(in liters)

M=N/V(liters)

Also upon dilution the number of moles of the solution remain unchanged

Therefore initial no of moles(before dilution)= final no of moles(after dilution)

M1V1=M2V2

According to the question,

Molarity of Na2S04 before dilution(M1)=1.5 M

Volume of NA2SO4(V1)=45 mL

Molarity of Na2S04 after dilution(M2)=x M

Volume of Na2S04(V2)=500 mL

x=M1V1/V2

=1.5X45/500

=0.135 M =1.35 X10-4 M

For dilution concept, refer-

https://brainly.in/question/11390951

Other Questions
what happen as a result of the louisiana purchase Explain why European countries should or should not keep Asian colonies. It is the year 1899 and you are a newspaper reporterYou have a news writing assignment to prepare an editorial about whether or not European countries should keep their Asian colonies. In your editorial, explain your position on whether or not European countries should keep their Aslan colonies ; describe positive and negative transformations of European colonialism for both Europeans and Asians; and provide a persuasive argument that includes facts and details supporting your argument the summer monsoons have both positive and negative impacts in india why would you change the copyright laws A new homeowner is purchasing a living room set for $2,975 and must decide between two financing offers.Offer 1: $250 down payment, remaining balanced financed at a 24.90% interest rate, compounded monthly, for 3 years.Offer 2: $400 down payment, remaining balanced financed at a 22.90% interest rate, compounded monthly, for 4 years.Part A: What is the total cost of offer 1? Explain which technology you used to solve and each step of your process. Part B: What is the total cost of offer 2? Explain which technology you used to solve and each step of your process. Part C: Which financing offer should the new homeowner choose? Explain your reasoning. Which quotation from "The Wise Fool best summarizes the moral of the story?One day the mother went to her garden and there found a baby with very long hair lying on its back under a big tree.That is why even today, children who do not do well are not cast out, but treated fairly. Wisdom hides in many places.Soon afterward, a troupe of fairy people came to the village to claim the baby.The chief and the elders did everything in their power to appease the fairies. X-it Company bought a new delivery truck. The manufacturer says that the truck should last for ten years and 120,000 miles. X-it plans to use the truck for 4 years, during which it will be driven 50,000 miles. What is the useful life of the truck for depreciation purposes Help asap4. Solomon Asch's experiment demonstrated that people in a group are influenced by group concesus even when the group is wrong.A. TrueB. False Jane has 3 cups of yogurt that she wants to split into smaller containers. Each container can hold cup of yogurt. draw the structure for 2-methyl-3-propalhex-2-yne Select the three word choices that indicate that Susan B. Anthony is using an angry tone.help plsss solve 5 - 2y = 12what is y which king fostered a revival of roman sculpture and decoration in sicily and southern italy in the 13th century? What strategy do firms in an oligopoly use to compete? What is particularly troubling about the death of Billee?He is still very healthy.It is an accident.He shows his fear through howling.He is killed in the traces. Look at the multiples of 4 that have an even number in the tens place. What values do they have in the ones place? Do you think this pattern would continue with multiples of 4 that are lager than 100 Given an exponential function for compounding interest, A(x) = P(0.77)^x , what is the rate of change as a percentage? Which two quotes from the text best supports the answer to part a ou have added all reagents for the Diels Alder lab and brought the solution to a reflux. However, some of the compounds remain undissolved. What should you do? O Add more xylene to help things dissolve Discard the chemicals and start over Move foward with the reaction the present value of the costs of financial distress increases as the debt ratio increases because the: group of answer choices expected return on assets increases present value of the interest tax shield is greater equity tax shield is depleted probability of default is greater