The 9th and the 12th term of an arithmetic progression are 50 and 65 respectively. find the common difference

Answers

Answer 1

The first term of the arithmetic progression exists at 10 and the common difference is 2.

How to estimate the common difference of an arithmetic progression?

let the nth term be named x, and the value of the term y, then there exists a function y = ax + b this formula exists also utilized for straight lines.

We just require a and b. we already got two data points. we can just plug the known x/y pairs into the formula

The 9th and the 12th term of an arithmetic progression exist at 50 and 65 respectively.

9th term = 50

a + 8d = 50 ...............(1)

12th term = 65

a + 11d = 65 ...............(2)

subtract them, (2) - (1), we get

3d = 15

d = 5

If a + 8d = 50 then substitute the value of d = 5, we get

a + 8 \(*\) 5 = 50

a + 40 = 50

a = 50 - 40

a = 10.

Therefore, the first term is 10 and the common difference is 2.

To learn more about common differences refer to:

https://brainly.com/question/1486233

#SPJ4


Related Questions

Plz help me
will give the brainliest!
Urgent!!!​
Please answer correctly
Please help me!!

Plz help mewill give the brainliest!Urgent!!!Please answer correctlyPlease help me!!

Answers

Step-by-step explanation:

1-a ,2-c,3_d

i thibk is you're answer

Construct a truth table for each of these compound propositions
a) p → ⇁p
b) p ↔ ⇁p
c) p ⊕ (p V q) d) (p ∧ q) → (p V q) e) (p → ⇁p) ↔ (p ↔ q) f) (p ↔ q) ⊕ (p ↔ ⇁q)

Answers

After considering the given data we conclude that there truth table is possible and is placed in the given figures concerning every sub question.

A truth table is a overview that projects  the truth-value of one or more compound propositions for each possible combination of truth-values of the propositions starting up the compound ones.
Every row of the table represents a possible combination of truth-values for the component propositions of the compound, and the count of rows is described by the range of possible combinations.
For instance, if the compound has just two component propositions, it comprises  four possibilities and then four rows to the table. The truth-value of the compound is projected on each row comprising the truth functional operator.
To learn more about truth table
https://brainly.com/question/28605215
#SPJ4

Construct a truth table for each of these compound propositionsa) p pb) p pc) p (p V q) d) (p q) (p V
Construct a truth table for each of these compound propositionsa) p pb) p pc) p (p V q) d) (p q) (p V
Construct a truth table for each of these compound propositionsa) p pb) p pc) p (p V q) d) (p q) (p V

GIVING BRAIN TO CORRECT ANSWER!!

The table shows the heights of 10 randomly selected second-grade students.

Helght (Inches)

44 45 47 49 48 48 49 50 48 52

Based on the data, select the most reasonable prediction about the height of second-grade students.

O A. The typical second-grade student is less than 45 inches tall.

B. The typical second-grade student is about 45 inches tall.

C. The typical second-grade student is more than 50 inches tall.

D. The typical second-grade student is about 48 inches tall.​

Answers

Answer:

Answer = D

Step-by-step explanation:

If you add all of the heights up you get 480. divide that by ten (because there were 10 students whose height was taken) then you get 48. therefore, the typical second-grade student is about 48 inches tall.

I hope this helps have a good day :)

The typical second-grade student is about 48 inches tall.

What is mean?

'Mean is the average of the given numbers and is calculated by dividing the sum of given numbers by the total number of numbers.'

According to the given problem,

Given data = { 44, 45, 47, 49, 48, 48, 49, 50, 48, 52 }

Sum of the given data = 44 + 45 + 47 + 49 + 48 + 48 + 49 + 50 + 48 + 52

                                     = 480

Average of the given heights = \(\frac{480}{10}\)

                                                 = 48

Hence, we can conclude,  The typical second-grade student is about 48 inches tall since the average of the given data is 48.

Learn more about mean here: https://brainly.com/question/22871228

#SPJ2

SOS bro i need help!!!!

SOS bro i need help!!!!

Answers

Answer:

It’s the first one

Step-by-step explanation:

I

An animal shelter conducts an annual fundraising drive. The animal shelter must raise at least enough money to cover their annual rental of $2,500 and weekly expenses of $450. So far, the shelter has received a one-time donation of $125 and pledged donations of $680 per week. Which inequality can be used to find w, the number of weeks it can take for the shelter to meet the goal?​

Answers

The inequality that can be used to find w, the number of weeks it can take for the shelter to meet its goal, is: w ≥ 10

To find the inequality that can be used to determine the number of weeks it can take for the animal shelter to meet its fundraising goal, we need to consider the total expenses and donations.

Let's break down the expenses and donations:

Expenses:

Annual rental = $2,500

Weekly expenses = $450

Donations:

One-time donation = $125

Pledged donations per week = $680

Let w represent the number of weeks it takes for the shelter to meet its goal.

Total expenses for w weeks = Annual rental + Weekly expenses * w

Total expenses = $2,500 + $450w

Total donations for w weeks = One-time donation + Pledged donations per week * w

Total donations = $125 + $680w

To meet the goal, the total donations must be greater than or equal to the total expenses. Therefore, the inequality is:

Total donations ≥ Total expenses

$125 + $680w ≥ $2,500 + $450w

Simplifying the inequality, we have:

$230w ≥ $2,375

Dividing both sides of the inequality by 230, we get:

w ≥ $2,375 / $230

Rounding the result to the nearest whole number, we have:

w ≥ 10

Therefore, the inequality that can be used to find w, the number of weeks it can take for the shelter to meet its goal, is:

w ≥ 10

Learn more about  number from

https://brainly.com/question/27894163

#SPJ11

Express the ratio as a fraction in simplest form. 15:45 2/3 3/9 1/3 5/16

Answers

Answer:

3/9

Step-by-step explanation:

15/45

divide both sides by a factor of each number; I'll be using 5.

3/9

It didn't have to be 5, I could have used 3, but in that case It wouldn't have been it's simplest form and I would have to divide again by another factor.

The width of a rectangle is 1/4 its length. The perimeter of the rectangle is 375 ft. What is the length, in feet, of the rectangle?

Answers

Answer:

Required Answer:-

Let

\(\sf length=x \)

\(\sf Breadth={\dfrac {x}{4}}\)

As we know that in a rectangle

\({\boxed{\sf Perimeter=2 (l+b)}}\)

Substitute the values

\({:}\longrightarrow\sf 2 \left (x+{\dfrac {x}{4}}\right)=375 \)

\({:}\longrightarrow\sf 2 \left({\dfrac {4x+x}{4}}\right)=375 \)

\({:}\longrightarrow\sf 2 \left({\dfrac {5x}{4}}\right)=375 \)

\({:}\longrightarrow\sf {\dfrac {10x}{4}}=375 \)

\({:}\longrightarrow\sf 10x=4×375 \)

\({:}\longrightarrow\sf 10x=1500 \)

\({:}\longrightarrow\sf x={\dfrac {1500}{10}}\)

\({:}\longrightarrow\sf x=150\)

\(\therefore\)Length =150feet

a is 60 miles from b. a starts for b at 20 mph, and b starts for a at 25 mph. when will a and b meet?

Answers

The problem describes a scenario in which two objects, A and B, start moving towards each other from different locations and speeds. Object A starts from point A, which is 60 miles away from object B, at a speed of 20 mph, while object B starts from point B at a speed of 25 mph.

To solve this problem, we can use the formula Distance = Speed x Time. We know that the total distance between A and B is 60 miles and we want to find the time at which they meet. Let's call that time "t". Let's also assume that they meet at some point "x" miles away from A. Then, the distance that A travels is 60 - x and the distance that B travels is x. Using the formula, we can set up an equation:

Distance A + Distance B = Total Distance

(60 - x) + x = 60

Simplifying this equation, we get:

60 - x + x = 60

60 = 60

This equation is always true, so it doesn't give us any information about when A and B will meet. However, we can use the formula Distance = Speed x Time to set up another equation that relates the distance and speeds of A and B to the time they travel before meeting:

Distance A = Speed A x Time

Distance B = Speed B x Time

Substituting the distances and speeds we know, we get:

(60 - x) = 20t

x = 25t

We can use either equation to solve for t, but let's use the second equation. Substituting x = 25t, we get:

(60 - 25t) = 20t

Simplifying and solving for t, we get:

60 = 45t

t = 4/3

Therefore, A and B will meet after traveling for 4/3 hours, or 1 hour and 20 minutes.

To learn  more about equation, click here:

brainly.com/question/29657992

#SPJ11

how to do polynomials ​

how to do polynomials

Answers

Answer:

D

Step-by-step explanation:

12/6 is 2 and the the exponents when you are dividing you just subtract. so 9-3 = 6 which makes it x^6.

You want to ride your bike down the street to your friend's house, which is 340 meters from your house. The trip takes you 68 seconds from start to finish. How fast are you traveling on your bike?

Answers

The speed of the Bike is 5 meters per second

What is speed?

Speed is a scalar quantity that describes how fast an object is moving . It is defined as the distance an object travels divided by the time it takes to travel that distance. The units of speed are typically meters per second (m/s) or kilometers per hour (km/h).

To find out how fast you are traveling on your bike, you can use the formula:

Speed = \(\frac{Distance}{Time}\)

In this case, the distance is 340 meters and the time is 68 seconds. So, you can plug these values into the formula and get:

Speed = 340 meters / 68 seconds

Speed =  \(\frac{340 meters}{68 seconds}\)  =   5 meters per second

To know more about the Speed, check out:

https://brainly.com/question/13943409

#SPJ1

When cut into 16 equal slices, each slice is 1/16 of the pizza. Express how much of the pizza 8 of these slices would be in decimal form.

Answers

Answer:

0.5

Step-by-step explanation:

If one part = 1/17

Then, 8 parts = 1/16 x 8 = 1/2

1/2/as a decimal is 0.5

Hope this helps

suppose that rosa's favorite is sausage and onion, but her mom can't remember that, and she is going to randomly choose 222 different toppings. what is the probability that rosa's mom chooses sausage and onion?

Answers

The probability of choosing sausage and onion by Rosa's mom from the given 8 different toppings as per given condition is equal to

(1/ ⁸C₂).

As given in the question,

Total number of different toppings = 8

Number of different toppings choose by Rosa's mom randomly = 2

Possibility of choosing sausage and onion (any one) = 1

Total number of outcomes = ⁸C₂

Number of favorable outcomes = 1

Probability of choosing sausage and onion ( exactly ) one topping

= ( Number of favorable outcomes ) / ( Total number of outcomes )

= ( 1/⁸C₂ )

Therefore, the probability when Rosa's mom chooses sausage and onion out of 8 toppings is equal to ( 1/⁸C₂ ).

The above question is incomplete, the complete question is:

A pizza restaurant is offering a special price on pizzas with 2 toppings. They offer the toppings

below:

Pepperoni ,Sausage, Chicken ,  Green pepper , Mushroom ,Pineapple, Ham, Onion

Suppose that Rosa's favorite is sausage and onion, but her mom can't remember that, and she is going to randomly choose 2 different toppings.

What is the probability that Rosa's mom chooses sausage and onion?

Learn more about probability here

brainly.com/question/11234923

#SPJ4

Answer:

1/8c^2

Step-by-step explanation:

Khan Acadmey

Use an Addition or Subtraction Formula to write the expression as a trigonometric function of one number. cos 13π 15 cos − π 5 − sin 13π 15 sin − π 5 Find its exact value.

Answers

Use an additive or reduction formula to determine an expression as a fractional derivative of one number, which is provided as -1/2.

Now, According to the question:

What do trigonometry's fundamentals entail?

The three basic trigonometric operations are sine, cosine, and tangent. Cotangent, radial basis, and cotangent functions are all built on these three fundamental functions. All trigonometry concepts are built on top of these functions. The learning of trigonometry is not really easy until pupils are familiarized with all the terms and formulae. As a result, it is suggested that students learn each of these and practice responding to test questions from prior years.

The expression is given as:

cos(13/15)cos(-/5)-sin(13/15)sin(-/5)

This has the format of a trigonometry identity -

Cos (A+B) = Cos A Cos B - Sin A Sin B

Then = Cos ( 13π/15 + (-π/5) )

= Cos( 10π/15)

= Cos( 2π/3)

= Cos(120°)

= cos (90° + 30°)

=  -sin 30°

= -1/2

Hence, Cos(13/15)Cos(-/5)-Sin(13/15)Sin(-/5) = -1/2

Learn more about Trigonometry function at:

https://brainly.com/question/29286780

#SPJ4

what is derivative calculator symbolab

Answers

Symbolab is an online math tool that offers a wide range of math-related services, including a derivative calculator. The derivative calculator provided by Symbolab is a free tool that allows users to calculate the derivative of a given function with respect to a variable.

To use the Symbolab derivative calculator, you simply need to enter the function you want to differentiate and choose the variable with respect to which you want to differentiate the function. The calculator will then provide you with the derivative of the function in a step-by-step format, including the derivative rules used at each step.

The Symbolab derivative calculator supports a wide range of functions, including trigonometric functions, exponential functions, logarithmic functions, and more. It also supports partial derivatives and implicit differentiation.

For more questions on Symbolab

https://brainly.com/question/30398313

#SPJ4

Part a: during what interval(s) of the domain is the water balloon's height increasing?


you don't have to answer the question completely. i simply need help in understanding this. i know quite a bit already.

is the answer (0 < x < 2 ?

Answers

Based on the information provided, the suggested interval (0 < x < 2) could potentially be an interval during which the water balloon's height is increasing.

In general, if the height of the water balloon is increasing, it means that as time progresses, the height of the balloon is getting larger. This corresponds to a positive rate of change of the height with respect to time.

If we have a function that describes the height of the water balloon over time, we can calculate the derivative of that function with respect to time. If the derivative is positive within the interval (0 < x < 2), it means that the height is increasing during that interval.

However, without the specific function or more information, it is not possible to determine with certainty whether the water balloon's height is increasing within the given interval.

To know more about interval,

https://brainly.com/question/27769698

#SPJ11

If the mean of a negatively skewed distribution is 64, which of these values
could be the median of the distribution?
OA. 64
B. 56
C. 68
O D. 60
APEX

Answers

The median value must be higher than the mean, which is 68 in this case, so option C is correct.

What is mean?

Mean is a measurement of a probability distribution's central tendency along the median and mode. It also goes by the name "anticipated value."

Given:

The mean of a negatively skewed distribution is 64.

Calculate the median by hit and trial method,

When a distribution is negatively skewed, the distribution curve will not fall equally on either side of the median. The distribution curve will be shifted even more toward the bottom end. It will be so far below if the median value is only marginally below the median.

Therefore, the median value must be higher than the mean, which is 68 in this case.

To know more about mean:

https://brainly.com/question/2810871

#SPJ1

To trisect an ___ angle you first construct an equilateral triangle.

A. Acute

B. Right

C. 60-degree

D. Obtuse

To trisect an ___ angle you first construct an equilateral triangle.A. AcuteB. RightC. 60-degreeD. Obtuse

Answers

To trisect a 60-degree angle you first construct an equilateral triangle.

Option C is the correct answer.

What is an angle?

The angles between two lines are the angles formed by two intersecting lines, measured in degrees or radians.

Several different types of angles can be formed between two lines, including acute angles, right angles, and obtuse angles.

We have,

To trisect a 60-degree angle, we can use the fact that an equilateral triangle has three 60-degree angles.

The steps to trisect a 60-degree angle using an equilateral triangle are as follows:

Draw an equilateral triangle with one of its vertices at the angle to be trisected.

Draw a line from the vertex of the angle to the opposite side of the triangle, dividing the angle into two 30-degree angles.

Draw a line from the vertex of the angle to the point where the opposite side intersects the circle centered at the vertex with a radius equal to the length of one side of the equilateral triangle. This will divide one of the 30-degree angles into two 15-degree angles.

Draw a line parallel to the opposite side of the triangle from the point where the 15-degree angle is divided to the adjacent side of the triangle. This will trisect the 60-degree angle into three 20-degree angles.

Thus,

By constructing an equilateral triangle, we can trisect a 60-degree angle.

Learn more about angles here:

https://brainly.com/question/7116550

#SPJ5

a particular fruit's weights are normally distributed, with a mean of 744 grams and a standard deviation of 37 grams. if you pick 20 fruit at random, what is the probability that their mean weight will be between 752 grams and 766 grams.

Answers

The probability that the mean weight of 20 randomly picked fruit will be between 752 grams and 766 grams can be calculated using the Central Limit Theorem. According to the Central Limit Theorem, if the sample size is large enough, the sampling distribution of the mean will be approximately normally distributed regardless of the shape of the population distribution.

In this case, the mean weight of the fruit is normally distributed with a mean of 744 grams and a standard deviation of 37 grams.

To find the probability, we need to standardize the values of 752 grams and 766 grams using the formula z = (x - μ) / (σ / √n), where z is the standard score, x is the value, μ is the mean, σ is the standard deviation, and n is the sample size.

For 752 grams:
z1 = (752 - 744) / (37 / √20) = 0.589

For 766 grams:
z2 = (766 - 744) / (37 / √20) = 1.573

Now, we can use a standard normal distribution table or a calculator to find the probability between these two z-scores.

Using the standard normal distribution table, the probability between z1 = 0.589 and z2 = 1.573 is approximately 0.1398 or 13.98%.

Therefore, the probability that the mean weight of 20 randomly picked fruit will be between 752 grams and 766 grams is approximately 0.1398 or 13.98%.

Please note that the calculation assumes the weights of the fruit are independent and identically distributed.

a mean of 744 grams and a standard deviation of 37 grams : https://brainly.com/question/33177805

#SPJ11

Help please giving points to right answer JUST NEED THE NUMBER TO FILL IN BLANK !!

Help please giving points to right answer JUST NEED THE NUMBER TO FILL IN BLANK !!

Answers

Answer:

We have the proportion: 8/10 = 100/y

We can solve for y by cross-multiplying.

That is, 8y = 100 * 10 Simplifying the right-hand side, 8y = 1000

Dividing both sides by 8 to solve for y, y = 125

Hence, the value of y is 125.

Finally, we have the expression: y = √80We can simplify this expression by factoring 80 into its prime factors:80 = 2 * 2 * 2 * 2 * 5

Taking the square root of 2 * 2 * 2 * 2, we have:√(2 * 2 * 2 * 2) = 2 * 2 = 4

Therefore, y = 4√5The value of y is 4√5.

Step-by-step explanation:

Hope this helps!! Have a good day/night!!

∠A=10x+24 ∘ start color #11accd, angle, A, equals, 10, x, plus, 24, degrees, end color #11accd \qquad \green{\angle B=6x + 72^\circ}∠B=6x+72 ∘ start color #28ae7b, angle, B, equals, 6, x, plus, 72, degrees, end color #28ae7b Solve for xxx and then find the measure of \blueD{\angle A}∠Astart color #11accd, angle, A, end color #11accd:

Answers

Answer:

x = 12

The measure of Angel A and Angle B = 144°

Step-by-step explanation:

Angle ∠ A= 10x+24∘

Angle ∠B=6x+72 ∘

Angle A and Angle B are Alternate interior angles hence, they are equal to each other.

Hence:

10x + 24 = 6x + 72

Collect like terms

10x - 6x = 72 - 24

4x = 48

x = 48/4

x = 12

The measure of ∠ A= 10x+24∘

=( 10(12) + 24)°

=( 120 + 24)°

= 144°

The Measure of Angle ∠B=6x+72 ∘

=( 6(12) + 72)°

= (72 + 72)°

= 144°

A=10x+24 start color #11accd, angle, A, equals, 10, x, plus, 24, degrees, end color #11accd \qquad \green{\angle

Answer:

∠A = 144 degrees

Step-by-step explanation:

Look at attachment:

Hope this helps! :)

A=10x+24 start color #11accd, angle, A, equals, 10, x, plus, 24, degrees, end color #11accd \qquad \green{\angle

which of the following are not assumptions for performing a one-way anova? multiple choice question. the population standard deviations are unknown but assumed equal. the samples are selected independently. the population standard deviations are unknown but assumed unequal. the populations are normally distributed.

Answers

The assumption that the population standard deviations are unknown but assumed unequal is not necessary for performing a one-way ANOVA. In fact, the one-way ANOVA assumes that the population standard deviations are equal.

The other assumptions - that the samples are selected independently and that the populations are normally distributed - are necessary for performing a one-way ANOVA. It is important to note that violating these assumptions can lead to inaccurate results and conclusions. Therefore, it is crucial to assess the validity of these assumptions before performing a one-way ANOVA.

This can be done through statistical tests and graphical analysis. Overall, understanding the assumptions of a one-way ANOVA is important in order to interpret and apply its results correctly.

To know more about Assumption  visit :

https://brainly.com/question/31317949

#SPJ11

PLEASEEEE SOMEONE HELP I GIVE AS MUCH POINTS :’( Thank you!

PLEASEEEE SOMEONE HELP I GIVE AS MUCH POINTS :( Thank you!

Answers

The approximate area of the trapezoid is determined as  13.95 unit².

What is the approximate area of the trapezoid?

The approximate area of the trapezoid is calculated as follows;

Area = ¹/₂(b₁ + b₂)h

Where;

b₁ and b₂ are the lengths of the parallel sidesh is the height

The y-coordinates of the points on the curve at x=3/2 and x=4 is calculated as follows;

y(3/2) = - (3/2)²/2 + 3/2 + 5

y(3/2) = -9/8 + 3/2 + 5

y(3/2) = 5.375

y(4) = -4²/2 + 4 + 5

y(4) = -8 + 9

y(4) = 1

h = 5.375 - 1 = 4.375

The approximate area of the trapezoid is calculated as;

Area = ¹/₂(5.375 + 1) x 4.375

Area = 13.95 unit²

Learn more about approximate area of trapezoid here: https://brainly.com/question/22357828

#SPJ1

Thirty cards, marked with the even numbers from 2 to 60 inclusive, are shuffled and one card
is withdrawn at random and then replaced. The random variable X takes the value of the
number on the card each time the experiment is repeated.
(a) What must be assumed about the cards if the distribution of X is modelled by a discrete
uniform distribution?
(1 mark)
(b) Making this modelling assumption, find the expectation and the variance of X.
(5 marks)

Answers

The variance of X is 55, and the expectation of X is 31.

(a) If the distribution of X is modeled by a discrete uniform distribution, then we must assume that each of the 30 cards has an equal probability of being chosen at random and that the outcomes are mutually exclusive and collectively exhaustive.

(b) Since the distribution of X is modeled by a discrete uniform distribution, the probability of X taking any value between 2 and 60 (inclusive) is the same, i.e., 1/30. Therefore, the expected value of X can be calculated as:

E(X) = (2 + 4 + ... + 60)/30 = 31

To calculate the variance of X, we first need to find the variance of a single trial, and then multiply it by the number of trials (which is 30 in this case). The variance of a single trial can be calculated using the formula:

\(Var(X) = E(X^2) - [E(X)]^2\)

where E(X^2) is the expected value of \(X^2\). Since the distribution of X is uniform, the expected value of \(X^2\) can be calculated as:

\(E(X^2) = (2^2 + 4^2 + ... + 60^2)/30 = 1234\)

Substituting this and the value of E(X) into the formula for variance, we get:

\(Var(X) = 1234 - 31^2 = 55\)

Therefore, the variance of X is 55, and the expectation of X is 31.

Learn more about normal distribution here:

https://brainly.com/question/29509087

#SPJ1

Sketch the region enclosed by the given curves. Decide whether to integrate with respect to x or y. Draw a typical approximating rectangle. y = x3 − 4x, y = 12x Find the area of the region

Answers

To sketch the region enclosed by the curves y = x^3 - 4x and y = 12x and determine the appropriate method of integration. By evaluating the definite integral ∫[-4 to 4] (12x - (x^3 - 4x)) dx, we can calculate the area of the region enclosed by the given curves.

The curves intersect when x^3 - 4x = 12x. Simplifying this equation, we get x^3 - 16x = 0. Factoring out x, we have x(x^2 - 16) = 0, which gives us x = 0 and x = ±4 as the intersection points.

To determine whether to integrate with respect to x or y, we can observe that the region is vertically bounded by the curves. Therefore, we'll integrate with respect to x.

To find the area of the region, we'll integrate the difference of the upper and lower curves within the given bounds, from x = -4 to x = 4.

Now, for a more detailed explanation:

First, let's analyze the curves individually. The curve y = x^3 - 4x represents a cubic function, and y = 12x represents a linear function. By plotting these curves on a graph, we can observe that they intersect at three points: (0, 0), (-4, -48), and (4, 48).

To determine the enclosed region, we need to find the x-values at which the curves intersect. Setting the two equations equal to each other, we have x^3 - 4x = 12x. Rearranging this equation, we get x^3 - 16x = 0. Factoring out x, we have x(x^2 - 16) = 0, giving us x = 0 and x = ±4 as the x-values of intersection.

Since the region is vertically bounded by the curves, we'll integrate with respect to x. To find the area, we'll integrate the difference between the upper curve (y = 12x) and the lower curve (y = x^3 - 4x) within the bounds from x = -4 to x = 4.

By evaluating the definite integral ∫[-4 to 4] (12x - (x^3 - 4x)) dx, we can calculate the area of the region enclosed by the given curves.

Learn more about enclosed click here: brainly.com/question/32198168

#SPJ11

Sketch the region enclosed by the given curves. Decide whether to integrate with respect to x or y. Draw

6. What is the length of BC?

6. What is the length of BC?

Answers

The length of BC is 9

Mirandah simplified the expression 5 x + 9 y - 4 . She says the answer is 10 x y . Answer the following questions. What error did Miranda make while combining like terms? What should her answer be?

Answers

Answer:

5x + 9y -4

Step-by-step explanation:

Use the discriminant to determine the number of real solutions for each quadratic equation. Do not solve.

Use the discriminant to determine the number of real solutions for each quadratic equation. Do not solve.

Answers

a) The quadratic equation x² + 7x + 10 = 0 has two distinct real roots
b) The quadratic equation 4x² - 3x + 4 = 0 has two complex (non-real) roots.

The discriminant of a quadratic equation of the form ax² + bx + c = 0 is given by the expression b² - 4ac. The value of the discriminant can help us determine the nature of the roots of the quadratic equation.

Specifically:

If the discriminant is positive, then the quadratic equation has two distinct real roots.

If the discriminant is zero, then the quadratic equation has one real root (also known as a double root or a repeated root).

If the discriminant is negative, then the quadratic equation has two complex (non-real) roots.

Using this information, we can determine the number of real solutions for each of the given quadratic equations without actually solving them:\

a) x² + 7x + 10 = 0

Here, a = 1, b = 7, and c = 10.

Therefore, the discriminant is:

b² - 4ac = 7² - 4(1)(10) = 49 - 40 = 9

Since the discriminant is positive, this quadratic equation has two distinct real roots.

b) 4x² - 3x + 4 = 0

Here, a = 4, b = -3, and c = 4.

Therefore, the discriminant is:

b² - 4ac = (-3)² - 4(4)(4) = 9 - 64 = -55

Since the discriminant is negative, this quadratic equation has two complex (non-real) roots.

To learn more about solution click on,

https://brainly.com/question/28974181

#SPJ1


Need answer for number 13.
Tysm

Need answer for number 13.Tysm

Answers

Answer:

B- 3

If you are satisfied with the results plz make me genius.

The answer is B hope this helps

Spots dog bowl is cylindrical and does not have a top surface. The bowl is 8 inches in diameter and has a height of 5.7 inches. What is the total surface are of the dog bowl?

Answers

Answer:

Total surface are of the dog bowl is 193.424 in²

=================

We need to find the total surface area of a cylinder excluding its top.

Dimensions

d = 8 in,h = 5.7 in

Equation

S = πd²/4 + πdh

Substitute and calculate

S = 3.14*8²/4 + 3.14*8*5.7 = 193.424 in²

ly| ≤3

Are the lines on graph at 3 and -3 also part of the answer?

ly| 3Are the lines on graph at 3 and -3 also part of the answer?

Answers

Answer:

Yes, the lines on the graph at 3 and -3 a part  of the solution,

Step-by-step explanation:

The inequality \(|y| \leq 3\) contains all the values of \(y\) 3 units from the origin including the values 3 and -3.

Thus, the lines on the graph y =-3 and y = 3 are the part of the solution.

Learn more about Graphs and inequality here,

brainly.com/question/16608196

brainly.com/question/17448505

Other Questions
A lifeguard fills a pool with water at a constant rate. After 12 hour, 13 of the pool is filled. At this rate, what fraction of the pool is filled per hour?. Find the area of a triangle with base of inches and a height of inches.A100100100 square inchesB505050 square inchesC252525 square inchesD12.512.512.5 square inches How did other countrys feel about the white mans burden Three particles having charges of equal magnitude q are fixed at the conrners of an equilateral triangle as shown. two of the charges are negative: the other is positive. which of the following vectors best represents the direction of the resultant electric field at point p, the center of the triangle? A charge has a value of 5.5x10^-6C. Find the value of the electric field 0.02m away from it. Is the following equation proportional or non-proportional? y=-1.7x* A disadvantage of disposing of waste polymers through _____ is that they must first be separated, which can be expensive. What is the missing word in this sentence? You are climbing the Haleakala Volcano on Maui at night so as to see the sunrise at dawn on the 3055 meter summit. The temperature at the coastline is 37.6C. The environmental lapse rate from the coastline to 1625 meters is 3.8C/1000m. The environmental lapse rate from the 1625 meters to 2500 meters is 9.1C/1000m. The environmental lapse rate above 2500 meters is 10C/1000m. What is the temperature on the summit of the Haleakala Volcano? Calculate your answer to one decimal point. helppppppppppppppp me pls 7HS: English 2AM (Prescriptive) / 1: Par15. Read the sentence.My brother would have worked all summer.What is the verb phrase? a rectangular prism has a volume of 10 cubic units what types of life insurance are normally used for key employee indemnification? 6. Aisha's test scores are 74, 86, 67, and 76.What score does she need on the last test inorder to average 80 on her tests? Rewrite each sentence using capitalisation correctly This boulder in Yosemite National Park formed far away from where it now rests. Which agent of erosion could have moved it here? A. Glacial ice B. Volcanic eruptionC. Wind abrasionD. Tectonic stress how was the stamp act one of the greatest causes of the american revolution? (The Wall Street Journal, 6/10/22) Prices at the pump rose 4.1% in May from the previous month.[] Russias invasion of Ukraine in February and the resulting sanctions on Russia caused prices to rise significantly. Russia is a major energy exporter and the sanctions are decreasing the quantity of gas available.What type of change must have happened in the gas market? (hint: start with a market in equilibrium and shift one curve to get to the situation described) Rice weighing 33/4 pounds was divided equally and placed in 4 containers. How many ounces of rice were in each? Under the NOC code 1432 Payroll Administrators, what are3 of the educational requirements for the jobtitle of Payroll Clerk? (3 marks) Read this excerpt from the Declaration of Independence.