Sublimation occurs when moving from
1) G to H.
2) I to J.
3) J to I.
4) I to H.

Sublimation Occurs When Moving From 1) G To H. 2) I To J.3) J To I.4) I To H.

Answers

Answer 1
I to H that should be your answer

Related Questions

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

A sample of oxygen is subjected to an absolute pressure of 2.4 atm. If the specific internal energy of the sample at 310 K is 5700 J/mol relative to a known reference state, what is the specific enthalpy of the oxygen relative to that same reference state?

Answers

Answer:

The required specific enthalpy for oxygen = 8277.34 J/mol

Explanation:

Given that :

Pressure = 2.4 atm

Temperature = 310 K

specific internal energy U = 5700 J/mol

To find the specific enthalpy using the formula:

H = U + PV

where;

H is known as the specific enthalpy

Recall that from ideal gas equation

PV = nRT

For specific enthalpy, it is constant that n = 1

Thus;

PV = RT

replacing that into the equation (H = U + PV), we have:

here;

R = 8.314 J/mol K (constant)

H = U + RT

H = 5700 J/mol +( 8.314 J/mol K × 310 K)

H = 5700 J/mol + ( 2577.34 J/mol)

H = 8277.34 J/mol

What is the number of molecules in CaCo3

Answers

Answer:

Solution — Molar mass (Molecular mass in gram) of CaCO3 = 40+12+3×16 = 100 g No. of moles of CaCO3 = No. of molecules/Avogadro constant = 6.022 × 1023/ 6.022 × 1023 = 1 mole Mass of CaCO3 = No. of moles × molar mass = 1 × 100 g = 100 g.

Explanation:

How many moles of aluminum ions al3+ are present in 0.42 mol of al2so43

Answers

There are 0.84 moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3.

To determine the number of moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3, we need to consider the stoichiometry of the compound.

The formula of aluminum sulfate (Al2(SO4)3) indicates that for every 1 mole of the compound, there are 2 moles of aluminum ions (Al3+). This means that the mole ratio of Al3+ to Al2(SO4)3 is 2:1.

Given that we have 0.42 mol of Al2(SO4)3, we can calculate the moles of Al3+ as follows:

Moles of Al3+ = 0.42 mol Al2(SO4)3 x (2 mol Al3+ / 1 mol Al2(SO4)3)

Moles of Al3+ = 0.42 mol Al2(SO4)3 x 2

Moles of Al3+ = 0.84 mol Al3+

Therefore, there are 0.84 moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3.

It's important to note that the stoichiometry of the compound determines the mole ratio between the different species involved in the chemical formula. In this case, the 2:1 ratio of Al3+ to Al2(SO4)3 allows us to determine the number of moles of Al3+ based on the given amount of Al2(SO4)3.

For more such question on aluminum visit:

https://brainly.com/question/30451292

#SPJ8

The name of an oxyacid has the suffix -ous acid. What is the suffix of the oxyanion?

Answers

Answer:

-ate

Explanation:

Can someone help me please. Use your knowledge of waves and the electromagnetic spectra to explain how electromagnetic radiation affects molecules? Be sure to include 3 specific examples

Answers

Electromagnetic radiation affects molecules in several ways. When electromagnetic radiation interacts with molecules, it can cause the molecules to vibrate, rotate, and even dissociate. These effects are due to the absorption of energy from the electromagnetic radiation by the molecules.

Here are three specific examples of how electromagnetic radiation affects molecules:

1. Ultraviolet (UV) radiation: UV radiation has enough energy to break chemical bonds in molecules, which can lead to the formation of free radicals. Free radicals are highly reactive and can damage cells and DNA, leading to mutations and cancer. For example, UV radiation from the sun can cause thymine dimers in DNA, which can disrupt DNA replication and lead to mutations.

2. Infrared (IR) radiation: IR radiation can cause molecules to vibrate, which can lead to changes in the molecular structure and properties. For example, IR radiation can be used to identify the functional groups in a molecule, such as the C=O bond in a carbonyl group. The absorption of IR radiation by a molecule can also lead to the release of heat, which can be used in various applications, such as in infrared heaters.

3. X-rays: X-rays have enough energy to ionize molecules, which can lead to the formation of free radicals and other reactive species. The ionization of molecules by X-rays is used in medical applications, such as in radiation therapy for cancer. However, the ionization of molecules by X-rays can also lead to damage to healthy cells and tissues, which can lead to side effects.

In summary, electromagnetic radiation affects molecules by causing them to vibrate, rotate, dissociate, and even ionize. The specific effects of electromagnetic radiation on molecules depend on the energy and frequency of the radiation, as well as the properties of the molecules.

Explain how the perfect gas equation of state arises by combination of Boyle’s law, Charles’s law, and Avogadro’s principle.​

Answers

The perfect gas equation of state is a fundamental law in thermodynamics that describes the relationship between the pressure, volume, and temperature of a gas. It is given by the equation:

PV = nRT

where P is the pressure of the gas, V is its volume, n is the number of moles of the gas, R is the universal gas constant, and T is the temperature of the gas in kelvin.

The perfect gas equation of state can be derived by combining three laws:

Boyle's law: This law states that the pressure of a gas is inversely proportional to its volume at a constant temperature. Mathematically, it can be expressed as:

P1V1 = P2V2

where P1 and V1 are the initial pressure and volume of the gas, and P2 and V2 are the final pressure and volume.

Charles's law: This law states that the volume of a gas is directly proportional to its absolute temperature at constant pressure. Mathematically, it can be expressed as:

V1/T1 = V2/T2

where V1 and T1 are the initial volume and temperature of the gas, and V2 and T2 are the final volume and temperature.

Avogadro's principle: This principle states that equal volumes of gases at the same temperature and pressure contain equal numbers of molecules. Mathematically, it can be expressed as:

V1/n1 = V2/n2

By combining these three laws, we can derive the perfect gas equation of state. First, we can rearrange Boyle's law to express pressure in terms of volume:

P = P1V1/V

Next, we can substitute this expression for P into Charles's law:

V1/T1 = V2/T2

V1/T1 = V1(P1V1)/(T2V)

T2 = (P1V1T1)/(V)

Similarly, we can rearrange Avogadro's principle to express volume in terms of the number of moles:

V = nRT/P

Substituting this expression for V into the equation we obtained from Charles's law, we get:

T2 = (P1V1T1)/(n1R)

Finally, we can rearrange this equation to isolate the pressure term, which gives us the perfect gas equation of state:

PV = nRT

Thus, by combining Boyle's law, Charles's law, and Avogadro's principle, we can derive the perfect gas equation of state, which is a fundamental law in thermodynamics that describes the behavior of ideal gases.

learn more about gas equation here

https://brainly.com/question/27870704

#SPJ9

Use what you’ve learned about Lewis structures and formal charges to predict which of the following sulfur-containing molecule(s) would be least likely to exist.

SO2

H2S2

SCl2

HS

HSOH

Answers

Answer:

its DDDDDDDDDDDDDDDDDD

The structure that is least likely to exist is HS.

Sulfur is an element in group 16. Sulfur is a divalent element that has two lone pairs of electrons. This means that sulfur forms compounds in which it is bonded to two atoms or groups.

All the molecules listed can exist because they consists of structures in which sulfur is bonded to two atoms or groups. The only structure that can not exist is HS because it does not satisfy the valency of sulfur.

Learn more: https://brainly.com/question/25249351

A stream of oxygen enters a compressor at 298 K and 1.00 atm at a rate of 127m3/h and is compressed to 358 K and 1000 atm. Estimate the volumetric flow rate of compressed O2 using the compressibility-factor equation of state.

Answers

Answer:

The value is  \(V_2  =   0.246 \  m^3/h\)  

Explanation:

From the question we are told that

  The temperature at which the gas enters the compressor is  

         \(T_i = 298 \  K\)

  The pressure  at which the gas enters the compressor is  

       \(P_I =  1.0 \ atm\)

  The volumetric rate at which the gas enters the compressor is

      \(V  =  127 m^3/h\)

   The temperature to which the gas is compressed to is  

      \(T_f  =  358 \ K\)

  The pressure  to which the gas is compressed to is  

     \(P_f=  1000 \  atm\)

Generally the volumetric flow rate of compressed oxygen is evaluated from the compressibility-factor equation of state as

    \(V_2  =  V_1 *\frac{z_2}{z_1} * \frac{T_2}{T_1} * \frac{P_1}{P_2}\)

Here \(z_1\) is the inflow compressibility factor with value \(z_1 = 1\)

Here \(z_1\) is the outflow compressibility factor with value \(z_2 = 1.61\)

So

    \(V_2  =  127*\frac{1.61}{1} * \frac{358}{298} * \frac{1}{1000}\)  

    \(V_2  =   0.246 \  m^3/h\)  

   

Which is NOT a compound?
A. silicon dioxide
B. water
C. carbon dioxide gas
D. oxygen gas

Answers

Answer: Oxygen

Explanation: Its found on the periodic table as an element.

write the atomicity of oxygen​

Answers

The atomicity of Oxyen is 2, i.e it is diatomic

What does a sound wave’s frequency tell you? HELP IF YOU WANT BRAINLEIST AND TO HAVE YOUR COMMENT LIKED!!


A. the loudness or softness of the sound from an object

B. the type of medium in which the sound is traveling

C. the number of vibrations per second an object is making

D. the amplitude of the sound wave

Answers

Answer:

I am pretty sure it is C.

Explanation:

Because the wave frequency's tell us the number of waves there are on that diagram.

Answer:

C. the number of vibrations per second an object is making

Explanation:

Hope this helps. Sorry if it doesn't. T^T

How does alternate freezing and thawing of water cause weathering to occur?

A Water expands when it freezes and cracks rocks open Water expands when it freezes and cracks rocks open

B Thawing causes rock particles to move from place to place Thawing causes rock particles to move from place to place

C Freezing chemically alters the rock surfaces

Answers

Freezing leads to weathering because water expands when it freezes and cracks rocks open Water expands when it freezes and cracks rocks open

What is weathering?

The term weathering has to do with the process of the breakdown of the rocks to give rise to the soil. Now there are are various ways in which the process of weathering could be able to take place. One of the ways that the process of weathering can take place is what we call physical weathering.

In the process of physical weathering, we are looking at some kind of physical pressure which would lead to the breakdown of the rock. This is what makes it different from the chemical and the mechanical forms of weathering.

Thus, the fact that water would expand when we freeze it would mount pressure on the rock and then cause it to weather and form soil.

Learn more about weathering:https://brainly.com/question/14426457

#SPJ1

An ideal gas occupies 400ml at 270 mm Hg and 65°C. If the pressure is changed to 1.4 atm and the
temperature is increased to 100°C, what is the new volume?

Answers

Answer:

113 ml

Explanation:

PV = nRT      remember T must be in Kelvin  Volume in L  

270 * .4 =  n 62.4*  338.15

n = .005118

1.4 atm = 1.4 * 760 = 1064 mm

1064 * V = .005118 * 62.4 * 373.15

V = .113 l

                       

Where are most of the state’s wind farms located? Why do you think this is?

Answers

A wind farm can also be located offshore in most of the state.

Why in most of the state wind frames are located in offshore?

Offshore, faster wind speeds allow for substantially greater energy production. The term "offshore wind energy" describes the installation of wind farms inside of bodies of water. To produce electricity, they use the sea winds. These wind farms may employ floating wind turbines or turbines with solid foundations. Also, compared to other renewable technologies, offshore wind is more similar to onshore wind in terms of resource accessibility and technological maturity. Offshore wind farms are starting to blend into the water and coastal environment as a result.

To know more about offshore, refer:-

https://brainly.in/question/51581294

SPJ1

How much heat energy, in kilojoules, is required to convert 72.0 g
of ice at − 18.0 C to water at 25.0 C?

Answers

The amount of heat energy required required to convert 72.0 g

of ice at − 18° C to water at 25° C is 31.9 kJ.

To calculate the amount of heat energy required to convert 72.0 g of ice at −18.0°C to water at 25.0°C, we need to consider two separate processes: first, the energy required to melt the ice (i.e., to convert it from a solid to a liquid), and second, the energy required to heat the liquid water from its initial temperature of 0°C to its final temperature of 25°C.

The energy required to melt the ice can be calculated using the formula:

\(Q1 = m × ΔH_fus\)

where Q1 is the heat energy required (in joules), m is the mass of the ice (72.0 g), and\(ΔH_fus\)is the heat of fusion of water (334 J/g).

Q1 = 72.0 g × 334 J/g = 24,048 J = 24.05 kJ

The energy required to heat the liquid water from 0°C to 25°C can be calculated using the formula:

\(Q2 = m × C × ΔT\)

where Q2 is the heat energy required (in joules), m is the mass of the water (also 72.0 g), C is the specific heat capacity of water (4.184 J/g°C), and ΔT is the change in temperature (25°C - 0°C = 25°C).

Q2 = 72.0 g × 4.184 J/g°C × 25°C = 7,845.6 J = 7.85 kJ

Therefore, the total heat energy required to convert 72.0 g of ice at −18.0°C to water at 25.0°C is:

\(Q_total = Q1 + Q2\) = 24.05 kJ + 7.85 kJ = 31.9 kJ

Therefore, the amount of heat energy required is 31.9 kJ.

To learn more about heat of fusion here

https://brainly.com/question/3650601

#SPJ1

12. 5.6g of solid copper was heated with 476.2 J at room temperature (25°C). Given that
copper has a C of 0.38 J/g°C, what would its final temperature be?

Answers

Answer:

The final temperature of the copper would be 311.3°C.

I hope this helps you

Both propane and butane are used as gaseous fuels. Which compound produce more heat per gram burned? (mass of propane (C 3 H 3 )=44.1g/mol. mass of butane (C,H,0)=

58.1g/mol)(10pts)

(Hpropane-103.8kJ/mol.) (H propane-126.0kJ/mol)

Answers

Since the heat of combustion of butane is higher than that of propane,  butane will produce more heat per gram when burned compared to propane.

The heat of combustion of a compound refers to the heat evolved when one mole of the compound is burnt under standard conditions. This heat of combustion increases from methane upwards.

Since the heat of combustion of alkanes increases according to increasing molar mass, butane will produce more heat per gram when burned compared to propane.

Learn more about heat of combustion: https://brainly.com/question/25312146

[SHOW WORK] will give brainliest! what is the rounded atomic mass of
1.Aluminum, 2.Calcium, 3.Sodium, 4.Potassium, 5.Nitrogen, 6.Silicon, 7.Iron, 8.Hydrogen ​​

Answers

Al = 26.981539u which rounds up to 27u

Ca= 40.078u which sounds to 40u

Sodium= 22.989769 which rounds up to 23u

Potassium= 39.0983u which rounds to 39u

Nitrogen= 14.0067u which rounds to 14u

Silicon= 28.0855 u which rounds to 28u

Iron= 55.845 u which rounds to 56u

Hydrogen= 1.00784 u which rounds to 1

I hope this helps!!

A chemist needs to know the mass of a sample of to significant digits. He puts the sample on a digital scale. This is what the scale shows:
0
0
0
7
6
.
3
g
If this measurement is precise enough for the chemist, round it to significant digits.
Otherwise, press the "No solution" button.

Answers

76.3 g aka 76 g
In type of scientific measurement, the precision of the measurement is expressed in the significant digits of that measurement. It also used to express measurement to the required degree of accuracy.
Significant digits include every digit except the leading zero(s).
And if the number after the required significant digits is not up to 5, it is rounded down and the required significant digits is written as is. If the number after the required significant digits is at least 5, it is rounded up, and the last number on the significant digits requirement is increased by a factor of 1.

How does a polar covalent bond differ from a covalent bond

Answers

Covalent bonds involve equal sharing of electrons while polar covalent bonds involve unequal sharing of electrons.

Polar covalent vs covalent bonds

A covalent bond involves the sharing of electrons between two atoms. A polar covalent bond is a type of covalent bond where the electrons are not shared equally between the atoms.

This occurs when one atom in the bond has a higher electronegativity than the other, resulting in an unequal distribution of electrons.

The result is a bond with a partial positive and a partial negative charge, creating a polar molecule. In contrast, a nonpolar covalent bond involves an equal sharing of electrons between two atoms.

More on covalent bonds can be found here:https://brainly.com/question/19382448

#SPJ1

What is the median reaction of second end point in HCL and NaOH titration

Answers

The median reaction at the second end point in the HCl and NaOH titration is: HCl + NaOH → NaCl + H2O

In a titration between hydrochloric acid (HCl) and sodium hydroxide (NaOH), the reaction involved is the neutralization reaction between an acid and a base. The balanced equation for this reaction is:

HCl + NaOH → NaCl + H2O

In this reaction, one mole of HCl reacts with one mole of NaOH to form one mole of NaCl (sodium chloride) and one mole of water.

During the titration process, the reaction occurs gradually as the base is added to the acid solution.

The first end point of the titration is reached when the moles of HCl and NaOH are stoichiometrically equivalent, meaning they react in a 1:1 ratio. At this point, all the HCl has been neutralized by the NaOH, and no excess of either reagent remains.

However, if the titration is continued beyond the first end point, the reaction between HCl and NaOH can still occur, albeit in a different ratio.

The second end point refers to the point where the moles of NaOH added exceed the stoichiometrically required amount to neutralize the HCl completely. As a result, any excess NaOH added after the second end point reacts with the excess HCl in a 1:1 ratio.

Therefore, the median reaction at the second end point in the HCl and NaOH titration is:

HCl + NaOH → NaCl + H2O

For more such question on  median reaction visit:

https://brainly.com/question/14189499

#SPJ8

At 40 °C, the solubility of KNO3 is 65 g/100 g of H2O. In the laboratory, a student mixes 110 g of KCl with 200. g of H2O at a temperature of 40 °C. How much of the KNO3 will dissolve?

Answers

At 40°C, the maximum amount of KNO₃ that can dissolve in 200 g of water is 130 g, but since only 110 g of KCl was added, all the KCl will dissolve, and 71.5 g of KNO₃ will dissolve.

To determine how much KNO₃ will dissolve, we need to compare the amount of KCl that was added to the maximum amount of KNO₃ that can dissolve at the same temperature.

First, we can find the maximum amount of KNO₃ that can dissolve in 200 g of water at 40°C, which is given as 65 g/100 g of water

Maximum amount of KNO₃ that can dissolve

= 65 g/100 g x 200 g

= 130 g

This means that at most, 130 g of KNO₃ can dissolve in 200 g of water at 40°C.

Next, we need to compare the amount of KCl added to the maximum amount of KNO₃ that can dissolve.

The amount of KCl added is 110 g, which is less than the maximum amount of KNO₃ that can dissolve (130 g). Therefore, all of the KCl will dissolve and some of the KNO₃ will dissolve.

To find the amount of KNO₃ that will dissolve, we need to calculate how much KNO₃ would be in 110 g of the solvent (water) if it were saturated with KNO₃

Amount of KNO₃ in 110 g of water

= 65 g/100 g x 110 g

= 71.5 g

This means that 71.5 g of KNO₃ will dissolve in 110 g of water at 40°C.

Therefore, the amount of KNO₃ that will dissolve in the 200 g of water containing 110 g of KCl is 71.5 g.

To know more about Dissolubility in water:
https://brainly.com/question/9082316

#SPJ1

(a) using principles of atomic structure, explain why the first ionization energy of rn is less than that of xe.

Answers

The difference in first ionization energy between Xe and Rn can be explained by the combination of differences in electron configuration and shielding effect.

The energy needed to remove one electron from an atom or ion is known as the initial ionization energy. The number of electrons in the atom and the arrangement of those electrons are two parameters that affect an element's ionization energy.

The electron configurations of the elements Rn (Radon) and Xe (Xenon) are similar, although Radon contains more electrons than Xenon. In contrast to the outermost electrons of Xenon, the outermost electrons of Radon are bound by the nucleus more securely and are therefore more difficult to remove. Because Xe has a lower initial ionization energy than Rn, it is simpler to remove one electron from Xe than from Rn.

Additionally, the shielding effect of inner electrons also affects the ionization energy. The shielding effect refers to the ability of inner electrons to screen or reduce the attraction between the nucleus and outer electrons. In Xe, there are more inner electrons than in Rn, which provides a stronger shielding effect, further reducing the ionization energy of Xe.

To Learn More About energy click

https://brainly.com/question/8630757

#SPJ4

What volume was present before the dilution of a 1.00 M KOH solution if the new concentration is 0.250 M and the volume has increased to 450 mL?


___ mL (Answer Format XXX.X)

Answers

Answer: 112.5 mL

Explanation:

We can use the dilution formula to determine the initial volume of the 1.00 M KOH solution:

M1V1 = M2V2

where M1 is the initial concentration, V1 is the initial volume, M2 is the final concentration, and V2 is the final volume.

Plugging in the given values, we get:

1.00 M x V1 = 0.250 M x 450 mL

Solving for V1, we get:

V1 = (0.250 M x 450 mL) / 1.00 M

V1 = 112.5 mL

ILL GIVE BRAINLIST


How many valence electrons does boron gain when it becomes an anion?


A. 2

B. 3

C. 4

D. 5

Answers

Answer:

5

Explanation:

answer is c because if you add the them up you get 5

Plz help me well mark brainliest if you are correct!

Plz help me well mark brainliest if you are correct!

Answers

Answer:

c: heat and erosine

Explanation:

Which is most likely a covalent compound?

LiF
MgS
NH3
CaCl2

Answers

Answer:

NH3 is the most likely covalent compound  

Explanation:

Other Choices are:

LiF- Ionic compound  

MgS- ionic compound  

CaCl2- ionic compound  

The most likely to have a covalent bond is NH₃. The correct option is c. covalent bonds are the strongest bonds among all.

What are covalent bonds?

A covalent bond is formed between two atoms by the mutual sharing of one or more pairs of electrons. The two atomic nuclei attract these electrons at the same time. When the difference in electronegativities of two atoms is too tiny for electron transfer to produce ions, a covalent bond occurs.

The unequal sharing of electrons between the combining atoms results in the formation of a polar covalent bond. The equal sharing of electrons between the combining atoms results in the formation of a non-polar covalent bond.

LiF- Ionic compound  

MgS- ionic compound  

CaCl₂- ionic compound  

Therefore, the correct option is c, NH₃.

To learn more about covalent bonds, refer to the link:

https://brainly.com/question/19382448

#SPJ2

they are called -----metals are good at transferring electric charge

Answers

Answer:

Copper Copper Copper Copper

Alkaline metals is the answer

The rate of reaction doubles every 10 K rise in temperature.
a. How much faster does the reaction proceed at 318 K than at 298 K?
b. How much faster does the reaction proceed at 368 K than at 298 K?

Answers

The reaction progresses 4 times quicker at 318 K than at 298 K and 128 times faster at 368 K than at 298 K when the reaction is carried out at 318 K than at 298 K.

How does a temperature increase of 10 degrees cause a reaction's rate to double?

Because the molecules of the reactants collide more frequently at higher temperatures, reaction rates rise. This occurs because as the temperature rises, the molecules' kinetic energy rises as well.

Rate1 and Rate2 are the rates of reaction at temperatures T1 and T2, respectively,

Rate2 / Rate1 = (k2 / k1)

As a result, the rate constant ratio between 318 K and 298 K is:

\(k2 / k1 = 2² = 4\)

Substituting this ratio into the equation for the ratio of rates, we get:

\(Rate2 / Rate1 = (k2 / k1) = 4\)

This means that the reaction proceeds 4 times faster at 318 K than at 298 K.

Using the same approach, the ratio of rate constants at 368 K and 298 K is:

\(k2 / k1 = 2⁷ = 128\)

Substituting this ratio into the equation for the ratio of rates, we get:

\(Rate2 / Rate1 = (k2 / k1) = 128\)

This means that the reaction proceeds 128 times faster at 368 K than at 298 K.

To know more about reaction visit:-

brainly.com/question/28984750

#SPJ1

Other Questions
Write an equation for each translation.y=cos x, 1.5 units to the right When examining the bank's balance sheet on the bank confirmation prepared by the client, auditors seek to analyze all of the following sources of information, excepta. General ledger (general ledger) of the client.b. The bank confirmation itself.c. Bank statement that comes directly to the client.d. Court of bank statement that comes directly to the auditors. (4x-23x-16) : (x+5) five balls are randomly chosen, without replacement, from an urn that contains 5 red, 6 white, and 7 blue balls. find the probability that at least one ball of each color is chosen. cardiorespiratory endurance activities often are called _____ exercises The combustion of c2h4(g) is represented by the equation above. (a) use the enthalpies of formation in the table below to calculate the value of h1 for the reaction Irina ran 1/2 in 3 1/2 minutes. At that rate, how long would it take her to run 2 miles? a repetitive up-and-down pattern within a year is typically called . Read the scenario. 1. The temperature at 6 A.M. was -5F. By noon the temperature had risen by 5F. What was the temperature at noon? Represent these values with integers and model them on a number line. + + + 0 1 2 3 4 5 6 7 8 9 10 -10 -9 -8 -7 -6 -5 -4 -3 -2 -1 Read the scenario. 2. A diver was 8 feet below sea level. The diver swam back up 8 feet. What is the location of the diver? Represent these values with integers and model them using integer tiles. NEED HELP WILL GIVE BRAINLIEST AND WILL RATE. Show work and I only need #2 Classify CH3CH2NHCH3 as a strong base or a weak base A chronic cough, blood-tinged sputum, and dyspnea are symptoms of which cancer?O A. breastOB. leukemiaC. skinD. lung what chaper of ann frank n my imagination the man who I thought was trying to get in had been growing and growing in size until in the end he appeared to be a giant and the greatest fascist that ever walked the earth. This graduated cylinder is being used to measure an amount of a liquid. The numbers represent milliliters. What is the most precise measurement of the volume of this liquid? Year Quarter Value CMA2019 1 29.8 2019 2 36.1 2019 3 43.3 2019 4 39.6 2020 1 50.7 2020 2 52.1 2020 3 62.5 2020 4 58 2021 1 60.9 2021 2 69.2 2021 3 71.9 2021 4 71.9 Using the data, calculate centred moving averages (CMAs) for the necessary time periods and fill them into the table below. Round all CMAs to two decimal places. Using the rounded CMA values from a. above, develop seasonal indices for each of the terms. Round the final indices to four decimal places. Do not round during these calculations, only at the end. What is the index for the first quarter? I1=I1= What is the index for the second quarter? I2=I2= What is the index for the third quarter? I3=I3= What is the index for the fourth quarter? I4=I4= Mitochondria, the organelles involved in cellular respiration, can also generate chemicals called reactive oxygen species (ROSs). ROSs can damage mitochondria. Damaged mitochondria generate more ROSs than healthy mitochondria. Is this an example of negative or positive feedback? How are the elements formed in the big bang different than theelements formed through nuclear fusion in stars. Find the GCF of 21m5n2 and 28m4n2. If angle 2 = 6x + 5 and angle 4 = 4x + 14, what is the value of angle 2? Round your answer to the hundredths place. Tactical forecasts are _________ term, while strategic forecasts are _____________ term. a) medium; long short; b) medium and long short; c) long short and medium; long