Select the correct answer for each situation a. When f" (x) <0, f (x) is decreasing b. When f' (x) > 0, f (t) is increasing c. When f' (x) <0, f(x) is decreasing d. When t" (x) > 0, f (x) increasing

Answers

Answer 1

The correct answer for each situation is as follows:

1. When f"(x) < 0, f(x) is concave down (not decreasing)
2. When f'(x) > 0, f(x) is increasing (correct option: b)
3. When f'(x) < 0, f(x) is decreasing (correct option: c)
4. When f"(x) > 0, f(x) is concave up (not increasing)

When f"(x) < 0, it means that the second derivative of f(x) is negative. Since the second derivative represents the rate of change of the first derivative, a negative second derivative implies that the slope of the tangent line to the graph of f(x) is decreasing. This means that the graph is curving downwards or concave down.

Moreover, since the slope of the tangent line is decreasing, the function f(x) is not increasing, i.e., it is not monotonically increasing. Therefore, the correct answer is that f(x) is concave down (not decreasing).

When f'(x) > 0, it means that the first derivative of f(x) is positive. Since the first derivative represents the slope of the tangent line to the graph of f(x), a positive first derivative implies that the function is sloping upwards or increasing. Therefore, the correct answer is that f(x) is increasing.

When f'(x) < 0, it means that the first derivative of f(x) is negative. Since the first derivative represents the slope of the tangent line to the graph of f(x), a negative first derivative implies that the function is sloping downwards or decreasing. Therefore, the correct answer is that f(x) is decreasing.

When f"(x) > 0, it means that the second derivative of f(x) is positive. Since the second derivative represents the rate of change of the first derivative, a positive second derivative implies that the slope of the tangent line to the graph of f(x) is increasing.

This means that the graph is curving upwards or concave up. Moreover, since the slope of the tangent line is increasing, the function f(x) is not decreasing, i.e., it is not monotonically decreasing. Therefore, the correct answer is that f(x) is concave up (not increasing).

To learn more about tangent line, refer below:

https://brainly.com/question/31326507

#SPJ11


Related Questions

A car’s ten-gallon gas tank is one-fourth full. If Stacey fills up the tank with gas prices at $2.98 a gallon and pays with $25.00, how much change will she receive? (Assume there is no sales tax.)

Answers

Since the tank is one-fourth full, it means it is three-fourths empty:

\(\frac{4}{4}-\frac{1}{4}=\frac{3}{4}\)

Also, the volume of the tank is 10 gallons. So, we need to multiply 10 by 3/4 to find out how many gallons Stacey needs to fill up the tank:

\(\frac{3}{4}\cdot10=\frac{30}{4}=\frac{15}{2}=7.5\)

Now, we know that 1 gallon costs $2.98. Then, 7.5 gallons costs x dollars:

number of gallons cost in dollars

1 2.98

7.5 x

We can find x by cross multiplying the proportions above:

1 * x = 7.5 * 2.98

x = 22.35

Thus, the total cost to fill up the tank will be $22.35. Since Stacy pays with $25.00, the change she will receive is:

$25.00 - $22.35 = $2.65

Therefore, the change she will receive is $2.65.

Pls help it’s for math pls pls help

Pls help its for math pls pls help

Answers

the degree is 6
leading polynomial is 23

Joes mother gave him 1/3 of the money in her purse. His father gave him 5.00. If they gave joe a total of 12.00, How much money did his mother have in her purse. Joes mother had $ money in her purse (Enter a number only and make sure to include the decimal and 2 numerical decimal places.)

Answers

Answer:

$21

Step-by-step explanation:

let the money in her purse be $x

1/3 of the money is 1/3x

Since his father gave him $5 and the total amount became $12

the expression for the total amount would be

12= 1/3x+5

We can now solve for x

12-5= 1/3x

1/3x= 7

cross multiply we have

x= 7*3

x= $21

Therefore the money in joes mother's purse is $21

Use this image to answer the questions.


2. Do the figures meet the conditions of Cavalieri's Principle?

Use this image to answer the questions.2. Do the figures meet the conditions of Cavalieri's Principle?

Answers

Both figures meet the conditions of Cavalieri's Principle because the height of both figures is the same with a value of 16 cm.

What is a Cavalieri's Principle?

Cavalieri's Principle is a geometric principle, which states that if two three-dimensional objects have the same height and their cross-sectional areas are equal at every level, then the two objects have the same volume.

In other words, if two solids have the same height and the same cross-sectional area at every level parallel to the base, then they have the same volume. This principle can be applied to various geometric shapes, such as cylinders, cones, pyramids, cubs and spheres.

The height of figure is 16 cm and the height of figure 2 is 16 cm, so we can conclude that the two figures meet the conditions of Cavalieri's Principle.

Learn more about Cavalieri's Principle here: https://brainly.com/question/2279671

#SPJ1

refer to table 13-12. firm 4's efficient scale occurs at what quantity?

Answers

The firm 4's efficient scale occurs at 4

In this question, we have been given a table of long-run total cost and the quantity.

We need to find the quantity at which the firm 4's efficient scale occurs.

We know that the efficient scale occurs at the quantity of output where average total cost is minimum.

For the firm 4 the average total cost would be,

(210 + 340 + 490 + 660 + 850 + 1060 + 1290) / 7

= 4900 / 7

= 700

This value is clsoe to 660.

Therefore, the firm 4's efficient scale occurs at quantity 4.

Learn more about the average here:

https://brainly.com/question/2906096

#SPJ4

Given question is incomplete.

refer to table 13-12. firm 4's efficient scale occurs at what quantity?

pls help need it plsssssssssss

pls help need it plsssssssssss

Answers

Answer:

a. r² = 0.8555148135 so...

r = 0.9249... or 0.92

b. a correlation coefficient of 0.92 indicates a strong positive association between the two data sets

pls help need it plsssssssssss

the correlation coefficient will always take values

Answers

The correlation coefficient can take values between -1 and 1, inclusive. A correlation coefficient of -1 indicates negative correlation and 1  indicates positive correlation.

A correlation coefficient of -1 indicates a perfect negative correlation, meaning that as the values of one variable increase, the values of the other variable decrease. A correlation coefficient of 1 indicates a perfect positive correlation, meaning that as the values of one variable increase, the values of the other variable also increase.

A correlation coefficient of 0 indicates no correlation, meaning that there is no relationship between the two variables. Correlation coefficients can take any value between -1 and 1, inclusive, including fractional and decimal values.

Positive values indicate positive correlation, negative values indicate negative correlation, and values close to 0 indicate little or no correlation. The magnitude of the correlation coefficient indicates the strength of the relationship between the two variables.

The closer the coefficient is to 1 or -1, the stronger the relationship between the variables.

To learn more about correlation click on,

https://brainly.com/question/16258940

#SPJ4

The average amount of time that students use computers at a university computer center is 36 minutes with a standard deviation of 5 minutes. The times are known to be normally distributed. Around 10,000 uses are recorded each week in the computer center. The computer center administrative committee has decided that if more than 2000 uses of longer than 40 minutes at each sitting are recorded weekly, some new terminals must be purchased to meet usage needs.


Required:

Should the computer center purchase the new computers?

Answers

The normal distribution calculation for the area shows the computer center should purchase the new computers to meet the usage needs.

Mean time of computer usage (μ) = 36 minutes

Standard deviation (σ) = 5 minutes

Number of uses recorded each week = 10,000

To determine whether the computer center should purchase new computers,

Calculate the probability of recording more than 2000 uses of longer than 40 minutes at each sitting in a week.

To find the probability, standardize the value of 40 minutes using the z-score formula,

z = (x - μ) / σ

where x is the value we are interested in (40 minutes),

μ is the mean (36 minutes),

and σ is the standard deviation (5 minutes).

Plugging in the values, we get,

z = (40 - 36) / 5

= 4 / 5

= 0.8

Next, find the area under the normal distribution curve to the right of the z-score of 0.8.

This represents the probability of recording computer usage longer than 40 minutes.

Using a standard normal distribution calculator, the area to the right of 0.8 is approximately 0.2119.

To find the number of uses longer than 40 minutes,

multiply this probability by the total number of uses recorded each week,

Number of uses longer than 40 minutes

= 0.2119 × 10,000

≈ 2119

Since the number of uses longer than 40 minutes is approximately 2119, which is greater than 2000.

Therefore, using normal distribution the computer center should purchase the new computers to meet the usage needs.

learn more about normal distribution here

brainly.com/question/14942473

#SPJ4

points on a perpendicular bisector of a line segment are equidistant from the segment’s endpoints.___

Answers

Answer:

true

Step-by-step explanation:

Solve for x. Round to the nearest tenth of a degree, if necessary.

Solve for x. Round to the nearest tenth of a degree, if necessary.

Answers

By using a trigonometric relation, we will see that the value of x is 60.57°

How to find the value of x?

On the image, we can see a right triangle where x represents one of the angles.

We can see that the length of the two catheti are shown, such that the adjacent cathetus is 2.2, and the opposite cathetus is 3.9, then we can use the trigonometric relation:

tan(a) = (opposite cathetus)/(adjacent cathetus)

Then we can write:

tan(x) = 3.9/2.2

Using the inverse tangent function in both sides, we will get:

Atan( tan(x)) = Atan(3.9/2.2)

x = Atan(3.9/2.2) = 60.57°

Learn more about trigonometric relations at:

https://brainly.com/question/24349828

#SPJ1

slope inrrcept of (0,-2) and (3,0)

Answers

Answer:

y=2/3x- 2

Step-by-step explanation:

Answer:

y = 2/3x - 2

Step-by-step explanation:

M = Y2 - Y1

X2 - X2

M = 0 - (-2)

3 - 0

M = 2

3

y = mx + b

0 = 2/3(3) + b

0 = 2 + b

-2 -2

-2 = b

y = 2/3x - 2

£110 is divided between Sara, Gordon & Malachy so that Sara gets twice as much as Gordon, and Gordon gets three times as much as Malachy. How much does Sara get?

Answers

Answer:

£66

Step-by-step explanation:

Find out the total units they 3 have altogether.

Sara = 6 units as it's 2 x 3 = 6 units and they mentioned that she got twice as much as Gordon

Gordon = 3 units as it mentioned got 3 times as much as Malachy

Malachy = 1 unit as they didn't mention one, two or three or more times as much as anyone else in the question.

6 + 3 + 1 = 10 units.

Find out how much is 1 unit, then find out how much Sara have with the units she have.

10 units = £110

1 unit = £110 ÷ 10 = £11

Sara has 6 units, so...

6 units = £11 x 6 = £66

Use substitution to solve 2x2=5+y and 4y= -20+8x2

Solve the first equation for Y and substitute it into the second equation. The resulting equation is?

Answers

Step-by-step explanation:

First

2 × 2 = 5 + y

y = -1

And

4y = -20 + 8 × 2

4 × (-1) = -4

-4 = -4

Is this what you wanted?

Select the correct answer. Given: p || q, and r || s. Linear pair theorem that is angle 1 is supplementary to angle 2 moves down to angle 2 equals angle 6. As for parallel lines cut by a transversal, corresponding angles are congruent. This moves down to blank box with question mark. Prove: ∠1 and ∠14 are supplementary angles. Two vertical parallel lines p and q runs through two horizontal parallel lines r and s to form 16 angles numbered from 1 to 16. What is the next step in the proof? Choose the most logical approach. A. Statement: ∠6 ≅ ∠14 Reason: For parallel lines cut by a transversal, corresponding angles are congruent. B. Statement: ∠6 ≅ ∠7 Reason: Vertical Angles Theorem C. Statement: ∠6 and ∠5 are supplementary. Reason: Linear Pair Theorem D. Statement: m∠6 + m∠8 = 180° Reason: angle addition

Answers

The next step in the proof that ∠1 and ∠14 are supplementary angles is;

A. Statement: ∠6 ≅ ∠14 Reason: For parallel lines cut by a transversal, corresponding angles are congruent

How to prove the complementary and supplementary angle?

Corresponding angles are defined as the angles that are formed in matching corners or corresponding corners with the transversal when two parallel lines are intersected by any other line .

Supplementary angles are defined as angles that sum up to 180 degrees.

In the figure attached, ∠2 ≅ ∠6 and ∠6 ≅ ∠14 because they are all corresponding angles in line with the definition above.

We are told that angle 1 is supplementary to angle 2 and and as such they both form a linear pair. Thus, by transitive property, we can say that;

∠2 = ∠14

This tells us that ∠1 and ∠14 form a linear pair

Thus;

∠1 + ∠14 = 180°

Read more about corresponding angles at: brainly.com/question/28769265

#SPJ1

Select the correct answer. Given: p || q, and r || s. Linear pair theorem that is angle 1 is supplementary

Identify the error Denise made when solving the following system of equations using the substitution method.

Identify the error Denise made when solving the following system of equations using the substitution

Answers

At second step

\(\\ \tt\hookrightarrow 2x+2(3x+1)=6\)

\(\\ \tt\hookrightarrow 2x+6x+\boxed{2}=6\)

\(\\ \tt\hookrightarrow 8x=4\)

\(\\ \tt\hookrightarrow x=1/2\)

Part A: Create a third-degree polynomial in standard form. How do you know it is in standard form?

Part B: Explain the closure property as it relates to addition of polynomials. Give an example.

Answers

The polynomial in standard form is y = 12x³ - 5x² + 5x + 17 and the addition closure property implies that addition of polynomial gives polynomial

How to determine a third-degree polynomial

The mathematical statement is given as:

Create a polynomial

A polynomial in standard form can be represented as

y = axⁿ + ...... + c

In the above representation, the variable n represents the degree of the polynomial

This means that

n = 3 in a third degree

So, an instance of the polynomial could be

y = 12x³ - 5x² + 5x + 17

It is in standard form, because the exponents are in decreasing order from 3

The closure property

The closure property states that "when something is closed, the output will be the same type of object as the inputs"

In this case, it means that when polynomials are added, the result is a polynomial

Read more about polynomial at

https://brainly.com/question/4142886

#SPJ1

Suppose that 2 ≤ f '(x) ≤ 5 for all values of x. What are the minimum and maximum possible values of
f(9) − f(4)? ___?___≤ f(9) − f(4) ≤___?___

Answers

Suppose that 2 ≤ f '(x) ≤ 5 for all values of x, then the minimum possible value of f(9) - f(4) is 8, and the maximum possible value is 25.

For the minimum and maximum possible values of f(9) - f(4), we can use the Mean Value Theorem.

According to the theorem, for a differentiable function f(x) on the interval [a, b], there exists a value c between a and b such that f'(c) is equal to the average rate of change of f(x) over that interval.

In this case, we have 2 ≤ f'(x) ≤ 5 for all values of x.

Applying the Mean Value Theorem, we can say that there exists a value c between 4 and 9 such that f'(c) is equal to the average rate of change of f(x) over that interval.

Since f'(x) is bounded between 2 and 5, the minimum and maximum values of f'(c) can be obtained by substituting the bounds:

2 ≤ f'(c) ≤ 5.

Now, integrating both sides of the inequality with respect to x over the interval [4, 9], we get:

2(x - 4) ≤ f(9) - f(4) ≤ 5(x - 4).

Simplifying, we have:

8 ≤ f(9) - f(4) ≤ 25.

Therefore, the minimum possible value of f(9) - f(4) is 8, and the maximum possible value is 25.

To know more about minimum and maximum possible values refer here:

https://brainly.com/question/28169046#

#SPJ11

Let f(x) = 2^x and g(x) = x-4. The graph of (fºg)(x)
is shown below.

What is the range of (fºg)(x)?
y>0
All real numbers except y=0
y<=0
All real numbers

Let f(x) = 2^x and g(x) = x-4. The graph of (fg)(x)is shown below. What is the range of (fg)(x)?y&gt;0All

Answers

Answer:

I believe it is b but I'm not completely sure sorry if I'm wrong

Answer:

D all real numbers

Step-by-step explanation:

just did the test on edge plz vote brainliest

I need help please!​

I need help please!

Answers

Where are you confused?

How do you write a geometric function?

Answers

A geometric sequence is an exponential function. Instead of y=ax, we write an=crn where r is the common ratio and c is a constant (not the first term of the sequence, however). A recursive definition, since each term is found by multiplying the previous term by the common ratio, ak+1=ak * r.

Geometric function theory is the study of geometric properties of analytic functions. A fundamental result in the theory is the Riemann mapping theorem.

There are many shapes in geometry based on their dimensions. Circle, Triangle, Square, Rectangle, Kite, Trapezium, Parallelogram, Rhombus and different types of polygons are the 2-d shapes. Cube, Cuboid, Sphere, Cone and Cylinder are the basic three-dimensional shapes.

Learn more about geometric function to visit this link

https://brainly.com/question/29550967

#SPJ4

PLEASEEE HURRY!!! And please show work thank youuu

PLEASEEE HURRY!!! And please show work thank youuu

Answers

30 because big brain maths

which is the most accurate way to estimate 32% of 64​

Answers

Answer:

32% of 200 is 64.

Step-by-step explanation:

When 18 is subtracted from six times a certain number, the result is − 42.
What is the number?

Answers

Answer:

18-6×10=-42

Step-by-step explanation:

all i did was put it in my calculator

Which expression is the same as 1/8 of 3?

1. 3×8

2. 8÷3

3. 3÷8

4. 1/3×1/8

Answers

Answer:

The correct answer should be 3÷8

Answer:

3÷8

Step-by-step explanation:

the z scores of two tests scores are 1.2 and 1.5. to obtain the area between these scores select one: a. subtract the z scores and find the area of the difference in the z score table b. find the area between each score and the mean in the z score table and then subtract the smaller area from the larger area c. find the area between each score and the mean in the z score table and then subtract the difference between them from 100% d. find the area beyond each score in the z score table and subtract the difference between the areas from the mean

Answers

Area between each score and the mean in the z score table and then subtract the smaller area from the larger area.

The correct option is b.

The area between each score and the mean in the z score table and then subtract the smaller area from the larger area.

What is Z score: The z-score (aka, standard score) is a dimensionless metric that represents the deviation of a score from the mean in units of the standard deviation.

The formula for computing z-scores is as follows:

Z = (X - μ) / σ

where X is the score,

μ is the mean,

and σ is the standard deviation.

Z-scores can be used to assess the relative position of a score in relation to the distribution's mean and standard deviation.

In this particular question, the Z score of two test scores is 1.2 and 1.5.

To obtain the area between these scores, we have to find the area between each score and the mean in the z-score table, and then subtract the smaller area from the larger area.

First, we need to find the area between 1.2 and 1.5.

We can see the area from the z-score table as P(z < 1.5) - P(z < 1.2).

The following z-score table can be used to find these probabilities:

z-score table

From the table, P(z < 1.5) is equal to 0.9332, and P(z < 1.2) is equal to 0.8849.

Thus, P(1.2 < z < 1.5) = 0.9332 - 0.8849 = 0.0483.

To find the answer to the question, we have to calculate the area between the scores, which is 0.0483 in this case, by finding the area between each score and the mean in the z-score table and then subtracting the smaller area from the larger area.

For similar question on z score.

https://brainly.com/question/30892911

#SPJ11

Josiah read 28 pages in 1 3/5 hours. At what rate, in pages per hour, did he read?

PLEASE HELP!!!!

Answers

answer: 17.5 pages
explanation: 1 and 3/5 hours = 1.6 hours
28 pages / 1.6 hours = 17.5 pages/hour

Josiah read  at the rate of 17.5 pages per  hour.

What is the speed of reading?

Speed of reading is the number of pages read per hour.

Given here, Josiah read 28 pages in  1 ³/₅ hours which is in mixed fraction

now   1 ³/₅ = ⁸/₅ = 1.6 hours

therefore the speed of reading is = 28 / 1.6 = 17.5 pages hour.

Hence, Josiah's the speed of reading is  17.5 pages hour.

Learn more about speed here:

https://brainly.com/question/7359669

#SPJ2

jamie took 20 pieces of same-sized colored paper and put them in a hat. eight pieces were red, three pieces were blue, and the rest were green. she randomly pulls a piece of paper out of the hat. what are the chances that the paper is red?

Answers

The chances that the paper she randomly pulls out of the hat is red are 2 out of 5, or 40%.

To calculate the chances of pulling a red piece of paper out of the hat, we need to use probability.

Probability is the likelihood of an event happening, expressed as a fraction or percentage. To find the probability of pulling a red piece of paper out of the hat, we need to divide the number of red pieces of paper by the total number of pieces of paper.

In this case, there are eight red pieces of paper and a total of 20 pieces of paper. So the probability of pulling a red piece of paper is:

8/20

Simplifying this fraction gives us:

2/5 or 0.4

So the chances of pulling a red piece of paper out of the hat are 2 out of 5, or 40%.

Learn more about Probability here: https://brainly.com/question/30390037

#SPJ11

Pls help with these two equations. Pls

Pls help with these two equations. Pls

Answers

Answer:

11. x = 16

12. x = 26

Step-by-step explanation:

11. ∠1 + ∠2 = 90°

   ∠1 = 42°

   ∠2 = 90° - 42° = 48°

   3x = 48

   x = 16

12. ∠C + ∠D = 180°

∠C = 128°

∠D = 180° - 128° = 52°

2x = 52

x = 26

how do we find the place value of 3a + b given that a=4, b=3, and c=-2

Answers

Answer:

3a+b

3(4)+3

12+3

15

Step-by-step explanation:

You substitute the variables with the given numbers. I think this is correct.

State the x-intercept, y intercept and the slope for each graph. Then write an equation in slope intercept form

State the x-intercept, y intercept and the slope for each graph. Then write an equation in slope intercept

Answers

Answer:

1.

x-intercept = 8/5

y-intercept = -4

m = 1.5 (or 5/2)

equation: y = 1.5x - 4

2.

x-intercept = -1/2

y-intercept = -3

m = -6

equation: y = -6x - 3

Useful things to note:

Definition of a y-intercept: The y value when x = 0.

Definition of a x-intercept: The x value when y = 0.

Definition of the slope-intercept form: y = mx + b

b = the y-intercept

Step-by-step explanation:

1.

We don't know the x-intercept yet, but we can easily find the y-intercept.

So on the x = 0 line, we see there's a point right at (0, -4). So, the y-intercept is at -4.

The other point that's given is (2, 1). This is useful for getting the slope-intercept form.

y = mx + b

Lets solve for m.

When solving for m in the slope-intercept form, we replace x and y with an available point. For this we'll use (2, 1). We already know that b = the y-intercept, which is -4. Combining these two facts, we get this equation:

1 = 2m - 4

Let's solve this:

1 = 2m - 4

1 + 4 = 2m -4 + 4

5 = 2m

5/2 = 2m/2

1 1/2 = m

or

1.5 = m

Now that we have m, we can easily get the equation!

b = -4

m = 1.5

replacing those in the slope-intercept formula, we get:

y = mx + b

y = (1.5)x + (-4)

equation: y = 1.5x - 4

in order to finally find the x-intercept, we find where x is when y = 0. (I'm going to use m = 5/2 for easiest convenience. All of those values work though :) )

y = 5/2x - 4

make y = 0

0 = 5/2x - 4

0 + 4 = 5/2x - 4 + 4

4  = 5/2x

4*(2/1)  = 5/2x*(2/1)

8 = 5x

8/5 = 5x/5

8/5 = x

2.

We don't know the x-intercept yet, but we can easily find the y-intercept.

So on the x = 0 line, we see there's a point right at (0, -3). So, the y-intercept is at -3.

The other point that's given is (-1, 3). This is useful for getting the slope-intercept form.

y = mx + b

Lets solve for m.

When solving for m in the slope-intercept form, we replace x and y with an available point. For this we'll use (-1, 3). We already know that b = the y-intercept, which is -3. Combining these two facts, we get this equation:

3 = -1m - 3

Let's solve this:

3 = -1m - 3

3 + 3 = -1m -3 + 3

6 = -1m

6/-1 = -1m/-1

-6 = m

or

-6 = m

Now that we have m, we can easily get the equation!

b = -3

m = -6

replacing those in the slope-intercept formula, we get:

y = mx + b

y = (-6)x + (-3)

equation: y = -6x - 3

in order to finally find the x-intercept, we find where x is when y = 0.

y = -6x - 3

make y = 0

0 = -6x - 3

0 + 3 = -6x - 3 + 3

3 = -6x

3/(-6) = -6x/(-6)

-3/6 = x

simplify

-1/2  = x

Other Questions
How did the textile industry affect the people in new England in the 1800s?A. Its created a need for education.B. It brought great wealth and prosperity to many.C. It allowed people to afford better lives.D. It brought great wealth and prosperity to some.Please be fast I will give you points! the theorist who claims we are experiencing both a more sophisticated means of surveillance and social control as well as more diverse and evasive means of resistance is ________. 4 6 6x 2 7 _____12865 A student said, To find the value of 109.26, I can divide 1,092 by 60. Do you agree with this statement? 6th grade math help pls ASAP When the following expression is written in simplest form, what is the coefficient of the variable term?-2.5y + 8y - 10.5y5.50-21-5 Niki makes the same payment every two months to pay off his $61,600 loan. the loan has an interest rate of 9.84%, compounded every two months. if niki pays off his loan after exactly eleven years, how much interest will he have paid in total? round all dollar values to the nearest cent. a. $39,695.48 b. $10,294.26 c. $3,126.29 d. $39,467.12 please select the best answer from the choices provided a b c d What decimal is represented by the point on the number line? Which of the following words have open syllables? Choose the two correct words. A. rusted B. returned C. yelling D. fever E. crash How come immigrants that move to U.S. metropolitan areas do NOT lower employment or wages for domestic residents?Is it true that inflation always means prices are rising across-the-board i.e. everything on average is getting a little more expensive or can inflation sometimes be the result of a just few items becoming extremely more expensive? Extrinsic motivation is Motivation that comes from the inside Motivation that comes from the outside Based on noticing similarities and differences Based on the way a character looks at something What is the answer to y=-6x-3, -8x-3y=-1. Which symptoms of gonorrhea are visible in males?crawling insects in the genitalssevere rash all over the bodyblistersthick yellow discharge from genitals At the start of the month, a company reported a $34,000 debit balance in its cash account. During the month, the company debited cash for $30,000 and credits cash for $42,000. At the end of the month, the cash account has a. Balance equation Co2(CO3)3(s)=Co2O3(s)+CoO2(g) These very natural (and not-at-all-staged) photos of politicians in hats are a goodexample of which propaganda and persuasion strategy?A.Plain folksB.Speculation C.Ad hominemD.Argumentum ad odium (appeal to hatred) Dietmar HeidrunBerndtBertaBrittaKarinHermann1. Wie heit der Bruder von Heidrun?2. Wer ist die Gromutter von Berta?.3. Wie heit die Tochter von Felix und Herta?4. Wer sind die Eltern von Heidrun und Felix?5. Wie heien die Kusinen von Lars?LarsFelix HertaAlexanderDaniela which of the following is a property of a reversible cholinesterase inhibitor? group of answer choices which of the following will decrease aggregate expenditure in the united states? a) a decrease in the value of the dollar b) a decrease in the price level c) a decrease in interest rates d) a decrease in government purchases You are given the task of reading in n numbers and then printing them out in sorted order. Suppose you have access to a balanced dictionary data structure, which supports each of the operations search, insert, delete, minimum, maximum, successor, and predecessor in O(log n) time. Explain how you can use this dictionary to sort inO(n log n) time using only the following abstract opera- tions: minimum, successor, insert, search. Explain how you can use this dictionary to sort inO(n log n) time using only the following abstract opera- tions: minimum, insert, delete, search. Explain how you can use this dictionary to sort inO(n log n) time using only the following abstract opera- tions: insert and in-order traversal. An asset is purchased for PHP 241589. The salvage value in 16 years PHP 24962. Using Sum of the years Digit Method , Determine the book value after 8 years (pls use complete decimal places within the solutions)